микрофиксы
This commit is contained in:
parent
1f3600297e
commit
7475f8251e
|
|
@ -1 +1 @@
|
||||||
<!DOCTYPE html><html lang=ru><head><base href=/ ><meta charset=utf-8><meta name=format-detection content="telephone=no"><meta name=msapplication-tap-highlight content=no><meta name=viewport content="user-scalable=yes,initial-scale=1,maximum-scale=5,minimum-scale=1,width=device-width"><link rel=apple-touch-icon sizes=180x180 href=/apple-touch-icon.png><link rel=icon type=image/png sizes=32x32 href=/favicon-32x32.png><link rel=icon type=image/png sizes=16x16 href=/favicon-16x16.png><link rel=manifest href=/site.webmanifest><link rel=mask-icon href=/safari-pinned-tab.svg color=#5bbad5><meta name=msapplication-TileColor content=#00a300><meta name=theme-color content=#119b58><script defer src=/js/vendor.07b99fdc.js></script><script defer src=/js/app.6da6f3b3.js></script><link href=/css/vendor.7a6922bc.css rel=stylesheet><link href=/css/app.1ae0248e.css rel=stylesheet></head><body><div id=q-app></div></body></html>
|
<!DOCTYPE html><html lang=ru><head><base href=/ ><meta charset=utf-8><meta name=format-detection content="telephone=no"><meta name=msapplication-tap-highlight content=no><meta name=viewport content="user-scalable=yes,initial-scale=1,maximum-scale=5,minimum-scale=1,width=device-width"><link rel=apple-touch-icon sizes=180x180 href=/apple-touch-icon.png><link rel=icon type=image/png sizes=32x32 href=/favicon-32x32.png><link rel=icon type=image/png sizes=16x16 href=/favicon-16x16.png><link rel=manifest href=/site.webmanifest><link rel=mask-icon href=/safari-pinned-tab.svg color=#5bbad5><meta name=msapplication-TileColor content=#00a300><meta name=theme-color content=#119b58><script defer src=/js/vendor.c4ca484a.js></script><script defer src=/js/app.96656978.js></script><link href=/css/vendor.7a6922bc.css rel=stylesheet><link href=/css/app.c356e720.css rel=stylesheet></head><body><div id=q-app></div></body></html>
|
||||||
|
|
@ -1 +0,0 @@
|
||||||
pip
|
|
||||||
|
|
@ -1,154 +0,0 @@
|
||||||
Metadata-Version: 2.1
|
|
||||||
Name: urllib3
|
|
||||||
Version: 2.2.1
|
|
||||||
Summary: HTTP library with thread-safe connection pooling, file post, and more.
|
|
||||||
Project-URL: Changelog, https://github.com/urllib3/urllib3/blob/main/CHANGES.rst
|
|
||||||
Project-URL: Documentation, https://urllib3.readthedocs.io
|
|
||||||
Project-URL: Code, https://github.com/urllib3/urllib3
|
|
||||||
Project-URL: Issue tracker, https://github.com/urllib3/urllib3/issues
|
|
||||||
Author-email: Andrey Petrov <andrey.petrov@shazow.net>
|
|
||||||
Maintainer-email: Seth Michael Larson <sethmichaellarson@gmail.com>, Quentin Pradet <quentin@pradet.me>, Illia Volochii <illia.volochii@gmail.com>
|
|
||||||
License-File: LICENSE.txt
|
|
||||||
Keywords: filepost,http,httplib,https,pooling,ssl,threadsafe,urllib
|
|
||||||
Classifier: Environment :: Web Environment
|
|
||||||
Classifier: Intended Audience :: Developers
|
|
||||||
Classifier: License :: OSI Approved :: MIT License
|
|
||||||
Classifier: Operating System :: OS Independent
|
|
||||||
Classifier: Programming Language :: Python
|
|
||||||
Classifier: Programming Language :: Python :: 3
|
|
||||||
Classifier: Programming Language :: Python :: 3 :: Only
|
|
||||||
Classifier: Programming Language :: Python :: 3.8
|
|
||||||
Classifier: Programming Language :: Python :: 3.9
|
|
||||||
Classifier: Programming Language :: Python :: 3.10
|
|
||||||
Classifier: Programming Language :: Python :: 3.11
|
|
||||||
Classifier: Programming Language :: Python :: 3.12
|
|
||||||
Classifier: Programming Language :: Python :: Implementation :: CPython
|
|
||||||
Classifier: Programming Language :: Python :: Implementation :: PyPy
|
|
||||||
Classifier: Topic :: Internet :: WWW/HTTP
|
|
||||||
Classifier: Topic :: Software Development :: Libraries
|
|
||||||
Requires-Python: >=3.8
|
|
||||||
Provides-Extra: brotli
|
|
||||||
Requires-Dist: brotli>=1.0.9; (platform_python_implementation == 'CPython') and extra == 'brotli'
|
|
||||||
Requires-Dist: brotlicffi>=0.8.0; (platform_python_implementation != 'CPython') and extra == 'brotli'
|
|
||||||
Provides-Extra: h2
|
|
||||||
Requires-Dist: h2<5,>=4; extra == 'h2'
|
|
||||||
Provides-Extra: socks
|
|
||||||
Requires-Dist: pysocks!=1.5.7,<2.0,>=1.5.6; extra == 'socks'
|
|
||||||
Provides-Extra: zstd
|
|
||||||
Requires-Dist: zstandard>=0.18.0; extra == 'zstd'
|
|
||||||
Description-Content-Type: text/markdown
|
|
||||||
|
|
||||||
<h1 align="center">
|
|
||||||
|
|
||||||

|
|
||||||
|
|
||||||
</h1>
|
|
||||||
|
|
||||||
<p align="center">
|
|
||||||
<a href="https://pypi.org/project/urllib3"><img alt="PyPI Version" src="https://img.shields.io/pypi/v/urllib3.svg?maxAge=86400" /></a>
|
|
||||||
<a href="https://pypi.org/project/urllib3"><img alt="Python Versions" src="https://img.shields.io/pypi/pyversions/urllib3.svg?maxAge=86400" /></a>
|
|
||||||
<a href="https://discord.gg/urllib3"><img alt="Join our Discord" src="https://img.shields.io/discord/756342717725933608?color=%237289da&label=discord" /></a>
|
|
||||||
<a href="https://github.com/urllib3/urllib3/actions?query=workflow%3ACI"><img alt="Coverage Status" src="https://img.shields.io/badge/coverage-100%25-success" /></a>
|
|
||||||
<a href="https://github.com/urllib3/urllib3/actions?query=workflow%3ACI"><img alt="Build Status on GitHub" src="https://github.com/urllib3/urllib3/workflows/CI/badge.svg" /></a>
|
|
||||||
<a href="https://urllib3.readthedocs.io"><img alt="Documentation Status" src="https://readthedocs.org/projects/urllib3/badge/?version=latest" /></a><br>
|
|
||||||
<a href="https://deps.dev/pypi/urllib3"><img alt="OpenSSF Scorecard" src="https://api.securityscorecards.dev/projects/github.com/urllib3/urllib3/badge" /></a>
|
|
||||||
<a href="https://slsa.dev"><img alt="SLSA 3" src="https://slsa.dev/images/gh-badge-level3.svg" /></a>
|
|
||||||
<a href="https://bestpractices.coreinfrastructure.org/projects/6227"><img alt="CII Best Practices" src="https://bestpractices.coreinfrastructure.org/projects/6227/badge" /></a>
|
|
||||||
</p>
|
|
||||||
|
|
||||||
urllib3 is a powerful, *user-friendly* HTTP client for Python. Much of the
|
|
||||||
Python ecosystem already uses urllib3 and you should too.
|
|
||||||
urllib3 brings many critical features that are missing from the Python
|
|
||||||
standard libraries:
|
|
||||||
|
|
||||||
- Thread safety.
|
|
||||||
- Connection pooling.
|
|
||||||
- Client-side SSL/TLS verification.
|
|
||||||
- File uploads with multipart encoding.
|
|
||||||
- Helpers for retrying requests and dealing with HTTP redirects.
|
|
||||||
- Support for gzip, deflate, brotli, and zstd encoding.
|
|
||||||
- Proxy support for HTTP and SOCKS.
|
|
||||||
- 100% test coverage.
|
|
||||||
|
|
||||||
urllib3 is powerful and easy to use:
|
|
||||||
|
|
||||||
```python3
|
|
||||||
>>> import urllib3
|
|
||||||
>>> resp = urllib3.request("GET", "http://httpbin.org/robots.txt")
|
|
||||||
>>> resp.status
|
|
||||||
200
|
|
||||||
>>> resp.data
|
|
||||||
b"User-agent: *\nDisallow: /deny\n"
|
|
||||||
```
|
|
||||||
|
|
||||||
## Installing
|
|
||||||
|
|
||||||
urllib3 can be installed with [pip](https://pip.pypa.io):
|
|
||||||
|
|
||||||
```bash
|
|
||||||
$ python -m pip install urllib3
|
|
||||||
```
|
|
||||||
|
|
||||||
Alternatively, you can grab the latest source code from [GitHub](https://github.com/urllib3/urllib3):
|
|
||||||
|
|
||||||
```bash
|
|
||||||
$ git clone https://github.com/urllib3/urllib3.git
|
|
||||||
$ cd urllib3
|
|
||||||
$ pip install .
|
|
||||||
```
|
|
||||||
|
|
||||||
|
|
||||||
## Documentation
|
|
||||||
|
|
||||||
urllib3 has usage and reference documentation at [urllib3.readthedocs.io](https://urllib3.readthedocs.io).
|
|
||||||
|
|
||||||
|
|
||||||
## Community
|
|
||||||
|
|
||||||
urllib3 has a [community Discord channel](https://discord.gg/urllib3) for asking questions and
|
|
||||||
collaborating with other contributors. Drop by and say hello 👋
|
|
||||||
|
|
||||||
|
|
||||||
## Contributing
|
|
||||||
|
|
||||||
urllib3 happily accepts contributions. Please see our
|
|
||||||
[contributing documentation](https://urllib3.readthedocs.io/en/latest/contributing.html)
|
|
||||||
for some tips on getting started.
|
|
||||||
|
|
||||||
|
|
||||||
## Security Disclosures
|
|
||||||
|
|
||||||
To report a security vulnerability, please use the
|
|
||||||
[Tidelift security contact](https://tidelift.com/security).
|
|
||||||
Tidelift will coordinate the fix and disclosure with maintainers.
|
|
||||||
|
|
||||||
|
|
||||||
## Maintainers
|
|
||||||
|
|
||||||
- [@sethmlarson](https://github.com/sethmlarson) (Seth M. Larson)
|
|
||||||
- [@pquentin](https://github.com/pquentin) (Quentin Pradet)
|
|
||||||
- [@illia-v](https://github.com/illia-v) (Illia Volochii)
|
|
||||||
- [@theacodes](https://github.com/theacodes) (Thea Flowers)
|
|
||||||
- [@haikuginger](https://github.com/haikuginger) (Jess Shapiro)
|
|
||||||
- [@lukasa](https://github.com/lukasa) (Cory Benfield)
|
|
||||||
- [@sigmavirus24](https://github.com/sigmavirus24) (Ian Stapleton Cordasco)
|
|
||||||
- [@shazow](https://github.com/shazow) (Andrey Petrov)
|
|
||||||
|
|
||||||
👋
|
|
||||||
|
|
||||||
|
|
||||||
## Sponsorship
|
|
||||||
|
|
||||||
If your company benefits from this library, please consider [sponsoring its
|
|
||||||
development](https://urllib3.readthedocs.io/en/latest/sponsors.html).
|
|
||||||
|
|
||||||
|
|
||||||
## For Enterprise
|
|
||||||
|
|
||||||
Professional support for urllib3 is available as part of the [Tidelift
|
|
||||||
Subscription][1]. Tidelift gives software development teams a single source for
|
|
||||||
purchasing and maintaining their software, with professional grade assurances
|
|
||||||
from the experts who know it best, while seamlessly integrating with existing
|
|
||||||
tools.
|
|
||||||
|
|
||||||
[1]: https://tidelift.com/subscription/pkg/pypi-urllib3?utm_source=pypi-urllib3&utm_medium=referral&utm_campaign=readme
|
|
||||||
|
|
@ -1,75 +0,0 @@
|
||||||
urllib3-2.2.1.dist-info/INSTALLER,sha256=zuuue4knoyJ-UwPPXg8fezS7VCrXJQrAP7zeNuwvFQg,4
|
|
||||||
urllib3-2.2.1.dist-info/METADATA,sha256=uROmjQwfAbwRYjV9PMdc5JF5NA3kRkpoKafPkNzybfc,6434
|
|
||||||
urllib3-2.2.1.dist-info/RECORD,,
|
|
||||||
urllib3-2.2.1.dist-info/WHEEL,sha256=TJPnKdtrSue7xZ_AVGkp9YXcvDrobsjBds1du3Nx6dc,87
|
|
||||||
urllib3-2.2.1.dist-info/licenses/LICENSE.txt,sha256=Ew46ZNX91dCWp1JpRjSn2d8oRGnehuVzIQAmgEHj1oY,1093
|
|
||||||
urllib3/__init__.py,sha256=JMo1tg1nIV1AeJ2vENC_Txfl0e5h6Gzl9DGVk1rWRbo,6979
|
|
||||||
urllib3/__pycache__/__init__.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/_base_connection.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/_collections.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/_request_methods.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/_version.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/connection.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/connectionpool.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/exceptions.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/fields.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/filepost.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/http2.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/poolmanager.cpython-38.pyc,,
|
|
||||||
urllib3/__pycache__/response.cpython-38.pyc,,
|
|
||||||
urllib3/_base_connection.py,sha256=p-DOG_Me7-sJXO1R9VgDpNmdVU_kIS8VtaC7ptEllA0,5640
|
|
||||||
urllib3/_collections.py,sha256=vzKA-7X-9resOamEWq52uV1nHshChjbYDvz47H0mMjw,17400
|
|
||||||
urllib3/_request_methods.py,sha256=ucEpHQyQf06b9o1RxKLkCpzGH0ct-v7X2xGpU6rmmlo,9984
|
|
||||||
urllib3/_version.py,sha256=12idLAcGmrAURPX52rGioBo33oQ__-ENJEdeqHvUUZg,98
|
|
||||||
urllib3/connection.py,sha256=zFgaaoqrICsl7-kBp-_4va9m82sYhioAuy4-4iDpK0I,34704
|
|
||||||
urllib3/connectionpool.py,sha256=XjTfYowLwN5ZzRMO41_OTbGNX4ANifgYVpWsVMRuC00,43556
|
|
||||||
urllib3/contrib/__init__.py,sha256=47DEQpj8HBSa-_TImW-5JCeuQeRkm5NMpJWZG3hSuFU,0
|
|
||||||
urllib3/contrib/__pycache__/__init__.cpython-38.pyc,,
|
|
||||||
urllib3/contrib/__pycache__/pyopenssl.cpython-38.pyc,,
|
|
||||||
urllib3/contrib/__pycache__/socks.cpython-38.pyc,,
|
|
||||||
urllib3/contrib/emscripten/__init__.py,sha256=u6KNgzjlFZbuAAXa_ybCR7gQ71VJESnF-IIdDA73brw,733
|
|
||||||
urllib3/contrib/emscripten/__pycache__/__init__.cpython-38.pyc,,
|
|
||||||
urllib3/contrib/emscripten/__pycache__/connection.cpython-38.pyc,,
|
|
||||||
urllib3/contrib/emscripten/__pycache__/fetch.cpython-38.pyc,,
|
|
||||||
urllib3/contrib/emscripten/__pycache__/request.cpython-38.pyc,,
|
|
||||||
urllib3/contrib/emscripten/__pycache__/response.cpython-38.pyc,,
|
|
||||||
urllib3/contrib/emscripten/connection.py,sha256=kaBe2tWt7Yy9vNUFRBV7CSyDnfhCYILGxju9KTZj8Sw,8755
|
|
||||||
urllib3/contrib/emscripten/emscripten_fetch_worker.js,sha256=CDfYF_9CDobtx2lGidyJ1zjDEvwNT5F-dchmVWXDh0E,3655
|
|
||||||
urllib3/contrib/emscripten/fetch.py,sha256=ymwJlHBBuw6WTpKgPHpdmmrNBxlsr75HqoD4Rn27YXk,14131
|
|
||||||
urllib3/contrib/emscripten/request.py,sha256=mL28szy1KvE3NJhWor5jNmarp8gwplDU-7gwGZY5g0Q,566
|
|
||||||
urllib3/contrib/emscripten/response.py,sha256=wIDmdJ4doFWqLl5s86l9n0V70gFjQ2HWaPgz69jM52E,9546
|
|
||||||
urllib3/contrib/pyopenssl.py,sha256=X31eCYGwB09EkAHX8RhDKC0X0Ki7d0cCVWoMJZUM5bQ,19161
|
|
||||||
urllib3/contrib/socks.py,sha256=gFS2-zOw4_vLGpUvExOf3fNVT8liz6vhM2t6lBPn3CY,7572
|
|
||||||
urllib3/exceptions.py,sha256=RDaiudtR7rqbVKTKpLSgZBBtwaIqV7eZtervZV_mZag,9393
|
|
||||||
urllib3/fields.py,sha256=8vi0PeRo_pE5chPmJA07LZtMkVls4UrBS1k2xM506jM,10843
|
|
||||||
urllib3/filepost.py,sha256=-9qJT11cNGjO9dqnI20-oErZuTvNaM18xZZPCjZSbOE,2395
|
|
||||||
urllib3/http2.py,sha256=4QQcjTM9UYOQZe0r8KnA8anU9ST4p_s3SB3gRTueyPc,7480
|
|
||||||
urllib3/poolmanager.py,sha256=fcC3OwjFKxha06NsOORwbZOzrVt1pyY-bNCbKiqC0l8,22935
|
|
||||||
urllib3/py.typed,sha256=UaCuPFa3H8UAakbt-5G8SPacldTOGvJv18pPjUJ5gDY,93
|
|
||||||
urllib3/response.py,sha256=lmvseToQbkLXuFyA3jcSyCPjTgSfa6YPA4xUhVqq8QI,43874
|
|
||||||
urllib3/util/__init__.py,sha256=-qeS0QceivazvBEKDNFCAI-6ACcdDOE4TMvo7SLNlAQ,1001
|
|
||||||
urllib3/util/__pycache__/__init__.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/connection.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/proxy.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/request.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/response.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/retry.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/ssl_.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/ssl_match_hostname.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/ssltransport.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/timeout.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/url.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/util.cpython-38.pyc,,
|
|
||||||
urllib3/util/__pycache__/wait.cpython-38.pyc,,
|
|
||||||
urllib3/util/connection.py,sha256=QeUUEuNmhznpuKNPL-B0IVOkMdMCu8oJX62OC0Vpzug,4462
|
|
||||||
urllib3/util/proxy.py,sha256=seP8-Q5B6bB0dMtwPj-YcZZQ30vHuLqRu-tI0JZ2fzs,1148
|
|
||||||
urllib3/util/request.py,sha256=PQnBmKUHMQ0hQQ41uhbLNAeA24ke60m6zeiwfwocpGo,8102
|
|
||||||
urllib3/util/response.py,sha256=vQE639uoEhj1vpjEdxu5lNIhJCSUZkd7pqllUI0BZOA,3374
|
|
||||||
urllib3/util/retry.py,sha256=WB-7x1m7fQH_-Qqtrk2OGvz93GvBTxc-pRn8Vf3p4mg,18384
|
|
||||||
urllib3/util/ssl_.py,sha256=FeymdS68RggEROwMB9VLGSqLHq2hRUKnIbQC_bCpGJI,19109
|
|
||||||
urllib3/util/ssl_match_hostname.py,sha256=gaWqixoYtQ_GKO8fcRGFj3VXeMoqyxQQuUTPgWeiL_M,5812
|
|
||||||
urllib3/util/ssltransport.py,sha256=SF__JQXVcHBQniFJZp3P9q-UeHM310WVwcBwqT9dCLE,9034
|
|
||||||
urllib3/util/timeout.py,sha256=4eT1FVeZZU7h7mYD1Jq2OXNe4fxekdNvhoWUkZusRpA,10346
|
|
||||||
urllib3/util/url.py,sha256=wHORhp80RAXyTlAIkTqLFzSrkU7J34ZDxX-tN65MBZk,15213
|
|
||||||
urllib3/util/util.py,sha256=j3lbZK1jPyiwD34T8IgJzdWEZVT-4E-0vYIJi9UjeNA,1146
|
|
||||||
urllib3/util/wait.py,sha256=_ph8IrUR3sqPqi0OopQgJUlH4wzkGeM5CiyA7XGGtmI,4423
|
|
||||||
|
|
@ -1,4 +0,0 @@
|
||||||
Wheel-Version: 1.0
|
|
||||||
Generator: hatchling 1.21.1
|
|
||||||
Root-Is-Purelib: true
|
|
||||||
Tag: py3-none-any
|
|
||||||
|
|
@ -1,21 +0,0 @@
|
||||||
MIT License
|
|
||||||
|
|
||||||
Copyright (c) 2008-2020 Andrey Petrov and contributors.
|
|
||||||
|
|
||||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
|
||||||
of this software and associated documentation files (the "Software"), to deal
|
|
||||||
in the Software without restriction, including without limitation the rights
|
|
||||||
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
|
||||||
copies of the Software, and to permit persons to whom the Software is
|
|
||||||
furnished to do so, subject to the following conditions:
|
|
||||||
|
|
||||||
The above copyright notice and this permission notice shall be included in all
|
|
||||||
copies or substantial portions of the Software.
|
|
||||||
|
|
||||||
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
|
||||||
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
|
||||||
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
|
||||||
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
|
||||||
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
|
||||||
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
|
||||||
SOFTWARE.
|
|
||||||
|
|
@ -1,48 +1,39 @@
|
||||||
"""
|
"""
|
||||||
Python HTTP library with thread-safe connection pooling, file post support, user friendly, and more
|
Python HTTP library with thread-safe connection pooling, file post support, user friendly, and more
|
||||||
"""
|
"""
|
||||||
|
from __future__ import absolute_import
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
# Set default logging handler to avoid "No handler found" warnings.
|
# Set default logging handler to avoid "No handler found" warnings.
|
||||||
import logging
|
import logging
|
||||||
import sys
|
|
||||||
import typing
|
|
||||||
import warnings
|
import warnings
|
||||||
from logging import NullHandler
|
from logging import NullHandler
|
||||||
|
|
||||||
from . import exceptions
|
from . import exceptions
|
||||||
from ._base_connection import _TYPE_BODY
|
|
||||||
from ._collections import HTTPHeaderDict
|
|
||||||
from ._version import __version__
|
from ._version import __version__
|
||||||
from .connectionpool import HTTPConnectionPool, HTTPSConnectionPool, connection_from_url
|
from .connectionpool import HTTPConnectionPool, HTTPSConnectionPool, connection_from_url
|
||||||
from .filepost import _TYPE_FIELDS, encode_multipart_formdata
|
from .filepost import encode_multipart_formdata
|
||||||
from .poolmanager import PoolManager, ProxyManager, proxy_from_url
|
from .poolmanager import PoolManager, ProxyManager, proxy_from_url
|
||||||
from .response import BaseHTTPResponse, HTTPResponse
|
from .response import HTTPResponse
|
||||||
from .util.request import make_headers
|
from .util.request import make_headers
|
||||||
from .util.retry import Retry
|
from .util.retry import Retry
|
||||||
from .util.timeout import Timeout
|
from .util.timeout import Timeout
|
||||||
|
from .util.url import get_host
|
||||||
|
|
||||||
# Ensure that Python is compiled with OpenSSL 1.1.1+
|
# === NOTE TO REPACKAGERS AND VENDORS ===
|
||||||
# If the 'ssl' module isn't available at all that's
|
# Please delete this block, this logic is only
|
||||||
# fine, we only care if the module is available.
|
# for urllib3 being distributed via PyPI.
|
||||||
|
# See: https://github.com/urllib3/urllib3/issues/2680
|
||||||
try:
|
try:
|
||||||
import ssl
|
import urllib3_secure_extra # type: ignore # noqa: F401
|
||||||
except ImportError:
|
except ImportError:
|
||||||
pass
|
pass
|
||||||
else:
|
else:
|
||||||
if not ssl.OPENSSL_VERSION.startswith("OpenSSL "): # Defensive:
|
|
||||||
warnings.warn(
|
warnings.warn(
|
||||||
"urllib3 v2 only supports OpenSSL 1.1.1+, currently "
|
"'urllib3[secure]' extra is deprecated and will be removed "
|
||||||
f"the 'ssl' module is compiled with {ssl.OPENSSL_VERSION!r}. "
|
"in a future release of urllib3 2.x. Read more in this issue: "
|
||||||
"See: https://github.com/urllib3/urllib3/issues/3020",
|
"https://github.com/urllib3/urllib3/issues/2680",
|
||||||
exceptions.NotOpenSSLWarning,
|
category=DeprecationWarning,
|
||||||
)
|
stacklevel=2,
|
||||||
elif ssl.OPENSSL_VERSION_INFO < (1, 1, 1): # Defensive:
|
|
||||||
raise ImportError(
|
|
||||||
"urllib3 v2 only supports OpenSSL 1.1.1+, currently "
|
|
||||||
f"the 'ssl' module is compiled with {ssl.OPENSSL_VERSION!r}. "
|
|
||||||
"See: https://github.com/urllib3/urllib3/issues/2168"
|
|
||||||
)
|
)
|
||||||
|
|
||||||
__author__ = "Andrey Petrov (andrey.petrov@shazow.net)"
|
__author__ = "Andrey Petrov (andrey.petrov@shazow.net)"
|
||||||
|
|
@ -51,7 +42,6 @@ __version__ = __version__
|
||||||
|
|
||||||
__all__ = (
|
__all__ = (
|
||||||
"HTTPConnectionPool",
|
"HTTPConnectionPool",
|
||||||
"HTTPHeaderDict",
|
|
||||||
"HTTPSConnectionPool",
|
"HTTPSConnectionPool",
|
||||||
"PoolManager",
|
"PoolManager",
|
||||||
"ProxyManager",
|
"ProxyManager",
|
||||||
|
|
@ -62,18 +52,15 @@ __all__ = (
|
||||||
"connection_from_url",
|
"connection_from_url",
|
||||||
"disable_warnings",
|
"disable_warnings",
|
||||||
"encode_multipart_formdata",
|
"encode_multipart_formdata",
|
||||||
|
"get_host",
|
||||||
"make_headers",
|
"make_headers",
|
||||||
"proxy_from_url",
|
"proxy_from_url",
|
||||||
"request",
|
|
||||||
"BaseHTTPResponse",
|
|
||||||
)
|
)
|
||||||
|
|
||||||
logging.getLogger(__name__).addHandler(NullHandler())
|
logging.getLogger(__name__).addHandler(NullHandler())
|
||||||
|
|
||||||
|
|
||||||
def add_stderr_logger(
|
def add_stderr_logger(level=logging.DEBUG):
|
||||||
level: int = logging.DEBUG,
|
|
||||||
) -> logging.StreamHandler[typing.TextIO]:
|
|
||||||
"""
|
"""
|
||||||
Helper for quickly adding a StreamHandler to the logger. Useful for
|
Helper for quickly adding a StreamHandler to the logger. Useful for
|
||||||
debugging.
|
debugging.
|
||||||
|
|
@ -100,112 +87,16 @@ del NullHandler
|
||||||
# mechanisms to silence them.
|
# mechanisms to silence them.
|
||||||
# SecurityWarning's always go off by default.
|
# SecurityWarning's always go off by default.
|
||||||
warnings.simplefilter("always", exceptions.SecurityWarning, append=True)
|
warnings.simplefilter("always", exceptions.SecurityWarning, append=True)
|
||||||
|
# SubjectAltNameWarning's should go off once per host
|
||||||
|
warnings.simplefilter("default", exceptions.SubjectAltNameWarning, append=True)
|
||||||
# InsecurePlatformWarning's don't vary between requests, so we keep it default.
|
# InsecurePlatformWarning's don't vary between requests, so we keep it default.
|
||||||
warnings.simplefilter("default", exceptions.InsecurePlatformWarning, append=True)
|
warnings.simplefilter("default", exceptions.InsecurePlatformWarning, append=True)
|
||||||
|
# SNIMissingWarnings should go off only once.
|
||||||
|
warnings.simplefilter("default", exceptions.SNIMissingWarning, append=True)
|
||||||
|
|
||||||
|
|
||||||
def disable_warnings(category: type[Warning] = exceptions.HTTPWarning) -> None:
|
def disable_warnings(category=exceptions.HTTPWarning):
|
||||||
"""
|
"""
|
||||||
Helper for quickly disabling all urllib3 warnings.
|
Helper for quickly disabling all urllib3 warnings.
|
||||||
"""
|
"""
|
||||||
warnings.simplefilter("ignore", category)
|
warnings.simplefilter("ignore", category)
|
||||||
|
|
||||||
|
|
||||||
_DEFAULT_POOL = PoolManager()
|
|
||||||
|
|
||||||
|
|
||||||
def request(
|
|
||||||
method: str,
|
|
||||||
url: str,
|
|
||||||
*,
|
|
||||||
body: _TYPE_BODY | None = None,
|
|
||||||
fields: _TYPE_FIELDS | None = None,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
preload_content: bool | None = True,
|
|
||||||
decode_content: bool | None = True,
|
|
||||||
redirect: bool | None = True,
|
|
||||||
retries: Retry | bool | int | None = None,
|
|
||||||
timeout: Timeout | float | int | None = 3,
|
|
||||||
json: typing.Any | None = None,
|
|
||||||
) -> BaseHTTPResponse:
|
|
||||||
"""
|
|
||||||
A convenience, top-level request method. It uses a module-global ``PoolManager`` instance.
|
|
||||||
Therefore, its side effects could be shared across dependencies relying on it.
|
|
||||||
To avoid side effects create a new ``PoolManager`` instance and use it instead.
|
|
||||||
The method does not accept low-level ``**urlopen_kw`` keyword arguments.
|
|
||||||
|
|
||||||
:param method:
|
|
||||||
HTTP request method (such as GET, POST, PUT, etc.)
|
|
||||||
|
|
||||||
:param url:
|
|
||||||
The URL to perform the request on.
|
|
||||||
|
|
||||||
:param body:
|
|
||||||
Data to send in the request body, either :class:`str`, :class:`bytes`,
|
|
||||||
an iterable of :class:`str`/:class:`bytes`, or a file-like object.
|
|
||||||
|
|
||||||
:param fields:
|
|
||||||
Data to encode and send in the request body.
|
|
||||||
|
|
||||||
:param headers:
|
|
||||||
Dictionary of custom headers to send, such as User-Agent,
|
|
||||||
If-None-Match, etc.
|
|
||||||
|
|
||||||
:param bool preload_content:
|
|
||||||
If True, the response's body will be preloaded into memory.
|
|
||||||
|
|
||||||
:param bool decode_content:
|
|
||||||
If True, will attempt to decode the body based on the
|
|
||||||
'content-encoding' header.
|
|
||||||
|
|
||||||
:param redirect:
|
|
||||||
If True, automatically handle redirects (status codes 301, 302,
|
|
||||||
303, 307, 308). Each redirect counts as a retry. Disabling retries
|
|
||||||
will disable redirect, too.
|
|
||||||
|
|
||||||
:param retries:
|
|
||||||
Configure the number of retries to allow before raising a
|
|
||||||
:class:`~urllib3.exceptions.MaxRetryError` exception.
|
|
||||||
|
|
||||||
If ``None`` (default) will retry 3 times, see ``Retry.DEFAULT``. Pass a
|
|
||||||
:class:`~urllib3.util.retry.Retry` object for fine-grained control
|
|
||||||
over different types of retries.
|
|
||||||
Pass an integer number to retry connection errors that many times,
|
|
||||||
but no other types of errors. Pass zero to never retry.
|
|
||||||
|
|
||||||
If ``False``, then retries are disabled and any exception is raised
|
|
||||||
immediately. Also, instead of raising a MaxRetryError on redirects,
|
|
||||||
the redirect response will be returned.
|
|
||||||
|
|
||||||
:type retries: :class:`~urllib3.util.retry.Retry`, False, or an int.
|
|
||||||
|
|
||||||
:param timeout:
|
|
||||||
If specified, overrides the default timeout for this one
|
|
||||||
request. It may be a float (in seconds) or an instance of
|
|
||||||
:class:`urllib3.util.Timeout`.
|
|
||||||
|
|
||||||
:param json:
|
|
||||||
Data to encode and send as JSON with UTF-encoded in the request body.
|
|
||||||
The ``"Content-Type"`` header will be set to ``"application/json"``
|
|
||||||
unless specified otherwise.
|
|
||||||
"""
|
|
||||||
|
|
||||||
return _DEFAULT_POOL.request(
|
|
||||||
method,
|
|
||||||
url,
|
|
||||||
body=body,
|
|
||||||
fields=fields,
|
|
||||||
headers=headers,
|
|
||||||
preload_content=preload_content,
|
|
||||||
decode_content=decode_content,
|
|
||||||
redirect=redirect,
|
|
||||||
retries=retries,
|
|
||||||
timeout=timeout,
|
|
||||||
json=json,
|
|
||||||
)
|
|
||||||
|
|
||||||
|
|
||||||
if sys.platform == "emscripten":
|
|
||||||
from .contrib.emscripten import inject_into_urllib3 # noqa: 401
|
|
||||||
|
|
||||||
inject_into_urllib3()
|
|
||||||
|
|
|
||||||
|
|
@ -1,172 +0,0 @@
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import typing
|
|
||||||
|
|
||||||
from .util.connection import _TYPE_SOCKET_OPTIONS
|
|
||||||
from .util.timeout import _DEFAULT_TIMEOUT, _TYPE_TIMEOUT
|
|
||||||
from .util.url import Url
|
|
||||||
|
|
||||||
_TYPE_BODY = typing.Union[bytes, typing.IO[typing.Any], typing.Iterable[bytes], str]
|
|
||||||
|
|
||||||
|
|
||||||
class ProxyConfig(typing.NamedTuple):
|
|
||||||
ssl_context: ssl.SSLContext | None
|
|
||||||
use_forwarding_for_https: bool
|
|
||||||
assert_hostname: None | str | Literal[False]
|
|
||||||
assert_fingerprint: str | None
|
|
||||||
|
|
||||||
|
|
||||||
class _ResponseOptions(typing.NamedTuple):
|
|
||||||
# TODO: Remove this in favor of a better
|
|
||||||
# HTTP request/response lifecycle tracking.
|
|
||||||
request_method: str
|
|
||||||
request_url: str
|
|
||||||
preload_content: bool
|
|
||||||
decode_content: bool
|
|
||||||
enforce_content_length: bool
|
|
||||||
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
import ssl
|
|
||||||
from typing import Literal, Protocol
|
|
||||||
|
|
||||||
from .response import BaseHTTPResponse
|
|
||||||
|
|
||||||
class BaseHTTPConnection(Protocol):
|
|
||||||
default_port: typing.ClassVar[int]
|
|
||||||
default_socket_options: typing.ClassVar[_TYPE_SOCKET_OPTIONS]
|
|
||||||
|
|
||||||
host: str
|
|
||||||
port: int
|
|
||||||
timeout: None | (
|
|
||||||
float
|
|
||||||
) # Instance doesn't store _DEFAULT_TIMEOUT, must be resolved.
|
|
||||||
blocksize: int
|
|
||||||
source_address: tuple[str, int] | None
|
|
||||||
socket_options: _TYPE_SOCKET_OPTIONS | None
|
|
||||||
|
|
||||||
proxy: Url | None
|
|
||||||
proxy_config: ProxyConfig | None
|
|
||||||
|
|
||||||
is_verified: bool
|
|
||||||
proxy_is_verified: bool | None
|
|
||||||
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
host: str,
|
|
||||||
port: int | None = None,
|
|
||||||
*,
|
|
||||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
|
||||||
source_address: tuple[str, int] | None = None,
|
|
||||||
blocksize: int = 8192,
|
|
||||||
socket_options: _TYPE_SOCKET_OPTIONS | None = ...,
|
|
||||||
proxy: Url | None = None,
|
|
||||||
proxy_config: ProxyConfig | None = None,
|
|
||||||
) -> None:
|
|
||||||
...
|
|
||||||
|
|
||||||
def set_tunnel(
|
|
||||||
self,
|
|
||||||
host: str,
|
|
||||||
port: int | None = None,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
scheme: str = "http",
|
|
||||||
) -> None:
|
|
||||||
...
|
|
||||||
|
|
||||||
def connect(self) -> None:
|
|
||||||
...
|
|
||||||
|
|
||||||
def request(
|
|
||||||
self,
|
|
||||||
method: str,
|
|
||||||
url: str,
|
|
||||||
body: _TYPE_BODY | None = None,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
# We know *at least* botocore is depending on the order of the
|
|
||||||
# first 3 parameters so to be safe we only mark the later ones
|
|
||||||
# as keyword-only to ensure we have space to extend.
|
|
||||||
*,
|
|
||||||
chunked: bool = False,
|
|
||||||
preload_content: bool = True,
|
|
||||||
decode_content: bool = True,
|
|
||||||
enforce_content_length: bool = True,
|
|
||||||
) -> None:
|
|
||||||
...
|
|
||||||
|
|
||||||
def getresponse(self) -> BaseHTTPResponse:
|
|
||||||
...
|
|
||||||
|
|
||||||
def close(self) -> None:
|
|
||||||
...
|
|
||||||
|
|
||||||
@property
|
|
||||||
def is_closed(self) -> bool:
|
|
||||||
"""Whether the connection either is brand new or has been previously closed.
|
|
||||||
If this property is True then both ``is_connected`` and ``has_connected_to_proxy``
|
|
||||||
properties must be False.
|
|
||||||
"""
|
|
||||||
|
|
||||||
@property
|
|
||||||
def is_connected(self) -> bool:
|
|
||||||
"""Whether the connection is actively connected to any origin (proxy or target)"""
|
|
||||||
|
|
||||||
@property
|
|
||||||
def has_connected_to_proxy(self) -> bool:
|
|
||||||
"""Whether the connection has successfully connected to its proxy.
|
|
||||||
This returns False if no proxy is in use. Used to determine whether
|
|
||||||
errors are coming from the proxy layer or from tunnelling to the target origin.
|
|
||||||
"""
|
|
||||||
|
|
||||||
class BaseHTTPSConnection(BaseHTTPConnection, Protocol):
|
|
||||||
default_port: typing.ClassVar[int]
|
|
||||||
default_socket_options: typing.ClassVar[_TYPE_SOCKET_OPTIONS]
|
|
||||||
|
|
||||||
# Certificate verification methods
|
|
||||||
cert_reqs: int | str | None
|
|
||||||
assert_hostname: None | str | Literal[False]
|
|
||||||
assert_fingerprint: str | None
|
|
||||||
ssl_context: ssl.SSLContext | None
|
|
||||||
|
|
||||||
# Trusted CAs
|
|
||||||
ca_certs: str | None
|
|
||||||
ca_cert_dir: str | None
|
|
||||||
ca_cert_data: None | str | bytes
|
|
||||||
|
|
||||||
# TLS version
|
|
||||||
ssl_minimum_version: int | None
|
|
||||||
ssl_maximum_version: int | None
|
|
||||||
ssl_version: int | str | None # Deprecated
|
|
||||||
|
|
||||||
# Client certificates
|
|
||||||
cert_file: str | None
|
|
||||||
key_file: str | None
|
|
||||||
key_password: str | None
|
|
||||||
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
host: str,
|
|
||||||
port: int | None = None,
|
|
||||||
*,
|
|
||||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
|
||||||
source_address: tuple[str, int] | None = None,
|
|
||||||
blocksize: int = 16384,
|
|
||||||
socket_options: _TYPE_SOCKET_OPTIONS | None = ...,
|
|
||||||
proxy: Url | None = None,
|
|
||||||
proxy_config: ProxyConfig | None = None,
|
|
||||||
cert_reqs: int | str | None = None,
|
|
||||||
assert_hostname: None | str | Literal[False] = None,
|
|
||||||
assert_fingerprint: str | None = None,
|
|
||||||
server_hostname: str | None = None,
|
|
||||||
ssl_context: ssl.SSLContext | None = None,
|
|
||||||
ca_certs: str | None = None,
|
|
||||||
ca_cert_dir: str | None = None,
|
|
||||||
ca_cert_data: None | str | bytes = None,
|
|
||||||
ssl_minimum_version: int | None = None,
|
|
||||||
ssl_maximum_version: int | None = None,
|
|
||||||
ssl_version: int | str | None = None, # Deprecated
|
|
||||||
cert_file: str | None = None,
|
|
||||||
key_file: str | None = None,
|
|
||||||
key_password: str | None = None,
|
|
||||||
) -> None:
|
|
||||||
...
|
|
||||||
|
|
@ -1,68 +1,34 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
|
try:
|
||||||
|
from collections.abc import Mapping, MutableMapping
|
||||||
|
except ImportError:
|
||||||
|
from collections import Mapping, MutableMapping
|
||||||
|
try:
|
||||||
|
from threading import RLock
|
||||||
|
except ImportError: # Platform-specific: No threads available
|
||||||
|
|
||||||
|
class RLock:
|
||||||
|
def __enter__(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
def __exit__(self, exc_type, exc_value, traceback):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
import typing
|
|
||||||
from collections import OrderedDict
|
from collections import OrderedDict
|
||||||
from enum import Enum, auto
|
|
||||||
from threading import RLock
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
# We can only import Protocol if TYPE_CHECKING because it's a development
|
|
||||||
# dependency, and is not available at runtime.
|
|
||||||
from typing import Protocol
|
|
||||||
|
|
||||||
from typing_extensions import Self
|
|
||||||
|
|
||||||
class HasGettableStringKeys(Protocol):
|
|
||||||
def keys(self) -> typing.Iterator[str]:
|
|
||||||
...
|
|
||||||
|
|
||||||
def __getitem__(self, key: str) -> str:
|
|
||||||
...
|
|
||||||
|
|
||||||
|
from .exceptions import InvalidHeader
|
||||||
|
from .packages import six
|
||||||
|
from .packages.six import iterkeys, itervalues
|
||||||
|
|
||||||
__all__ = ["RecentlyUsedContainer", "HTTPHeaderDict"]
|
__all__ = ["RecentlyUsedContainer", "HTTPHeaderDict"]
|
||||||
|
|
||||||
|
|
||||||
# Key type
|
_Null = object()
|
||||||
_KT = typing.TypeVar("_KT")
|
|
||||||
# Value type
|
|
||||||
_VT = typing.TypeVar("_VT")
|
|
||||||
# Default type
|
|
||||||
_DT = typing.TypeVar("_DT")
|
|
||||||
|
|
||||||
ValidHTTPHeaderSource = typing.Union[
|
|
||||||
"HTTPHeaderDict",
|
|
||||||
typing.Mapping[str, str],
|
|
||||||
typing.Iterable[typing.Tuple[str, str]],
|
|
||||||
"HasGettableStringKeys",
|
|
||||||
]
|
|
||||||
|
|
||||||
|
|
||||||
class _Sentinel(Enum):
|
class RecentlyUsedContainer(MutableMapping):
|
||||||
not_passed = auto()
|
|
||||||
|
|
||||||
|
|
||||||
def ensure_can_construct_http_header_dict(
|
|
||||||
potential: object,
|
|
||||||
) -> ValidHTTPHeaderSource | None:
|
|
||||||
if isinstance(potential, HTTPHeaderDict):
|
|
||||||
return potential
|
|
||||||
elif isinstance(potential, typing.Mapping):
|
|
||||||
# Full runtime checking of the contents of a Mapping is expensive, so for the
|
|
||||||
# purposes of typechecking, we assume that any Mapping is the right shape.
|
|
||||||
return typing.cast(typing.Mapping[str, str], potential)
|
|
||||||
elif isinstance(potential, typing.Iterable):
|
|
||||||
# Similarly to Mapping, full runtime checking of the contents of an Iterable is
|
|
||||||
# expensive, so for the purposes of typechecking, we assume that any Iterable
|
|
||||||
# is the right shape.
|
|
||||||
return typing.cast(typing.Iterable[typing.Tuple[str, str]], potential)
|
|
||||||
elif hasattr(potential, "keys") and hasattr(potential, "__getitem__"):
|
|
||||||
return typing.cast("HasGettableStringKeys", potential)
|
|
||||||
else:
|
|
||||||
return None
|
|
||||||
|
|
||||||
|
|
||||||
class RecentlyUsedContainer(typing.Generic[_KT, _VT], typing.MutableMapping[_KT, _VT]):
|
|
||||||
"""
|
"""
|
||||||
Provides a thread-safe dict-like container which maintains up to
|
Provides a thread-safe dict-like container which maintains up to
|
||||||
``maxsize`` keys while throwing away the least-recently-used keys beyond
|
``maxsize`` keys while throwing away the least-recently-used keys beyond
|
||||||
|
|
@ -76,134 +42,69 @@ class RecentlyUsedContainer(typing.Generic[_KT, _VT], typing.MutableMapping[_KT,
|
||||||
``dispose_func(value)`` is called. Callback which will get called
|
``dispose_func(value)`` is called. Callback which will get called
|
||||||
"""
|
"""
|
||||||
|
|
||||||
_container: typing.OrderedDict[_KT, _VT]
|
ContainerCls = OrderedDict
|
||||||
_maxsize: int
|
|
||||||
dispose_func: typing.Callable[[_VT], None] | None
|
|
||||||
lock: RLock
|
|
||||||
|
|
||||||
def __init__(
|
def __init__(self, maxsize=10, dispose_func=None):
|
||||||
self,
|
|
||||||
maxsize: int = 10,
|
|
||||||
dispose_func: typing.Callable[[_VT], None] | None = None,
|
|
||||||
) -> None:
|
|
||||||
super().__init__()
|
|
||||||
self._maxsize = maxsize
|
self._maxsize = maxsize
|
||||||
self.dispose_func = dispose_func
|
self.dispose_func = dispose_func
|
||||||
self._container = OrderedDict()
|
|
||||||
|
self._container = self.ContainerCls()
|
||||||
self.lock = RLock()
|
self.lock = RLock()
|
||||||
|
|
||||||
def __getitem__(self, key: _KT) -> _VT:
|
def __getitem__(self, key):
|
||||||
# Re-insert the item, moving it to the end of the eviction line.
|
# Re-insert the item, moving it to the end of the eviction line.
|
||||||
with self.lock:
|
with self.lock:
|
||||||
item = self._container.pop(key)
|
item = self._container.pop(key)
|
||||||
self._container[key] = item
|
self._container[key] = item
|
||||||
return item
|
return item
|
||||||
|
|
||||||
def __setitem__(self, key: _KT, value: _VT) -> None:
|
def __setitem__(self, key, value):
|
||||||
evicted_item = None
|
evicted_value = _Null
|
||||||
with self.lock:
|
with self.lock:
|
||||||
# Possibly evict the existing value of 'key'
|
# Possibly evict the existing value of 'key'
|
||||||
try:
|
evicted_value = self._container.get(key, _Null)
|
||||||
# If the key exists, we'll overwrite it, which won't change the
|
|
||||||
# size of the pool. Because accessing a key should move it to
|
|
||||||
# the end of the eviction line, we pop it out first.
|
|
||||||
evicted_item = key, self._container.pop(key)
|
|
||||||
self._container[key] = value
|
self._container[key] = value
|
||||||
except KeyError:
|
|
||||||
# When the key does not exist, we insert the value first so that
|
|
||||||
# evicting works in all cases, including when self._maxsize is 0
|
|
||||||
self._container[key] = value
|
|
||||||
if len(self._container) > self._maxsize:
|
|
||||||
# If we didn't evict an existing value, and we've hit our maximum
|
|
||||||
# size, then we have to evict the least recently used item from
|
|
||||||
# the beginning of the container.
|
|
||||||
evicted_item = self._container.popitem(last=False)
|
|
||||||
|
|
||||||
# After releasing the lock on the pool, dispose of any evicted value.
|
# If we didn't evict an existing value, we might have to evict the
|
||||||
if evicted_item is not None and self.dispose_func:
|
# least recently used item from the beginning of the container.
|
||||||
_, evicted_value = evicted_item
|
if len(self._container) > self._maxsize:
|
||||||
|
_key, evicted_value = self._container.popitem(last=False)
|
||||||
|
|
||||||
|
if self.dispose_func and evicted_value is not _Null:
|
||||||
self.dispose_func(evicted_value)
|
self.dispose_func(evicted_value)
|
||||||
|
|
||||||
def __delitem__(self, key: _KT) -> None:
|
def __delitem__(self, key):
|
||||||
with self.lock:
|
with self.lock:
|
||||||
value = self._container.pop(key)
|
value = self._container.pop(key)
|
||||||
|
|
||||||
if self.dispose_func:
|
if self.dispose_func:
|
||||||
self.dispose_func(value)
|
self.dispose_func(value)
|
||||||
|
|
||||||
def __len__(self) -> int:
|
def __len__(self):
|
||||||
with self.lock:
|
with self.lock:
|
||||||
return len(self._container)
|
return len(self._container)
|
||||||
|
|
||||||
def __iter__(self) -> typing.NoReturn:
|
def __iter__(self):
|
||||||
raise NotImplementedError(
|
raise NotImplementedError(
|
||||||
"Iteration over this class is unlikely to be threadsafe."
|
"Iteration over this class is unlikely to be threadsafe."
|
||||||
)
|
)
|
||||||
|
|
||||||
def clear(self) -> None:
|
def clear(self):
|
||||||
with self.lock:
|
with self.lock:
|
||||||
# Copy pointers to all values, then wipe the mapping
|
# Copy pointers to all values, then wipe the mapping
|
||||||
values = list(self._container.values())
|
values = list(itervalues(self._container))
|
||||||
self._container.clear()
|
self._container.clear()
|
||||||
|
|
||||||
if self.dispose_func:
|
if self.dispose_func:
|
||||||
for value in values:
|
for value in values:
|
||||||
self.dispose_func(value)
|
self.dispose_func(value)
|
||||||
|
|
||||||
def keys(self) -> set[_KT]: # type: ignore[override]
|
def keys(self):
|
||||||
with self.lock:
|
with self.lock:
|
||||||
return set(self._container.keys())
|
return list(iterkeys(self._container))
|
||||||
|
|
||||||
|
|
||||||
class HTTPHeaderDictItemView(typing.Set[typing.Tuple[str, str]]):
|
class HTTPHeaderDict(MutableMapping):
|
||||||
"""
|
|
||||||
HTTPHeaderDict is unusual for a Mapping[str, str] in that it has two modes of
|
|
||||||
address.
|
|
||||||
|
|
||||||
If we directly try to get an item with a particular name, we will get a string
|
|
||||||
back that is the concatenated version of all the values:
|
|
||||||
|
|
||||||
>>> d['X-Header-Name']
|
|
||||||
'Value1, Value2, Value3'
|
|
||||||
|
|
||||||
However, if we iterate over an HTTPHeaderDict's items, we will optionally combine
|
|
||||||
these values based on whether combine=True was called when building up the dictionary
|
|
||||||
|
|
||||||
>>> d = HTTPHeaderDict({"A": "1", "B": "foo"})
|
|
||||||
>>> d.add("A", "2", combine=True)
|
|
||||||
>>> d.add("B", "bar")
|
|
||||||
>>> list(d.items())
|
|
||||||
[
|
|
||||||
('A', '1, 2'),
|
|
||||||
('B', 'foo'),
|
|
||||||
('B', 'bar'),
|
|
||||||
]
|
|
||||||
|
|
||||||
This class conforms to the interface required by the MutableMapping ABC while
|
|
||||||
also giving us the nonstandard iteration behavior we want; items with duplicate
|
|
||||||
keys, ordered by time of first insertion.
|
|
||||||
"""
|
|
||||||
|
|
||||||
_headers: HTTPHeaderDict
|
|
||||||
|
|
||||||
def __init__(self, headers: HTTPHeaderDict) -> None:
|
|
||||||
self._headers = headers
|
|
||||||
|
|
||||||
def __len__(self) -> int:
|
|
||||||
return len(list(self._headers.iteritems()))
|
|
||||||
|
|
||||||
def __iter__(self) -> typing.Iterator[tuple[str, str]]:
|
|
||||||
return self._headers.iteritems()
|
|
||||||
|
|
||||||
def __contains__(self, item: object) -> bool:
|
|
||||||
if isinstance(item, tuple) and len(item) == 2:
|
|
||||||
passed_key, passed_val = item
|
|
||||||
if isinstance(passed_key, str) and isinstance(passed_val, str):
|
|
||||||
return self._headers._has_value_for_header(passed_key, passed_val)
|
|
||||||
return False
|
|
||||||
|
|
||||||
|
|
||||||
class HTTPHeaderDict(typing.MutableMapping[str, str]):
|
|
||||||
"""
|
"""
|
||||||
:param headers:
|
:param headers:
|
||||||
An iterable of field-value pairs. Must not contain multiple field names
|
An iterable of field-value pairs. Must not contain multiple field names
|
||||||
|
|
@ -237,11 +138,9 @@ class HTTPHeaderDict(typing.MutableMapping[str, str]):
|
||||||
'7'
|
'7'
|
||||||
"""
|
"""
|
||||||
|
|
||||||
_container: typing.MutableMapping[str, list[str]]
|
def __init__(self, headers=None, **kwargs):
|
||||||
|
super(HTTPHeaderDict, self).__init__()
|
||||||
def __init__(self, headers: ValidHTTPHeaderSource | None = None, **kwargs: str):
|
self._container = OrderedDict()
|
||||||
super().__init__()
|
|
||||||
self._container = {} # 'dict' is insert-ordered
|
|
||||||
if headers is not None:
|
if headers is not None:
|
||||||
if isinstance(headers, HTTPHeaderDict):
|
if isinstance(headers, HTTPHeaderDict):
|
||||||
self._copy_from(headers)
|
self._copy_from(headers)
|
||||||
|
|
@ -250,167 +149,125 @@ class HTTPHeaderDict(typing.MutableMapping[str, str]):
|
||||||
if kwargs:
|
if kwargs:
|
||||||
self.extend(kwargs)
|
self.extend(kwargs)
|
||||||
|
|
||||||
def __setitem__(self, key: str, val: str) -> None:
|
def __setitem__(self, key, val):
|
||||||
# avoid a bytes/str comparison by decoding before httplib
|
|
||||||
if isinstance(key, bytes):
|
|
||||||
key = key.decode("latin-1")
|
|
||||||
self._container[key.lower()] = [key, val]
|
self._container[key.lower()] = [key, val]
|
||||||
|
return self._container[key.lower()]
|
||||||
|
|
||||||
def __getitem__(self, key: str) -> str:
|
def __getitem__(self, key):
|
||||||
val = self._container[key.lower()]
|
val = self._container[key.lower()]
|
||||||
return ", ".join(val[1:])
|
return ", ".join(val[1:])
|
||||||
|
|
||||||
def __delitem__(self, key: str) -> None:
|
def __delitem__(self, key):
|
||||||
del self._container[key.lower()]
|
del self._container[key.lower()]
|
||||||
|
|
||||||
def __contains__(self, key: object) -> bool:
|
def __contains__(self, key):
|
||||||
if isinstance(key, str):
|
|
||||||
return key.lower() in self._container
|
return key.lower() in self._container
|
||||||
|
|
||||||
|
def __eq__(self, other):
|
||||||
|
if not isinstance(other, Mapping) and not hasattr(other, "keys"):
|
||||||
return False
|
return False
|
||||||
|
if not isinstance(other, type(self)):
|
||||||
|
other = type(self)(other)
|
||||||
|
return dict((k.lower(), v) for k, v in self.itermerged()) == dict(
|
||||||
|
(k.lower(), v) for k, v in other.itermerged()
|
||||||
|
)
|
||||||
|
|
||||||
def setdefault(self, key: str, default: str = "") -> str:
|
def __ne__(self, other):
|
||||||
return super().setdefault(key, default)
|
|
||||||
|
|
||||||
def __eq__(self, other: object) -> bool:
|
|
||||||
maybe_constructable = ensure_can_construct_http_header_dict(other)
|
|
||||||
if maybe_constructable is None:
|
|
||||||
return False
|
|
||||||
else:
|
|
||||||
other_as_http_header_dict = type(self)(maybe_constructable)
|
|
||||||
|
|
||||||
return {k.lower(): v for k, v in self.itermerged()} == {
|
|
||||||
k.lower(): v for k, v in other_as_http_header_dict.itermerged()
|
|
||||||
}
|
|
||||||
|
|
||||||
def __ne__(self, other: object) -> bool:
|
|
||||||
return not self.__eq__(other)
|
return not self.__eq__(other)
|
||||||
|
|
||||||
def __len__(self) -> int:
|
if six.PY2: # Python 2
|
||||||
|
iterkeys = MutableMapping.iterkeys
|
||||||
|
itervalues = MutableMapping.itervalues
|
||||||
|
|
||||||
|
__marker = object()
|
||||||
|
|
||||||
|
def __len__(self):
|
||||||
return len(self._container)
|
return len(self._container)
|
||||||
|
|
||||||
def __iter__(self) -> typing.Iterator[str]:
|
def __iter__(self):
|
||||||
# Only provide the originally cased names
|
# Only provide the originally cased names
|
||||||
for vals in self._container.values():
|
for vals in self._container.values():
|
||||||
yield vals[0]
|
yield vals[0]
|
||||||
|
|
||||||
def discard(self, key: str) -> None:
|
def pop(self, key, default=__marker):
|
||||||
|
"""D.pop(k[,d]) -> v, remove specified key and return the corresponding value.
|
||||||
|
If key is not found, d is returned if given, otherwise KeyError is raised.
|
||||||
|
"""
|
||||||
|
# Using the MutableMapping function directly fails due to the private marker.
|
||||||
|
# Using ordinary dict.pop would expose the internal structures.
|
||||||
|
# So let's reinvent the wheel.
|
||||||
|
try:
|
||||||
|
value = self[key]
|
||||||
|
except KeyError:
|
||||||
|
if default is self.__marker:
|
||||||
|
raise
|
||||||
|
return default
|
||||||
|
else:
|
||||||
|
del self[key]
|
||||||
|
return value
|
||||||
|
|
||||||
|
def discard(self, key):
|
||||||
try:
|
try:
|
||||||
del self[key]
|
del self[key]
|
||||||
except KeyError:
|
except KeyError:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
def add(self, key: str, val: str, *, combine: bool = False) -> None:
|
def add(self, key, val):
|
||||||
"""Adds a (name, value) pair, doesn't overwrite the value if it already
|
"""Adds a (name, value) pair, doesn't overwrite the value if it already
|
||||||
exists.
|
exists.
|
||||||
|
|
||||||
If this is called with combine=True, instead of adding a new header value
|
|
||||||
as a distinct item during iteration, this will instead append the value to
|
|
||||||
any existing header value with a comma. If no existing header value exists
|
|
||||||
for the key, then the value will simply be added, ignoring the combine parameter.
|
|
||||||
|
|
||||||
>>> headers = HTTPHeaderDict(foo='bar')
|
>>> headers = HTTPHeaderDict(foo='bar')
|
||||||
>>> headers.add('Foo', 'baz')
|
>>> headers.add('Foo', 'baz')
|
||||||
>>> headers['foo']
|
>>> headers['foo']
|
||||||
'bar, baz'
|
'bar, baz'
|
||||||
>>> list(headers.items())
|
|
||||||
[('foo', 'bar'), ('foo', 'baz')]
|
|
||||||
>>> headers.add('foo', 'quz', combine=True)
|
|
||||||
>>> list(headers.items())
|
|
||||||
[('foo', 'bar, baz, quz')]
|
|
||||||
"""
|
"""
|
||||||
# avoid a bytes/str comparison by decoding before httplib
|
|
||||||
if isinstance(key, bytes):
|
|
||||||
key = key.decode("latin-1")
|
|
||||||
key_lower = key.lower()
|
key_lower = key.lower()
|
||||||
new_vals = [key, val]
|
new_vals = [key, val]
|
||||||
# Keep the common case aka no item present as fast as possible
|
# Keep the common case aka no item present as fast as possible
|
||||||
vals = self._container.setdefault(key_lower, new_vals)
|
vals = self._container.setdefault(key_lower, new_vals)
|
||||||
if new_vals is not vals:
|
if new_vals is not vals:
|
||||||
# if there are values here, then there is at least the initial
|
|
||||||
# key/value pair
|
|
||||||
assert len(vals) >= 2
|
|
||||||
if combine:
|
|
||||||
vals[-1] = vals[-1] + ", " + val
|
|
||||||
else:
|
|
||||||
vals.append(val)
|
vals.append(val)
|
||||||
|
|
||||||
def extend(self, *args: ValidHTTPHeaderSource, **kwargs: str) -> None:
|
def extend(self, *args, **kwargs):
|
||||||
"""Generic import function for any type of header-like object.
|
"""Generic import function for any type of header-like object.
|
||||||
Adapted version of MutableMapping.update in order to insert items
|
Adapted version of MutableMapping.update in order to insert items
|
||||||
with self.add instead of self.__setitem__
|
with self.add instead of self.__setitem__
|
||||||
"""
|
"""
|
||||||
if len(args) > 1:
|
if len(args) > 1:
|
||||||
raise TypeError(
|
raise TypeError(
|
||||||
f"extend() takes at most 1 positional arguments ({len(args)} given)"
|
"extend() takes at most 1 positional "
|
||||||
|
"arguments ({0} given)".format(len(args))
|
||||||
)
|
)
|
||||||
other = args[0] if len(args) >= 1 else ()
|
other = args[0] if len(args) >= 1 else ()
|
||||||
|
|
||||||
if isinstance(other, HTTPHeaderDict):
|
if isinstance(other, HTTPHeaderDict):
|
||||||
for key, val in other.iteritems():
|
for key, val in other.iteritems():
|
||||||
self.add(key, val)
|
self.add(key, val)
|
||||||
elif isinstance(other, typing.Mapping):
|
elif isinstance(other, Mapping):
|
||||||
for key, val in other.items():
|
for key in other:
|
||||||
self.add(key, val)
|
self.add(key, other[key])
|
||||||
elif isinstance(other, typing.Iterable):
|
elif hasattr(other, "keys"):
|
||||||
other = typing.cast(typing.Iterable[typing.Tuple[str, str]], other)
|
|
||||||
for key, value in other:
|
|
||||||
self.add(key, value)
|
|
||||||
elif hasattr(other, "keys") and hasattr(other, "__getitem__"):
|
|
||||||
# THIS IS NOT A TYPESAFE BRANCH
|
|
||||||
# In this branch, the object has a `keys` attr but is not a Mapping or any of
|
|
||||||
# the other types indicated in the method signature. We do some stuff with
|
|
||||||
# it as though it partially implements the Mapping interface, but we're not
|
|
||||||
# doing that stuff safely AT ALL.
|
|
||||||
for key in other.keys():
|
for key in other.keys():
|
||||||
self.add(key, other[key])
|
self.add(key, other[key])
|
||||||
|
else:
|
||||||
|
for key, value in other:
|
||||||
|
self.add(key, value)
|
||||||
|
|
||||||
for key, value in kwargs.items():
|
for key, value in kwargs.items():
|
||||||
self.add(key, value)
|
self.add(key, value)
|
||||||
|
|
||||||
@typing.overload
|
def getlist(self, key, default=__marker):
|
||||||
def getlist(self, key: str) -> list[str]:
|
|
||||||
...
|
|
||||||
|
|
||||||
@typing.overload
|
|
||||||
def getlist(self, key: str, default: _DT) -> list[str] | _DT:
|
|
||||||
...
|
|
||||||
|
|
||||||
def getlist(
|
|
||||||
self, key: str, default: _Sentinel | _DT = _Sentinel.not_passed
|
|
||||||
) -> list[str] | _DT:
|
|
||||||
"""Returns a list of all the values for the named field. Returns an
|
"""Returns a list of all the values for the named field. Returns an
|
||||||
empty list if the key doesn't exist."""
|
empty list if the key doesn't exist."""
|
||||||
try:
|
try:
|
||||||
vals = self._container[key.lower()]
|
vals = self._container[key.lower()]
|
||||||
except KeyError:
|
except KeyError:
|
||||||
if default is _Sentinel.not_passed:
|
if default is self.__marker:
|
||||||
# _DT is unbound; empty list is instance of List[str]
|
|
||||||
return []
|
return []
|
||||||
# _DT is bound; default is instance of _DT
|
|
||||||
return default
|
return default
|
||||||
else:
|
else:
|
||||||
# _DT may or may not be bound; vals[1:] is instance of List[str], which
|
|
||||||
# meets our external interface requirement of `Union[List[str], _DT]`.
|
|
||||||
return vals[1:]
|
return vals[1:]
|
||||||
|
|
||||||
def _prepare_for_method_change(self) -> Self:
|
|
||||||
"""
|
|
||||||
Remove content-specific header fields before changing the request
|
|
||||||
method to GET or HEAD according to RFC 9110, Section 15.4.
|
|
||||||
"""
|
|
||||||
content_specific_headers = [
|
|
||||||
"Content-Encoding",
|
|
||||||
"Content-Language",
|
|
||||||
"Content-Location",
|
|
||||||
"Content-Type",
|
|
||||||
"Content-Length",
|
|
||||||
"Digest",
|
|
||||||
"Last-Modified",
|
|
||||||
]
|
|
||||||
for header in content_specific_headers:
|
|
||||||
self.discard(header)
|
|
||||||
return self
|
|
||||||
|
|
||||||
# Backwards compatibility for httplib
|
# Backwards compatibility for httplib
|
||||||
getheaders = getlist
|
getheaders = getlist
|
||||||
getallmatchingheaders = getlist
|
getallmatchingheaders = getlist
|
||||||
|
|
@ -419,65 +276,62 @@ class HTTPHeaderDict(typing.MutableMapping[str, str]):
|
||||||
# Backwards compatibility for http.cookiejar
|
# Backwards compatibility for http.cookiejar
|
||||||
get_all = getlist
|
get_all = getlist
|
||||||
|
|
||||||
def __repr__(self) -> str:
|
def __repr__(self):
|
||||||
return f"{type(self).__name__}({dict(self.itermerged())})"
|
return "%s(%s)" % (type(self).__name__, dict(self.itermerged()))
|
||||||
|
|
||||||
def _copy_from(self, other: HTTPHeaderDict) -> None:
|
def _copy_from(self, other):
|
||||||
for key in other:
|
for key in other:
|
||||||
val = other.getlist(key)
|
val = other.getlist(key)
|
||||||
self._container[key.lower()] = [key, *val]
|
if isinstance(val, list):
|
||||||
|
# Don't need to convert tuples
|
||||||
|
val = list(val)
|
||||||
|
self._container[key.lower()] = [key] + val
|
||||||
|
|
||||||
def copy(self) -> HTTPHeaderDict:
|
def copy(self):
|
||||||
clone = type(self)()
|
clone = type(self)()
|
||||||
clone._copy_from(self)
|
clone._copy_from(self)
|
||||||
return clone
|
return clone
|
||||||
|
|
||||||
def iteritems(self) -> typing.Iterator[tuple[str, str]]:
|
def iteritems(self):
|
||||||
"""Iterate over all header lines, including duplicate ones."""
|
"""Iterate over all header lines, including duplicate ones."""
|
||||||
for key in self:
|
for key in self:
|
||||||
vals = self._container[key.lower()]
|
vals = self._container[key.lower()]
|
||||||
for val in vals[1:]:
|
for val in vals[1:]:
|
||||||
yield vals[0], val
|
yield vals[0], val
|
||||||
|
|
||||||
def itermerged(self) -> typing.Iterator[tuple[str, str]]:
|
def itermerged(self):
|
||||||
"""Iterate over all headers, merging duplicate ones together."""
|
"""Iterate over all headers, merging duplicate ones together."""
|
||||||
for key in self:
|
for key in self:
|
||||||
val = self._container[key.lower()]
|
val = self._container[key.lower()]
|
||||||
yield val[0], ", ".join(val[1:])
|
yield val[0], ", ".join(val[1:])
|
||||||
|
|
||||||
def items(self) -> HTTPHeaderDictItemView: # type: ignore[override]
|
def items(self):
|
||||||
return HTTPHeaderDictItemView(self)
|
return list(self.iteritems())
|
||||||
|
|
||||||
def _has_value_for_header(self, header_name: str, potential_value: str) -> bool:
|
@classmethod
|
||||||
if header_name in self:
|
def from_httplib(cls, message): # Python 2
|
||||||
return potential_value in self._container[header_name.lower()][1:]
|
"""Read headers from a Python 2 httplib message object."""
|
||||||
return False
|
# python2.7 does not expose a proper API for exporting multiheaders
|
||||||
|
# efficiently. This function re-reads raw lines from the message
|
||||||
|
# object and extracts the multiheaders properly.
|
||||||
|
obs_fold_continued_leaders = (" ", "\t")
|
||||||
|
headers = []
|
||||||
|
|
||||||
def __ior__(self, other: object) -> HTTPHeaderDict:
|
for line in message.headers:
|
||||||
# Supports extending a header dict in-place using operator |=
|
if line.startswith(obs_fold_continued_leaders):
|
||||||
# combining items with add instead of __setitem__
|
if not headers:
|
||||||
maybe_constructable = ensure_can_construct_http_header_dict(other)
|
# We received a header line that starts with OWS as described
|
||||||
if maybe_constructable is None:
|
# in RFC-7230 S3.2.4. This indicates a multiline header, but
|
||||||
return NotImplemented
|
# there exists no previous header to which we can attach it.
|
||||||
self.extend(maybe_constructable)
|
raise InvalidHeader(
|
||||||
return self
|
"Header continuation with no previous header: %s" % line
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
key, value = headers[-1]
|
||||||
|
headers[-1] = (key, value + " " + line.strip())
|
||||||
|
continue
|
||||||
|
|
||||||
def __or__(self, other: object) -> HTTPHeaderDict:
|
key, value = line.split(":", 1)
|
||||||
# Supports merging header dicts using operator |
|
headers.append((key, value.strip()))
|
||||||
# combining items with add instead of __setitem__
|
|
||||||
maybe_constructable = ensure_can_construct_http_header_dict(other)
|
|
||||||
if maybe_constructable is None:
|
|
||||||
return NotImplemented
|
|
||||||
result = self.copy()
|
|
||||||
result.extend(maybe_constructable)
|
|
||||||
return result
|
|
||||||
|
|
||||||
def __ror__(self, other: object) -> HTTPHeaderDict:
|
return cls(headers)
|
||||||
# Supports merging header dicts using operator | when other is on left side
|
|
||||||
# combining items with add instead of __setitem__
|
|
||||||
maybe_constructable = ensure_can_construct_http_header_dict(other)
|
|
||||||
if maybe_constructable is None:
|
|
||||||
return NotImplemented
|
|
||||||
result = type(self)(maybe_constructable)
|
|
||||||
result.extend(self)
|
|
||||||
return result
|
|
||||||
|
|
|
||||||
|
|
@ -1,279 +0,0 @@
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import json as _json
|
|
||||||
import typing
|
|
||||||
from urllib.parse import urlencode
|
|
||||||
|
|
||||||
from ._base_connection import _TYPE_BODY
|
|
||||||
from ._collections import HTTPHeaderDict
|
|
||||||
from .filepost import _TYPE_FIELDS, encode_multipart_formdata
|
|
||||||
from .response import BaseHTTPResponse
|
|
||||||
|
|
||||||
__all__ = ["RequestMethods"]
|
|
||||||
|
|
||||||
_TYPE_ENCODE_URL_FIELDS = typing.Union[
|
|
||||||
typing.Sequence[typing.Tuple[str, typing.Union[str, bytes]]],
|
|
||||||
typing.Mapping[str, typing.Union[str, bytes]],
|
|
||||||
]
|
|
||||||
|
|
||||||
|
|
||||||
class RequestMethods:
|
|
||||||
"""
|
|
||||||
Convenience mixin for classes who implement a :meth:`urlopen` method, such
|
|
||||||
as :class:`urllib3.HTTPConnectionPool` and
|
|
||||||
:class:`urllib3.PoolManager`.
|
|
||||||
|
|
||||||
Provides behavior for making common types of HTTP request methods and
|
|
||||||
decides which type of request field encoding to use.
|
|
||||||
|
|
||||||
Specifically,
|
|
||||||
|
|
||||||
:meth:`.request_encode_url` is for sending requests whose fields are
|
|
||||||
encoded in the URL (such as GET, HEAD, DELETE).
|
|
||||||
|
|
||||||
:meth:`.request_encode_body` is for sending requests whose fields are
|
|
||||||
encoded in the *body* of the request using multipart or www-form-urlencoded
|
|
||||||
(such as for POST, PUT, PATCH).
|
|
||||||
|
|
||||||
:meth:`.request` is for making any kind of request, it will look up the
|
|
||||||
appropriate encoding format and use one of the above two methods to make
|
|
||||||
the request.
|
|
||||||
|
|
||||||
Initializer parameters:
|
|
||||||
|
|
||||||
:param headers:
|
|
||||||
Headers to include with all requests, unless other headers are given
|
|
||||||
explicitly.
|
|
||||||
"""
|
|
||||||
|
|
||||||
_encode_url_methods = {"DELETE", "GET", "HEAD", "OPTIONS"}
|
|
||||||
|
|
||||||
def __init__(self, headers: typing.Mapping[str, str] | None = None) -> None:
|
|
||||||
self.headers = headers or {}
|
|
||||||
|
|
||||||
def urlopen(
|
|
||||||
self,
|
|
||||||
method: str,
|
|
||||||
url: str,
|
|
||||||
body: _TYPE_BODY | None = None,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
encode_multipart: bool = True,
|
|
||||||
multipart_boundary: str | None = None,
|
|
||||||
**kw: typing.Any,
|
|
||||||
) -> BaseHTTPResponse: # Abstract
|
|
||||||
raise NotImplementedError(
|
|
||||||
"Classes extending RequestMethods must implement "
|
|
||||||
"their own ``urlopen`` method."
|
|
||||||
)
|
|
||||||
|
|
||||||
def request(
|
|
||||||
self,
|
|
||||||
method: str,
|
|
||||||
url: str,
|
|
||||||
body: _TYPE_BODY | None = None,
|
|
||||||
fields: _TYPE_FIELDS | None = None,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
json: typing.Any | None = None,
|
|
||||||
**urlopen_kw: typing.Any,
|
|
||||||
) -> BaseHTTPResponse:
|
|
||||||
"""
|
|
||||||
Make a request using :meth:`urlopen` with the appropriate encoding of
|
|
||||||
``fields`` based on the ``method`` used.
|
|
||||||
|
|
||||||
This is a convenience method that requires the least amount of manual
|
|
||||||
effort. It can be used in most situations, while still having the
|
|
||||||
option to drop down to more specific methods when necessary, such as
|
|
||||||
:meth:`request_encode_url`, :meth:`request_encode_body`,
|
|
||||||
or even the lowest level :meth:`urlopen`.
|
|
||||||
|
|
||||||
:param method:
|
|
||||||
HTTP request method (such as GET, POST, PUT, etc.)
|
|
||||||
|
|
||||||
:param url:
|
|
||||||
The URL to perform the request on.
|
|
||||||
|
|
||||||
:param body:
|
|
||||||
Data to send in the request body, either :class:`str`, :class:`bytes`,
|
|
||||||
an iterable of :class:`str`/:class:`bytes`, or a file-like object.
|
|
||||||
|
|
||||||
:param fields:
|
|
||||||
Data to encode and send in the request body. Values are processed
|
|
||||||
by :func:`urllib.parse.urlencode`.
|
|
||||||
|
|
||||||
:param headers:
|
|
||||||
Dictionary of custom headers to send, such as User-Agent,
|
|
||||||
If-None-Match, etc. If None, pool headers are used. If provided,
|
|
||||||
these headers completely replace any pool-specific headers.
|
|
||||||
|
|
||||||
:param json:
|
|
||||||
Data to encode and send as JSON with UTF-encoded in the request body.
|
|
||||||
The ``"Content-Type"`` header will be set to ``"application/json"``
|
|
||||||
unless specified otherwise.
|
|
||||||
"""
|
|
||||||
method = method.upper()
|
|
||||||
|
|
||||||
if json is not None and body is not None:
|
|
||||||
raise TypeError(
|
|
||||||
"request got values for both 'body' and 'json' parameters which are mutually exclusive"
|
|
||||||
)
|
|
||||||
|
|
||||||
if json is not None:
|
|
||||||
if headers is None:
|
|
||||||
headers = self.headers
|
|
||||||
|
|
||||||
if not ("content-type" in map(str.lower, headers.keys())):
|
|
||||||
headers = HTTPHeaderDict(headers)
|
|
||||||
headers["Content-Type"] = "application/json"
|
|
||||||
|
|
||||||
body = _json.dumps(json, separators=(",", ":"), ensure_ascii=False).encode(
|
|
||||||
"utf-8"
|
|
||||||
)
|
|
||||||
|
|
||||||
if body is not None:
|
|
||||||
urlopen_kw["body"] = body
|
|
||||||
|
|
||||||
if method in self._encode_url_methods:
|
|
||||||
return self.request_encode_url(
|
|
||||||
method,
|
|
||||||
url,
|
|
||||||
fields=fields, # type: ignore[arg-type]
|
|
||||||
headers=headers,
|
|
||||||
**urlopen_kw,
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
return self.request_encode_body(
|
|
||||||
method, url, fields=fields, headers=headers, **urlopen_kw
|
|
||||||
)
|
|
||||||
|
|
||||||
def request_encode_url(
|
|
||||||
self,
|
|
||||||
method: str,
|
|
||||||
url: str,
|
|
||||||
fields: _TYPE_ENCODE_URL_FIELDS | None = None,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
**urlopen_kw: str,
|
|
||||||
) -> BaseHTTPResponse:
|
|
||||||
"""
|
|
||||||
Make a request using :meth:`urlopen` with the ``fields`` encoded in
|
|
||||||
the url. This is useful for request methods like GET, HEAD, DELETE, etc.
|
|
||||||
|
|
||||||
:param method:
|
|
||||||
HTTP request method (such as GET, POST, PUT, etc.)
|
|
||||||
|
|
||||||
:param url:
|
|
||||||
The URL to perform the request on.
|
|
||||||
|
|
||||||
:param fields:
|
|
||||||
Data to encode and send in the request body.
|
|
||||||
|
|
||||||
:param headers:
|
|
||||||
Dictionary of custom headers to send, such as User-Agent,
|
|
||||||
If-None-Match, etc. If None, pool headers are used. If provided,
|
|
||||||
these headers completely replace any pool-specific headers.
|
|
||||||
"""
|
|
||||||
if headers is None:
|
|
||||||
headers = self.headers
|
|
||||||
|
|
||||||
extra_kw: dict[str, typing.Any] = {"headers": headers}
|
|
||||||
extra_kw.update(urlopen_kw)
|
|
||||||
|
|
||||||
if fields:
|
|
||||||
url += "?" + urlencode(fields)
|
|
||||||
|
|
||||||
return self.urlopen(method, url, **extra_kw)
|
|
||||||
|
|
||||||
def request_encode_body(
|
|
||||||
self,
|
|
||||||
method: str,
|
|
||||||
url: str,
|
|
||||||
fields: _TYPE_FIELDS | None = None,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
encode_multipart: bool = True,
|
|
||||||
multipart_boundary: str | None = None,
|
|
||||||
**urlopen_kw: str,
|
|
||||||
) -> BaseHTTPResponse:
|
|
||||||
"""
|
|
||||||
Make a request using :meth:`urlopen` with the ``fields`` encoded in
|
|
||||||
the body. This is useful for request methods like POST, PUT, PATCH, etc.
|
|
||||||
|
|
||||||
When ``encode_multipart=True`` (default), then
|
|
||||||
:func:`urllib3.encode_multipart_formdata` is used to encode
|
|
||||||
the payload with the appropriate content type. Otherwise
|
|
||||||
:func:`urllib.parse.urlencode` is used with the
|
|
||||||
'application/x-www-form-urlencoded' content type.
|
|
||||||
|
|
||||||
Multipart encoding must be used when posting files, and it's reasonably
|
|
||||||
safe to use it in other times too. However, it may break request
|
|
||||||
signing, such as with OAuth.
|
|
||||||
|
|
||||||
Supports an optional ``fields`` parameter of key/value strings AND
|
|
||||||
key/filetuple. A filetuple is a (filename, data, MIME type) tuple where
|
|
||||||
the MIME type is optional. For example::
|
|
||||||
|
|
||||||
fields = {
|
|
||||||
'foo': 'bar',
|
|
||||||
'fakefile': ('foofile.txt', 'contents of foofile'),
|
|
||||||
'realfile': ('barfile.txt', open('realfile').read()),
|
|
||||||
'typedfile': ('bazfile.bin', open('bazfile').read(),
|
|
||||||
'image/jpeg'),
|
|
||||||
'nonamefile': 'contents of nonamefile field',
|
|
||||||
}
|
|
||||||
|
|
||||||
When uploading a file, providing a filename (the first parameter of the
|
|
||||||
tuple) is optional but recommended to best mimic behavior of browsers.
|
|
||||||
|
|
||||||
Note that if ``headers`` are supplied, the 'Content-Type' header will
|
|
||||||
be overwritten because it depends on the dynamic random boundary string
|
|
||||||
which is used to compose the body of the request. The random boundary
|
|
||||||
string can be explicitly set with the ``multipart_boundary`` parameter.
|
|
||||||
|
|
||||||
:param method:
|
|
||||||
HTTP request method (such as GET, POST, PUT, etc.)
|
|
||||||
|
|
||||||
:param url:
|
|
||||||
The URL to perform the request on.
|
|
||||||
|
|
||||||
:param fields:
|
|
||||||
Data to encode and send in the request body.
|
|
||||||
|
|
||||||
:param headers:
|
|
||||||
Dictionary of custom headers to send, such as User-Agent,
|
|
||||||
If-None-Match, etc. If None, pool headers are used. If provided,
|
|
||||||
these headers completely replace any pool-specific headers.
|
|
||||||
|
|
||||||
:param encode_multipart:
|
|
||||||
If True, encode the ``fields`` using the multipart/form-data MIME
|
|
||||||
format.
|
|
||||||
|
|
||||||
:param multipart_boundary:
|
|
||||||
If not specified, then a random boundary will be generated using
|
|
||||||
:func:`urllib3.filepost.choose_boundary`.
|
|
||||||
"""
|
|
||||||
if headers is None:
|
|
||||||
headers = self.headers
|
|
||||||
|
|
||||||
extra_kw: dict[str, typing.Any] = {"headers": HTTPHeaderDict(headers)}
|
|
||||||
body: bytes | str
|
|
||||||
|
|
||||||
if fields:
|
|
||||||
if "body" in urlopen_kw:
|
|
||||||
raise TypeError(
|
|
||||||
"request got values for both 'fields' and 'body', can only specify one."
|
|
||||||
)
|
|
||||||
|
|
||||||
if encode_multipart:
|
|
||||||
body, content_type = encode_multipart_formdata(
|
|
||||||
fields, boundary=multipart_boundary
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
body, content_type = (
|
|
||||||
urlencode(fields), # type: ignore[arg-type]
|
|
||||||
"application/x-www-form-urlencoded",
|
|
||||||
)
|
|
||||||
|
|
||||||
extra_kw["body"] = body
|
|
||||||
extra_kw["headers"].setdefault("Content-Type", content_type)
|
|
||||||
|
|
||||||
extra_kw.update(urlopen_kw)
|
|
||||||
|
|
||||||
return self.urlopen(method, url, **extra_kw)
|
|
||||||
|
|
@ -1,4 +1,2 @@
|
||||||
# This file is protected via CODEOWNERS
|
# This file is protected via CODEOWNERS
|
||||||
from __future__ import annotations
|
__version__ = "1.26.15"
|
||||||
|
|
||||||
__version__ = "2.2.1"
|
|
||||||
|
|
|
||||||
File diff suppressed because it is too large
Load Diff
File diff suppressed because it is too large
Load Diff
|
|
@ -1,16 +0,0 @@
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import urllib3.connection
|
|
||||||
|
|
||||||
from ...connectionpool import HTTPConnectionPool, HTTPSConnectionPool
|
|
||||||
from .connection import EmscriptenHTTPConnection, EmscriptenHTTPSConnection
|
|
||||||
|
|
||||||
|
|
||||||
def inject_into_urllib3() -> None:
|
|
||||||
# override connection classes to use emscripten specific classes
|
|
||||||
# n.b. mypy complains about the overriding of classes below
|
|
||||||
# if it isn't ignored
|
|
||||||
HTTPConnectionPool.ConnectionCls = EmscriptenHTTPConnection
|
|
||||||
HTTPSConnectionPool.ConnectionCls = EmscriptenHTTPSConnection
|
|
||||||
urllib3.connection.HTTPConnection = EmscriptenHTTPConnection # type: ignore[misc,assignment]
|
|
||||||
urllib3.connection.HTTPSConnection = EmscriptenHTTPSConnection # type: ignore[misc,assignment]
|
|
||||||
|
|
@ -1,254 +0,0 @@
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import os
|
|
||||||
import typing
|
|
||||||
|
|
||||||
# use http.client.HTTPException for consistency with non-emscripten
|
|
||||||
from http.client import HTTPException as HTTPException # noqa: F401
|
|
||||||
from http.client import ResponseNotReady
|
|
||||||
|
|
||||||
from ..._base_connection import _TYPE_BODY
|
|
||||||
from ...connection import HTTPConnection, ProxyConfig, port_by_scheme
|
|
||||||
from ...exceptions import TimeoutError
|
|
||||||
from ...response import BaseHTTPResponse
|
|
||||||
from ...util.connection import _TYPE_SOCKET_OPTIONS
|
|
||||||
from ...util.timeout import _DEFAULT_TIMEOUT, _TYPE_TIMEOUT
|
|
||||||
from ...util.url import Url
|
|
||||||
from .fetch import _RequestError, _TimeoutError, send_request, send_streaming_request
|
|
||||||
from .request import EmscriptenRequest
|
|
||||||
from .response import EmscriptenHttpResponseWrapper, EmscriptenResponse
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
from ..._base_connection import BaseHTTPConnection, BaseHTTPSConnection
|
|
||||||
|
|
||||||
|
|
||||||
class EmscriptenHTTPConnection:
|
|
||||||
default_port: typing.ClassVar[int] = port_by_scheme["http"]
|
|
||||||
default_socket_options: typing.ClassVar[_TYPE_SOCKET_OPTIONS]
|
|
||||||
|
|
||||||
timeout: None | (float)
|
|
||||||
|
|
||||||
host: str
|
|
||||||
port: int
|
|
||||||
blocksize: int
|
|
||||||
source_address: tuple[str, int] | None
|
|
||||||
socket_options: _TYPE_SOCKET_OPTIONS | None
|
|
||||||
|
|
||||||
proxy: Url | None
|
|
||||||
proxy_config: ProxyConfig | None
|
|
||||||
|
|
||||||
is_verified: bool = False
|
|
||||||
proxy_is_verified: bool | None = None
|
|
||||||
|
|
||||||
_response: EmscriptenResponse | None
|
|
||||||
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
host: str,
|
|
||||||
port: int = 0,
|
|
||||||
*,
|
|
||||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
|
||||||
source_address: tuple[str, int] | None = None,
|
|
||||||
blocksize: int = 8192,
|
|
||||||
socket_options: _TYPE_SOCKET_OPTIONS | None = None,
|
|
||||||
proxy: Url | None = None,
|
|
||||||
proxy_config: ProxyConfig | None = None,
|
|
||||||
) -> None:
|
|
||||||
self.host = host
|
|
||||||
self.port = port
|
|
||||||
self.timeout = timeout if isinstance(timeout, float) else 0.0
|
|
||||||
self.scheme = "http"
|
|
||||||
self._closed = True
|
|
||||||
self._response = None
|
|
||||||
# ignore these things because we don't
|
|
||||||
# have control over that stuff
|
|
||||||
self.proxy = None
|
|
||||||
self.proxy_config = None
|
|
||||||
self.blocksize = blocksize
|
|
||||||
self.source_address = None
|
|
||||||
self.socket_options = None
|
|
||||||
self.is_verified = False
|
|
||||||
|
|
||||||
def set_tunnel(
|
|
||||||
self,
|
|
||||||
host: str,
|
|
||||||
port: int | None = 0,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
scheme: str = "http",
|
|
||||||
) -> None:
|
|
||||||
pass
|
|
||||||
|
|
||||||
def connect(self) -> None:
|
|
||||||
pass
|
|
||||||
|
|
||||||
def request(
|
|
||||||
self,
|
|
||||||
method: str,
|
|
||||||
url: str,
|
|
||||||
body: _TYPE_BODY | None = None,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
# We know *at least* botocore is depending on the order of the
|
|
||||||
# first 3 parameters so to be safe we only mark the later ones
|
|
||||||
# as keyword-only to ensure we have space to extend.
|
|
||||||
*,
|
|
||||||
chunked: bool = False,
|
|
||||||
preload_content: bool = True,
|
|
||||||
decode_content: bool = True,
|
|
||||||
enforce_content_length: bool = True,
|
|
||||||
) -> None:
|
|
||||||
self._closed = False
|
|
||||||
if url.startswith("/"):
|
|
||||||
# no scheme / host / port included, make a full url
|
|
||||||
url = f"{self.scheme}://{self.host}:{self.port}" + url
|
|
||||||
request = EmscriptenRequest(
|
|
||||||
url=url,
|
|
||||||
method=method,
|
|
||||||
timeout=self.timeout if self.timeout else 0,
|
|
||||||
decode_content=decode_content,
|
|
||||||
)
|
|
||||||
request.set_body(body)
|
|
||||||
if headers:
|
|
||||||
for k, v in headers.items():
|
|
||||||
request.set_header(k, v)
|
|
||||||
self._response = None
|
|
||||||
try:
|
|
||||||
if not preload_content:
|
|
||||||
self._response = send_streaming_request(request)
|
|
||||||
if self._response is None:
|
|
||||||
self._response = send_request(request)
|
|
||||||
except _TimeoutError as e:
|
|
||||||
raise TimeoutError(e.message) from e
|
|
||||||
except _RequestError as e:
|
|
||||||
raise HTTPException(e.message) from e
|
|
||||||
|
|
||||||
def getresponse(self) -> BaseHTTPResponse:
|
|
||||||
if self._response is not None:
|
|
||||||
return EmscriptenHttpResponseWrapper(
|
|
||||||
internal_response=self._response,
|
|
||||||
url=self._response.request.url,
|
|
||||||
connection=self,
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
raise ResponseNotReady()
|
|
||||||
|
|
||||||
def close(self) -> None:
|
|
||||||
self._closed = True
|
|
||||||
self._response = None
|
|
||||||
|
|
||||||
@property
|
|
||||||
def is_closed(self) -> bool:
|
|
||||||
"""Whether the connection either is brand new or has been previously closed.
|
|
||||||
If this property is True then both ``is_connected`` and ``has_connected_to_proxy``
|
|
||||||
properties must be False.
|
|
||||||
"""
|
|
||||||
return self._closed
|
|
||||||
|
|
||||||
@property
|
|
||||||
def is_connected(self) -> bool:
|
|
||||||
"""Whether the connection is actively connected to any origin (proxy or target)"""
|
|
||||||
return True
|
|
||||||
|
|
||||||
@property
|
|
||||||
def has_connected_to_proxy(self) -> bool:
|
|
||||||
"""Whether the connection has successfully connected to its proxy.
|
|
||||||
This returns False if no proxy is in use. Used to determine whether
|
|
||||||
errors are coming from the proxy layer or from tunnelling to the target origin.
|
|
||||||
"""
|
|
||||||
return False
|
|
||||||
|
|
||||||
|
|
||||||
class EmscriptenHTTPSConnection(EmscriptenHTTPConnection):
|
|
||||||
default_port = port_by_scheme["https"]
|
|
||||||
# all this is basically ignored, as browser handles https
|
|
||||||
cert_reqs: int | str | None = None
|
|
||||||
ca_certs: str | None = None
|
|
||||||
ca_cert_dir: str | None = None
|
|
||||||
ca_cert_data: None | str | bytes = None
|
|
||||||
cert_file: str | None
|
|
||||||
key_file: str | None
|
|
||||||
key_password: str | None
|
|
||||||
ssl_context: typing.Any | None
|
|
||||||
ssl_version: int | str | None = None
|
|
||||||
ssl_minimum_version: int | None = None
|
|
||||||
ssl_maximum_version: int | None = None
|
|
||||||
assert_hostname: None | str | typing.Literal[False]
|
|
||||||
assert_fingerprint: str | None = None
|
|
||||||
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
host: str,
|
|
||||||
port: int = 0,
|
|
||||||
*,
|
|
||||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
|
||||||
source_address: tuple[str, int] | None = None,
|
|
||||||
blocksize: int = 16384,
|
|
||||||
socket_options: None
|
|
||||||
| _TYPE_SOCKET_OPTIONS = HTTPConnection.default_socket_options,
|
|
||||||
proxy: Url | None = None,
|
|
||||||
proxy_config: ProxyConfig | None = None,
|
|
||||||
cert_reqs: int | str | None = None,
|
|
||||||
assert_hostname: None | str | typing.Literal[False] = None,
|
|
||||||
assert_fingerprint: str | None = None,
|
|
||||||
server_hostname: str | None = None,
|
|
||||||
ssl_context: typing.Any | None = None,
|
|
||||||
ca_certs: str | None = None,
|
|
||||||
ca_cert_dir: str | None = None,
|
|
||||||
ca_cert_data: None | str | bytes = None,
|
|
||||||
ssl_minimum_version: int | None = None,
|
|
||||||
ssl_maximum_version: int | None = None,
|
|
||||||
ssl_version: int | str | None = None, # Deprecated
|
|
||||||
cert_file: str | None = None,
|
|
||||||
key_file: str | None = None,
|
|
||||||
key_password: str | None = None,
|
|
||||||
) -> None:
|
|
||||||
super().__init__(
|
|
||||||
host,
|
|
||||||
port=port,
|
|
||||||
timeout=timeout,
|
|
||||||
source_address=source_address,
|
|
||||||
blocksize=blocksize,
|
|
||||||
socket_options=socket_options,
|
|
||||||
proxy=proxy,
|
|
||||||
proxy_config=proxy_config,
|
|
||||||
)
|
|
||||||
self.scheme = "https"
|
|
||||||
|
|
||||||
self.key_file = key_file
|
|
||||||
self.cert_file = cert_file
|
|
||||||
self.key_password = key_password
|
|
||||||
self.ssl_context = ssl_context
|
|
||||||
self.server_hostname = server_hostname
|
|
||||||
self.assert_hostname = assert_hostname
|
|
||||||
self.assert_fingerprint = assert_fingerprint
|
|
||||||
self.ssl_version = ssl_version
|
|
||||||
self.ssl_minimum_version = ssl_minimum_version
|
|
||||||
self.ssl_maximum_version = ssl_maximum_version
|
|
||||||
self.ca_certs = ca_certs and os.path.expanduser(ca_certs)
|
|
||||||
self.ca_cert_dir = ca_cert_dir and os.path.expanduser(ca_cert_dir)
|
|
||||||
self.ca_cert_data = ca_cert_data
|
|
||||||
|
|
||||||
self.cert_reqs = None
|
|
||||||
|
|
||||||
# The browser will automatically verify all requests.
|
|
||||||
# We have no control over that setting.
|
|
||||||
self.is_verified = True
|
|
||||||
|
|
||||||
def set_cert(
|
|
||||||
self,
|
|
||||||
key_file: str | None = None,
|
|
||||||
cert_file: str | None = None,
|
|
||||||
cert_reqs: int | str | None = None,
|
|
||||||
key_password: str | None = None,
|
|
||||||
ca_certs: str | None = None,
|
|
||||||
assert_hostname: None | str | typing.Literal[False] = None,
|
|
||||||
assert_fingerprint: str | None = None,
|
|
||||||
ca_cert_dir: str | None = None,
|
|
||||||
ca_cert_data: None | str | bytes = None,
|
|
||||||
) -> None:
|
|
||||||
pass
|
|
||||||
|
|
||||||
|
|
||||||
# verify that this class implements BaseHTTP(s) connection correctly
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
_supports_http_protocol: BaseHTTPConnection = EmscriptenHTTPConnection("", 0)
|
|
||||||
_supports_https_protocol: BaseHTTPSConnection = EmscriptenHTTPSConnection("", 0)
|
|
||||||
|
|
@ -1,110 +0,0 @@
|
||||||
let Status = {
|
|
||||||
SUCCESS_HEADER: -1,
|
|
||||||
SUCCESS_EOF: -2,
|
|
||||||
ERROR_TIMEOUT: -3,
|
|
||||||
ERROR_EXCEPTION: -4,
|
|
||||||
};
|
|
||||||
|
|
||||||
let connections = {};
|
|
||||||
let nextConnectionID = 1;
|
|
||||||
const encoder = new TextEncoder();
|
|
||||||
|
|
||||||
self.addEventListener("message", async function (event) {
|
|
||||||
if (event.data.close) {
|
|
||||||
let connectionID = event.data.close;
|
|
||||||
delete connections[connectionID];
|
|
||||||
return;
|
|
||||||
} else if (event.data.getMore) {
|
|
||||||
let connectionID = event.data.getMore;
|
|
||||||
let { curOffset, value, reader, intBuffer, byteBuffer } =
|
|
||||||
connections[connectionID];
|
|
||||||
// if we still have some in buffer, then just send it back straight away
|
|
||||||
if (!value || curOffset >= value.length) {
|
|
||||||
// read another buffer if required
|
|
||||||
try {
|
|
||||||
let readResponse = await reader.read();
|
|
||||||
|
|
||||||
if (readResponse.done) {
|
|
||||||
// read everything - clear connection and return
|
|
||||||
delete connections[connectionID];
|
|
||||||
Atomics.store(intBuffer, 0, Status.SUCCESS_EOF);
|
|
||||||
Atomics.notify(intBuffer, 0);
|
|
||||||
// finished reading successfully
|
|
||||||
// return from event handler
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
curOffset = 0;
|
|
||||||
connections[connectionID].value = readResponse.value;
|
|
||||||
value = readResponse.value;
|
|
||||||
} catch (error) {
|
|
||||||
console.log("Request exception:", error);
|
|
||||||
let errorBytes = encoder.encode(error.message);
|
|
||||||
let written = errorBytes.length;
|
|
||||||
byteBuffer.set(errorBytes);
|
|
||||||
intBuffer[1] = written;
|
|
||||||
Atomics.store(intBuffer, 0, Status.ERROR_EXCEPTION);
|
|
||||||
Atomics.notify(intBuffer, 0);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// send as much buffer as we can
|
|
||||||
let curLen = value.length - curOffset;
|
|
||||||
if (curLen > byteBuffer.length) {
|
|
||||||
curLen = byteBuffer.length;
|
|
||||||
}
|
|
||||||
byteBuffer.set(value.subarray(curOffset, curOffset + curLen), 0);
|
|
||||||
|
|
||||||
Atomics.store(intBuffer, 0, curLen); // store current length in bytes
|
|
||||||
Atomics.notify(intBuffer, 0);
|
|
||||||
curOffset += curLen;
|
|
||||||
connections[connectionID].curOffset = curOffset;
|
|
||||||
|
|
||||||
return;
|
|
||||||
} else {
|
|
||||||
// start fetch
|
|
||||||
let connectionID = nextConnectionID;
|
|
||||||
nextConnectionID += 1;
|
|
||||||
const intBuffer = new Int32Array(event.data.buffer);
|
|
||||||
const byteBuffer = new Uint8Array(event.data.buffer, 8);
|
|
||||||
try {
|
|
||||||
const response = await fetch(event.data.url, event.data.fetchParams);
|
|
||||||
// return the headers first via textencoder
|
|
||||||
var headers = [];
|
|
||||||
for (const pair of response.headers.entries()) {
|
|
||||||
headers.push([pair[0], pair[1]]);
|
|
||||||
}
|
|
||||||
let headerObj = {
|
|
||||||
headers: headers,
|
|
||||||
status: response.status,
|
|
||||||
connectionID,
|
|
||||||
};
|
|
||||||
const headerText = JSON.stringify(headerObj);
|
|
||||||
let headerBytes = encoder.encode(headerText);
|
|
||||||
let written = headerBytes.length;
|
|
||||||
byteBuffer.set(headerBytes);
|
|
||||||
intBuffer[1] = written;
|
|
||||||
// make a connection
|
|
||||||
connections[connectionID] = {
|
|
||||||
reader: response.body.getReader(),
|
|
||||||
intBuffer: intBuffer,
|
|
||||||
byteBuffer: byteBuffer,
|
|
||||||
value: undefined,
|
|
||||||
curOffset: 0,
|
|
||||||
};
|
|
||||||
// set header ready
|
|
||||||
Atomics.store(intBuffer, 0, Status.SUCCESS_HEADER);
|
|
||||||
Atomics.notify(intBuffer, 0);
|
|
||||||
// all fetching after this goes through a new postmessage call with getMore
|
|
||||||
// this allows for parallel requests
|
|
||||||
} catch (error) {
|
|
||||||
console.log("Request exception:", error);
|
|
||||||
let errorBytes = encoder.encode(error.message);
|
|
||||||
let written = errorBytes.length;
|
|
||||||
byteBuffer.set(errorBytes);
|
|
||||||
intBuffer[1] = written;
|
|
||||||
Atomics.store(intBuffer, 0, Status.ERROR_EXCEPTION);
|
|
||||||
Atomics.notify(intBuffer, 0);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
});
|
|
||||||
self.postMessage({ inited: true });
|
|
||||||
|
|
@ -1,418 +0,0 @@
|
||||||
"""
|
|
||||||
Support for streaming http requests in emscripten.
|
|
||||||
|
|
||||||
A few caveats -
|
|
||||||
|
|
||||||
Firstly, you can't do streaming http in the main UI thread, because atomics.wait isn't allowed.
|
|
||||||
Streaming only works if you're running pyodide in a web worker.
|
|
||||||
|
|
||||||
Secondly, this uses an extra web worker and SharedArrayBuffer to do the asynchronous fetch
|
|
||||||
operation, so it requires that you have crossOriginIsolation enabled, by serving over https
|
|
||||||
(or from localhost) with the two headers below set:
|
|
||||||
|
|
||||||
Cross-Origin-Opener-Policy: same-origin
|
|
||||||
Cross-Origin-Embedder-Policy: require-corp
|
|
||||||
|
|
||||||
You can tell if cross origin isolation is successfully enabled by looking at the global crossOriginIsolated variable in
|
|
||||||
javascript console. If it isn't, streaming requests will fallback to XMLHttpRequest, i.e. getting the whole
|
|
||||||
request into a buffer and then returning it. it shows a warning in the javascript console in this case.
|
|
||||||
|
|
||||||
Finally, the webworker which does the streaming fetch is created on initial import, but will only be started once
|
|
||||||
control is returned to javascript. Call `await wait_for_streaming_ready()` to wait for streaming fetch.
|
|
||||||
|
|
||||||
NB: in this code, there are a lot of javascript objects. They are named js_*
|
|
||||||
to make it clear what type of object they are.
|
|
||||||
"""
|
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import io
|
|
||||||
import json
|
|
||||||
from email.parser import Parser
|
|
||||||
from importlib.resources import files
|
|
||||||
from typing import TYPE_CHECKING, Any
|
|
||||||
|
|
||||||
import js # type: ignore[import-not-found]
|
|
||||||
from pyodide.ffi import ( # type: ignore[import-not-found]
|
|
||||||
JsArray,
|
|
||||||
JsException,
|
|
||||||
JsProxy,
|
|
||||||
to_js,
|
|
||||||
)
|
|
||||||
|
|
||||||
if TYPE_CHECKING:
|
|
||||||
from typing_extensions import Buffer
|
|
||||||
|
|
||||||
from .request import EmscriptenRequest
|
|
||||||
from .response import EmscriptenResponse
|
|
||||||
|
|
||||||
"""
|
|
||||||
There are some headers that trigger unintended CORS preflight requests.
|
|
||||||
See also https://github.com/koenvo/pyodide-http/issues/22
|
|
||||||
"""
|
|
||||||
HEADERS_TO_IGNORE = ("user-agent",)
|
|
||||||
|
|
||||||
SUCCESS_HEADER = -1
|
|
||||||
SUCCESS_EOF = -2
|
|
||||||
ERROR_TIMEOUT = -3
|
|
||||||
ERROR_EXCEPTION = -4
|
|
||||||
|
|
||||||
_STREAMING_WORKER_CODE = (
|
|
||||||
files(__package__)
|
|
||||||
.joinpath("emscripten_fetch_worker.js")
|
|
||||||
.read_text(encoding="utf-8")
|
|
||||||
)
|
|
||||||
|
|
||||||
|
|
||||||
class _RequestError(Exception):
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
message: str | None = None,
|
|
||||||
*,
|
|
||||||
request: EmscriptenRequest | None = None,
|
|
||||||
response: EmscriptenResponse | None = None,
|
|
||||||
):
|
|
||||||
self.request = request
|
|
||||||
self.response = response
|
|
||||||
self.message = message
|
|
||||||
super().__init__(self.message)
|
|
||||||
|
|
||||||
|
|
||||||
class _StreamingError(_RequestError):
|
|
||||||
pass
|
|
||||||
|
|
||||||
|
|
||||||
class _TimeoutError(_RequestError):
|
|
||||||
pass
|
|
||||||
|
|
||||||
|
|
||||||
def _obj_from_dict(dict_val: dict[str, Any]) -> JsProxy:
|
|
||||||
return to_js(dict_val, dict_converter=js.Object.fromEntries)
|
|
||||||
|
|
||||||
|
|
||||||
class _ReadStream(io.RawIOBase):
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
int_buffer: JsArray,
|
|
||||||
byte_buffer: JsArray,
|
|
||||||
timeout: float,
|
|
||||||
worker: JsProxy,
|
|
||||||
connection_id: int,
|
|
||||||
request: EmscriptenRequest,
|
|
||||||
):
|
|
||||||
self.int_buffer = int_buffer
|
|
||||||
self.byte_buffer = byte_buffer
|
|
||||||
self.read_pos = 0
|
|
||||||
self.read_len = 0
|
|
||||||
self.connection_id = connection_id
|
|
||||||
self.worker = worker
|
|
||||||
self.timeout = int(1000 * timeout) if timeout > 0 else None
|
|
||||||
self.is_live = True
|
|
||||||
self._is_closed = False
|
|
||||||
self.request: EmscriptenRequest | None = request
|
|
||||||
|
|
||||||
def __del__(self) -> None:
|
|
||||||
self.close()
|
|
||||||
|
|
||||||
# this is compatible with _base_connection
|
|
||||||
def is_closed(self) -> bool:
|
|
||||||
return self._is_closed
|
|
||||||
|
|
||||||
# for compatibility with RawIOBase
|
|
||||||
@property
|
|
||||||
def closed(self) -> bool:
|
|
||||||
return self.is_closed()
|
|
||||||
|
|
||||||
def close(self) -> None:
|
|
||||||
if not self.is_closed():
|
|
||||||
self.read_len = 0
|
|
||||||
self.read_pos = 0
|
|
||||||
self.int_buffer = None
|
|
||||||
self.byte_buffer = None
|
|
||||||
self._is_closed = True
|
|
||||||
self.request = None
|
|
||||||
if self.is_live:
|
|
||||||
self.worker.postMessage(_obj_from_dict({"close": self.connection_id}))
|
|
||||||
self.is_live = False
|
|
||||||
super().close()
|
|
||||||
|
|
||||||
def readable(self) -> bool:
|
|
||||||
return True
|
|
||||||
|
|
||||||
def writable(self) -> bool:
|
|
||||||
return False
|
|
||||||
|
|
||||||
def seekable(self) -> bool:
|
|
||||||
return False
|
|
||||||
|
|
||||||
def readinto(self, byte_obj: Buffer) -> int:
|
|
||||||
if not self.int_buffer:
|
|
||||||
raise _StreamingError(
|
|
||||||
"No buffer for stream in _ReadStream.readinto",
|
|
||||||
request=self.request,
|
|
||||||
response=None,
|
|
||||||
)
|
|
||||||
if self.read_len == 0:
|
|
||||||
# wait for the worker to send something
|
|
||||||
js.Atomics.store(self.int_buffer, 0, ERROR_TIMEOUT)
|
|
||||||
self.worker.postMessage(_obj_from_dict({"getMore": self.connection_id}))
|
|
||||||
if (
|
|
||||||
js.Atomics.wait(self.int_buffer, 0, ERROR_TIMEOUT, self.timeout)
|
|
||||||
== "timed-out"
|
|
||||||
):
|
|
||||||
raise _TimeoutError
|
|
||||||
data_len = self.int_buffer[0]
|
|
||||||
if data_len > 0:
|
|
||||||
self.read_len = data_len
|
|
||||||
self.read_pos = 0
|
|
||||||
elif data_len == ERROR_EXCEPTION:
|
|
||||||
string_len = self.int_buffer[1]
|
|
||||||
# decode the error string
|
|
||||||
js_decoder = js.TextDecoder.new()
|
|
||||||
json_str = js_decoder.decode(self.byte_buffer.slice(0, string_len))
|
|
||||||
raise _StreamingError(
|
|
||||||
f"Exception thrown in fetch: {json_str}",
|
|
||||||
request=self.request,
|
|
||||||
response=None,
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
# EOF, free the buffers and return zero
|
|
||||||
# and free the request
|
|
||||||
self.is_live = False
|
|
||||||
self.close()
|
|
||||||
return 0
|
|
||||||
# copy from int32array to python bytes
|
|
||||||
ret_length = min(self.read_len, len(memoryview(byte_obj)))
|
|
||||||
subarray = self.byte_buffer.subarray(
|
|
||||||
self.read_pos, self.read_pos + ret_length
|
|
||||||
).to_py()
|
|
||||||
memoryview(byte_obj)[0:ret_length] = subarray
|
|
||||||
self.read_len -= ret_length
|
|
||||||
self.read_pos += ret_length
|
|
||||||
return ret_length
|
|
||||||
|
|
||||||
|
|
||||||
class _StreamingFetcher:
|
|
||||||
def __init__(self) -> None:
|
|
||||||
# make web-worker and data buffer on startup
|
|
||||||
self.streaming_ready = False
|
|
||||||
|
|
||||||
js_data_blob = js.Blob.new(
|
|
||||||
[_STREAMING_WORKER_CODE], _obj_from_dict({"type": "application/javascript"})
|
|
||||||
)
|
|
||||||
|
|
||||||
def promise_resolver(js_resolve_fn: JsProxy, js_reject_fn: JsProxy) -> None:
|
|
||||||
def onMsg(e: JsProxy) -> None:
|
|
||||||
self.streaming_ready = True
|
|
||||||
js_resolve_fn(e)
|
|
||||||
|
|
||||||
def onErr(e: JsProxy) -> None:
|
|
||||||
js_reject_fn(e) # Defensive: never happens in ci
|
|
||||||
|
|
||||||
self.js_worker.onmessage = onMsg
|
|
||||||
self.js_worker.onerror = onErr
|
|
||||||
|
|
||||||
js_data_url = js.URL.createObjectURL(js_data_blob)
|
|
||||||
self.js_worker = js.globalThis.Worker.new(js_data_url)
|
|
||||||
self.js_worker_ready_promise = js.globalThis.Promise.new(promise_resolver)
|
|
||||||
|
|
||||||
def send(self, request: EmscriptenRequest) -> EmscriptenResponse:
|
|
||||||
headers = {
|
|
||||||
k: v for k, v in request.headers.items() if k not in HEADERS_TO_IGNORE
|
|
||||||
}
|
|
||||||
|
|
||||||
body = request.body
|
|
||||||
fetch_data = {"headers": headers, "body": to_js(body), "method": request.method}
|
|
||||||
# start the request off in the worker
|
|
||||||
timeout = int(1000 * request.timeout) if request.timeout > 0 else None
|
|
||||||
js_shared_buffer = js.SharedArrayBuffer.new(1048576)
|
|
||||||
js_int_buffer = js.Int32Array.new(js_shared_buffer)
|
|
||||||
js_byte_buffer = js.Uint8Array.new(js_shared_buffer, 8)
|
|
||||||
|
|
||||||
js.Atomics.store(js_int_buffer, 0, ERROR_TIMEOUT)
|
|
||||||
js.Atomics.notify(js_int_buffer, 0)
|
|
||||||
js_absolute_url = js.URL.new(request.url, js.location).href
|
|
||||||
self.js_worker.postMessage(
|
|
||||||
_obj_from_dict(
|
|
||||||
{
|
|
||||||
"buffer": js_shared_buffer,
|
|
||||||
"url": js_absolute_url,
|
|
||||||
"fetchParams": fetch_data,
|
|
||||||
}
|
|
||||||
)
|
|
||||||
)
|
|
||||||
# wait for the worker to send something
|
|
||||||
js.Atomics.wait(js_int_buffer, 0, ERROR_TIMEOUT, timeout)
|
|
||||||
if js_int_buffer[0] == ERROR_TIMEOUT:
|
|
||||||
raise _TimeoutError(
|
|
||||||
"Timeout connecting to streaming request",
|
|
||||||
request=request,
|
|
||||||
response=None,
|
|
||||||
)
|
|
||||||
elif js_int_buffer[0] == SUCCESS_HEADER:
|
|
||||||
# got response
|
|
||||||
# header length is in second int of intBuffer
|
|
||||||
string_len = js_int_buffer[1]
|
|
||||||
# decode the rest to a JSON string
|
|
||||||
js_decoder = js.TextDecoder.new()
|
|
||||||
# this does a copy (the slice) because decode can't work on shared array
|
|
||||||
# for some silly reason
|
|
||||||
json_str = js_decoder.decode(js_byte_buffer.slice(0, string_len))
|
|
||||||
# get it as an object
|
|
||||||
response_obj = json.loads(json_str)
|
|
||||||
return EmscriptenResponse(
|
|
||||||
request=request,
|
|
||||||
status_code=response_obj["status"],
|
|
||||||
headers=response_obj["headers"],
|
|
||||||
body=_ReadStream(
|
|
||||||
js_int_buffer,
|
|
||||||
js_byte_buffer,
|
|
||||||
request.timeout,
|
|
||||||
self.js_worker,
|
|
||||||
response_obj["connectionID"],
|
|
||||||
request,
|
|
||||||
),
|
|
||||||
)
|
|
||||||
elif js_int_buffer[0] == ERROR_EXCEPTION:
|
|
||||||
string_len = js_int_buffer[1]
|
|
||||||
# decode the error string
|
|
||||||
js_decoder = js.TextDecoder.new()
|
|
||||||
json_str = js_decoder.decode(js_byte_buffer.slice(0, string_len))
|
|
||||||
raise _StreamingError(
|
|
||||||
f"Exception thrown in fetch: {json_str}", request=request, response=None
|
|
||||||
)
|
|
||||||
else:
|
|
||||||
raise _StreamingError(
|
|
||||||
f"Unknown status from worker in fetch: {js_int_buffer[0]}",
|
|
||||||
request=request,
|
|
||||||
response=None,
|
|
||||||
)
|
|
||||||
|
|
||||||
|
|
||||||
# check if we are in a worker or not
|
|
||||||
def is_in_browser_main_thread() -> bool:
|
|
||||||
return hasattr(js, "window") and hasattr(js, "self") and js.self == js.window
|
|
||||||
|
|
||||||
|
|
||||||
def is_cross_origin_isolated() -> bool:
|
|
||||||
return hasattr(js, "crossOriginIsolated") and js.crossOriginIsolated
|
|
||||||
|
|
||||||
|
|
||||||
def is_in_node() -> bool:
|
|
||||||
return (
|
|
||||||
hasattr(js, "process")
|
|
||||||
and hasattr(js.process, "release")
|
|
||||||
and hasattr(js.process.release, "name")
|
|
||||||
and js.process.release.name == "node"
|
|
||||||
)
|
|
||||||
|
|
||||||
|
|
||||||
def is_worker_available() -> bool:
|
|
||||||
return hasattr(js, "Worker") and hasattr(js, "Blob")
|
|
||||||
|
|
||||||
|
|
||||||
_fetcher: _StreamingFetcher | None = None
|
|
||||||
|
|
||||||
if is_worker_available() and (
|
|
||||||
(is_cross_origin_isolated() and not is_in_browser_main_thread())
|
|
||||||
and (not is_in_node())
|
|
||||||
):
|
|
||||||
_fetcher = _StreamingFetcher()
|
|
||||||
else:
|
|
||||||
_fetcher = None
|
|
||||||
|
|
||||||
|
|
||||||
def send_streaming_request(request: EmscriptenRequest) -> EmscriptenResponse | None:
|
|
||||||
if _fetcher and streaming_ready():
|
|
||||||
return _fetcher.send(request)
|
|
||||||
else:
|
|
||||||
_show_streaming_warning()
|
|
||||||
return None
|
|
||||||
|
|
||||||
|
|
||||||
_SHOWN_TIMEOUT_WARNING = False
|
|
||||||
|
|
||||||
|
|
||||||
def _show_timeout_warning() -> None:
|
|
||||||
global _SHOWN_TIMEOUT_WARNING
|
|
||||||
if not _SHOWN_TIMEOUT_WARNING:
|
|
||||||
_SHOWN_TIMEOUT_WARNING = True
|
|
||||||
message = "Warning: Timeout is not available on main browser thread"
|
|
||||||
js.console.warn(message)
|
|
||||||
|
|
||||||
|
|
||||||
_SHOWN_STREAMING_WARNING = False
|
|
||||||
|
|
||||||
|
|
||||||
def _show_streaming_warning() -> None:
|
|
||||||
global _SHOWN_STREAMING_WARNING
|
|
||||||
if not _SHOWN_STREAMING_WARNING:
|
|
||||||
_SHOWN_STREAMING_WARNING = True
|
|
||||||
message = "Can't stream HTTP requests because: \n"
|
|
||||||
if not is_cross_origin_isolated():
|
|
||||||
message += " Page is not cross-origin isolated\n"
|
|
||||||
if is_in_browser_main_thread():
|
|
||||||
message += " Python is running in main browser thread\n"
|
|
||||||
if not is_worker_available():
|
|
||||||
message += " Worker or Blob classes are not available in this environment." # Defensive: this is always False in browsers that we test in
|
|
||||||
if streaming_ready() is False:
|
|
||||||
message += """ Streaming fetch worker isn't ready. If you want to be sure that streaming fetch
|
|
||||||
is working, you need to call: 'await urllib3.contrib.emscripten.fetch.wait_for_streaming_ready()`"""
|
|
||||||
from js import console
|
|
||||||
|
|
||||||
console.warn(message)
|
|
||||||
|
|
||||||
|
|
||||||
def send_request(request: EmscriptenRequest) -> EmscriptenResponse:
|
|
||||||
try:
|
|
||||||
js_xhr = js.XMLHttpRequest.new()
|
|
||||||
|
|
||||||
if not is_in_browser_main_thread():
|
|
||||||
js_xhr.responseType = "arraybuffer"
|
|
||||||
if request.timeout:
|
|
||||||
js_xhr.timeout = int(request.timeout * 1000)
|
|
||||||
else:
|
|
||||||
js_xhr.overrideMimeType("text/plain; charset=ISO-8859-15")
|
|
||||||
if request.timeout:
|
|
||||||
# timeout isn't available on the main thread - show a warning in console
|
|
||||||
# if it is set
|
|
||||||
_show_timeout_warning()
|
|
||||||
|
|
||||||
js_xhr.open(request.method, request.url, False)
|
|
||||||
for name, value in request.headers.items():
|
|
||||||
if name.lower() not in HEADERS_TO_IGNORE:
|
|
||||||
js_xhr.setRequestHeader(name, value)
|
|
||||||
|
|
||||||
js_xhr.send(to_js(request.body))
|
|
||||||
|
|
||||||
headers = dict(Parser().parsestr(js_xhr.getAllResponseHeaders()))
|
|
||||||
|
|
||||||
if not is_in_browser_main_thread():
|
|
||||||
body = js_xhr.response.to_py().tobytes()
|
|
||||||
else:
|
|
||||||
body = js_xhr.response.encode("ISO-8859-15")
|
|
||||||
return EmscriptenResponse(
|
|
||||||
status_code=js_xhr.status, headers=headers, body=body, request=request
|
|
||||||
)
|
|
||||||
except JsException as err:
|
|
||||||
if err.name == "TimeoutError":
|
|
||||||
raise _TimeoutError(err.message, request=request)
|
|
||||||
elif err.name == "NetworkError":
|
|
||||||
raise _RequestError(err.message, request=request)
|
|
||||||
else:
|
|
||||||
# general http error
|
|
||||||
raise _RequestError(err.message, request=request)
|
|
||||||
|
|
||||||
|
|
||||||
def streaming_ready() -> bool | None:
|
|
||||||
if _fetcher:
|
|
||||||
return _fetcher.streaming_ready
|
|
||||||
else:
|
|
||||||
return None # no fetcher, return None to signify that
|
|
||||||
|
|
||||||
|
|
||||||
async def wait_for_streaming_ready() -> bool:
|
|
||||||
if _fetcher:
|
|
||||||
await _fetcher.js_worker_ready_promise
|
|
||||||
return True
|
|
||||||
else:
|
|
||||||
return False
|
|
||||||
|
|
@ -1,22 +0,0 @@
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
from dataclasses import dataclass, field
|
|
||||||
|
|
||||||
from ..._base_connection import _TYPE_BODY
|
|
||||||
|
|
||||||
|
|
||||||
@dataclass
|
|
||||||
class EmscriptenRequest:
|
|
||||||
method: str
|
|
||||||
url: str
|
|
||||||
params: dict[str, str] | None = None
|
|
||||||
body: _TYPE_BODY | None = None
|
|
||||||
headers: dict[str, str] = field(default_factory=dict)
|
|
||||||
timeout: float = 0
|
|
||||||
decode_content: bool = True
|
|
||||||
|
|
||||||
def set_header(self, name: str, value: str) -> None:
|
|
||||||
self.headers[name.capitalize()] = value
|
|
||||||
|
|
||||||
def set_body(self, body: _TYPE_BODY | None) -> None:
|
|
||||||
self.body = body
|
|
||||||
|
|
@ -1,276 +0,0 @@
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import json as _json
|
|
||||||
import logging
|
|
||||||
import typing
|
|
||||||
from contextlib import contextmanager
|
|
||||||
from dataclasses import dataclass
|
|
||||||
from http.client import HTTPException as HTTPException
|
|
||||||
from io import BytesIO, IOBase
|
|
||||||
|
|
||||||
from ...exceptions import InvalidHeader, TimeoutError
|
|
||||||
from ...response import BaseHTTPResponse
|
|
||||||
from ...util.retry import Retry
|
|
||||||
from .request import EmscriptenRequest
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
from ..._base_connection import BaseHTTPConnection, BaseHTTPSConnection
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
|
||||||
|
|
||||||
|
|
||||||
@dataclass
|
|
||||||
class EmscriptenResponse:
|
|
||||||
status_code: int
|
|
||||||
headers: dict[str, str]
|
|
||||||
body: IOBase | bytes
|
|
||||||
request: EmscriptenRequest
|
|
||||||
|
|
||||||
|
|
||||||
class EmscriptenHttpResponseWrapper(BaseHTTPResponse):
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
internal_response: EmscriptenResponse,
|
|
||||||
url: str | None = None,
|
|
||||||
connection: BaseHTTPConnection | BaseHTTPSConnection | None = None,
|
|
||||||
):
|
|
||||||
self._pool = None # set by pool class
|
|
||||||
self._body = None
|
|
||||||
self._response = internal_response
|
|
||||||
self._url = url
|
|
||||||
self._connection = connection
|
|
||||||
self._closed = False
|
|
||||||
super().__init__(
|
|
||||||
headers=internal_response.headers,
|
|
||||||
status=internal_response.status_code,
|
|
||||||
request_url=url,
|
|
||||||
version=0,
|
|
||||||
reason="",
|
|
||||||
decode_content=True,
|
|
||||||
)
|
|
||||||
self.length_remaining = self._init_length(self._response.request.method)
|
|
||||||
self.length_is_certain = False
|
|
||||||
|
|
||||||
@property
|
|
||||||
def url(self) -> str | None:
|
|
||||||
return self._url
|
|
||||||
|
|
||||||
@url.setter
|
|
||||||
def url(self, url: str | None) -> None:
|
|
||||||
self._url = url
|
|
||||||
|
|
||||||
@property
|
|
||||||
def connection(self) -> BaseHTTPConnection | BaseHTTPSConnection | None:
|
|
||||||
return self._connection
|
|
||||||
|
|
||||||
@property
|
|
||||||
def retries(self) -> Retry | None:
|
|
||||||
return self._retries
|
|
||||||
|
|
||||||
@retries.setter
|
|
||||||
def retries(self, retries: Retry | None) -> None:
|
|
||||||
# Override the request_url if retries has a redirect location.
|
|
||||||
self._retries = retries
|
|
||||||
|
|
||||||
def stream(
|
|
||||||
self, amt: int | None = 2**16, decode_content: bool | None = None
|
|
||||||
) -> typing.Generator[bytes, None, None]:
|
|
||||||
"""
|
|
||||||
A generator wrapper for the read() method. A call will block until
|
|
||||||
``amt`` bytes have been read from the connection or until the
|
|
||||||
connection is closed.
|
|
||||||
|
|
||||||
:param amt:
|
|
||||||
How much of the content to read. The generator will return up to
|
|
||||||
much data per iteration, but may return less. This is particularly
|
|
||||||
likely when using compressed data. However, the empty string will
|
|
||||||
never be returned.
|
|
||||||
|
|
||||||
:param decode_content:
|
|
||||||
If True, will attempt to decode the body based on the
|
|
||||||
'content-encoding' header.
|
|
||||||
"""
|
|
||||||
while True:
|
|
||||||
data = self.read(amt=amt, decode_content=decode_content)
|
|
||||||
|
|
||||||
if data:
|
|
||||||
yield data
|
|
||||||
else:
|
|
||||||
break
|
|
||||||
|
|
||||||
def _init_length(self, request_method: str | None) -> int | None:
|
|
||||||
length: int | None
|
|
||||||
content_length: str | None = self.headers.get("content-length")
|
|
||||||
|
|
||||||
if content_length is not None:
|
|
||||||
try:
|
|
||||||
# RFC 7230 section 3.3.2 specifies multiple content lengths can
|
|
||||||
# be sent in a single Content-Length header
|
|
||||||
# (e.g. Content-Length: 42, 42). This line ensures the values
|
|
||||||
# are all valid ints and that as long as the `set` length is 1,
|
|
||||||
# all values are the same. Otherwise, the header is invalid.
|
|
||||||
lengths = {int(val) for val in content_length.split(",")}
|
|
||||||
if len(lengths) > 1:
|
|
||||||
raise InvalidHeader(
|
|
||||||
"Content-Length contained multiple "
|
|
||||||
"unmatching values (%s)" % content_length
|
|
||||||
)
|
|
||||||
length = lengths.pop()
|
|
||||||
except ValueError:
|
|
||||||
length = None
|
|
||||||
else:
|
|
||||||
if length < 0:
|
|
||||||
length = None
|
|
||||||
|
|
||||||
else: # if content_length is None
|
|
||||||
length = None
|
|
||||||
|
|
||||||
# Check for responses that shouldn't include a body
|
|
||||||
if (
|
|
||||||
self.status in (204, 304)
|
|
||||||
or 100 <= self.status < 200
|
|
||||||
or request_method == "HEAD"
|
|
||||||
):
|
|
||||||
length = 0
|
|
||||||
|
|
||||||
return length
|
|
||||||
|
|
||||||
def read(
|
|
||||||
self,
|
|
||||||
amt: int | None = None,
|
|
||||||
decode_content: bool | None = None, # ignored because browser decodes always
|
|
||||||
cache_content: bool = False,
|
|
||||||
) -> bytes:
|
|
||||||
if (
|
|
||||||
self._closed
|
|
||||||
or self._response is None
|
|
||||||
or (isinstance(self._response.body, IOBase) and self._response.body.closed)
|
|
||||||
):
|
|
||||||
return b""
|
|
||||||
|
|
||||||
with self._error_catcher():
|
|
||||||
# body has been preloaded as a string by XmlHttpRequest
|
|
||||||
if not isinstance(self._response.body, IOBase):
|
|
||||||
self.length_remaining = len(self._response.body)
|
|
||||||
self.length_is_certain = True
|
|
||||||
# wrap body in IOStream
|
|
||||||
self._response.body = BytesIO(self._response.body)
|
|
||||||
if amt is not None:
|
|
||||||
# don't cache partial content
|
|
||||||
cache_content = False
|
|
||||||
data = self._response.body.read(amt)
|
|
||||||
if self.length_remaining is not None:
|
|
||||||
self.length_remaining = max(self.length_remaining - len(data), 0)
|
|
||||||
if (self.length_is_certain and self.length_remaining == 0) or len(
|
|
||||||
data
|
|
||||||
) < amt:
|
|
||||||
# definitely finished reading, close response stream
|
|
||||||
self._response.body.close()
|
|
||||||
return typing.cast(bytes, data)
|
|
||||||
else: # read all we can (and cache it)
|
|
||||||
data = self._response.body.read()
|
|
||||||
if cache_content:
|
|
||||||
self._body = data
|
|
||||||
if self.length_remaining is not None:
|
|
||||||
self.length_remaining = max(self.length_remaining - len(data), 0)
|
|
||||||
if len(data) == 0 or (
|
|
||||||
self.length_is_certain and self.length_remaining == 0
|
|
||||||
):
|
|
||||||
# definitely finished reading, close response stream
|
|
||||||
self._response.body.close()
|
|
||||||
return typing.cast(bytes, data)
|
|
||||||
|
|
||||||
def read_chunked(
|
|
||||||
self,
|
|
||||||
amt: int | None = None,
|
|
||||||
decode_content: bool | None = None,
|
|
||||||
) -> typing.Generator[bytes, None, None]:
|
|
||||||
# chunked is handled by browser
|
|
||||||
while True:
|
|
||||||
bytes = self.read(amt, decode_content)
|
|
||||||
if not bytes:
|
|
||||||
break
|
|
||||||
yield bytes
|
|
||||||
|
|
||||||
def release_conn(self) -> None:
|
|
||||||
if not self._pool or not self._connection:
|
|
||||||
return None
|
|
||||||
|
|
||||||
self._pool._put_conn(self._connection)
|
|
||||||
self._connection = None
|
|
||||||
|
|
||||||
def drain_conn(self) -> None:
|
|
||||||
self.close()
|
|
||||||
|
|
||||||
@property
|
|
||||||
def data(self) -> bytes:
|
|
||||||
if self._body:
|
|
||||||
return self._body
|
|
||||||
else:
|
|
||||||
return self.read(cache_content=True)
|
|
||||||
|
|
||||||
def json(self) -> typing.Any:
|
|
||||||
"""
|
|
||||||
Parses the body of the HTTP response as JSON.
|
|
||||||
|
|
||||||
To use a custom JSON decoder pass the result of :attr:`HTTPResponse.data` to the decoder.
|
|
||||||
|
|
||||||
This method can raise either `UnicodeDecodeError` or `json.JSONDecodeError`.
|
|
||||||
|
|
||||||
Read more :ref:`here <json>`.
|
|
||||||
"""
|
|
||||||
data = self.data.decode("utf-8")
|
|
||||||
return _json.loads(data)
|
|
||||||
|
|
||||||
def close(self) -> None:
|
|
||||||
if not self._closed:
|
|
||||||
if isinstance(self._response.body, IOBase):
|
|
||||||
self._response.body.close()
|
|
||||||
if self._connection:
|
|
||||||
self._connection.close()
|
|
||||||
self._connection = None
|
|
||||||
self._closed = True
|
|
||||||
|
|
||||||
@contextmanager
|
|
||||||
def _error_catcher(self) -> typing.Generator[None, None, None]:
|
|
||||||
"""
|
|
||||||
Catch Emscripten specific exceptions thrown by fetch.py,
|
|
||||||
instead re-raising urllib3 variants, so that low-level exceptions
|
|
||||||
are not leaked in the high-level api.
|
|
||||||
|
|
||||||
On exit, release the connection back to the pool.
|
|
||||||
"""
|
|
||||||
from .fetch import _RequestError, _TimeoutError # avoid circular import
|
|
||||||
|
|
||||||
clean_exit = False
|
|
||||||
|
|
||||||
try:
|
|
||||||
yield
|
|
||||||
# If no exception is thrown, we should avoid cleaning up
|
|
||||||
# unnecessarily.
|
|
||||||
clean_exit = True
|
|
||||||
except _TimeoutError as e:
|
|
||||||
raise TimeoutError(str(e))
|
|
||||||
except _RequestError as e:
|
|
||||||
raise HTTPException(str(e))
|
|
||||||
finally:
|
|
||||||
# If we didn't terminate cleanly, we need to throw away our
|
|
||||||
# connection.
|
|
||||||
if not clean_exit:
|
|
||||||
# The response may not be closed but we're not going to use it
|
|
||||||
# anymore so close it now
|
|
||||||
if (
|
|
||||||
isinstance(self._response.body, IOBase)
|
|
||||||
and not self._response.body.closed
|
|
||||||
):
|
|
||||||
self._response.body.close()
|
|
||||||
# release the connection back to the pool
|
|
||||||
self.release_conn()
|
|
||||||
else:
|
|
||||||
# If we have read everything from the response stream,
|
|
||||||
# return the connection back to the pool.
|
|
||||||
if (
|
|
||||||
isinstance(self._response.body, IOBase)
|
|
||||||
and self._response.body.closed
|
|
||||||
):
|
|
||||||
self.release_conn()
|
|
||||||
|
|
@ -1,17 +1,17 @@
|
||||||
"""
|
"""
|
||||||
Module for using pyOpenSSL as a TLS backend. This module was relevant before
|
TLS with SNI_-support for Python 2. Follow these instructions if you would
|
||||||
the standard library ``ssl`` module supported SNI, but now that we've dropped
|
like to verify TLS certificates in Python 2. Note, the default libraries do
|
||||||
support for Python 2.7 all relevant Python versions support SNI so
|
*not* do certificate checking; you need to do additional work to validate
|
||||||
**this module is no longer recommended**.
|
certificates yourself.
|
||||||
|
|
||||||
This needs the following packages installed:
|
This needs the following packages installed:
|
||||||
|
|
||||||
* `pyOpenSSL`_ (tested with 16.0.0)
|
* `pyOpenSSL`_ (tested with 16.0.0)
|
||||||
* `cryptography`_ (minimum 1.3.4, from pyopenssl)
|
* `cryptography`_ (minimum 1.3.4, from pyopenssl)
|
||||||
* `idna`_ (minimum 2.0)
|
* `idna`_ (minimum 2.0, from cryptography)
|
||||||
|
|
||||||
However, pyOpenSSL depends on cryptography, so while we use all three directly here we
|
However, pyopenssl depends on cryptography, which depends on idna, so while we
|
||||||
end up having relatively few packages required.
|
use all three directly here we end up having relatively few packages required.
|
||||||
|
|
||||||
You can install them with the following command:
|
You can install them with the following command:
|
||||||
|
|
||||||
|
|
@ -33,46 +33,75 @@ like this:
|
||||||
except ImportError:
|
except ImportError:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
|
Now you can use :mod:`urllib3` as you normally would, and it will support SNI
|
||||||
|
when the required modules are installed.
|
||||||
|
|
||||||
|
Activating this module also has the positive side effect of disabling SSL/TLS
|
||||||
|
compression in Python 2 (see `CRIME attack`_).
|
||||||
|
|
||||||
|
.. _sni: https://en.wikipedia.org/wiki/Server_Name_Indication
|
||||||
|
.. _crime attack: https://en.wikipedia.org/wiki/CRIME_(security_exploit)
|
||||||
.. _pyopenssl: https://www.pyopenssl.org
|
.. _pyopenssl: https://www.pyopenssl.org
|
||||||
.. _cryptography: https://cryptography.io
|
.. _cryptography: https://cryptography.io
|
||||||
.. _idna: https://github.com/kjd/idna
|
.. _idna: https://github.com/kjd/idna
|
||||||
"""
|
"""
|
||||||
|
from __future__ import absolute_import
|
||||||
|
|
||||||
from __future__ import annotations
|
import OpenSSL.crypto
|
||||||
|
import OpenSSL.SSL
|
||||||
import OpenSSL.SSL # type: ignore[import-untyped]
|
|
||||||
from cryptography import x509
|
from cryptography import x509
|
||||||
|
from cryptography.hazmat.backends.openssl import backend as openssl_backend
|
||||||
|
|
||||||
try:
|
try:
|
||||||
from cryptography.x509 import UnsupportedExtension # type: ignore[attr-defined]
|
from cryptography.x509 import UnsupportedExtension
|
||||||
except ImportError:
|
except ImportError:
|
||||||
# UnsupportedExtension is gone in cryptography >= 2.1.0
|
# UnsupportedExtension is gone in cryptography >= 2.1.0
|
||||||
class UnsupportedExtension(Exception): # type: ignore[no-redef]
|
class UnsupportedExtension(Exception):
|
||||||
pass
|
pass
|
||||||
|
|
||||||
|
|
||||||
import logging
|
|
||||||
import ssl
|
|
||||||
import typing
|
|
||||||
from io import BytesIO
|
from io import BytesIO
|
||||||
from socket import socket as socket_cls
|
from socket import error as SocketError
|
||||||
from socket import timeout
|
from socket import timeout
|
||||||
|
|
||||||
|
try: # Platform-specific: Python 2
|
||||||
|
from socket import _fileobject
|
||||||
|
except ImportError: # Platform-specific: Python 3
|
||||||
|
_fileobject = None
|
||||||
|
from ..packages.backports.makefile import backport_makefile
|
||||||
|
|
||||||
|
import logging
|
||||||
|
import ssl
|
||||||
|
import sys
|
||||||
|
import warnings
|
||||||
|
|
||||||
from .. import util
|
from .. import util
|
||||||
|
from ..packages import six
|
||||||
|
from ..util.ssl_ import PROTOCOL_TLS_CLIENT
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
warnings.warn(
|
||||||
from OpenSSL.crypto import X509 # type: ignore[import-untyped]
|
"'urllib3.contrib.pyopenssl' module is deprecated and will be removed "
|
||||||
|
"in a future release of urllib3 2.x. Read more in this issue: "
|
||||||
|
"https://github.com/urllib3/urllib3/issues/2680",
|
||||||
|
category=DeprecationWarning,
|
||||||
|
stacklevel=2,
|
||||||
|
)
|
||||||
|
|
||||||
__all__ = ["inject_into_urllib3", "extract_from_urllib3"]
|
__all__ = ["inject_into_urllib3", "extract_from_urllib3"]
|
||||||
|
|
||||||
|
# SNI always works.
|
||||||
|
HAS_SNI = True
|
||||||
|
|
||||||
# Map from urllib3 to PyOpenSSL compatible parameter-values.
|
# Map from urllib3 to PyOpenSSL compatible parameter-values.
|
||||||
_openssl_versions: dict[int, int] = {
|
_openssl_versions = {
|
||||||
util.ssl_.PROTOCOL_TLS: OpenSSL.SSL.SSLv23_METHOD, # type: ignore[attr-defined]
|
util.PROTOCOL_TLS: OpenSSL.SSL.SSLv23_METHOD,
|
||||||
util.ssl_.PROTOCOL_TLS_CLIENT: OpenSSL.SSL.SSLv23_METHOD, # type: ignore[attr-defined]
|
PROTOCOL_TLS_CLIENT: OpenSSL.SSL.SSLv23_METHOD,
|
||||||
ssl.PROTOCOL_TLSv1: OpenSSL.SSL.TLSv1_METHOD,
|
ssl.PROTOCOL_TLSv1: OpenSSL.SSL.TLSv1_METHOD,
|
||||||
}
|
}
|
||||||
|
|
||||||
|
if hasattr(ssl, "PROTOCOL_SSLv3") and hasattr(OpenSSL.SSL, "SSLv3_METHOD"):
|
||||||
|
_openssl_versions[ssl.PROTOCOL_SSLv3] = OpenSSL.SSL.SSLv3_METHOD
|
||||||
|
|
||||||
if hasattr(ssl, "PROTOCOL_TLSv1_1") and hasattr(OpenSSL.SSL, "TLSv1_1_METHOD"):
|
if hasattr(ssl, "PROTOCOL_TLSv1_1") and hasattr(OpenSSL.SSL, "TLSv1_1_METHOD"):
|
||||||
_openssl_versions[ssl.PROTOCOL_TLSv1_1] = OpenSSL.SSL.TLSv1_1_METHOD
|
_openssl_versions[ssl.PROTOCOL_TLSv1_1] = OpenSSL.SSL.TLSv1_1_METHOD
|
||||||
|
|
||||||
|
|
@ -86,77 +115,43 @@ _stdlib_to_openssl_verify = {
|
||||||
ssl.CERT_REQUIRED: OpenSSL.SSL.VERIFY_PEER
|
ssl.CERT_REQUIRED: OpenSSL.SSL.VERIFY_PEER
|
||||||
+ OpenSSL.SSL.VERIFY_FAIL_IF_NO_PEER_CERT,
|
+ OpenSSL.SSL.VERIFY_FAIL_IF_NO_PEER_CERT,
|
||||||
}
|
}
|
||||||
_openssl_to_stdlib_verify = {v: k for k, v in _stdlib_to_openssl_verify.items()}
|
_openssl_to_stdlib_verify = dict((v, k) for k, v in _stdlib_to_openssl_verify.items())
|
||||||
|
|
||||||
# The SSLvX values are the most likely to be missing in the future
|
|
||||||
# but we check them all just to be sure.
|
|
||||||
_OP_NO_SSLv2_OR_SSLv3: int = getattr(OpenSSL.SSL, "OP_NO_SSLv2", 0) | getattr(
|
|
||||||
OpenSSL.SSL, "OP_NO_SSLv3", 0
|
|
||||||
)
|
|
||||||
_OP_NO_TLSv1: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1", 0)
|
|
||||||
_OP_NO_TLSv1_1: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1_1", 0)
|
|
||||||
_OP_NO_TLSv1_2: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1_2", 0)
|
|
||||||
_OP_NO_TLSv1_3: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1_3", 0)
|
|
||||||
|
|
||||||
_openssl_to_ssl_minimum_version: dict[int, int] = {
|
|
||||||
ssl.TLSVersion.MINIMUM_SUPPORTED: _OP_NO_SSLv2_OR_SSLv3,
|
|
||||||
ssl.TLSVersion.TLSv1: _OP_NO_SSLv2_OR_SSLv3,
|
|
||||||
ssl.TLSVersion.TLSv1_1: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1,
|
|
||||||
ssl.TLSVersion.TLSv1_2: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1 | _OP_NO_TLSv1_1,
|
|
||||||
ssl.TLSVersion.TLSv1_3: (
|
|
||||||
_OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1 | _OP_NO_TLSv1_1 | _OP_NO_TLSv1_2
|
|
||||||
),
|
|
||||||
ssl.TLSVersion.MAXIMUM_SUPPORTED: (
|
|
||||||
_OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1 | _OP_NO_TLSv1_1 | _OP_NO_TLSv1_2
|
|
||||||
),
|
|
||||||
}
|
|
||||||
_openssl_to_ssl_maximum_version: dict[int, int] = {
|
|
||||||
ssl.TLSVersion.MINIMUM_SUPPORTED: (
|
|
||||||
_OP_NO_SSLv2_OR_SSLv3
|
|
||||||
| _OP_NO_TLSv1
|
|
||||||
| _OP_NO_TLSv1_1
|
|
||||||
| _OP_NO_TLSv1_2
|
|
||||||
| _OP_NO_TLSv1_3
|
|
||||||
),
|
|
||||||
ssl.TLSVersion.TLSv1: (
|
|
||||||
_OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1_1 | _OP_NO_TLSv1_2 | _OP_NO_TLSv1_3
|
|
||||||
),
|
|
||||||
ssl.TLSVersion.TLSv1_1: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1_2 | _OP_NO_TLSv1_3,
|
|
||||||
ssl.TLSVersion.TLSv1_2: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1_3,
|
|
||||||
ssl.TLSVersion.TLSv1_3: _OP_NO_SSLv2_OR_SSLv3,
|
|
||||||
ssl.TLSVersion.MAXIMUM_SUPPORTED: _OP_NO_SSLv2_OR_SSLv3,
|
|
||||||
}
|
|
||||||
|
|
||||||
# OpenSSL will only write 16K at a time
|
# OpenSSL will only write 16K at a time
|
||||||
SSL_WRITE_BLOCKSIZE = 16384
|
SSL_WRITE_BLOCKSIZE = 16384
|
||||||
|
|
||||||
|
orig_util_HAS_SNI = util.HAS_SNI
|
||||||
orig_util_SSLContext = util.ssl_.SSLContext
|
orig_util_SSLContext = util.ssl_.SSLContext
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
def inject_into_urllib3() -> None:
|
def inject_into_urllib3():
|
||||||
"Monkey-patch urllib3 with PyOpenSSL-backed SSL-support."
|
"Monkey-patch urllib3 with PyOpenSSL-backed SSL-support."
|
||||||
|
|
||||||
_validate_dependencies_met()
|
_validate_dependencies_met()
|
||||||
|
|
||||||
util.SSLContext = PyOpenSSLContext # type: ignore[assignment]
|
util.SSLContext = PyOpenSSLContext
|
||||||
util.ssl_.SSLContext = PyOpenSSLContext # type: ignore[assignment]
|
util.ssl_.SSLContext = PyOpenSSLContext
|
||||||
|
util.HAS_SNI = HAS_SNI
|
||||||
|
util.ssl_.HAS_SNI = HAS_SNI
|
||||||
util.IS_PYOPENSSL = True
|
util.IS_PYOPENSSL = True
|
||||||
util.ssl_.IS_PYOPENSSL = True
|
util.ssl_.IS_PYOPENSSL = True
|
||||||
|
|
||||||
|
|
||||||
def extract_from_urllib3() -> None:
|
def extract_from_urllib3():
|
||||||
"Undo monkey-patching by :func:`inject_into_urllib3`."
|
"Undo monkey-patching by :func:`inject_into_urllib3`."
|
||||||
|
|
||||||
util.SSLContext = orig_util_SSLContext
|
util.SSLContext = orig_util_SSLContext
|
||||||
util.ssl_.SSLContext = orig_util_SSLContext
|
util.ssl_.SSLContext = orig_util_SSLContext
|
||||||
|
util.HAS_SNI = orig_util_HAS_SNI
|
||||||
|
util.ssl_.HAS_SNI = orig_util_HAS_SNI
|
||||||
util.IS_PYOPENSSL = False
|
util.IS_PYOPENSSL = False
|
||||||
util.ssl_.IS_PYOPENSSL = False
|
util.ssl_.IS_PYOPENSSL = False
|
||||||
|
|
||||||
|
|
||||||
def _validate_dependencies_met() -> None:
|
def _validate_dependencies_met():
|
||||||
"""
|
"""
|
||||||
Verifies that PyOpenSSL's package-level dependencies have been met.
|
Verifies that PyOpenSSL's package-level dependencies have been met.
|
||||||
Throws `ImportError` if they are not met.
|
Throws `ImportError` if they are not met.
|
||||||
|
|
@ -182,7 +177,7 @@ def _validate_dependencies_met() -> None:
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
def _dnsname_to_stdlib(name: str) -> str | None:
|
def _dnsname_to_stdlib(name):
|
||||||
"""
|
"""
|
||||||
Converts a dNSName SubjectAlternativeName field to the form used by the
|
Converts a dNSName SubjectAlternativeName field to the form used by the
|
||||||
standard library on the given Python version.
|
standard library on the given Python version.
|
||||||
|
|
@ -196,7 +191,7 @@ def _dnsname_to_stdlib(name: str) -> str | None:
|
||||||
the name given should be skipped.
|
the name given should be skipped.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def idna_encode(name: str) -> bytes | None:
|
def idna_encode(name):
|
||||||
"""
|
"""
|
||||||
Borrowed wholesale from the Python Cryptography Project. It turns out
|
Borrowed wholesale from the Python Cryptography Project. It turns out
|
||||||
that we can't just safely call `idna.encode`: it can explode for
|
that we can't just safely call `idna.encode`: it can explode for
|
||||||
|
|
@ -205,7 +200,7 @@ def _dnsname_to_stdlib(name: str) -> str | None:
|
||||||
import idna
|
import idna
|
||||||
|
|
||||||
try:
|
try:
|
||||||
for prefix in ["*.", "."]:
|
for prefix in [u"*.", u"."]:
|
||||||
if name.startswith(prefix):
|
if name.startswith(prefix):
|
||||||
name = name[len(prefix) :]
|
name = name[len(prefix) :]
|
||||||
return prefix.encode("ascii") + idna.encode(name)
|
return prefix.encode("ascii") + idna.encode(name)
|
||||||
|
|
@ -217,17 +212,24 @@ def _dnsname_to_stdlib(name: str) -> str | None:
|
||||||
if ":" in name:
|
if ":" in name:
|
||||||
return name
|
return name
|
||||||
|
|
||||||
encoded_name = idna_encode(name)
|
name = idna_encode(name)
|
||||||
if encoded_name is None:
|
if name is None:
|
||||||
return None
|
return None
|
||||||
return encoded_name.decode("utf-8")
|
elif sys.version_info >= (3, 0):
|
||||||
|
name = name.decode("utf-8")
|
||||||
|
return name
|
||||||
|
|
||||||
|
|
||||||
def get_subj_alt_name(peer_cert: X509) -> list[tuple[str, str]]:
|
def get_subj_alt_name(peer_cert):
|
||||||
"""
|
"""
|
||||||
Given an PyOpenSSL certificate, provides all the subject alternative names.
|
Given an PyOpenSSL certificate, provides all the subject alternative names.
|
||||||
"""
|
"""
|
||||||
|
# Pass the cert to cryptography, which has much better APIs for this.
|
||||||
|
if hasattr(peer_cert, "to_cryptography"):
|
||||||
cert = peer_cert.to_cryptography()
|
cert = peer_cert.to_cryptography()
|
||||||
|
else:
|
||||||
|
der = OpenSSL.crypto.dump_certificate(OpenSSL.crypto.FILETYPE_ASN1, peer_cert)
|
||||||
|
cert = x509.load_der_x509_certificate(der, openssl_backend)
|
||||||
|
|
||||||
# We want to find the SAN extension. Ask Cryptography to locate it (it's
|
# We want to find the SAN extension. Ask Cryptography to locate it (it's
|
||||||
# faster than looping in Python)
|
# faster than looping in Python)
|
||||||
|
|
@ -271,94 +273,93 @@ def get_subj_alt_name(peer_cert: X509) -> list[tuple[str, str]]:
|
||||||
return names
|
return names
|
||||||
|
|
||||||
|
|
||||||
class WrappedSocket:
|
class WrappedSocket(object):
|
||||||
"""API-compatibility wrapper for Python OpenSSL's Connection-class."""
|
"""API-compatibility wrapper for Python OpenSSL's Connection-class.
|
||||||
|
|
||||||
def __init__(
|
Note: _makefile_refs, _drop() and _reuse() are needed for the garbage
|
||||||
self,
|
collector of pypy.
|
||||||
connection: OpenSSL.SSL.Connection,
|
"""
|
||||||
socket: socket_cls,
|
|
||||||
suppress_ragged_eofs: bool = True,
|
def __init__(self, connection, socket, suppress_ragged_eofs=True):
|
||||||
) -> None:
|
|
||||||
self.connection = connection
|
self.connection = connection
|
||||||
self.socket = socket
|
self.socket = socket
|
||||||
self.suppress_ragged_eofs = suppress_ragged_eofs
|
self.suppress_ragged_eofs = suppress_ragged_eofs
|
||||||
self._io_refs = 0
|
self._makefile_refs = 0
|
||||||
self._closed = False
|
self._closed = False
|
||||||
|
|
||||||
def fileno(self) -> int:
|
def fileno(self):
|
||||||
return self.socket.fileno()
|
return self.socket.fileno()
|
||||||
|
|
||||||
# Copy-pasted from Python 3.5 source code
|
# Copy-pasted from Python 3.5 source code
|
||||||
def _decref_socketios(self) -> None:
|
def _decref_socketios(self):
|
||||||
if self._io_refs > 0:
|
if self._makefile_refs > 0:
|
||||||
self._io_refs -= 1
|
self._makefile_refs -= 1
|
||||||
if self._closed:
|
if self._closed:
|
||||||
self.close()
|
self.close()
|
||||||
|
|
||||||
def recv(self, *args: typing.Any, **kwargs: typing.Any) -> bytes:
|
def recv(self, *args, **kwargs):
|
||||||
try:
|
try:
|
||||||
data = self.connection.recv(*args, **kwargs)
|
data = self.connection.recv(*args, **kwargs)
|
||||||
except OpenSSL.SSL.SysCallError as e:
|
except OpenSSL.SSL.SysCallError as e:
|
||||||
if self.suppress_ragged_eofs and e.args == (-1, "Unexpected EOF"):
|
if self.suppress_ragged_eofs and e.args == (-1, "Unexpected EOF"):
|
||||||
return b""
|
return b""
|
||||||
else:
|
else:
|
||||||
raise OSError(e.args[0], str(e)) from e
|
raise SocketError(str(e))
|
||||||
except OpenSSL.SSL.ZeroReturnError:
|
except OpenSSL.SSL.ZeroReturnError:
|
||||||
if self.connection.get_shutdown() == OpenSSL.SSL.RECEIVED_SHUTDOWN:
|
if self.connection.get_shutdown() == OpenSSL.SSL.RECEIVED_SHUTDOWN:
|
||||||
return b""
|
return b""
|
||||||
else:
|
else:
|
||||||
raise
|
raise
|
||||||
except OpenSSL.SSL.WantReadError as e:
|
except OpenSSL.SSL.WantReadError:
|
||||||
if not util.wait_for_read(self.socket, self.socket.gettimeout()):
|
if not util.wait_for_read(self.socket, self.socket.gettimeout()):
|
||||||
raise timeout("The read operation timed out") from e
|
raise timeout("The read operation timed out")
|
||||||
else:
|
else:
|
||||||
return self.recv(*args, **kwargs)
|
return self.recv(*args, **kwargs)
|
||||||
|
|
||||||
# TLS 1.3 post-handshake authentication
|
# TLS 1.3 post-handshake authentication
|
||||||
except OpenSSL.SSL.Error as e:
|
except OpenSSL.SSL.Error as e:
|
||||||
raise ssl.SSLError(f"read error: {e!r}") from e
|
raise ssl.SSLError("read error: %r" % e)
|
||||||
else:
|
else:
|
||||||
return data # type: ignore[no-any-return]
|
return data
|
||||||
|
|
||||||
def recv_into(self, *args: typing.Any, **kwargs: typing.Any) -> int:
|
def recv_into(self, *args, **kwargs):
|
||||||
try:
|
try:
|
||||||
return self.connection.recv_into(*args, **kwargs) # type: ignore[no-any-return]
|
return self.connection.recv_into(*args, **kwargs)
|
||||||
except OpenSSL.SSL.SysCallError as e:
|
except OpenSSL.SSL.SysCallError as e:
|
||||||
if self.suppress_ragged_eofs and e.args == (-1, "Unexpected EOF"):
|
if self.suppress_ragged_eofs and e.args == (-1, "Unexpected EOF"):
|
||||||
return 0
|
return 0
|
||||||
else:
|
else:
|
||||||
raise OSError(e.args[0], str(e)) from e
|
raise SocketError(str(e))
|
||||||
except OpenSSL.SSL.ZeroReturnError:
|
except OpenSSL.SSL.ZeroReturnError:
|
||||||
if self.connection.get_shutdown() == OpenSSL.SSL.RECEIVED_SHUTDOWN:
|
if self.connection.get_shutdown() == OpenSSL.SSL.RECEIVED_SHUTDOWN:
|
||||||
return 0
|
return 0
|
||||||
else:
|
else:
|
||||||
raise
|
raise
|
||||||
except OpenSSL.SSL.WantReadError as e:
|
except OpenSSL.SSL.WantReadError:
|
||||||
if not util.wait_for_read(self.socket, self.socket.gettimeout()):
|
if not util.wait_for_read(self.socket, self.socket.gettimeout()):
|
||||||
raise timeout("The read operation timed out") from e
|
raise timeout("The read operation timed out")
|
||||||
else:
|
else:
|
||||||
return self.recv_into(*args, **kwargs)
|
return self.recv_into(*args, **kwargs)
|
||||||
|
|
||||||
# TLS 1.3 post-handshake authentication
|
# TLS 1.3 post-handshake authentication
|
||||||
except OpenSSL.SSL.Error as e:
|
except OpenSSL.SSL.Error as e:
|
||||||
raise ssl.SSLError(f"read error: {e!r}") from e
|
raise ssl.SSLError("read error: %r" % e)
|
||||||
|
|
||||||
def settimeout(self, timeout: float) -> None:
|
def settimeout(self, timeout):
|
||||||
return self.socket.settimeout(timeout)
|
return self.socket.settimeout(timeout)
|
||||||
|
|
||||||
def _send_until_done(self, data: bytes) -> int:
|
def _send_until_done(self, data):
|
||||||
while True:
|
while True:
|
||||||
try:
|
try:
|
||||||
return self.connection.send(data) # type: ignore[no-any-return]
|
return self.connection.send(data)
|
||||||
except OpenSSL.SSL.WantWriteError as e:
|
except OpenSSL.SSL.WantWriteError:
|
||||||
if not util.wait_for_write(self.socket, self.socket.gettimeout()):
|
if not util.wait_for_write(self.socket, self.socket.gettimeout()):
|
||||||
raise timeout() from e
|
raise timeout()
|
||||||
continue
|
continue
|
||||||
except OpenSSL.SSL.SysCallError as e:
|
except OpenSSL.SSL.SysCallError as e:
|
||||||
raise OSError(e.args[0], str(e)) from e
|
raise SocketError(str(e))
|
||||||
|
|
||||||
def sendall(self, data: bytes) -> None:
|
def sendall(self, data):
|
||||||
total_sent = 0
|
total_sent = 0
|
||||||
while total_sent < len(data):
|
while total_sent < len(data):
|
||||||
sent = self._send_until_done(
|
sent = self._send_until_done(
|
||||||
|
|
@ -366,135 +367,135 @@ class WrappedSocket:
|
||||||
)
|
)
|
||||||
total_sent += sent
|
total_sent += sent
|
||||||
|
|
||||||
def shutdown(self) -> None:
|
def shutdown(self):
|
||||||
# FIXME rethrow compatible exceptions should we ever use this
|
# FIXME rethrow compatible exceptions should we ever use this
|
||||||
self.connection.shutdown()
|
self.connection.shutdown()
|
||||||
|
|
||||||
def close(self) -> None:
|
def close(self):
|
||||||
self._closed = True
|
if self._makefile_refs < 1:
|
||||||
if self._io_refs <= 0:
|
|
||||||
self._real_close()
|
|
||||||
|
|
||||||
def _real_close(self) -> None:
|
|
||||||
try:
|
try:
|
||||||
return self.connection.close() # type: ignore[no-any-return]
|
self._closed = True
|
||||||
|
return self.connection.close()
|
||||||
except OpenSSL.SSL.Error:
|
except OpenSSL.SSL.Error:
|
||||||
return
|
return
|
||||||
|
else:
|
||||||
|
self._makefile_refs -= 1
|
||||||
|
|
||||||
def getpeercert(
|
def getpeercert(self, binary_form=False):
|
||||||
self, binary_form: bool = False
|
|
||||||
) -> dict[str, list[typing.Any]] | None:
|
|
||||||
x509 = self.connection.get_peer_certificate()
|
x509 = self.connection.get_peer_certificate()
|
||||||
|
|
||||||
if not x509:
|
if not x509:
|
||||||
return x509 # type: ignore[no-any-return]
|
return x509
|
||||||
|
|
||||||
if binary_form:
|
if binary_form:
|
||||||
return OpenSSL.crypto.dump_certificate(OpenSSL.crypto.FILETYPE_ASN1, x509) # type: ignore[no-any-return]
|
return OpenSSL.crypto.dump_certificate(OpenSSL.crypto.FILETYPE_ASN1, x509)
|
||||||
|
|
||||||
return {
|
return {
|
||||||
"subject": ((("commonName", x509.get_subject().CN),),), # type: ignore[dict-item]
|
"subject": ((("commonName", x509.get_subject().CN),),),
|
||||||
"subjectAltName": get_subj_alt_name(x509),
|
"subjectAltName": get_subj_alt_name(x509),
|
||||||
}
|
}
|
||||||
|
|
||||||
def version(self) -> str:
|
def version(self):
|
||||||
return self.connection.get_protocol_version_name() # type: ignore[no-any-return]
|
return self.connection.get_protocol_version_name()
|
||||||
|
|
||||||
|
def _reuse(self):
|
||||||
|
self._makefile_refs += 1
|
||||||
|
|
||||||
|
def _drop(self):
|
||||||
|
if self._makefile_refs < 1:
|
||||||
|
self.close()
|
||||||
|
else:
|
||||||
|
self._makefile_refs -= 1
|
||||||
|
|
||||||
|
|
||||||
WrappedSocket.makefile = socket_cls.makefile # type: ignore[attr-defined]
|
if _fileobject: # Platform-specific: Python 2
|
||||||
|
|
||||||
|
def makefile(self, mode, bufsize=-1):
|
||||||
|
self._makefile_refs += 1
|
||||||
|
return _fileobject(self, mode, bufsize, close=True)
|
||||||
|
|
||||||
|
else: # Platform-specific: Python 3
|
||||||
|
makefile = backport_makefile
|
||||||
|
|
||||||
|
WrappedSocket.makefile = makefile
|
||||||
|
|
||||||
|
|
||||||
class PyOpenSSLContext:
|
class PyOpenSSLContext(object):
|
||||||
"""
|
"""
|
||||||
I am a wrapper class for the PyOpenSSL ``Context`` object. I am responsible
|
I am a wrapper class for the PyOpenSSL ``Context`` object. I am responsible
|
||||||
for translating the interface of the standard library ``SSLContext`` object
|
for translating the interface of the standard library ``SSLContext`` object
|
||||||
to calls into PyOpenSSL.
|
to calls into PyOpenSSL.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, protocol: int) -> None:
|
def __init__(self, protocol):
|
||||||
self.protocol = _openssl_versions[protocol]
|
self.protocol = _openssl_versions[protocol]
|
||||||
self._ctx = OpenSSL.SSL.Context(self.protocol)
|
self._ctx = OpenSSL.SSL.Context(self.protocol)
|
||||||
self._options = 0
|
self._options = 0
|
||||||
self.check_hostname = False
|
self.check_hostname = False
|
||||||
self._minimum_version: int = ssl.TLSVersion.MINIMUM_SUPPORTED
|
|
||||||
self._maximum_version: int = ssl.TLSVersion.MAXIMUM_SUPPORTED
|
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def options(self) -> int:
|
def options(self):
|
||||||
return self._options
|
return self._options
|
||||||
|
|
||||||
@options.setter
|
@options.setter
|
||||||
def options(self, value: int) -> None:
|
def options(self, value):
|
||||||
self._options = value
|
self._options = value
|
||||||
self._set_ctx_options()
|
self._ctx.set_options(value)
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def verify_mode(self) -> int:
|
def verify_mode(self):
|
||||||
return _openssl_to_stdlib_verify[self._ctx.get_verify_mode()]
|
return _openssl_to_stdlib_verify[self._ctx.get_verify_mode()]
|
||||||
|
|
||||||
@verify_mode.setter
|
@verify_mode.setter
|
||||||
def verify_mode(self, value: ssl.VerifyMode) -> None:
|
def verify_mode(self, value):
|
||||||
self._ctx.set_verify(_stdlib_to_openssl_verify[value], _verify_callback)
|
self._ctx.set_verify(_stdlib_to_openssl_verify[value], _verify_callback)
|
||||||
|
|
||||||
def set_default_verify_paths(self) -> None:
|
def set_default_verify_paths(self):
|
||||||
self._ctx.set_default_verify_paths()
|
self._ctx.set_default_verify_paths()
|
||||||
|
|
||||||
def set_ciphers(self, ciphers: bytes | str) -> None:
|
def set_ciphers(self, ciphers):
|
||||||
if isinstance(ciphers, str):
|
if isinstance(ciphers, six.text_type):
|
||||||
ciphers = ciphers.encode("utf-8")
|
ciphers = ciphers.encode("utf-8")
|
||||||
self._ctx.set_cipher_list(ciphers)
|
self._ctx.set_cipher_list(ciphers)
|
||||||
|
|
||||||
def load_verify_locations(
|
def load_verify_locations(self, cafile=None, capath=None, cadata=None):
|
||||||
self,
|
|
||||||
cafile: str | None = None,
|
|
||||||
capath: str | None = None,
|
|
||||||
cadata: bytes | None = None,
|
|
||||||
) -> None:
|
|
||||||
if cafile is not None:
|
if cafile is not None:
|
||||||
cafile = cafile.encode("utf-8") # type: ignore[assignment]
|
cafile = cafile.encode("utf-8")
|
||||||
if capath is not None:
|
if capath is not None:
|
||||||
capath = capath.encode("utf-8") # type: ignore[assignment]
|
capath = capath.encode("utf-8")
|
||||||
try:
|
try:
|
||||||
self._ctx.load_verify_locations(cafile, capath)
|
self._ctx.load_verify_locations(cafile, capath)
|
||||||
if cadata is not None:
|
if cadata is not None:
|
||||||
self._ctx.load_verify_locations(BytesIO(cadata))
|
self._ctx.load_verify_locations(BytesIO(cadata))
|
||||||
except OpenSSL.SSL.Error as e:
|
except OpenSSL.SSL.Error as e:
|
||||||
raise ssl.SSLError(f"unable to load trusted certificates: {e!r}") from e
|
raise ssl.SSLError("unable to load trusted certificates: %r" % e)
|
||||||
|
|
||||||
def load_cert_chain(
|
def load_cert_chain(self, certfile, keyfile=None, password=None):
|
||||||
self,
|
|
||||||
certfile: str,
|
|
||||||
keyfile: str | None = None,
|
|
||||||
password: str | None = None,
|
|
||||||
) -> None:
|
|
||||||
try:
|
|
||||||
self._ctx.use_certificate_chain_file(certfile)
|
self._ctx.use_certificate_chain_file(certfile)
|
||||||
if password is not None:
|
if password is not None:
|
||||||
if not isinstance(password, bytes):
|
if not isinstance(password, six.binary_type):
|
||||||
password = password.encode("utf-8") # type: ignore[assignment]
|
password = password.encode("utf-8")
|
||||||
self._ctx.set_passwd_cb(lambda *_: password)
|
self._ctx.set_passwd_cb(lambda *_: password)
|
||||||
self._ctx.use_privatekey_file(keyfile or certfile)
|
self._ctx.use_privatekey_file(keyfile or certfile)
|
||||||
except OpenSSL.SSL.Error as e:
|
|
||||||
raise ssl.SSLError(f"Unable to load certificate chain: {e!r}") from e
|
|
||||||
|
|
||||||
def set_alpn_protocols(self, protocols: list[bytes | str]) -> None:
|
def set_alpn_protocols(self, protocols):
|
||||||
protocols = [util.util.to_bytes(p, "ascii") for p in protocols]
|
protocols = [six.ensure_binary(p) for p in protocols]
|
||||||
return self._ctx.set_alpn_protos(protocols) # type: ignore[no-any-return]
|
return self._ctx.set_alpn_protos(protocols)
|
||||||
|
|
||||||
def wrap_socket(
|
def wrap_socket(
|
||||||
self,
|
self,
|
||||||
sock: socket_cls,
|
sock,
|
||||||
server_side: bool = False,
|
server_side=False,
|
||||||
do_handshake_on_connect: bool = True,
|
do_handshake_on_connect=True,
|
||||||
suppress_ragged_eofs: bool = True,
|
suppress_ragged_eofs=True,
|
||||||
server_hostname: bytes | str | None = None,
|
server_hostname=None,
|
||||||
) -> WrappedSocket:
|
):
|
||||||
cnx = OpenSSL.SSL.Connection(self._ctx, sock)
|
cnx = OpenSSL.SSL.Connection(self._ctx, sock)
|
||||||
|
|
||||||
# If server_hostname is an IP, don't use it for SNI, per RFC6066 Section 3
|
if isinstance(server_hostname, six.text_type): # Platform-specific: Python 3
|
||||||
if server_hostname and not util.ssl_.is_ipaddress(server_hostname):
|
|
||||||
if isinstance(server_hostname, str):
|
|
||||||
server_hostname = server_hostname.encode("utf-8")
|
server_hostname = server_hostname.encode("utf-8")
|
||||||
|
|
||||||
|
if server_hostname is not None:
|
||||||
cnx.set_tlsext_host_name(server_hostname)
|
cnx.set_tlsext_host_name(server_hostname)
|
||||||
|
|
||||||
cnx.set_connect_state()
|
cnx.set_connect_state()
|
||||||
|
|
@ -502,47 +503,16 @@ class PyOpenSSLContext:
|
||||||
while True:
|
while True:
|
||||||
try:
|
try:
|
||||||
cnx.do_handshake()
|
cnx.do_handshake()
|
||||||
except OpenSSL.SSL.WantReadError as e:
|
except OpenSSL.SSL.WantReadError:
|
||||||
if not util.wait_for_read(sock, sock.gettimeout()):
|
if not util.wait_for_read(sock, sock.gettimeout()):
|
||||||
raise timeout("select timed out") from e
|
raise timeout("select timed out")
|
||||||
continue
|
continue
|
||||||
except OpenSSL.SSL.Error as e:
|
except OpenSSL.SSL.Error as e:
|
||||||
raise ssl.SSLError(f"bad handshake: {e!r}") from e
|
raise ssl.SSLError("bad handshake: %r" % e)
|
||||||
break
|
break
|
||||||
|
|
||||||
return WrappedSocket(cnx, sock)
|
return WrappedSocket(cnx, sock)
|
||||||
|
|
||||||
def _set_ctx_options(self) -> None:
|
|
||||||
self._ctx.set_options(
|
|
||||||
self._options
|
|
||||||
| _openssl_to_ssl_minimum_version[self._minimum_version]
|
|
||||||
| _openssl_to_ssl_maximum_version[self._maximum_version]
|
|
||||||
)
|
|
||||||
|
|
||||||
@property
|
def _verify_callback(cnx, x509, err_no, err_depth, return_code):
|
||||||
def minimum_version(self) -> int:
|
|
||||||
return self._minimum_version
|
|
||||||
|
|
||||||
@minimum_version.setter
|
|
||||||
def minimum_version(self, minimum_version: int) -> None:
|
|
||||||
self._minimum_version = minimum_version
|
|
||||||
self._set_ctx_options()
|
|
||||||
|
|
||||||
@property
|
|
||||||
def maximum_version(self) -> int:
|
|
||||||
return self._maximum_version
|
|
||||||
|
|
||||||
@maximum_version.setter
|
|
||||||
def maximum_version(self, maximum_version: int) -> None:
|
|
||||||
self._maximum_version = maximum_version
|
|
||||||
self._set_ctx_options()
|
|
||||||
|
|
||||||
|
|
||||||
def _verify_callback(
|
|
||||||
cnx: OpenSSL.SSL.Connection,
|
|
||||||
x509: X509,
|
|
||||||
err_no: int,
|
|
||||||
err_depth: int,
|
|
||||||
return_code: int,
|
|
||||||
) -> bool:
|
|
||||||
return err_no == 0
|
return err_no == 0
|
||||||
|
|
|
||||||
|
|
@ -1,3 +1,4 @@
|
||||||
|
# -*- coding: utf-8 -*-
|
||||||
"""
|
"""
|
||||||
This module contains provisional support for SOCKS proxies from within
|
This module contains provisional support for SOCKS proxies from within
|
||||||
urllib3. This module supports SOCKS4, SOCKS4A (an extension of SOCKS4), and
|
urllib3. This module supports SOCKS4, SOCKS4A (an extension of SOCKS4), and
|
||||||
|
|
@ -37,11 +38,10 @@ with the proxy:
|
||||||
proxy_url="socks5h://<username>:<password>@proxy-host"
|
proxy_url="socks5h://<username>:<password>@proxy-host"
|
||||||
|
|
||||||
"""
|
"""
|
||||||
|
from __future__ import absolute_import
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
try:
|
try:
|
||||||
import socks # type: ignore[import-not-found]
|
import socks
|
||||||
except ImportError:
|
except ImportError:
|
||||||
import warnings
|
import warnings
|
||||||
|
|
||||||
|
|
@ -51,13 +51,13 @@ except ImportError:
|
||||||
(
|
(
|
||||||
"SOCKS support in urllib3 requires the installation of optional "
|
"SOCKS support in urllib3 requires the installation of optional "
|
||||||
"dependencies: specifically, PySocks. For more information, see "
|
"dependencies: specifically, PySocks. For more information, see "
|
||||||
"https://urllib3.readthedocs.io/en/latest/advanced-usage.html#socks-proxies"
|
"https://urllib3.readthedocs.io/en/1.26.x/contrib.html#socks-proxies"
|
||||||
),
|
),
|
||||||
DependencyWarning,
|
DependencyWarning,
|
||||||
)
|
)
|
||||||
raise
|
raise
|
||||||
|
|
||||||
import typing
|
from socket import error as SocketError
|
||||||
from socket import timeout as SocketTimeout
|
from socket import timeout as SocketTimeout
|
||||||
|
|
||||||
from ..connection import HTTPConnection, HTTPSConnection
|
from ..connection import HTTPConnection, HTTPSConnection
|
||||||
|
|
@ -69,18 +69,7 @@ from ..util.url import parse_url
|
||||||
try:
|
try:
|
||||||
import ssl
|
import ssl
|
||||||
except ImportError:
|
except ImportError:
|
||||||
ssl = None # type: ignore[assignment]
|
ssl = None
|
||||||
|
|
||||||
from typing import TypedDict
|
|
||||||
|
|
||||||
|
|
||||||
class _TYPE_SOCKS_OPTIONS(TypedDict):
|
|
||||||
socks_version: int
|
|
||||||
proxy_host: str | None
|
|
||||||
proxy_port: str | None
|
|
||||||
username: str | None
|
|
||||||
password: str | None
|
|
||||||
rdns: bool
|
|
||||||
|
|
||||||
|
|
||||||
class SOCKSConnection(HTTPConnection):
|
class SOCKSConnection(HTTPConnection):
|
||||||
|
|
@ -88,20 +77,15 @@ class SOCKSConnection(HTTPConnection):
|
||||||
A plain-text HTTP connection that connects via a SOCKS proxy.
|
A plain-text HTTP connection that connects via a SOCKS proxy.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(
|
def __init__(self, *args, **kwargs):
|
||||||
self,
|
self._socks_options = kwargs.pop("_socks_options")
|
||||||
_socks_options: _TYPE_SOCKS_OPTIONS,
|
super(SOCKSConnection, self).__init__(*args, **kwargs)
|
||||||
*args: typing.Any,
|
|
||||||
**kwargs: typing.Any,
|
|
||||||
) -> None:
|
|
||||||
self._socks_options = _socks_options
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
|
|
||||||
def _new_conn(self) -> socks.socksocket:
|
def _new_conn(self):
|
||||||
"""
|
"""
|
||||||
Establish a new connection via the SOCKS proxy.
|
Establish a new connection via the SOCKS proxy.
|
||||||
"""
|
"""
|
||||||
extra_kw: dict[str, typing.Any] = {}
|
extra_kw = {}
|
||||||
if self.source_address:
|
if self.source_address:
|
||||||
extra_kw["source_address"] = self.source_address
|
extra_kw["source_address"] = self.source_address
|
||||||
|
|
||||||
|
|
@ -118,14 +102,15 @@ class SOCKSConnection(HTTPConnection):
|
||||||
proxy_password=self._socks_options["password"],
|
proxy_password=self._socks_options["password"],
|
||||||
proxy_rdns=self._socks_options["rdns"],
|
proxy_rdns=self._socks_options["rdns"],
|
||||||
timeout=self.timeout,
|
timeout=self.timeout,
|
||||||
**extra_kw,
|
**extra_kw
|
||||||
)
|
)
|
||||||
|
|
||||||
except SocketTimeout as e:
|
except SocketTimeout:
|
||||||
raise ConnectTimeoutError(
|
raise ConnectTimeoutError(
|
||||||
self,
|
self,
|
||||||
f"Connection to {self.host} timed out. (connect timeout={self.timeout})",
|
"Connection to %s timed out. (connect timeout=%s)"
|
||||||
) from e
|
% (self.host, self.timeout),
|
||||||
|
)
|
||||||
|
|
||||||
except socks.ProxyError as e:
|
except socks.ProxyError as e:
|
||||||
# This is fragile as hell, but it seems to be the only way to raise
|
# This is fragile as hell, but it seems to be the only way to raise
|
||||||
|
|
@ -135,23 +120,22 @@ class SOCKSConnection(HTTPConnection):
|
||||||
if isinstance(error, SocketTimeout):
|
if isinstance(error, SocketTimeout):
|
||||||
raise ConnectTimeoutError(
|
raise ConnectTimeoutError(
|
||||||
self,
|
self,
|
||||||
f"Connection to {self.host} timed out. (connect timeout={self.timeout})",
|
"Connection to %s timed out. (connect timeout=%s)"
|
||||||
) from e
|
% (self.host, self.timeout),
|
||||||
else:
|
|
||||||
# Adding `from e` messes with coverage somehow, so it's omitted.
|
|
||||||
# See #2386.
|
|
||||||
raise NewConnectionError(
|
|
||||||
self, f"Failed to establish a new connection: {error}"
|
|
||||||
)
|
)
|
||||||
else:
|
else:
|
||||||
raise NewConnectionError(
|
raise NewConnectionError(
|
||||||
self, f"Failed to establish a new connection: {e}"
|
self, "Failed to establish a new connection: %s" % error
|
||||||
) from e
|
)
|
||||||
|
else:
|
||||||
except OSError as e: # Defensive: PySocks should catch all these.
|
|
||||||
raise NewConnectionError(
|
raise NewConnectionError(
|
||||||
self, f"Failed to establish a new connection: {e}"
|
self, "Failed to establish a new connection: %s" % e
|
||||||
) from e
|
)
|
||||||
|
|
||||||
|
except SocketError as e: # Defensive: PySocks should catch all these.
|
||||||
|
raise NewConnectionError(
|
||||||
|
self, "Failed to establish a new connection: %s" % e
|
||||||
|
)
|
||||||
|
|
||||||
return conn
|
return conn
|
||||||
|
|
||||||
|
|
@ -185,12 +169,12 @@ class SOCKSProxyManager(PoolManager):
|
||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
proxy_url: str,
|
proxy_url,
|
||||||
username: str | None = None,
|
username=None,
|
||||||
password: str | None = None,
|
password=None,
|
||||||
num_pools: int = 10,
|
num_pools=10,
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
headers=None,
|
||||||
**connection_pool_kw: typing.Any,
|
**connection_pool_kw
|
||||||
):
|
):
|
||||||
parsed = parse_url(proxy_url)
|
parsed = parse_url(proxy_url)
|
||||||
|
|
||||||
|
|
@ -211,7 +195,7 @@ class SOCKSProxyManager(PoolManager):
|
||||||
socks_version = socks.PROXY_TYPE_SOCKS4
|
socks_version = socks.PROXY_TYPE_SOCKS4
|
||||||
rdns = True
|
rdns = True
|
||||||
else:
|
else:
|
||||||
raise ValueError(f"Unable to determine SOCKS version from {proxy_url}")
|
raise ValueError("Unable to determine SOCKS version from %s" % proxy_url)
|
||||||
|
|
||||||
self.proxy_url = proxy_url
|
self.proxy_url = proxy_url
|
||||||
|
|
||||||
|
|
@ -225,6 +209,8 @@ class SOCKSProxyManager(PoolManager):
|
||||||
}
|
}
|
||||||
connection_pool_kw["_socks_options"] = socks_options
|
connection_pool_kw["_socks_options"] = socks_options
|
||||||
|
|
||||||
super().__init__(num_pools, headers, **connection_pool_kw)
|
super(SOCKSProxyManager, self).__init__(
|
||||||
|
num_pools, headers, **connection_pool_kw
|
||||||
|
)
|
||||||
|
|
||||||
self.pool_classes_by_scheme = SOCKSProxyManager.pool_classes_by_scheme
|
self.pool_classes_by_scheme = SOCKSProxyManager.pool_classes_by_scheme
|
||||||
|
|
|
||||||
|
|
@ -1,16 +1,6 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import socket
|
from .packages.six.moves.http_client import IncompleteRead as httplib_IncompleteRead
|
||||||
import typing
|
|
||||||
import warnings
|
|
||||||
from email.errors import MessageDefect
|
|
||||||
from http.client import IncompleteRead as httplib_IncompleteRead
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
from .connection import HTTPConnection
|
|
||||||
from .connectionpool import ConnectionPool
|
|
||||||
from .response import HTTPResponse
|
|
||||||
from .util.retry import Retry
|
|
||||||
|
|
||||||
# Base Exceptions
|
# Base Exceptions
|
||||||
|
|
||||||
|
|
@ -18,24 +8,23 @@ if typing.TYPE_CHECKING:
|
||||||
class HTTPError(Exception):
|
class HTTPError(Exception):
|
||||||
"""Base exception used by this module."""
|
"""Base exception used by this module."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class HTTPWarning(Warning):
|
class HTTPWarning(Warning):
|
||||||
"""Base warning used by this module."""
|
"""Base warning used by this module."""
|
||||||
|
|
||||||
|
pass
|
||||||
_TYPE_REDUCE_RESULT = typing.Tuple[
|
|
||||||
typing.Callable[..., object], typing.Tuple[object, ...]
|
|
||||||
]
|
|
||||||
|
|
||||||
|
|
||||||
class PoolError(HTTPError):
|
class PoolError(HTTPError):
|
||||||
"""Base exception for errors caused within a pool."""
|
"""Base exception for errors caused within a pool."""
|
||||||
|
|
||||||
def __init__(self, pool: ConnectionPool, message: str) -> None:
|
def __init__(self, pool, message):
|
||||||
self.pool = pool
|
self.pool = pool
|
||||||
super().__init__(f"{pool}: {message}")
|
HTTPError.__init__(self, "%s: %s" % (pool, message))
|
||||||
|
|
||||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
def __reduce__(self):
|
||||||
# For pickling purposes.
|
# For pickling purposes.
|
||||||
return self.__class__, (None, None)
|
return self.__class__, (None, None)
|
||||||
|
|
||||||
|
|
@ -43,11 +32,11 @@ class PoolError(HTTPError):
|
||||||
class RequestError(PoolError):
|
class RequestError(PoolError):
|
||||||
"""Base exception for PoolErrors that have associated URLs."""
|
"""Base exception for PoolErrors that have associated URLs."""
|
||||||
|
|
||||||
def __init__(self, pool: ConnectionPool, url: str, message: str) -> None:
|
def __init__(self, pool, url, message):
|
||||||
self.url = url
|
self.url = url
|
||||||
super().__init__(pool, message)
|
PoolError.__init__(self, pool, message)
|
||||||
|
|
||||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
def __reduce__(self):
|
||||||
# For pickling purposes.
|
# For pickling purposes.
|
||||||
return self.__class__, (None, self.url, None)
|
return self.__class__, (None, self.url, None)
|
||||||
|
|
||||||
|
|
@ -55,25 +44,28 @@ class RequestError(PoolError):
|
||||||
class SSLError(HTTPError):
|
class SSLError(HTTPError):
|
||||||
"""Raised when SSL certificate fails in an HTTPS connection."""
|
"""Raised when SSL certificate fails in an HTTPS connection."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class ProxyError(HTTPError):
|
class ProxyError(HTTPError):
|
||||||
"""Raised when the connection to a proxy fails."""
|
"""Raised when the connection to a proxy fails."""
|
||||||
|
|
||||||
# The original error is also available as __cause__.
|
def __init__(self, message, error, *args):
|
||||||
original_error: Exception
|
super(ProxyError, self).__init__(message, error, *args)
|
||||||
|
|
||||||
def __init__(self, message: str, error: Exception) -> None:
|
|
||||||
super().__init__(message, error)
|
|
||||||
self.original_error = error
|
self.original_error = error
|
||||||
|
|
||||||
|
|
||||||
class DecodeError(HTTPError):
|
class DecodeError(HTTPError):
|
||||||
"""Raised when automatic decoding based on Content-Type fails."""
|
"""Raised when automatic decoding based on Content-Type fails."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class ProtocolError(HTTPError):
|
class ProtocolError(HTTPError):
|
||||||
"""Raised when something unexpected happens mid-request/response."""
|
"""Raised when something unexpected happens mid-request/response."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
#: Renamed to ProtocolError but aliased for backwards compatibility.
|
#: Renamed to ProtocolError but aliased for backwards compatibility.
|
||||||
ConnectionError = ProtocolError
|
ConnectionError = ProtocolError
|
||||||
|
|
@ -87,36 +79,33 @@ class MaxRetryError(RequestError):
|
||||||
|
|
||||||
:param pool: The connection pool
|
:param pool: The connection pool
|
||||||
:type pool: :class:`~urllib3.connectionpool.HTTPConnectionPool`
|
:type pool: :class:`~urllib3.connectionpool.HTTPConnectionPool`
|
||||||
:param str url: The requested Url
|
:param string url: The requested Url
|
||||||
:param reason: The underlying error
|
:param exceptions.Exception reason: The underlying error
|
||||||
:type reason: :class:`Exception`
|
|
||||||
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(
|
def __init__(self, pool, url, reason=None):
|
||||||
self, pool: ConnectionPool, url: str, reason: Exception | None = None
|
|
||||||
) -> None:
|
|
||||||
self.reason = reason
|
self.reason = reason
|
||||||
|
|
||||||
message = f"Max retries exceeded with url: {url} (Caused by {reason!r})"
|
message = "Max retries exceeded with url: %s (Caused by %r)" % (url, reason)
|
||||||
|
|
||||||
super().__init__(pool, url, message)
|
RequestError.__init__(self, pool, url, message)
|
||||||
|
|
||||||
|
|
||||||
class HostChangedError(RequestError):
|
class HostChangedError(RequestError):
|
||||||
"""Raised when an existing pool gets a request for a foreign host."""
|
"""Raised when an existing pool gets a request for a foreign host."""
|
||||||
|
|
||||||
def __init__(
|
def __init__(self, pool, url, retries=3):
|
||||||
self, pool: ConnectionPool, url: str, retries: Retry | int = 3
|
message = "Tried to open a foreign host with url: %s" % url
|
||||||
) -> None:
|
RequestError.__init__(self, pool, url, message)
|
||||||
message = f"Tried to open a foreign host with url: {url}"
|
|
||||||
super().__init__(pool, url, message)
|
|
||||||
self.retries = retries
|
self.retries = retries
|
||||||
|
|
||||||
|
|
||||||
class TimeoutStateError(HTTPError):
|
class TimeoutStateError(HTTPError):
|
||||||
"""Raised when passing an invalid state to a timeout"""
|
"""Raised when passing an invalid state to a timeout"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class TimeoutError(HTTPError):
|
class TimeoutError(HTTPError):
|
||||||
"""Raised when a socket timeout error occurs.
|
"""Raised when a socket timeout error occurs.
|
||||||
|
|
@ -125,66 +114,53 @@ class TimeoutError(HTTPError):
|
||||||
<ReadTimeoutError>` and :exc:`ConnectTimeoutErrors <ConnectTimeoutError>`.
|
<ReadTimeoutError>` and :exc:`ConnectTimeoutErrors <ConnectTimeoutError>`.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class ReadTimeoutError(TimeoutError, RequestError):
|
class ReadTimeoutError(TimeoutError, RequestError):
|
||||||
"""Raised when a socket timeout occurs while receiving data from a server"""
|
"""Raised when a socket timeout occurs while receiving data from a server"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
# This timeout error does not have a URL attached and needs to inherit from the
|
# This timeout error does not have a URL attached and needs to inherit from the
|
||||||
# base HTTPError
|
# base HTTPError
|
||||||
class ConnectTimeoutError(TimeoutError):
|
class ConnectTimeoutError(TimeoutError):
|
||||||
"""Raised when a socket timeout occurs while connecting to a server"""
|
"""Raised when a socket timeout occurs while connecting to a server"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
class NewConnectionError(ConnectTimeoutError, HTTPError):
|
|
||||||
|
class NewConnectionError(ConnectTimeoutError, PoolError):
|
||||||
"""Raised when we fail to establish a new connection. Usually ECONNREFUSED."""
|
"""Raised when we fail to establish a new connection. Usually ECONNREFUSED."""
|
||||||
|
|
||||||
def __init__(self, conn: HTTPConnection, message: str) -> None:
|
pass
|
||||||
self.conn = conn
|
|
||||||
super().__init__(f"{conn}: {message}")
|
|
||||||
|
|
||||||
@property
|
|
||||||
def pool(self) -> HTTPConnection:
|
|
||||||
warnings.warn(
|
|
||||||
"The 'pool' property is deprecated and will be removed "
|
|
||||||
"in urllib3 v2.1.0. Use 'conn' instead.",
|
|
||||||
DeprecationWarning,
|
|
||||||
stacklevel=2,
|
|
||||||
)
|
|
||||||
|
|
||||||
return self.conn
|
|
||||||
|
|
||||||
|
|
||||||
class NameResolutionError(NewConnectionError):
|
|
||||||
"""Raised when host name resolution fails."""
|
|
||||||
|
|
||||||
def __init__(self, host: str, conn: HTTPConnection, reason: socket.gaierror):
|
|
||||||
message = f"Failed to resolve '{host}' ({reason})"
|
|
||||||
super().__init__(conn, message)
|
|
||||||
|
|
||||||
|
|
||||||
class EmptyPoolError(PoolError):
|
class EmptyPoolError(PoolError):
|
||||||
"""Raised when a pool runs out of connections and no more are allowed."""
|
"""Raised when a pool runs out of connections and no more are allowed."""
|
||||||
|
|
||||||
|
pass
|
||||||
class FullPoolError(PoolError):
|
|
||||||
"""Raised when we try to add a connection to a full pool in blocking mode."""
|
|
||||||
|
|
||||||
|
|
||||||
class ClosedPoolError(PoolError):
|
class ClosedPoolError(PoolError):
|
||||||
"""Raised when a request enters a pool after the pool has been closed."""
|
"""Raised when a request enters a pool after the pool has been closed."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class LocationValueError(ValueError, HTTPError):
|
class LocationValueError(ValueError, HTTPError):
|
||||||
"""Raised when there is something wrong with a given URL input."""
|
"""Raised when there is something wrong with a given URL input."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class LocationParseError(LocationValueError):
|
class LocationParseError(LocationValueError):
|
||||||
"""Raised when get_host or similar fails to parse the URL input."""
|
"""Raised when get_host or similar fails to parse the URL input."""
|
||||||
|
|
||||||
def __init__(self, location: str) -> None:
|
def __init__(self, location):
|
||||||
message = f"Failed to parse: {location}"
|
message = "Failed to parse: %s" % location
|
||||||
super().__init__(message)
|
HTTPError.__init__(self, message)
|
||||||
|
|
||||||
self.location = location
|
self.location = location
|
||||||
|
|
||||||
|
|
@ -192,9 +168,9 @@ class LocationParseError(LocationValueError):
|
||||||
class URLSchemeUnknown(LocationValueError):
|
class URLSchemeUnknown(LocationValueError):
|
||||||
"""Raised when a URL input has an unsupported scheme."""
|
"""Raised when a URL input has an unsupported scheme."""
|
||||||
|
|
||||||
def __init__(self, scheme: str):
|
def __init__(self, scheme):
|
||||||
message = f"Not supported URL scheme {scheme}"
|
message = "Not supported URL scheme %s" % scheme
|
||||||
super().__init__(message)
|
super(URLSchemeUnknown, self).__init__(message)
|
||||||
|
|
||||||
self.scheme = scheme
|
self.scheme = scheme
|
||||||
|
|
||||||
|
|
@ -209,22 +185,38 @@ class ResponseError(HTTPError):
|
||||||
class SecurityWarning(HTTPWarning):
|
class SecurityWarning(HTTPWarning):
|
||||||
"""Warned when performing security reducing actions"""
|
"""Warned when performing security reducing actions"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
class SubjectAltNameWarning(SecurityWarning):
|
||||||
|
"""Warned when connecting to a host with a certificate missing a SAN."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class InsecureRequestWarning(SecurityWarning):
|
class InsecureRequestWarning(SecurityWarning):
|
||||||
"""Warned when making an unverified HTTPS request."""
|
"""Warned when making an unverified HTTPS request."""
|
||||||
|
|
||||||
|
pass
|
||||||
class NotOpenSSLWarning(SecurityWarning):
|
|
||||||
"""Warned when using unsupported SSL library"""
|
|
||||||
|
|
||||||
|
|
||||||
class SystemTimeWarning(SecurityWarning):
|
class SystemTimeWarning(SecurityWarning):
|
||||||
"""Warned when system time is suspected to be wrong"""
|
"""Warned when system time is suspected to be wrong"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class InsecurePlatformWarning(SecurityWarning):
|
class InsecurePlatformWarning(SecurityWarning):
|
||||||
"""Warned when certain TLS/SSL configuration is not available on a platform."""
|
"""Warned when certain TLS/SSL configuration is not available on a platform."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
class SNIMissingWarning(HTTPWarning):
|
||||||
|
"""Warned when making a HTTPS request without SNI available."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class DependencyWarning(HTTPWarning):
|
class DependencyWarning(HTTPWarning):
|
||||||
"""
|
"""
|
||||||
|
|
@ -232,10 +224,14 @@ class DependencyWarning(HTTPWarning):
|
||||||
dependencies.
|
dependencies.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class ResponseNotChunked(ProtocolError, ValueError):
|
class ResponseNotChunked(ProtocolError, ValueError):
|
||||||
"""Response needs to be chunked in order to read it as chunks."""
|
"""Response needs to be chunked in order to read it as chunks."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class BodyNotHttplibCompatible(HTTPError):
|
class BodyNotHttplibCompatible(HTTPError):
|
||||||
"""
|
"""
|
||||||
|
|
@ -243,6 +239,8 @@ class BodyNotHttplibCompatible(HTTPError):
|
||||||
(have an fp attribute which returns raw chunks) for read_chunked().
|
(have an fp attribute which returns raw chunks) for read_chunked().
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class IncompleteRead(HTTPError, httplib_IncompleteRead):
|
class IncompleteRead(HTTPError, httplib_IncompleteRead):
|
||||||
"""
|
"""
|
||||||
|
|
@ -252,14 +250,10 @@ class IncompleteRead(HTTPError, httplib_IncompleteRead):
|
||||||
for ``partial`` to avoid creating large objects on streamed reads.
|
for ``partial`` to avoid creating large objects on streamed reads.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
partial: int # type: ignore[assignment]
|
def __init__(self, partial, expected):
|
||||||
expected: int
|
super(IncompleteRead, self).__init__(partial, expected)
|
||||||
|
|
||||||
def __init__(self, partial: int, expected: int) -> None:
|
def __repr__(self):
|
||||||
self.partial = partial
|
|
||||||
self.expected = expected
|
|
||||||
|
|
||||||
def __repr__(self) -> str:
|
|
||||||
return "IncompleteRead(%i bytes read, %i more expected)" % (
|
return "IncompleteRead(%i bytes read, %i more expected)" % (
|
||||||
self.partial,
|
self.partial,
|
||||||
self.expected,
|
self.expected,
|
||||||
|
|
@ -269,13 +263,14 @@ class IncompleteRead(HTTPError, httplib_IncompleteRead):
|
||||||
class InvalidChunkLength(HTTPError, httplib_IncompleteRead):
|
class InvalidChunkLength(HTTPError, httplib_IncompleteRead):
|
||||||
"""Invalid chunk length in a chunked response."""
|
"""Invalid chunk length in a chunked response."""
|
||||||
|
|
||||||
def __init__(self, response: HTTPResponse, length: bytes) -> None:
|
def __init__(self, response, length):
|
||||||
self.partial: int = response.tell() # type: ignore[assignment]
|
super(InvalidChunkLength, self).__init__(
|
||||||
self.expected: int | None = response.length_remaining
|
response.tell(), response.length_remaining
|
||||||
|
)
|
||||||
self.response = response
|
self.response = response
|
||||||
self.length = length
|
self.length = length
|
||||||
|
|
||||||
def __repr__(self) -> str:
|
def __repr__(self):
|
||||||
return "InvalidChunkLength(got length %r, %i bytes read)" % (
|
return "InvalidChunkLength(got length %r, %i bytes read)" % (
|
||||||
self.length,
|
self.length,
|
||||||
self.partial,
|
self.partial,
|
||||||
|
|
@ -285,13 +280,15 @@ class InvalidChunkLength(HTTPError, httplib_IncompleteRead):
|
||||||
class InvalidHeader(HTTPError):
|
class InvalidHeader(HTTPError):
|
||||||
"""The header provided was somehow invalid."""
|
"""The header provided was somehow invalid."""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class ProxySchemeUnknown(AssertionError, URLSchemeUnknown):
|
class ProxySchemeUnknown(AssertionError, URLSchemeUnknown):
|
||||||
"""ProxyManager does not support the supplied scheme"""
|
"""ProxyManager does not support the supplied scheme"""
|
||||||
|
|
||||||
# TODO(t-8ch): Stop inheriting from AssertionError in v2.0.
|
# TODO(t-8ch): Stop inheriting from AssertionError in v2.0.
|
||||||
|
|
||||||
def __init__(self, scheme: str | None) -> None:
|
def __init__(self, scheme):
|
||||||
# 'localhost' is here because our URL parser parses
|
# 'localhost' is here because our URL parser parses
|
||||||
# localhost:8080 -> scheme=localhost, remove if we fix this.
|
# localhost:8080 -> scheme=localhost, remove if we fix this.
|
||||||
if scheme == "localhost":
|
if scheme == "localhost":
|
||||||
|
|
@ -299,23 +296,28 @@ class ProxySchemeUnknown(AssertionError, URLSchemeUnknown):
|
||||||
if scheme is None:
|
if scheme is None:
|
||||||
message = "Proxy URL had no scheme, should start with http:// or https://"
|
message = "Proxy URL had no scheme, should start with http:// or https://"
|
||||||
else:
|
else:
|
||||||
message = f"Proxy URL had unsupported scheme {scheme}, should use http:// or https://"
|
message = (
|
||||||
super().__init__(message)
|
"Proxy URL had unsupported scheme %s, should use http:// or https://"
|
||||||
|
% scheme
|
||||||
|
)
|
||||||
|
super(ProxySchemeUnknown, self).__init__(message)
|
||||||
|
|
||||||
|
|
||||||
class ProxySchemeUnsupported(ValueError):
|
class ProxySchemeUnsupported(ValueError):
|
||||||
"""Fetching HTTPS resources through HTTPS proxies is unsupported"""
|
"""Fetching HTTPS resources through HTTPS proxies is unsupported"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
class HeaderParsingError(HTTPError):
|
class HeaderParsingError(HTTPError):
|
||||||
"""Raised by assert_header_parsing, but we convert it to a log.warning statement."""
|
"""Raised by assert_header_parsing, but we convert it to a log.warning statement."""
|
||||||
|
|
||||||
def __init__(
|
def __init__(self, defects, unparsed_data):
|
||||||
self, defects: list[MessageDefect], unparsed_data: bytes | str | None
|
message = "%s, unparsed data: %r" % (defects or "Unknown", unparsed_data)
|
||||||
) -> None:
|
super(HeaderParsingError, self).__init__(message)
|
||||||
message = f"{defects or 'Unknown'}, unparsed data: {unparsed_data!r}"
|
|
||||||
super().__init__(message)
|
|
||||||
|
|
||||||
|
|
||||||
class UnrewindableBodyError(HTTPError):
|
class UnrewindableBodyError(HTTPError):
|
||||||
"""urllib3 encountered an error when trying to rewind a body"""
|
"""urllib3 encountered an error when trying to rewind a body"""
|
||||||
|
|
||||||
|
pass
|
||||||
|
|
|
||||||
|
|
@ -1,20 +1,13 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import email.utils
|
import email.utils
|
||||||
import mimetypes
|
import mimetypes
|
||||||
import typing
|
import re
|
||||||
|
|
||||||
_TYPE_FIELD_VALUE = typing.Union[str, bytes]
|
from .packages import six
|
||||||
_TYPE_FIELD_VALUE_TUPLE = typing.Union[
|
|
||||||
_TYPE_FIELD_VALUE,
|
|
||||||
typing.Tuple[str, _TYPE_FIELD_VALUE],
|
|
||||||
typing.Tuple[str, _TYPE_FIELD_VALUE, str],
|
|
||||||
]
|
|
||||||
|
|
||||||
|
|
||||||
def guess_content_type(
|
def guess_content_type(filename, default="application/octet-stream"):
|
||||||
filename: str | None, default: str = "application/octet-stream"
|
|
||||||
) -> str:
|
|
||||||
"""
|
"""
|
||||||
Guess the "Content-Type" of a file.
|
Guess the "Content-Type" of a file.
|
||||||
|
|
||||||
|
|
@ -28,7 +21,7 @@ def guess_content_type(
|
||||||
return default
|
return default
|
||||||
|
|
||||||
|
|
||||||
def format_header_param_rfc2231(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
def format_header_param_rfc2231(name, value):
|
||||||
"""
|
"""
|
||||||
Helper function to format and quote a single header parameter using the
|
Helper function to format and quote a single header parameter using the
|
||||||
strategy defined in RFC 2231.
|
strategy defined in RFC 2231.
|
||||||
|
|
@ -41,28 +34,14 @@ def format_header_param_rfc2231(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
||||||
The name of the parameter, a string expected to be ASCII only.
|
The name of the parameter, a string expected to be ASCII only.
|
||||||
:param value:
|
:param value:
|
||||||
The value of the parameter, provided as ``bytes`` or `str``.
|
The value of the parameter, provided as ``bytes`` or `str``.
|
||||||
:returns:
|
:ret:
|
||||||
An RFC-2231-formatted unicode string.
|
An RFC-2231-formatted unicode string.
|
||||||
|
|
||||||
.. deprecated:: 2.0.0
|
|
||||||
Will be removed in urllib3 v2.1.0. This is not valid for
|
|
||||||
``multipart/form-data`` header parameters.
|
|
||||||
"""
|
"""
|
||||||
import warnings
|
if isinstance(value, six.binary_type):
|
||||||
|
|
||||||
warnings.warn(
|
|
||||||
"'format_header_param_rfc2231' is deprecated and will be "
|
|
||||||
"removed in urllib3 v2.1.0. This is not valid for "
|
|
||||||
"multipart/form-data header parameters.",
|
|
||||||
DeprecationWarning,
|
|
||||||
stacklevel=2,
|
|
||||||
)
|
|
||||||
|
|
||||||
if isinstance(value, bytes):
|
|
||||||
value = value.decode("utf-8")
|
value = value.decode("utf-8")
|
||||||
|
|
||||||
if not any(ch in value for ch in '"\\\r\n'):
|
if not any(ch in value for ch in '"\\\r\n'):
|
||||||
result = f'{name}="{value}"'
|
result = u'%s="%s"' % (name, value)
|
||||||
try:
|
try:
|
||||||
result.encode("ascii")
|
result.encode("ascii")
|
||||||
except (UnicodeEncodeError, UnicodeDecodeError):
|
except (UnicodeEncodeError, UnicodeDecodeError):
|
||||||
|
|
@ -70,87 +49,81 @@ def format_header_param_rfc2231(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
||||||
else:
|
else:
|
||||||
return result
|
return result
|
||||||
|
|
||||||
|
if six.PY2: # Python 2:
|
||||||
|
value = value.encode("utf-8")
|
||||||
|
|
||||||
|
# encode_rfc2231 accepts an encoded string and returns an ascii-encoded
|
||||||
|
# string in Python 2 but accepts and returns unicode strings in Python 3
|
||||||
value = email.utils.encode_rfc2231(value, "utf-8")
|
value = email.utils.encode_rfc2231(value, "utf-8")
|
||||||
value = f"{name}*={value}"
|
value = "%s*=%s" % (name, value)
|
||||||
|
|
||||||
|
if six.PY2: # Python 2:
|
||||||
|
value = value.decode("utf-8")
|
||||||
|
|
||||||
return value
|
return value
|
||||||
|
|
||||||
|
|
||||||
def format_multipart_header_param(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
_HTML5_REPLACEMENTS = {
|
||||||
|
u"\u0022": u"%22",
|
||||||
|
# Replace "\" with "\\".
|
||||||
|
u"\u005C": u"\u005C\u005C",
|
||||||
|
}
|
||||||
|
|
||||||
|
# All control characters from 0x00 to 0x1F *except* 0x1B.
|
||||||
|
_HTML5_REPLACEMENTS.update(
|
||||||
|
{
|
||||||
|
six.unichr(cc): u"%{:02X}".format(cc)
|
||||||
|
for cc in range(0x00, 0x1F + 1)
|
||||||
|
if cc not in (0x1B,)
|
||||||
|
}
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def _replace_multiple(value, needles_and_replacements):
|
||||||
|
def replacer(match):
|
||||||
|
return needles_and_replacements[match.group(0)]
|
||||||
|
|
||||||
|
pattern = re.compile(
|
||||||
|
r"|".join([re.escape(needle) for needle in needles_and_replacements.keys()])
|
||||||
|
)
|
||||||
|
|
||||||
|
result = pattern.sub(replacer, value)
|
||||||
|
|
||||||
|
return result
|
||||||
|
|
||||||
|
|
||||||
|
def format_header_param_html5(name, value):
|
||||||
"""
|
"""
|
||||||
Format and quote a single multipart header parameter.
|
Helper function to format and quote a single header parameter using the
|
||||||
|
HTML5 strategy.
|
||||||
|
|
||||||
This follows the `WHATWG HTML Standard`_ as of 2021/06/10, matching
|
Particularly useful for header parameters which might contain
|
||||||
the behavior of current browser and curl versions. Values are
|
non-ASCII values, like file names. This follows the `HTML5 Working Draft
|
||||||
assumed to be UTF-8. The ``\\n``, ``\\r``, and ``"`` characters are
|
Section 4.10.22.7`_ and matches the behavior of curl and modern browsers.
|
||||||
percent encoded.
|
|
||||||
|
|
||||||
.. _WHATWG HTML Standard:
|
.. _HTML5 Working Draft Section 4.10.22.7:
|
||||||
https://html.spec.whatwg.org/multipage/
|
https://w3c.github.io/html/sec-forms.html#multipart-form-data
|
||||||
form-control-infrastructure.html#multipart-form-data
|
|
||||||
|
|
||||||
:param name:
|
:param name:
|
||||||
The name of the parameter, an ASCII-only ``str``.
|
The name of the parameter, a string expected to be ASCII only.
|
||||||
:param value:
|
:param value:
|
||||||
The value of the parameter, a ``str`` or UTF-8 encoded
|
The value of the parameter, provided as ``bytes`` or `str``.
|
||||||
``bytes``.
|
:ret:
|
||||||
:returns:
|
A unicode string, stripped of troublesome characters.
|
||||||
A string ``name="value"`` with the escaped value.
|
|
||||||
|
|
||||||
.. versionchanged:: 2.0.0
|
|
||||||
Matches the WHATWG HTML Standard as of 2021/06/10. Control
|
|
||||||
characters are no longer percent encoded.
|
|
||||||
|
|
||||||
.. versionchanged:: 2.0.0
|
|
||||||
Renamed from ``format_header_param_html5`` and
|
|
||||||
``format_header_param``. The old names will be removed in
|
|
||||||
urllib3 v2.1.0.
|
|
||||||
"""
|
"""
|
||||||
if isinstance(value, bytes):
|
if isinstance(value, six.binary_type):
|
||||||
value = value.decode("utf-8")
|
value = value.decode("utf-8")
|
||||||
|
|
||||||
# percent encode \n \r "
|
value = _replace_multiple(value, _HTML5_REPLACEMENTS)
|
||||||
value = value.translate({10: "%0A", 13: "%0D", 34: "%22"})
|
|
||||||
return f'{name}="{value}"'
|
return u'%s="%s"' % (name, value)
|
||||||
|
|
||||||
|
|
||||||
def format_header_param_html5(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
# For backwards-compatibility.
|
||||||
"""
|
format_header_param = format_header_param_html5
|
||||||
.. deprecated:: 2.0.0
|
|
||||||
Renamed to :func:`format_multipart_header_param`. Will be
|
|
||||||
removed in urllib3 v2.1.0.
|
|
||||||
"""
|
|
||||||
import warnings
|
|
||||||
|
|
||||||
warnings.warn(
|
|
||||||
"'format_header_param_html5' has been renamed to "
|
|
||||||
"'format_multipart_header_param'. The old name will be "
|
|
||||||
"removed in urllib3 v2.1.0.",
|
|
||||||
DeprecationWarning,
|
|
||||||
stacklevel=2,
|
|
||||||
)
|
|
||||||
return format_multipart_header_param(name, value)
|
|
||||||
|
|
||||||
|
|
||||||
def format_header_param(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
class RequestField(object):
|
||||||
"""
|
|
||||||
.. deprecated:: 2.0.0
|
|
||||||
Renamed to :func:`format_multipart_header_param`. Will be
|
|
||||||
removed in urllib3 v2.1.0.
|
|
||||||
"""
|
|
||||||
import warnings
|
|
||||||
|
|
||||||
warnings.warn(
|
|
||||||
"'format_header_param' has been renamed to "
|
|
||||||
"'format_multipart_header_param'. The old name will be "
|
|
||||||
"removed in urllib3 v2.1.0.",
|
|
||||||
DeprecationWarning,
|
|
||||||
stacklevel=2,
|
|
||||||
)
|
|
||||||
return format_multipart_header_param(name, value)
|
|
||||||
|
|
||||||
|
|
||||||
class RequestField:
|
|
||||||
"""
|
"""
|
||||||
A data container for request body parameters.
|
A data container for request body parameters.
|
||||||
|
|
||||||
|
|
@ -162,47 +135,29 @@ class RequestField:
|
||||||
An optional filename of the request field. Must be unicode.
|
An optional filename of the request field. Must be unicode.
|
||||||
:param headers:
|
:param headers:
|
||||||
An optional dict-like object of headers to initially use for the field.
|
An optional dict-like object of headers to initially use for the field.
|
||||||
|
:param header_formatter:
|
||||||
.. versionchanged:: 2.0.0
|
An optional callable that is used to encode and format the headers. By
|
||||||
The ``header_formatter`` parameter is deprecated and will
|
default, this is :func:`format_header_param_html5`.
|
||||||
be removed in urllib3 v2.1.0.
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
name: str,
|
name,
|
||||||
data: _TYPE_FIELD_VALUE,
|
data,
|
||||||
filename: str | None = None,
|
filename=None,
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
headers=None,
|
||||||
header_formatter: typing.Callable[[str, _TYPE_FIELD_VALUE], str] | None = None,
|
header_formatter=format_header_param_html5,
|
||||||
):
|
):
|
||||||
self._name = name
|
self._name = name
|
||||||
self._filename = filename
|
self._filename = filename
|
||||||
self.data = data
|
self.data = data
|
||||||
self.headers: dict[str, str | None] = {}
|
self.headers = {}
|
||||||
if headers:
|
if headers:
|
||||||
self.headers = dict(headers)
|
self.headers = dict(headers)
|
||||||
|
|
||||||
if header_formatter is not None:
|
|
||||||
import warnings
|
|
||||||
|
|
||||||
warnings.warn(
|
|
||||||
"The 'header_formatter' parameter is deprecated and "
|
|
||||||
"will be removed in urllib3 v2.1.0.",
|
|
||||||
DeprecationWarning,
|
|
||||||
stacklevel=2,
|
|
||||||
)
|
|
||||||
self.header_formatter = header_formatter
|
self.header_formatter = header_formatter
|
||||||
else:
|
|
||||||
self.header_formatter = format_multipart_header_param
|
|
||||||
|
|
||||||
@classmethod
|
@classmethod
|
||||||
def from_tuples(
|
def from_tuples(cls, fieldname, value, header_formatter=format_header_param_html5):
|
||||||
cls,
|
|
||||||
fieldname: str,
|
|
||||||
value: _TYPE_FIELD_VALUE_TUPLE,
|
|
||||||
header_formatter: typing.Callable[[str, _TYPE_FIELD_VALUE], str] | None = None,
|
|
||||||
) -> RequestField:
|
|
||||||
"""
|
"""
|
||||||
A :class:`~urllib3.fields.RequestField` factory from old-style tuple parameters.
|
A :class:`~urllib3.fields.RequestField` factory from old-style tuple parameters.
|
||||||
|
|
||||||
|
|
@ -219,10 +174,6 @@ class RequestField:
|
||||||
|
|
||||||
Field names and filenames must be unicode.
|
Field names and filenames must be unicode.
|
||||||
"""
|
"""
|
||||||
filename: str | None
|
|
||||||
content_type: str | None
|
|
||||||
data: _TYPE_FIELD_VALUE
|
|
||||||
|
|
||||||
if isinstance(value, tuple):
|
if isinstance(value, tuple):
|
||||||
if len(value) == 3:
|
if len(value) == 3:
|
||||||
filename, data, content_type = value
|
filename, data, content_type = value
|
||||||
|
|
@ -241,29 +192,20 @@ class RequestField:
|
||||||
|
|
||||||
return request_param
|
return request_param
|
||||||
|
|
||||||
def _render_part(self, name: str, value: _TYPE_FIELD_VALUE) -> str:
|
def _render_part(self, name, value):
|
||||||
"""
|
"""
|
||||||
Override this method to change how each multipart header
|
Overridable helper function to format a single header parameter. By
|
||||||
parameter is formatted. By default, this calls
|
default, this calls ``self.header_formatter``.
|
||||||
:func:`format_multipart_header_param`.
|
|
||||||
|
|
||||||
:param name:
|
:param name:
|
||||||
The name of the parameter, an ASCII-only ``str``.
|
The name of the parameter, a string expected to be ASCII only.
|
||||||
:param value:
|
:param value:
|
||||||
The value of the parameter, a ``str`` or UTF-8 encoded
|
The value of the parameter, provided as a unicode string.
|
||||||
``bytes``.
|
|
||||||
|
|
||||||
:meta public:
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
return self.header_formatter(name, value)
|
return self.header_formatter(name, value)
|
||||||
|
|
||||||
def _render_parts(
|
def _render_parts(self, header_parts):
|
||||||
self,
|
|
||||||
header_parts: (
|
|
||||||
dict[str, _TYPE_FIELD_VALUE | None]
|
|
||||||
| typing.Sequence[tuple[str, _TYPE_FIELD_VALUE | None]]
|
|
||||||
),
|
|
||||||
) -> str:
|
|
||||||
"""
|
"""
|
||||||
Helper function to format and quote a single header.
|
Helper function to format and quote a single header.
|
||||||
|
|
||||||
|
|
@ -274,21 +216,18 @@ class RequestField:
|
||||||
A sequence of (k, v) tuples or a :class:`dict` of (k, v) to format
|
A sequence of (k, v) tuples or a :class:`dict` of (k, v) to format
|
||||||
as `k1="v1"; k2="v2"; ...`.
|
as `k1="v1"; k2="v2"; ...`.
|
||||||
"""
|
"""
|
||||||
iterable: typing.Iterable[tuple[str, _TYPE_FIELD_VALUE | None]]
|
|
||||||
|
|
||||||
parts = []
|
parts = []
|
||||||
|
iterable = header_parts
|
||||||
if isinstance(header_parts, dict):
|
if isinstance(header_parts, dict):
|
||||||
iterable = header_parts.items()
|
iterable = header_parts.items()
|
||||||
else:
|
|
||||||
iterable = header_parts
|
|
||||||
|
|
||||||
for name, value in iterable:
|
for name, value in iterable:
|
||||||
if value is not None:
|
if value is not None:
|
||||||
parts.append(self._render_part(name, value))
|
parts.append(self._render_part(name, value))
|
||||||
|
|
||||||
return "; ".join(parts)
|
return u"; ".join(parts)
|
||||||
|
|
||||||
def render_headers(self) -> str:
|
def render_headers(self):
|
||||||
"""
|
"""
|
||||||
Renders the headers for this request field.
|
Renders the headers for this request field.
|
||||||
"""
|
"""
|
||||||
|
|
@ -297,45 +236,39 @@ class RequestField:
|
||||||
sort_keys = ["Content-Disposition", "Content-Type", "Content-Location"]
|
sort_keys = ["Content-Disposition", "Content-Type", "Content-Location"]
|
||||||
for sort_key in sort_keys:
|
for sort_key in sort_keys:
|
||||||
if self.headers.get(sort_key, False):
|
if self.headers.get(sort_key, False):
|
||||||
lines.append(f"{sort_key}: {self.headers[sort_key]}")
|
lines.append(u"%s: %s" % (sort_key, self.headers[sort_key]))
|
||||||
|
|
||||||
for header_name, header_value in self.headers.items():
|
for header_name, header_value in self.headers.items():
|
||||||
if header_name not in sort_keys:
|
if header_name not in sort_keys:
|
||||||
if header_value:
|
if header_value:
|
||||||
lines.append(f"{header_name}: {header_value}")
|
lines.append(u"%s: %s" % (header_name, header_value))
|
||||||
|
|
||||||
lines.append("\r\n")
|
lines.append(u"\r\n")
|
||||||
return "\r\n".join(lines)
|
return u"\r\n".join(lines)
|
||||||
|
|
||||||
def make_multipart(
|
def make_multipart(
|
||||||
self,
|
self, content_disposition=None, content_type=None, content_location=None
|
||||||
content_disposition: str | None = None,
|
):
|
||||||
content_type: str | None = None,
|
|
||||||
content_location: str | None = None,
|
|
||||||
) -> None:
|
|
||||||
"""
|
"""
|
||||||
Makes this request field into a multipart request field.
|
Makes this request field into a multipart request field.
|
||||||
|
|
||||||
This method overrides "Content-Disposition", "Content-Type" and
|
This method overrides "Content-Disposition", "Content-Type" and
|
||||||
"Content-Location" headers to the request parameter.
|
"Content-Location" headers to the request parameter.
|
||||||
|
|
||||||
:param content_disposition:
|
|
||||||
The 'Content-Disposition' of the request body. Defaults to 'form-data'
|
|
||||||
:param content_type:
|
:param content_type:
|
||||||
The 'Content-Type' of the request body.
|
The 'Content-Type' of the request body.
|
||||||
:param content_location:
|
:param content_location:
|
||||||
The 'Content-Location' of the request body.
|
The 'Content-Location' of the request body.
|
||||||
|
|
||||||
"""
|
"""
|
||||||
content_disposition = (content_disposition or "form-data") + "; ".join(
|
self.headers["Content-Disposition"] = content_disposition or u"form-data"
|
||||||
|
self.headers["Content-Disposition"] += u"; ".join(
|
||||||
[
|
[
|
||||||
"",
|
u"",
|
||||||
self._render_parts(
|
self._render_parts(
|
||||||
(("name", self._name), ("filename", self._filename))
|
((u"name", self._name), (u"filename", self._filename))
|
||||||
),
|
),
|
||||||
]
|
]
|
||||||
)
|
)
|
||||||
|
|
||||||
self.headers["Content-Disposition"] = content_disposition
|
|
||||||
self.headers["Content-Type"] = content_type
|
self.headers["Content-Type"] = content_type
|
||||||
self.headers["Content-Location"] = content_location
|
self.headers["Content-Location"] = content_location
|
||||||
|
|
|
||||||
|
|
@ -1,32 +1,28 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import binascii
|
import binascii
|
||||||
import codecs
|
import codecs
|
||||||
import os
|
import os
|
||||||
import typing
|
|
||||||
from io import BytesIO
|
from io import BytesIO
|
||||||
|
|
||||||
from .fields import _TYPE_FIELD_VALUE_TUPLE, RequestField
|
from .fields import RequestField
|
||||||
|
from .packages import six
|
||||||
|
from .packages.six import b
|
||||||
|
|
||||||
writer = codecs.lookup("utf-8")[3]
|
writer = codecs.lookup("utf-8")[3]
|
||||||
|
|
||||||
_TYPE_FIELDS_SEQUENCE = typing.Sequence[
|
|
||||||
typing.Union[typing.Tuple[str, _TYPE_FIELD_VALUE_TUPLE], RequestField]
|
|
||||||
]
|
|
||||||
_TYPE_FIELDS = typing.Union[
|
|
||||||
_TYPE_FIELDS_SEQUENCE,
|
|
||||||
typing.Mapping[str, _TYPE_FIELD_VALUE_TUPLE],
|
|
||||||
]
|
|
||||||
|
|
||||||
|
def choose_boundary():
|
||||||
def choose_boundary() -> str:
|
|
||||||
"""
|
"""
|
||||||
Our embarrassingly-simple replacement for mimetools.choose_boundary.
|
Our embarrassingly-simple replacement for mimetools.choose_boundary.
|
||||||
"""
|
"""
|
||||||
return binascii.hexlify(os.urandom(16)).decode()
|
boundary = binascii.hexlify(os.urandom(16))
|
||||||
|
if not six.PY2:
|
||||||
|
boundary = boundary.decode("ascii")
|
||||||
|
return boundary
|
||||||
|
|
||||||
|
|
||||||
def iter_field_objects(fields: _TYPE_FIELDS) -> typing.Iterable[RequestField]:
|
def iter_field_objects(fields):
|
||||||
"""
|
"""
|
||||||
Iterate over fields.
|
Iterate over fields.
|
||||||
|
|
||||||
|
|
@ -34,29 +30,42 @@ def iter_field_objects(fields: _TYPE_FIELDS) -> typing.Iterable[RequestField]:
|
||||||
:class:`~urllib3.fields.RequestField`.
|
:class:`~urllib3.fields.RequestField`.
|
||||||
|
|
||||||
"""
|
"""
|
||||||
iterable: typing.Iterable[RequestField | tuple[str, _TYPE_FIELD_VALUE_TUPLE]]
|
if isinstance(fields, dict):
|
||||||
|
i = six.iteritems(fields)
|
||||||
if isinstance(fields, typing.Mapping):
|
|
||||||
iterable = fields.items()
|
|
||||||
else:
|
else:
|
||||||
iterable = fields
|
i = iter(fields)
|
||||||
|
|
||||||
for field in iterable:
|
for field in i:
|
||||||
if isinstance(field, RequestField):
|
if isinstance(field, RequestField):
|
||||||
yield field
|
yield field
|
||||||
else:
|
else:
|
||||||
yield RequestField.from_tuples(*field)
|
yield RequestField.from_tuples(*field)
|
||||||
|
|
||||||
|
|
||||||
def encode_multipart_formdata(
|
def iter_fields(fields):
|
||||||
fields: _TYPE_FIELDS, boundary: str | None = None
|
"""
|
||||||
) -> tuple[bytes, str]:
|
.. deprecated:: 1.6
|
||||||
|
|
||||||
|
Iterate over fields.
|
||||||
|
|
||||||
|
The addition of :class:`~urllib3.fields.RequestField` makes this function
|
||||||
|
obsolete. Instead, use :func:`iter_field_objects`, which returns
|
||||||
|
:class:`~urllib3.fields.RequestField` objects.
|
||||||
|
|
||||||
|
Supports list of (k, v) tuples and dicts.
|
||||||
|
"""
|
||||||
|
if isinstance(fields, dict):
|
||||||
|
return ((k, v) for k, v in six.iteritems(fields))
|
||||||
|
|
||||||
|
return ((k, v) for k, v in fields)
|
||||||
|
|
||||||
|
|
||||||
|
def encode_multipart_formdata(fields, boundary=None):
|
||||||
"""
|
"""
|
||||||
Encode a dictionary of ``fields`` using the multipart/form-data MIME format.
|
Encode a dictionary of ``fields`` using the multipart/form-data MIME format.
|
||||||
|
|
||||||
:param fields:
|
:param fields:
|
||||||
Dictionary of fields or list of (key, :class:`~urllib3.fields.RequestField`).
|
Dictionary of fields or list of (key, :class:`~urllib3.fields.RequestField`).
|
||||||
Values are processed by :func:`urllib3.fields.RequestField.from_tuples`.
|
|
||||||
|
|
||||||
:param boundary:
|
:param boundary:
|
||||||
If not specified, then a random boundary will be generated using
|
If not specified, then a random boundary will be generated using
|
||||||
|
|
@ -67,7 +76,7 @@ def encode_multipart_formdata(
|
||||||
boundary = choose_boundary()
|
boundary = choose_boundary()
|
||||||
|
|
||||||
for field in iter_field_objects(fields):
|
for field in iter_field_objects(fields):
|
||||||
body.write(f"--{boundary}\r\n".encode("latin-1"))
|
body.write(b("--%s\r\n" % (boundary)))
|
||||||
|
|
||||||
writer(body).write(field.render_headers())
|
writer(body).write(field.render_headers())
|
||||||
data = field.data
|
data = field.data
|
||||||
|
|
@ -75,15 +84,15 @@ def encode_multipart_formdata(
|
||||||
if isinstance(data, int):
|
if isinstance(data, int):
|
||||||
data = str(data) # Backwards compatibility
|
data = str(data) # Backwards compatibility
|
||||||
|
|
||||||
if isinstance(data, str):
|
if isinstance(data, six.text_type):
|
||||||
writer(body).write(data)
|
writer(body).write(data)
|
||||||
else:
|
else:
|
||||||
body.write(data)
|
body.write(data)
|
||||||
|
|
||||||
body.write(b"\r\n")
|
body.write(b"\r\n")
|
||||||
|
|
||||||
body.write(f"--{boundary}--\r\n".encode("latin-1"))
|
body.write(b("--%s--\r\n" % (boundary)))
|
||||||
|
|
||||||
content_type = f"multipart/form-data; boundary={boundary}"
|
content_type = str("multipart/form-data; boundary=%s" % boundary)
|
||||||
|
|
||||||
return body.getvalue(), content_type
|
return body.getvalue(), content_type
|
||||||
|
|
|
||||||
|
|
@ -1,229 +0,0 @@
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import threading
|
|
||||||
import types
|
|
||||||
import typing
|
|
||||||
|
|
||||||
import h2.config # type: ignore[import-untyped]
|
|
||||||
import h2.connection # type: ignore[import-untyped]
|
|
||||||
import h2.events # type: ignore[import-untyped]
|
|
||||||
|
|
||||||
import urllib3.connection
|
|
||||||
import urllib3.util.ssl_
|
|
||||||
from urllib3.response import BaseHTTPResponse
|
|
||||||
|
|
||||||
from ._collections import HTTPHeaderDict
|
|
||||||
from .connection import HTTPSConnection
|
|
||||||
from .connectionpool import HTTPSConnectionPool
|
|
||||||
|
|
||||||
orig_HTTPSConnection = HTTPSConnection
|
|
||||||
|
|
||||||
T = typing.TypeVar("T")
|
|
||||||
|
|
||||||
|
|
||||||
class _LockedObject(typing.Generic[T]):
|
|
||||||
"""
|
|
||||||
A wrapper class that hides a specific object behind a lock.
|
|
||||||
|
|
||||||
The goal here is to provide a simple way to protect access to an object
|
|
||||||
that cannot safely be simultaneously accessed from multiple threads. The
|
|
||||||
intended use of this class is simple: take hold of it with a context
|
|
||||||
manager, which returns the protected object.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, obj: T):
|
|
||||||
self.lock = threading.RLock()
|
|
||||||
self._obj = obj
|
|
||||||
|
|
||||||
def __enter__(self) -> T:
|
|
||||||
self.lock.acquire()
|
|
||||||
return self._obj
|
|
||||||
|
|
||||||
def __exit__(
|
|
||||||
self,
|
|
||||||
exc_type: type[BaseException] | None,
|
|
||||||
exc_val: BaseException | None,
|
|
||||||
exc_tb: types.TracebackType | None,
|
|
||||||
) -> None:
|
|
||||||
self.lock.release()
|
|
||||||
|
|
||||||
|
|
||||||
class HTTP2Connection(HTTPSConnection):
|
|
||||||
def __init__(
|
|
||||||
self, host: str, port: int | None = None, **kwargs: typing.Any
|
|
||||||
) -> None:
|
|
||||||
self._h2_conn = self._new_h2_conn()
|
|
||||||
self._h2_stream: int | None = None
|
|
||||||
self._h2_headers: list[tuple[bytes, bytes]] = []
|
|
||||||
|
|
||||||
if "proxy" in kwargs or "proxy_config" in kwargs: # Defensive:
|
|
||||||
raise NotImplementedError("Proxies aren't supported with HTTP/2")
|
|
||||||
|
|
||||||
super().__init__(host, port, **kwargs)
|
|
||||||
|
|
||||||
def _new_h2_conn(self) -> _LockedObject[h2.connection.H2Connection]:
|
|
||||||
config = h2.config.H2Configuration(client_side=True)
|
|
||||||
return _LockedObject(h2.connection.H2Connection(config=config))
|
|
||||||
|
|
||||||
def connect(self) -> None:
|
|
||||||
super().connect()
|
|
||||||
|
|
||||||
with self._h2_conn as h2_conn:
|
|
||||||
h2_conn.initiate_connection()
|
|
||||||
self.sock.sendall(h2_conn.data_to_send())
|
|
||||||
|
|
||||||
def putrequest(
|
|
||||||
self,
|
|
||||||
method: str,
|
|
||||||
url: str,
|
|
||||||
skip_host: bool = False,
|
|
||||||
skip_accept_encoding: bool = False,
|
|
||||||
) -> None:
|
|
||||||
with self._h2_conn as h2_conn:
|
|
||||||
self._request_url = url
|
|
||||||
self._h2_stream = h2_conn.get_next_available_stream_id()
|
|
||||||
|
|
||||||
if ":" in self.host:
|
|
||||||
authority = f"[{self.host}]:{self.port or 443}"
|
|
||||||
else:
|
|
||||||
authority = f"{self.host}:{self.port or 443}"
|
|
||||||
|
|
||||||
self._h2_headers.extend(
|
|
||||||
(
|
|
||||||
(b":scheme", b"https"),
|
|
||||||
(b":method", method.encode()),
|
|
||||||
(b":authority", authority.encode()),
|
|
||||||
(b":path", url.encode()),
|
|
||||||
)
|
|
||||||
)
|
|
||||||
|
|
||||||
def putheader(self, header: str, *values: str) -> None: # type: ignore[override]
|
|
||||||
for value in values:
|
|
||||||
self._h2_headers.append(
|
|
||||||
(header.encode("utf-8").lower(), value.encode("utf-8"))
|
|
||||||
)
|
|
||||||
|
|
||||||
def endheaders(self) -> None: # type: ignore[override]
|
|
||||||
with self._h2_conn as h2_conn:
|
|
||||||
h2_conn.send_headers(
|
|
||||||
stream_id=self._h2_stream,
|
|
||||||
headers=self._h2_headers,
|
|
||||||
end_stream=True,
|
|
||||||
)
|
|
||||||
if data_to_send := h2_conn.data_to_send():
|
|
||||||
self.sock.sendall(data_to_send)
|
|
||||||
|
|
||||||
def send(self, data: bytes) -> None: # type: ignore[override] # Defensive:
|
|
||||||
if not data:
|
|
||||||
return
|
|
||||||
raise NotImplementedError("Sending data isn't supported yet")
|
|
||||||
|
|
||||||
def getresponse( # type: ignore[override]
|
|
||||||
self,
|
|
||||||
) -> HTTP2Response:
|
|
||||||
status = None
|
|
||||||
data = bytearray()
|
|
||||||
with self._h2_conn as h2_conn:
|
|
||||||
end_stream = False
|
|
||||||
while not end_stream:
|
|
||||||
# TODO: Arbitrary read value.
|
|
||||||
if received_data := self.sock.recv(65535):
|
|
||||||
events = h2_conn.receive_data(received_data)
|
|
||||||
for event in events:
|
|
||||||
if isinstance(event, h2.events.ResponseReceived):
|
|
||||||
headers = HTTPHeaderDict()
|
|
||||||
for header, value in event.headers:
|
|
||||||
if header == b":status":
|
|
||||||
status = int(value.decode())
|
|
||||||
else:
|
|
||||||
headers.add(
|
|
||||||
header.decode("ascii"), value.decode("ascii")
|
|
||||||
)
|
|
||||||
|
|
||||||
elif isinstance(event, h2.events.DataReceived):
|
|
||||||
data += event.data
|
|
||||||
h2_conn.acknowledge_received_data(
|
|
||||||
event.flow_controlled_length, event.stream_id
|
|
||||||
)
|
|
||||||
|
|
||||||
elif isinstance(event, h2.events.StreamEnded):
|
|
||||||
end_stream = True
|
|
||||||
|
|
||||||
if data_to_send := h2_conn.data_to_send():
|
|
||||||
self.sock.sendall(data_to_send)
|
|
||||||
|
|
||||||
# We always close to not have to handle connection management.
|
|
||||||
self.close()
|
|
||||||
|
|
||||||
assert status is not None
|
|
||||||
return HTTP2Response(
|
|
||||||
status=status,
|
|
||||||
headers=headers,
|
|
||||||
request_url=self._request_url,
|
|
||||||
data=bytes(data),
|
|
||||||
)
|
|
||||||
|
|
||||||
def close(self) -> None:
|
|
||||||
with self._h2_conn as h2_conn:
|
|
||||||
try:
|
|
||||||
h2_conn.close_connection()
|
|
||||||
if data := h2_conn.data_to_send():
|
|
||||||
self.sock.sendall(data)
|
|
||||||
except Exception:
|
|
||||||
pass
|
|
||||||
|
|
||||||
# Reset all our HTTP/2 connection state.
|
|
||||||
self._h2_conn = self._new_h2_conn()
|
|
||||||
self._h2_stream = None
|
|
||||||
self._h2_headers = []
|
|
||||||
|
|
||||||
super().close()
|
|
||||||
|
|
||||||
|
|
||||||
class HTTP2Response(BaseHTTPResponse):
|
|
||||||
# TODO: This is a woefully incomplete response object, but works for non-streaming.
|
|
||||||
def __init__(
|
|
||||||
self,
|
|
||||||
status: int,
|
|
||||||
headers: HTTPHeaderDict,
|
|
||||||
request_url: str,
|
|
||||||
data: bytes,
|
|
||||||
decode_content: bool = False, # TODO: support decoding
|
|
||||||
) -> None:
|
|
||||||
super().__init__(
|
|
||||||
status=status,
|
|
||||||
headers=headers,
|
|
||||||
# Following CPython, we map HTTP versions to major * 10 + minor integers
|
|
||||||
version=20,
|
|
||||||
# No reason phrase in HTTP/2
|
|
||||||
reason=None,
|
|
||||||
decode_content=decode_content,
|
|
||||||
request_url=request_url,
|
|
||||||
)
|
|
||||||
self._data = data
|
|
||||||
self.length_remaining = 0
|
|
||||||
|
|
||||||
@property
|
|
||||||
def data(self) -> bytes:
|
|
||||||
return self._data
|
|
||||||
|
|
||||||
def get_redirect_location(self) -> None:
|
|
||||||
return None
|
|
||||||
|
|
||||||
def close(self) -> None:
|
|
||||||
pass
|
|
||||||
|
|
||||||
|
|
||||||
def inject_into_urllib3() -> None:
|
|
||||||
HTTPSConnectionPool.ConnectionCls = HTTP2Connection
|
|
||||||
urllib3.connection.HTTPSConnection = HTTP2Connection # type: ignore[misc]
|
|
||||||
|
|
||||||
# TODO: Offer 'http/1.1' as well, but for testing purposes this is handy.
|
|
||||||
urllib3.util.ssl_.ALPN_PROTOCOLS = ["h2"]
|
|
||||||
|
|
||||||
|
|
||||||
def extract_from_urllib3() -> None:
|
|
||||||
HTTPSConnectionPool.ConnectionCls = orig_HTTPSConnection
|
|
||||||
urllib3.connection.HTTPSConnection = orig_HTTPSConnection # type: ignore[misc]
|
|
||||||
|
|
||||||
urllib3.util.ssl_.ALPN_PROTOCOLS = ["http/1.1"]
|
|
||||||
|
|
@ -1,32 +1,24 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
|
import collections
|
||||||
import functools
|
import functools
|
||||||
import logging
|
import logging
|
||||||
import typing
|
|
||||||
import warnings
|
|
||||||
from types import TracebackType
|
|
||||||
from urllib.parse import urljoin
|
|
||||||
|
|
||||||
from ._collections import HTTPHeaderDict, RecentlyUsedContainer
|
from ._collections import RecentlyUsedContainer
|
||||||
from ._request_methods import RequestMethods
|
|
||||||
from .connection import ProxyConfig
|
|
||||||
from .connectionpool import HTTPConnectionPool, HTTPSConnectionPool, port_by_scheme
|
from .connectionpool import HTTPConnectionPool, HTTPSConnectionPool, port_by_scheme
|
||||||
from .exceptions import (
|
from .exceptions import (
|
||||||
LocationValueError,
|
LocationValueError,
|
||||||
MaxRetryError,
|
MaxRetryError,
|
||||||
ProxySchemeUnknown,
|
ProxySchemeUnknown,
|
||||||
|
ProxySchemeUnsupported,
|
||||||
URLSchemeUnknown,
|
URLSchemeUnknown,
|
||||||
)
|
)
|
||||||
from .response import BaseHTTPResponse
|
from .packages import six
|
||||||
from .util.connection import _TYPE_SOCKET_OPTIONS
|
from .packages.six.moves.urllib.parse import urljoin
|
||||||
|
from .request import RequestMethods
|
||||||
from .util.proxy import connection_requires_http_tunnel
|
from .util.proxy import connection_requires_http_tunnel
|
||||||
from .util.retry import Retry
|
from .util.retry import Retry
|
||||||
from .util.timeout import Timeout
|
from .util.url import parse_url
|
||||||
from .util.url import Url, parse_url
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
import ssl
|
|
||||||
from typing import Literal
|
|
||||||
|
|
||||||
__all__ = ["PoolManager", "ProxyManager", "proxy_from_url"]
|
__all__ = ["PoolManager", "ProxyManager", "proxy_from_url"]
|
||||||
|
|
||||||
|
|
@ -38,64 +30,53 @@ SSL_KEYWORDS = (
|
||||||
"cert_file",
|
"cert_file",
|
||||||
"cert_reqs",
|
"cert_reqs",
|
||||||
"ca_certs",
|
"ca_certs",
|
||||||
"ca_cert_data",
|
|
||||||
"ssl_version",
|
"ssl_version",
|
||||||
"ssl_minimum_version",
|
|
||||||
"ssl_maximum_version",
|
|
||||||
"ca_cert_dir",
|
"ca_cert_dir",
|
||||||
"ssl_context",
|
"ssl_context",
|
||||||
"key_password",
|
"key_password",
|
||||||
"server_hostname",
|
"server_hostname",
|
||||||
)
|
)
|
||||||
# Default value for `blocksize` - a new parameter introduced to
|
|
||||||
# http.client.HTTPConnection & http.client.HTTPSConnection in Python 3.7
|
|
||||||
_DEFAULT_BLOCKSIZE = 16384
|
|
||||||
|
|
||||||
_SelfT = typing.TypeVar("_SelfT")
|
# All known keyword arguments that could be provided to the pool manager, its
|
||||||
|
# pools, or the underlying connections. This is used to construct a pool key.
|
||||||
|
_key_fields = (
|
||||||
|
"key_scheme", # str
|
||||||
|
"key_host", # str
|
||||||
|
"key_port", # int
|
||||||
|
"key_timeout", # int or float or Timeout
|
||||||
|
"key_retries", # int or Retry
|
||||||
|
"key_strict", # bool
|
||||||
|
"key_block", # bool
|
||||||
|
"key_source_address", # str
|
||||||
|
"key_key_file", # str
|
||||||
|
"key_key_password", # str
|
||||||
|
"key_cert_file", # str
|
||||||
|
"key_cert_reqs", # str
|
||||||
|
"key_ca_certs", # str
|
||||||
|
"key_ssl_version", # str
|
||||||
|
"key_ca_cert_dir", # str
|
||||||
|
"key_ssl_context", # instance of ssl.SSLContext or urllib3.util.ssl_.SSLContext
|
||||||
|
"key_maxsize", # int
|
||||||
|
"key_headers", # dict
|
||||||
|
"key__proxy", # parsed proxy url
|
||||||
|
"key__proxy_headers", # dict
|
||||||
|
"key__proxy_config", # class
|
||||||
|
"key_socket_options", # list of (level (int), optname (int), value (int or str)) tuples
|
||||||
|
"key__socks_options", # dict
|
||||||
|
"key_assert_hostname", # bool or string
|
||||||
|
"key_assert_fingerprint", # str
|
||||||
|
"key_server_hostname", # str
|
||||||
|
)
|
||||||
|
|
||||||
|
#: The namedtuple class used to construct keys for the connection pool.
|
||||||
|
#: All custom key schemes should include the fields in this key at a minimum.
|
||||||
|
PoolKey = collections.namedtuple("PoolKey", _key_fields)
|
||||||
|
|
||||||
|
_proxy_config_fields = ("ssl_context", "use_forwarding_for_https")
|
||||||
|
ProxyConfig = collections.namedtuple("ProxyConfig", _proxy_config_fields)
|
||||||
|
|
||||||
|
|
||||||
class PoolKey(typing.NamedTuple):
|
def _default_key_normalizer(key_class, request_context):
|
||||||
"""
|
|
||||||
All known keyword arguments that could be provided to the pool manager, its
|
|
||||||
pools, or the underlying connections.
|
|
||||||
|
|
||||||
All custom key schemes should include the fields in this key at a minimum.
|
|
||||||
"""
|
|
||||||
|
|
||||||
key_scheme: str
|
|
||||||
key_host: str
|
|
||||||
key_port: int | None
|
|
||||||
key_timeout: Timeout | float | int | None
|
|
||||||
key_retries: Retry | bool | int | None
|
|
||||||
key_block: bool | None
|
|
||||||
key_source_address: tuple[str, int] | None
|
|
||||||
key_key_file: str | None
|
|
||||||
key_key_password: str | None
|
|
||||||
key_cert_file: str | None
|
|
||||||
key_cert_reqs: str | None
|
|
||||||
key_ca_certs: str | None
|
|
||||||
key_ca_cert_data: str | bytes | None
|
|
||||||
key_ssl_version: int | str | None
|
|
||||||
key_ssl_minimum_version: ssl.TLSVersion | None
|
|
||||||
key_ssl_maximum_version: ssl.TLSVersion | None
|
|
||||||
key_ca_cert_dir: str | None
|
|
||||||
key_ssl_context: ssl.SSLContext | None
|
|
||||||
key_maxsize: int | None
|
|
||||||
key_headers: frozenset[tuple[str, str]] | None
|
|
||||||
key__proxy: Url | None
|
|
||||||
key__proxy_headers: frozenset[tuple[str, str]] | None
|
|
||||||
key__proxy_config: ProxyConfig | None
|
|
||||||
key_socket_options: _TYPE_SOCKET_OPTIONS | None
|
|
||||||
key__socks_options: frozenset[tuple[str, str]] | None
|
|
||||||
key_assert_hostname: bool | str | None
|
|
||||||
key_assert_fingerprint: str | None
|
|
||||||
key_server_hostname: str | None
|
|
||||||
key_blocksize: int | None
|
|
||||||
|
|
||||||
|
|
||||||
def _default_key_normalizer(
|
|
||||||
key_class: type[PoolKey], request_context: dict[str, typing.Any]
|
|
||||||
) -> PoolKey:
|
|
||||||
"""
|
"""
|
||||||
Create a pool key out of a request context dictionary.
|
Create a pool key out of a request context dictionary.
|
||||||
|
|
||||||
|
|
@ -141,10 +122,6 @@ def _default_key_normalizer(
|
||||||
if field not in context:
|
if field not in context:
|
||||||
context[field] = None
|
context[field] = None
|
||||||
|
|
||||||
# Default key_blocksize to _DEFAULT_BLOCKSIZE if missing from the context
|
|
||||||
if context.get("key_blocksize") is None:
|
|
||||||
context["key_blocksize"] = _DEFAULT_BLOCKSIZE
|
|
||||||
|
|
||||||
return key_class(**context)
|
return key_class(**context)
|
||||||
|
|
||||||
|
|
||||||
|
|
@ -177,63 +154,39 @@ class PoolManager(RequestMethods):
|
||||||
Additional parameters are used to create fresh
|
Additional parameters are used to create fresh
|
||||||
:class:`urllib3.connectionpool.ConnectionPool` instances.
|
:class:`urllib3.connectionpool.ConnectionPool` instances.
|
||||||
|
|
||||||
Example:
|
Example::
|
||||||
|
|
||||||
.. code-block:: python
|
>>> manager = PoolManager(num_pools=2)
|
||||||
|
>>> r = manager.request('GET', 'http://google.com/')
|
||||||
import urllib3
|
>>> r = manager.request('GET', 'http://google.com/mail')
|
||||||
|
>>> r = manager.request('GET', 'http://yahoo.com/')
|
||||||
http = urllib3.PoolManager(num_pools=2)
|
>>> len(manager.pools)
|
||||||
|
2
|
||||||
resp1 = http.request("GET", "https://google.com/")
|
|
||||||
resp2 = http.request("GET", "https://google.com/mail")
|
|
||||||
resp3 = http.request("GET", "https://yahoo.com/")
|
|
||||||
|
|
||||||
print(len(http.pools))
|
|
||||||
# 2
|
|
||||||
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
proxy: Url | None = None
|
proxy = None
|
||||||
proxy_config: ProxyConfig | None = None
|
proxy_config = None
|
||||||
|
|
||||||
def __init__(
|
def __init__(self, num_pools=10, headers=None, **connection_pool_kw):
|
||||||
self,
|
RequestMethods.__init__(self, headers)
|
||||||
num_pools: int = 10,
|
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
|
||||||
**connection_pool_kw: typing.Any,
|
|
||||||
) -> None:
|
|
||||||
super().__init__(headers)
|
|
||||||
self.connection_pool_kw = connection_pool_kw
|
self.connection_pool_kw = connection_pool_kw
|
||||||
|
self.pools = RecentlyUsedContainer(num_pools, dispose_func=lambda p: p.close())
|
||||||
self.pools: RecentlyUsedContainer[PoolKey, HTTPConnectionPool]
|
|
||||||
self.pools = RecentlyUsedContainer(num_pools)
|
|
||||||
|
|
||||||
# Locally set the pool classes and keys so other PoolManagers can
|
# Locally set the pool classes and keys so other PoolManagers can
|
||||||
# override them.
|
# override them.
|
||||||
self.pool_classes_by_scheme = pool_classes_by_scheme
|
self.pool_classes_by_scheme = pool_classes_by_scheme
|
||||||
self.key_fn_by_scheme = key_fn_by_scheme.copy()
|
self.key_fn_by_scheme = key_fn_by_scheme.copy()
|
||||||
|
|
||||||
def __enter__(self: _SelfT) -> _SelfT:
|
def __enter__(self):
|
||||||
return self
|
return self
|
||||||
|
|
||||||
def __exit__(
|
def __exit__(self, exc_type, exc_val, exc_tb):
|
||||||
self,
|
|
||||||
exc_type: type[BaseException] | None,
|
|
||||||
exc_val: BaseException | None,
|
|
||||||
exc_tb: TracebackType | None,
|
|
||||||
) -> Literal[False]:
|
|
||||||
self.clear()
|
self.clear()
|
||||||
# Return False to re-raise any potential exceptions
|
# Return False to re-raise any potential exceptions
|
||||||
return False
|
return False
|
||||||
|
|
||||||
def _new_pool(
|
def _new_pool(self, scheme, host, port, request_context=None):
|
||||||
self,
|
|
||||||
scheme: str,
|
|
||||||
host: str,
|
|
||||||
port: int,
|
|
||||||
request_context: dict[str, typing.Any] | None = None,
|
|
||||||
) -> HTTPConnectionPool:
|
|
||||||
"""
|
"""
|
||||||
Create a new :class:`urllib3.connectionpool.ConnectionPool` based on host, port, scheme, and
|
Create a new :class:`urllib3.connectionpool.ConnectionPool` based on host, port, scheme, and
|
||||||
any additional pool keyword arguments.
|
any additional pool keyword arguments.
|
||||||
|
|
@ -243,15 +196,10 @@ class PoolManager(RequestMethods):
|
||||||
connection pools handed out by :meth:`connection_from_url` and
|
connection pools handed out by :meth:`connection_from_url` and
|
||||||
companion methods. It is intended to be overridden for customization.
|
companion methods. It is intended to be overridden for customization.
|
||||||
"""
|
"""
|
||||||
pool_cls: type[HTTPConnectionPool] = self.pool_classes_by_scheme[scheme]
|
pool_cls = self.pool_classes_by_scheme[scheme]
|
||||||
if request_context is None:
|
if request_context is None:
|
||||||
request_context = self.connection_pool_kw.copy()
|
request_context = self.connection_pool_kw.copy()
|
||||||
|
|
||||||
# Default blocksize to _DEFAULT_BLOCKSIZE if missing or explicitly
|
|
||||||
# set to 'None' in the request_context.
|
|
||||||
if request_context.get("blocksize") is None:
|
|
||||||
request_context["blocksize"] = _DEFAULT_BLOCKSIZE
|
|
||||||
|
|
||||||
# Although the context has everything necessary to create the pool,
|
# Although the context has everything necessary to create the pool,
|
||||||
# this function has historically only used the scheme, host, and port
|
# this function has historically only used the scheme, host, and port
|
||||||
# in the positional args. When an API change is acceptable these can
|
# in the positional args. When an API change is acceptable these can
|
||||||
|
|
@ -265,7 +213,7 @@ class PoolManager(RequestMethods):
|
||||||
|
|
||||||
return pool_cls(host, port, **request_context)
|
return pool_cls(host, port, **request_context)
|
||||||
|
|
||||||
def clear(self) -> None:
|
def clear(self):
|
||||||
"""
|
"""
|
||||||
Empty our store of pools and direct them all to close.
|
Empty our store of pools and direct them all to close.
|
||||||
|
|
||||||
|
|
@ -274,13 +222,7 @@ class PoolManager(RequestMethods):
|
||||||
"""
|
"""
|
||||||
self.pools.clear()
|
self.pools.clear()
|
||||||
|
|
||||||
def connection_from_host(
|
def connection_from_host(self, host, port=None, scheme="http", pool_kwargs=None):
|
||||||
self,
|
|
||||||
host: str | None,
|
|
||||||
port: int | None = None,
|
|
||||||
scheme: str | None = "http",
|
|
||||||
pool_kwargs: dict[str, typing.Any] | None = None,
|
|
||||||
) -> HTTPConnectionPool:
|
|
||||||
"""
|
"""
|
||||||
Get a :class:`urllib3.connectionpool.ConnectionPool` based on the host, port, and scheme.
|
Get a :class:`urllib3.connectionpool.ConnectionPool` based on the host, port, and scheme.
|
||||||
|
|
||||||
|
|
@ -303,23 +245,13 @@ class PoolManager(RequestMethods):
|
||||||
|
|
||||||
return self.connection_from_context(request_context)
|
return self.connection_from_context(request_context)
|
||||||
|
|
||||||
def connection_from_context(
|
def connection_from_context(self, request_context):
|
||||||
self, request_context: dict[str, typing.Any]
|
|
||||||
) -> HTTPConnectionPool:
|
|
||||||
"""
|
"""
|
||||||
Get a :class:`urllib3.connectionpool.ConnectionPool` based on the request context.
|
Get a :class:`urllib3.connectionpool.ConnectionPool` based on the request context.
|
||||||
|
|
||||||
``request_context`` must at least contain the ``scheme`` key and its
|
``request_context`` must at least contain the ``scheme`` key and its
|
||||||
value must be a key in ``key_fn_by_scheme`` instance variable.
|
value must be a key in ``key_fn_by_scheme`` instance variable.
|
||||||
"""
|
"""
|
||||||
if "strict" in request_context:
|
|
||||||
warnings.warn(
|
|
||||||
"The 'strict' parameter is no longer needed on Python 3+. "
|
|
||||||
"This will raise an error in urllib3 v2.1.0.",
|
|
||||||
DeprecationWarning,
|
|
||||||
)
|
|
||||||
request_context.pop("strict")
|
|
||||||
|
|
||||||
scheme = request_context["scheme"].lower()
|
scheme = request_context["scheme"].lower()
|
||||||
pool_key_constructor = self.key_fn_by_scheme.get(scheme)
|
pool_key_constructor = self.key_fn_by_scheme.get(scheme)
|
||||||
if not pool_key_constructor:
|
if not pool_key_constructor:
|
||||||
|
|
@ -328,9 +260,7 @@ class PoolManager(RequestMethods):
|
||||||
|
|
||||||
return self.connection_from_pool_key(pool_key, request_context=request_context)
|
return self.connection_from_pool_key(pool_key, request_context=request_context)
|
||||||
|
|
||||||
def connection_from_pool_key(
|
def connection_from_pool_key(self, pool_key, request_context=None):
|
||||||
self, pool_key: PoolKey, request_context: dict[str, typing.Any]
|
|
||||||
) -> HTTPConnectionPool:
|
|
||||||
"""
|
"""
|
||||||
Get a :class:`urllib3.connectionpool.ConnectionPool` based on the provided pool key.
|
Get a :class:`urllib3.connectionpool.ConnectionPool` based on the provided pool key.
|
||||||
|
|
||||||
|
|
@ -354,9 +284,7 @@ class PoolManager(RequestMethods):
|
||||||
|
|
||||||
return pool
|
return pool
|
||||||
|
|
||||||
def connection_from_url(
|
def connection_from_url(self, url, pool_kwargs=None):
|
||||||
self, url: str, pool_kwargs: dict[str, typing.Any] | None = None
|
|
||||||
) -> HTTPConnectionPool:
|
|
||||||
"""
|
"""
|
||||||
Similar to :func:`urllib3.connectionpool.connection_from_url`.
|
Similar to :func:`urllib3.connectionpool.connection_from_url`.
|
||||||
|
|
||||||
|
|
@ -372,9 +300,7 @@ class PoolManager(RequestMethods):
|
||||||
u.host, port=u.port, scheme=u.scheme, pool_kwargs=pool_kwargs
|
u.host, port=u.port, scheme=u.scheme, pool_kwargs=pool_kwargs
|
||||||
)
|
)
|
||||||
|
|
||||||
def _merge_pool_kwargs(
|
def _merge_pool_kwargs(self, override):
|
||||||
self, override: dict[str, typing.Any] | None
|
|
||||||
) -> dict[str, typing.Any]:
|
|
||||||
"""
|
"""
|
||||||
Merge a dictionary of override values for self.connection_pool_kw.
|
Merge a dictionary of override values for self.connection_pool_kw.
|
||||||
|
|
||||||
|
|
@ -394,7 +320,7 @@ class PoolManager(RequestMethods):
|
||||||
base_pool_kwargs[key] = value
|
base_pool_kwargs[key] = value
|
||||||
return base_pool_kwargs
|
return base_pool_kwargs
|
||||||
|
|
||||||
def _proxy_requires_url_absolute_form(self, parsed_url: Url) -> bool:
|
def _proxy_requires_url_absolute_form(self, parsed_url):
|
||||||
"""
|
"""
|
||||||
Indicates if the proxy requires the complete destination URL in the
|
Indicates if the proxy requires the complete destination URL in the
|
||||||
request. Normally this is only needed when not using an HTTP CONNECT
|
request. Normally this is only needed when not using an HTTP CONNECT
|
||||||
|
|
@ -407,9 +333,24 @@ class PoolManager(RequestMethods):
|
||||||
self.proxy, self.proxy_config, parsed_url.scheme
|
self.proxy, self.proxy_config, parsed_url.scheme
|
||||||
)
|
)
|
||||||
|
|
||||||
def urlopen( # type: ignore[override]
|
def _validate_proxy_scheme_url_selection(self, url_scheme):
|
||||||
self, method: str, url: str, redirect: bool = True, **kw: typing.Any
|
"""
|
||||||
) -> BaseHTTPResponse:
|
Validates that were not attempting to do TLS in TLS connections on
|
||||||
|
Python2 or with unsupported SSL implementations.
|
||||||
|
"""
|
||||||
|
if self.proxy is None or url_scheme != "https":
|
||||||
|
return
|
||||||
|
|
||||||
|
if self.proxy.scheme != "https":
|
||||||
|
return
|
||||||
|
|
||||||
|
if six.PY2 and not self.proxy_config.use_forwarding_for_https:
|
||||||
|
raise ProxySchemeUnsupported(
|
||||||
|
"Contacting HTTPS destinations through HTTPS proxies "
|
||||||
|
"'via CONNECT tunnels' is not supported in Python 2"
|
||||||
|
)
|
||||||
|
|
||||||
|
def urlopen(self, method, url, redirect=True, **kw):
|
||||||
"""
|
"""
|
||||||
Same as :meth:`urllib3.HTTPConnectionPool.urlopen`
|
Same as :meth:`urllib3.HTTPConnectionPool.urlopen`
|
||||||
with custom cross-host redirect logic and only sends the request-uri
|
with custom cross-host redirect logic and only sends the request-uri
|
||||||
|
|
@ -419,16 +360,7 @@ class PoolManager(RequestMethods):
|
||||||
:class:`urllib3.connectionpool.ConnectionPool` can be chosen for it.
|
:class:`urllib3.connectionpool.ConnectionPool` can be chosen for it.
|
||||||
"""
|
"""
|
||||||
u = parse_url(url)
|
u = parse_url(url)
|
||||||
|
self._validate_proxy_scheme_url_selection(u.scheme)
|
||||||
if u.scheme is None:
|
|
||||||
warnings.warn(
|
|
||||||
"URLs without a scheme (ie 'https://') are deprecated and will raise an error "
|
|
||||||
"in a future version of urllib3. To avoid this DeprecationWarning ensure all URLs "
|
|
||||||
"start with 'https://' or 'http://'. Read more in this issue: "
|
|
||||||
"https://github.com/urllib3/urllib3/issues/2920",
|
|
||||||
category=DeprecationWarning,
|
|
||||||
stacklevel=2,
|
|
||||||
)
|
|
||||||
|
|
||||||
conn = self.connection_from_host(u.host, port=u.port, scheme=u.scheme)
|
conn = self.connection_from_host(u.host, port=u.port, scheme=u.scheme)
|
||||||
|
|
||||||
|
|
@ -436,7 +368,7 @@ class PoolManager(RequestMethods):
|
||||||
kw["redirect"] = False
|
kw["redirect"] = False
|
||||||
|
|
||||||
if "headers" not in kw:
|
if "headers" not in kw:
|
||||||
kw["headers"] = self.headers
|
kw["headers"] = self.headers.copy()
|
||||||
|
|
||||||
if self._proxy_requires_url_absolute_form(u):
|
if self._proxy_requires_url_absolute_form(u):
|
||||||
response = conn.urlopen(method, url, **kw)
|
response = conn.urlopen(method, url, **kw)
|
||||||
|
|
@ -450,12 +382,9 @@ class PoolManager(RequestMethods):
|
||||||
# Support relative URLs for redirecting.
|
# Support relative URLs for redirecting.
|
||||||
redirect_location = urljoin(url, redirect_location)
|
redirect_location = urljoin(url, redirect_location)
|
||||||
|
|
||||||
|
# RFC 7231, Section 6.4.4
|
||||||
if response.status == 303:
|
if response.status == 303:
|
||||||
# Change the method according to RFC 9110, Section 15.4.4.
|
|
||||||
method = "GET"
|
method = "GET"
|
||||||
# And lose the body not to transfer anything sensitive.
|
|
||||||
kw["body"] = None
|
|
||||||
kw["headers"] = HTTPHeaderDict(kw["headers"])._prepare_for_method_change()
|
|
||||||
|
|
||||||
retries = kw.get("retries")
|
retries = kw.get("retries")
|
||||||
if not isinstance(retries, Retry):
|
if not isinstance(retries, Retry):
|
||||||
|
|
@ -467,11 +396,10 @@ class PoolManager(RequestMethods):
|
||||||
if retries.remove_headers_on_redirect and not conn.is_same_host(
|
if retries.remove_headers_on_redirect and not conn.is_same_host(
|
||||||
redirect_location
|
redirect_location
|
||||||
):
|
):
|
||||||
new_headers = kw["headers"].copy()
|
headers = list(six.iterkeys(kw["headers"]))
|
||||||
for header in kw["headers"]:
|
for header in headers:
|
||||||
if header.lower() in retries.remove_headers_on_redirect:
|
if header.lower() in retries.remove_headers_on_redirect:
|
||||||
new_headers.pop(header, None)
|
kw["headers"].pop(header, None)
|
||||||
kw["headers"] = new_headers
|
|
||||||
|
|
||||||
try:
|
try:
|
||||||
retries = retries.increment(method, url, response=response, _pool=conn)
|
retries = retries.increment(method, url, response=response, _pool=conn)
|
||||||
|
|
@ -517,51 +445,37 @@ class ProxyManager(PoolManager):
|
||||||
private. IP address, target hostname, SNI, and port are always visible
|
private. IP address, target hostname, SNI, and port are always visible
|
||||||
to an HTTPS proxy even when this flag is disabled.
|
to an HTTPS proxy even when this flag is disabled.
|
||||||
|
|
||||||
:param proxy_assert_hostname:
|
|
||||||
The hostname of the certificate to verify against.
|
|
||||||
|
|
||||||
:param proxy_assert_fingerprint:
|
|
||||||
The fingerprint of the certificate to verify against.
|
|
||||||
|
|
||||||
Example:
|
Example:
|
||||||
|
>>> proxy = urllib3.ProxyManager('http://localhost:3128/')
|
||||||
.. code-block:: python
|
>>> r1 = proxy.request('GET', 'http://google.com/')
|
||||||
|
>>> r2 = proxy.request('GET', 'http://httpbin.org/')
|
||||||
import urllib3
|
>>> len(proxy.pools)
|
||||||
|
1
|
||||||
proxy = urllib3.ProxyManager("https://localhost:3128/")
|
>>> r3 = proxy.request('GET', 'https://httpbin.org/')
|
||||||
|
>>> r4 = proxy.request('GET', 'https://twitter.com/')
|
||||||
resp1 = proxy.request("GET", "https://google.com/")
|
>>> len(proxy.pools)
|
||||||
resp2 = proxy.request("GET", "https://httpbin.org/")
|
3
|
||||||
|
|
||||||
print(len(proxy.pools))
|
|
||||||
# 1
|
|
||||||
|
|
||||||
resp3 = proxy.request("GET", "https://httpbin.org/")
|
|
||||||
resp4 = proxy.request("GET", "https://twitter.com/")
|
|
||||||
|
|
||||||
print(len(proxy.pools))
|
|
||||||
# 3
|
|
||||||
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
proxy_url: str,
|
proxy_url,
|
||||||
num_pools: int = 10,
|
num_pools=10,
|
||||||
headers: typing.Mapping[str, str] | None = None,
|
headers=None,
|
||||||
proxy_headers: typing.Mapping[str, str] | None = None,
|
proxy_headers=None,
|
||||||
proxy_ssl_context: ssl.SSLContext | None = None,
|
proxy_ssl_context=None,
|
||||||
use_forwarding_for_https: bool = False,
|
use_forwarding_for_https=False,
|
||||||
proxy_assert_hostname: None | str | Literal[False] = None,
|
**connection_pool_kw
|
||||||
proxy_assert_fingerprint: str | None = None,
|
):
|
||||||
**connection_pool_kw: typing.Any,
|
|
||||||
) -> None:
|
|
||||||
if isinstance(proxy_url, HTTPConnectionPool):
|
if isinstance(proxy_url, HTTPConnectionPool):
|
||||||
str_proxy_url = f"{proxy_url.scheme}://{proxy_url.host}:{proxy_url.port}"
|
proxy_url = "%s://%s:%i" % (
|
||||||
else:
|
proxy_url.scheme,
|
||||||
str_proxy_url = proxy_url
|
proxy_url.host,
|
||||||
proxy = parse_url(str_proxy_url)
|
proxy_url.port,
|
||||||
|
)
|
||||||
|
proxy = parse_url(proxy_url)
|
||||||
|
|
||||||
if proxy.scheme not in ("http", "https"):
|
if proxy.scheme not in ("http", "https"):
|
||||||
raise ProxySchemeUnknown(proxy.scheme)
|
raise ProxySchemeUnknown(proxy.scheme)
|
||||||
|
|
@ -573,38 +487,25 @@ class ProxyManager(PoolManager):
|
||||||
self.proxy = proxy
|
self.proxy = proxy
|
||||||
self.proxy_headers = proxy_headers or {}
|
self.proxy_headers = proxy_headers or {}
|
||||||
self.proxy_ssl_context = proxy_ssl_context
|
self.proxy_ssl_context = proxy_ssl_context
|
||||||
self.proxy_config = ProxyConfig(
|
self.proxy_config = ProxyConfig(proxy_ssl_context, use_forwarding_for_https)
|
||||||
proxy_ssl_context,
|
|
||||||
use_forwarding_for_https,
|
|
||||||
proxy_assert_hostname,
|
|
||||||
proxy_assert_fingerprint,
|
|
||||||
)
|
|
||||||
|
|
||||||
connection_pool_kw["_proxy"] = self.proxy
|
connection_pool_kw["_proxy"] = self.proxy
|
||||||
connection_pool_kw["_proxy_headers"] = self.proxy_headers
|
connection_pool_kw["_proxy_headers"] = self.proxy_headers
|
||||||
connection_pool_kw["_proxy_config"] = self.proxy_config
|
connection_pool_kw["_proxy_config"] = self.proxy_config
|
||||||
|
|
||||||
super().__init__(num_pools, headers, **connection_pool_kw)
|
super(ProxyManager, self).__init__(num_pools, headers, **connection_pool_kw)
|
||||||
|
|
||||||
def connection_from_host(
|
def connection_from_host(self, host, port=None, scheme="http", pool_kwargs=None):
|
||||||
self,
|
|
||||||
host: str | None,
|
|
||||||
port: int | None = None,
|
|
||||||
scheme: str | None = "http",
|
|
||||||
pool_kwargs: dict[str, typing.Any] | None = None,
|
|
||||||
) -> HTTPConnectionPool:
|
|
||||||
if scheme == "https":
|
if scheme == "https":
|
||||||
return super().connection_from_host(
|
return super(ProxyManager, self).connection_from_host(
|
||||||
host, port, scheme, pool_kwargs=pool_kwargs
|
host, port, scheme, pool_kwargs=pool_kwargs
|
||||||
)
|
)
|
||||||
|
|
||||||
return super().connection_from_host(
|
return super(ProxyManager, self).connection_from_host(
|
||||||
self.proxy.host, self.proxy.port, self.proxy.scheme, pool_kwargs=pool_kwargs # type: ignore[union-attr]
|
self.proxy.host, self.proxy.port, self.proxy.scheme, pool_kwargs=pool_kwargs
|
||||||
)
|
)
|
||||||
|
|
||||||
def _set_proxy_headers(
|
def _set_proxy_headers(self, url, headers=None):
|
||||||
self, url: str, headers: typing.Mapping[str, str] | None = None
|
|
||||||
) -> typing.Mapping[str, str]:
|
|
||||||
"""
|
"""
|
||||||
Sets headers needed by proxies: specifically, the Accept and Host
|
Sets headers needed by proxies: specifically, the Accept and Host
|
||||||
headers. Only sets headers not provided by the user.
|
headers. Only sets headers not provided by the user.
|
||||||
|
|
@ -619,9 +520,7 @@ class ProxyManager(PoolManager):
|
||||||
headers_.update(headers)
|
headers_.update(headers)
|
||||||
return headers_
|
return headers_
|
||||||
|
|
||||||
def urlopen( # type: ignore[override]
|
def urlopen(self, method, url, redirect=True, **kw):
|
||||||
self, method: str, url: str, redirect: bool = True, **kw: typing.Any
|
|
||||||
) -> BaseHTTPResponse:
|
|
||||||
"Same as HTTP(S)ConnectionPool.urlopen, ``url`` must be absolute."
|
"Same as HTTP(S)ConnectionPool.urlopen, ``url`` must be absolute."
|
||||||
u = parse_url(url)
|
u = parse_url(url)
|
||||||
if not connection_requires_http_tunnel(self.proxy, self.proxy_config, u.scheme):
|
if not connection_requires_http_tunnel(self.proxy, self.proxy_config, u.scheme):
|
||||||
|
|
@ -631,8 +530,8 @@ class ProxyManager(PoolManager):
|
||||||
headers = kw.get("headers", self.headers)
|
headers = kw.get("headers", self.headers)
|
||||||
kw["headers"] = self._set_proxy_headers(url, headers)
|
kw["headers"] = self._set_proxy_headers(url, headers)
|
||||||
|
|
||||||
return super().urlopen(method, url, redirect=redirect, **kw)
|
return super(ProxyManager, self).urlopen(method, url, redirect=redirect, **kw)
|
||||||
|
|
||||||
|
|
||||||
def proxy_from_url(url: str, **kw: typing.Any) -> ProxyManager:
|
def proxy_from_url(url, **kw):
|
||||||
return ProxyManager(proxy_url=url, **kw)
|
return ProxyManager(proxy_url=url, **kw)
|
||||||
|
|
|
||||||
|
|
@ -1,2 +0,0 @@
|
||||||
# Instruct type checkers to look for inline type annotations in this package.
|
|
||||||
# See PEP 561.
|
|
||||||
File diff suppressed because it is too large
Load Diff
|
|
@ -1,39 +1,46 @@
|
||||||
# For backwards compatibility, provide imports that used to be here.
|
from __future__ import absolute_import
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
|
# For backwards compatibility, provide imports that used to be here.
|
||||||
from .connection import is_connection_dropped
|
from .connection import is_connection_dropped
|
||||||
from .request import SKIP_HEADER, SKIPPABLE_HEADERS, make_headers
|
from .request import SKIP_HEADER, SKIPPABLE_HEADERS, make_headers
|
||||||
from .response import is_fp_closed
|
from .response import is_fp_closed
|
||||||
from .retry import Retry
|
from .retry import Retry
|
||||||
from .ssl_ import (
|
from .ssl_ import (
|
||||||
ALPN_PROTOCOLS,
|
ALPN_PROTOCOLS,
|
||||||
|
HAS_SNI,
|
||||||
IS_PYOPENSSL,
|
IS_PYOPENSSL,
|
||||||
|
IS_SECURETRANSPORT,
|
||||||
|
PROTOCOL_TLS,
|
||||||
SSLContext,
|
SSLContext,
|
||||||
assert_fingerprint,
|
assert_fingerprint,
|
||||||
create_urllib3_context,
|
|
||||||
resolve_cert_reqs,
|
resolve_cert_reqs,
|
||||||
resolve_ssl_version,
|
resolve_ssl_version,
|
||||||
ssl_wrap_socket,
|
ssl_wrap_socket,
|
||||||
)
|
)
|
||||||
from .timeout import Timeout
|
from .timeout import Timeout, current_time
|
||||||
from .url import Url, parse_url
|
from .url import Url, get_host, parse_url, split_first
|
||||||
from .wait import wait_for_read, wait_for_write
|
from .wait import wait_for_read, wait_for_write
|
||||||
|
|
||||||
__all__ = (
|
__all__ = (
|
||||||
|
"HAS_SNI",
|
||||||
"IS_PYOPENSSL",
|
"IS_PYOPENSSL",
|
||||||
|
"IS_SECURETRANSPORT",
|
||||||
"SSLContext",
|
"SSLContext",
|
||||||
|
"PROTOCOL_TLS",
|
||||||
"ALPN_PROTOCOLS",
|
"ALPN_PROTOCOLS",
|
||||||
"Retry",
|
"Retry",
|
||||||
"Timeout",
|
"Timeout",
|
||||||
"Url",
|
"Url",
|
||||||
"assert_fingerprint",
|
"assert_fingerprint",
|
||||||
"create_urllib3_context",
|
"current_time",
|
||||||
"is_connection_dropped",
|
"is_connection_dropped",
|
||||||
"is_fp_closed",
|
"is_fp_closed",
|
||||||
|
"get_host",
|
||||||
"parse_url",
|
"parse_url",
|
||||||
"make_headers",
|
"make_headers",
|
||||||
"resolve_cert_reqs",
|
"resolve_cert_reqs",
|
||||||
"resolve_ssl_version",
|
"resolve_ssl_version",
|
||||||
|
"split_first",
|
||||||
"ssl_wrap_socket",
|
"ssl_wrap_socket",
|
||||||
"wait_for_read",
|
"wait_for_read",
|
||||||
"wait_for_write",
|
"wait_for_write",
|
||||||
|
|
|
||||||
|
|
@ -1,23 +1,33 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import socket
|
import socket
|
||||||
import typing
|
|
||||||
|
|
||||||
|
from ..contrib import _appengine_environ
|
||||||
from ..exceptions import LocationParseError
|
from ..exceptions import LocationParseError
|
||||||
from .timeout import _DEFAULT_TIMEOUT, _TYPE_TIMEOUT
|
from ..packages import six
|
||||||
|
from .wait import NoWayToWaitForSocketError, wait_for_read
|
||||||
_TYPE_SOCKET_OPTIONS = typing.Sequence[typing.Tuple[int, int, typing.Union[int, bytes]]]
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
from .._base_connection import BaseHTTPConnection
|
|
||||||
|
|
||||||
|
|
||||||
def is_connection_dropped(conn: BaseHTTPConnection) -> bool: # Platform-specific
|
def is_connection_dropped(conn): # Platform-specific
|
||||||
"""
|
"""
|
||||||
Returns True if the connection is dropped and should be closed.
|
Returns True if the connection is dropped and should be closed.
|
||||||
:param conn: :class:`urllib3.connection.HTTPConnection` object.
|
|
||||||
|
:param conn:
|
||||||
|
:class:`http.client.HTTPConnection` object.
|
||||||
|
|
||||||
|
Note: For platforms like AppEngine, this will always return ``False`` to
|
||||||
|
let the platform handle connection recycling transparently for us.
|
||||||
"""
|
"""
|
||||||
return not conn.is_connected
|
sock = getattr(conn, "sock", False)
|
||||||
|
if sock is False: # Platform-specific: AppEngine
|
||||||
|
return False
|
||||||
|
if sock is None: # Connection already closed (such as by httplib).
|
||||||
|
return True
|
||||||
|
try:
|
||||||
|
# Returns True if readable, which here means it's been dropped
|
||||||
|
return wait_for_read(sock, timeout=0.0)
|
||||||
|
except NoWayToWaitForSocketError: # Platform-specific: AppEngine
|
||||||
|
return False
|
||||||
|
|
||||||
|
|
||||||
# This function is copied from socket.py in the Python 2.7 standard
|
# This function is copied from socket.py in the Python 2.7 standard
|
||||||
|
|
@ -25,11 +35,11 @@ def is_connection_dropped(conn: BaseHTTPConnection) -> bool: # Platform-specifi
|
||||||
# One additional modification is that we avoid binding to IPv6 servers
|
# One additional modification is that we avoid binding to IPv6 servers
|
||||||
# discovered in DNS if the system doesn't have IPv6 functionality.
|
# discovered in DNS if the system doesn't have IPv6 functionality.
|
||||||
def create_connection(
|
def create_connection(
|
||||||
address: tuple[str, int],
|
address,
|
||||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
timeout=socket._GLOBAL_DEFAULT_TIMEOUT,
|
||||||
source_address: tuple[str, int] | None = None,
|
source_address=None,
|
||||||
socket_options: _TYPE_SOCKET_OPTIONS | None = None,
|
socket_options=None,
|
||||||
) -> socket.socket:
|
):
|
||||||
"""Connect to *address* and return the socket object.
|
"""Connect to *address* and return the socket object.
|
||||||
|
|
||||||
Convenience function. Connect to *address* (a 2-tuple ``(host,
|
Convenience function. Connect to *address* (a 2-tuple ``(host,
|
||||||
|
|
@ -55,7 +65,9 @@ def create_connection(
|
||||||
try:
|
try:
|
||||||
host.encode("idna")
|
host.encode("idna")
|
||||||
except UnicodeError:
|
except UnicodeError:
|
||||||
raise LocationParseError(f"'{host}', label empty or too long") from None
|
return six.raise_from(
|
||||||
|
LocationParseError(u"'%s', label empty or too long" % host), None
|
||||||
|
)
|
||||||
|
|
||||||
for res in socket.getaddrinfo(host, port, family, socket.SOCK_STREAM):
|
for res in socket.getaddrinfo(host, port, family, socket.SOCK_STREAM):
|
||||||
af, socktype, proto, canonname, sa = res
|
af, socktype, proto, canonname, sa = res
|
||||||
|
|
@ -66,33 +78,26 @@ def create_connection(
|
||||||
# If provided, set socket level options before connecting.
|
# If provided, set socket level options before connecting.
|
||||||
_set_socket_options(sock, socket_options)
|
_set_socket_options(sock, socket_options)
|
||||||
|
|
||||||
if timeout is not _DEFAULT_TIMEOUT:
|
if timeout is not socket._GLOBAL_DEFAULT_TIMEOUT:
|
||||||
sock.settimeout(timeout)
|
sock.settimeout(timeout)
|
||||||
if source_address:
|
if source_address:
|
||||||
sock.bind(source_address)
|
sock.bind(source_address)
|
||||||
sock.connect(sa)
|
sock.connect(sa)
|
||||||
# Break explicitly a reference cycle
|
|
||||||
err = None
|
|
||||||
return sock
|
return sock
|
||||||
|
|
||||||
except OSError as _:
|
except socket.error as e:
|
||||||
err = _
|
err = e
|
||||||
if sock is not None:
|
if sock is not None:
|
||||||
sock.close()
|
sock.close()
|
||||||
|
sock = None
|
||||||
|
|
||||||
if err is not None:
|
if err is not None:
|
||||||
try:
|
|
||||||
raise err
|
raise err
|
||||||
finally:
|
|
||||||
# Break explicitly a reference cycle
|
raise socket.error("getaddrinfo returns an empty list")
|
||||||
err = None
|
|
||||||
else:
|
|
||||||
raise OSError("getaddrinfo returns an empty list")
|
|
||||||
|
|
||||||
|
|
||||||
def _set_socket_options(
|
def _set_socket_options(sock, options):
|
||||||
sock: socket.socket, options: _TYPE_SOCKET_OPTIONS | None
|
|
||||||
) -> None:
|
|
||||||
if options is None:
|
if options is None:
|
||||||
return
|
return
|
||||||
|
|
||||||
|
|
@ -100,7 +105,7 @@ def _set_socket_options(
|
||||||
sock.setsockopt(*opt)
|
sock.setsockopt(*opt)
|
||||||
|
|
||||||
|
|
||||||
def allowed_gai_family() -> socket.AddressFamily:
|
def allowed_gai_family():
|
||||||
"""This function is designed to work in the context of
|
"""This function is designed to work in the context of
|
||||||
getaddrinfo, where family=socket.AF_UNSPEC is the default and
|
getaddrinfo, where family=socket.AF_UNSPEC is the default and
|
||||||
will perform a DNS search for both IPv6 and IPv4 records."""
|
will perform a DNS search for both IPv6 and IPv4 records."""
|
||||||
|
|
@ -111,11 +116,18 @@ def allowed_gai_family() -> socket.AddressFamily:
|
||||||
return family
|
return family
|
||||||
|
|
||||||
|
|
||||||
def _has_ipv6(host: str) -> bool:
|
def _has_ipv6(host):
|
||||||
"""Returns True if the system can bind an IPv6 address."""
|
"""Returns True if the system can bind an IPv6 address."""
|
||||||
sock = None
|
sock = None
|
||||||
has_ipv6 = False
|
has_ipv6 = False
|
||||||
|
|
||||||
|
# App Engine doesn't support IPV6 sockets and actually has a quota on the
|
||||||
|
# number of sockets that can be used, so just early out here instead of
|
||||||
|
# creating a socket needlessly.
|
||||||
|
# See https://github.com/urllib3/urllib3/issues/1446
|
||||||
|
if _appengine_environ.is_appengine_sandbox():
|
||||||
|
return False
|
||||||
|
|
||||||
if socket.has_ipv6:
|
if socket.has_ipv6:
|
||||||
# has_ipv6 returns true if cPython was compiled with IPv6 support.
|
# has_ipv6 returns true if cPython was compiled with IPv6 support.
|
||||||
# It does not tell us if the system has IPv6 support enabled. To
|
# It does not tell us if the system has IPv6 support enabled. To
|
||||||
|
|
|
||||||
|
|
@ -1,18 +1,9 @@
|
||||||
from __future__ import annotations
|
from .ssl_ import create_urllib3_context, resolve_cert_reqs, resolve_ssl_version
|
||||||
|
|
||||||
import typing
|
|
||||||
|
|
||||||
from .url import Url
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
from ..connection import ProxyConfig
|
|
||||||
|
|
||||||
|
|
||||||
def connection_requires_http_tunnel(
|
def connection_requires_http_tunnel(
|
||||||
proxy_url: Url | None = None,
|
proxy_url=None, proxy_config=None, destination_scheme=None
|
||||||
proxy_config: ProxyConfig | None = None,
|
):
|
||||||
destination_scheme: str | None = None,
|
|
||||||
) -> bool:
|
|
||||||
"""
|
"""
|
||||||
Returns True if the connection requires an HTTP CONNECT through the proxy.
|
Returns True if the connection requires an HTTP CONNECT through the proxy.
|
||||||
|
|
||||||
|
|
@ -41,3 +32,26 @@ def connection_requires_http_tunnel(
|
||||||
|
|
||||||
# Otherwise always use a tunnel.
|
# Otherwise always use a tunnel.
|
||||||
return True
|
return True
|
||||||
|
|
||||||
|
|
||||||
|
def create_proxy_ssl_context(
|
||||||
|
ssl_version, cert_reqs, ca_certs=None, ca_cert_dir=None, ca_cert_data=None
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Generates a default proxy ssl context if one hasn't been provided by the
|
||||||
|
user.
|
||||||
|
"""
|
||||||
|
ssl_context = create_urllib3_context(
|
||||||
|
ssl_version=resolve_ssl_version(ssl_version),
|
||||||
|
cert_reqs=resolve_cert_reqs(cert_reqs),
|
||||||
|
)
|
||||||
|
|
||||||
|
if (
|
||||||
|
not ca_certs
|
||||||
|
and not ca_cert_dir
|
||||||
|
and not ca_cert_data
|
||||||
|
and hasattr(ssl_context, "load_default_certs")
|
||||||
|
):
|
||||||
|
ssl_context.load_default_certs()
|
||||||
|
|
||||||
|
return ssl_context
|
||||||
|
|
|
||||||
|
|
@ -1,15 +1,9 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import io
|
|
||||||
import typing
|
|
||||||
from base64 import b64encode
|
from base64 import b64encode
|
||||||
from enum import Enum
|
|
||||||
|
|
||||||
from ..exceptions import UnrewindableBodyError
|
from ..exceptions import UnrewindableBodyError
|
||||||
from .util import to_bytes
|
from ..packages.six import b, integer_types
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
from typing import Final
|
|
||||||
|
|
||||||
# Pass as a value within ``headers`` to skip
|
# Pass as a value within ``headers`` to skip
|
||||||
# emitting some HTTP headers that are added automatically.
|
# emitting some HTTP headers that are added automatically.
|
||||||
|
|
@ -21,45 +15,25 @@ SKIPPABLE_HEADERS = frozenset(["accept-encoding", "host", "user-agent"])
|
||||||
ACCEPT_ENCODING = "gzip,deflate"
|
ACCEPT_ENCODING = "gzip,deflate"
|
||||||
try:
|
try:
|
||||||
try:
|
try:
|
||||||
import brotlicffi as _unused_module_brotli # type: ignore[import-not-found] # noqa: F401
|
import brotlicffi as _unused_module_brotli # noqa: F401
|
||||||
except ImportError:
|
except ImportError:
|
||||||
import brotli as _unused_module_brotli # type: ignore[import-not-found] # noqa: F401
|
import brotli as _unused_module_brotli # noqa: F401
|
||||||
except ImportError:
|
except ImportError:
|
||||||
pass
|
pass
|
||||||
else:
|
else:
|
||||||
ACCEPT_ENCODING += ",br"
|
ACCEPT_ENCODING += ",br"
|
||||||
try:
|
|
||||||
import zstandard as _unused_module_zstd # type: ignore[import-not-found] # noqa: F401
|
|
||||||
except ImportError:
|
|
||||||
pass
|
|
||||||
else:
|
|
||||||
ACCEPT_ENCODING += ",zstd"
|
|
||||||
|
|
||||||
|
_FAILEDTELL = object()
|
||||||
class _TYPE_FAILEDTELL(Enum):
|
|
||||||
token = 0
|
|
||||||
|
|
||||||
|
|
||||||
_FAILEDTELL: Final[_TYPE_FAILEDTELL] = _TYPE_FAILEDTELL.token
|
|
||||||
|
|
||||||
_TYPE_BODY_POSITION = typing.Union[int, _TYPE_FAILEDTELL]
|
|
||||||
|
|
||||||
# When sending a request with these methods we aren't expecting
|
|
||||||
# a body so don't need to set an explicit 'Content-Length: 0'
|
|
||||||
# The reason we do this in the negative instead of tracking methods
|
|
||||||
# which 'should' have a body is because unknown methods should be
|
|
||||||
# treated as if they were 'POST' which *does* expect a body.
|
|
||||||
_METHODS_NOT_EXPECTING_BODY = {"GET", "HEAD", "DELETE", "TRACE", "OPTIONS", "CONNECT"}
|
|
||||||
|
|
||||||
|
|
||||||
def make_headers(
|
def make_headers(
|
||||||
keep_alive: bool | None = None,
|
keep_alive=None,
|
||||||
accept_encoding: bool | list[str] | str | None = None,
|
accept_encoding=None,
|
||||||
user_agent: str | None = None,
|
user_agent=None,
|
||||||
basic_auth: str | None = None,
|
basic_auth=None,
|
||||||
proxy_basic_auth: str | None = None,
|
proxy_basic_auth=None,
|
||||||
disable_cache: bool | None = None,
|
disable_cache=None,
|
||||||
) -> dict[str, str]:
|
):
|
||||||
"""
|
"""
|
||||||
Shortcuts for generating request headers.
|
Shortcuts for generating request headers.
|
||||||
|
|
||||||
|
|
@ -68,8 +42,7 @@ def make_headers(
|
||||||
|
|
||||||
:param accept_encoding:
|
:param accept_encoding:
|
||||||
Can be a boolean, list, or string.
|
Can be a boolean, list, or string.
|
||||||
``True`` translates to 'gzip,deflate'. If either the ``brotli`` or
|
``True`` translates to 'gzip,deflate'.
|
||||||
``brotlicffi`` package is installed 'gzip,deflate,br' is used instead.
|
|
||||||
List will get joined by comma.
|
List will get joined by comma.
|
||||||
String will be used as provided.
|
String will be used as provided.
|
||||||
|
|
||||||
|
|
@ -88,18 +61,14 @@ def make_headers(
|
||||||
:param disable_cache:
|
:param disable_cache:
|
||||||
If ``True``, adds 'cache-control: no-cache' header.
|
If ``True``, adds 'cache-control: no-cache' header.
|
||||||
|
|
||||||
Example:
|
Example::
|
||||||
|
|
||||||
.. code-block:: python
|
>>> make_headers(keep_alive=True, user_agent="Batman/1.0")
|
||||||
|
{'connection': 'keep-alive', 'user-agent': 'Batman/1.0'}
|
||||||
import urllib3
|
>>> make_headers(accept_encoding=True)
|
||||||
|
{'accept-encoding': 'gzip,deflate'}
|
||||||
print(urllib3.util.make_headers(keep_alive=True, user_agent="Batman/1.0"))
|
|
||||||
# {'connection': 'keep-alive', 'user-agent': 'Batman/1.0'}
|
|
||||||
print(urllib3.util.make_headers(accept_encoding=True))
|
|
||||||
# {'accept-encoding': 'gzip,deflate'}
|
|
||||||
"""
|
"""
|
||||||
headers: dict[str, str] = {}
|
headers = {}
|
||||||
if accept_encoding:
|
if accept_encoding:
|
||||||
if isinstance(accept_encoding, str):
|
if isinstance(accept_encoding, str):
|
||||||
pass
|
pass
|
||||||
|
|
@ -116,14 +85,12 @@ def make_headers(
|
||||||
headers["connection"] = "keep-alive"
|
headers["connection"] = "keep-alive"
|
||||||
|
|
||||||
if basic_auth:
|
if basic_auth:
|
||||||
headers[
|
headers["authorization"] = "Basic " + b64encode(b(basic_auth)).decode("utf-8")
|
||||||
"authorization"
|
|
||||||
] = f"Basic {b64encode(basic_auth.encode('latin-1')).decode()}"
|
|
||||||
|
|
||||||
if proxy_basic_auth:
|
if proxy_basic_auth:
|
||||||
headers[
|
headers["proxy-authorization"] = "Basic " + b64encode(
|
||||||
"proxy-authorization"
|
b(proxy_basic_auth)
|
||||||
] = f"Basic {b64encode(proxy_basic_auth.encode('latin-1')).decode()}"
|
).decode("utf-8")
|
||||||
|
|
||||||
if disable_cache:
|
if disable_cache:
|
||||||
headers["cache-control"] = "no-cache"
|
headers["cache-control"] = "no-cache"
|
||||||
|
|
@ -131,9 +98,7 @@ def make_headers(
|
||||||
return headers
|
return headers
|
||||||
|
|
||||||
|
|
||||||
def set_file_position(
|
def set_file_position(body, pos):
|
||||||
body: typing.Any, pos: _TYPE_BODY_POSITION | None
|
|
||||||
) -> _TYPE_BODY_POSITION | None:
|
|
||||||
"""
|
"""
|
||||||
If a position is provided, move file to that point.
|
If a position is provided, move file to that point.
|
||||||
Otherwise, we'll attempt to record a position for future use.
|
Otherwise, we'll attempt to record a position for future use.
|
||||||
|
|
@ -143,7 +108,7 @@ def set_file_position(
|
||||||
elif getattr(body, "tell", None) is not None:
|
elif getattr(body, "tell", None) is not None:
|
||||||
try:
|
try:
|
||||||
pos = body.tell()
|
pos = body.tell()
|
||||||
except OSError:
|
except (IOError, OSError):
|
||||||
# This differentiates from None, allowing us to catch
|
# This differentiates from None, allowing us to catch
|
||||||
# a failed `tell()` later when trying to rewind the body.
|
# a failed `tell()` later when trying to rewind the body.
|
||||||
pos = _FAILEDTELL
|
pos = _FAILEDTELL
|
||||||
|
|
@ -151,7 +116,7 @@ def set_file_position(
|
||||||
return pos
|
return pos
|
||||||
|
|
||||||
|
|
||||||
def rewind_body(body: typing.IO[typing.AnyStr], body_pos: _TYPE_BODY_POSITION) -> None:
|
def rewind_body(body, body_pos):
|
||||||
"""
|
"""
|
||||||
Attempt to rewind body to a certain position.
|
Attempt to rewind body to a certain position.
|
||||||
Primarily used for request redirects and retries.
|
Primarily used for request redirects and retries.
|
||||||
|
|
@ -163,13 +128,13 @@ def rewind_body(body: typing.IO[typing.AnyStr], body_pos: _TYPE_BODY_POSITION) -
|
||||||
Position to seek to in file.
|
Position to seek to in file.
|
||||||
"""
|
"""
|
||||||
body_seek = getattr(body, "seek", None)
|
body_seek = getattr(body, "seek", None)
|
||||||
if body_seek is not None and isinstance(body_pos, int):
|
if body_seek is not None and isinstance(body_pos, integer_types):
|
||||||
try:
|
try:
|
||||||
body_seek(body_pos)
|
body_seek(body_pos)
|
||||||
except OSError as e:
|
except (IOError, OSError):
|
||||||
raise UnrewindableBodyError(
|
raise UnrewindableBodyError(
|
||||||
"An error occurred when rewinding request body for redirect/retry."
|
"An error occurred when rewinding request body for redirect/retry."
|
||||||
) from e
|
)
|
||||||
elif body_pos is _FAILEDTELL:
|
elif body_pos is _FAILEDTELL:
|
||||||
raise UnrewindableBodyError(
|
raise UnrewindableBodyError(
|
||||||
"Unable to record file position for rewinding "
|
"Unable to record file position for rewinding "
|
||||||
|
|
@ -177,80 +142,5 @@ def rewind_body(body: typing.IO[typing.AnyStr], body_pos: _TYPE_BODY_POSITION) -
|
||||||
)
|
)
|
||||||
else:
|
else:
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
f"body_pos must be of type integer, instead it was {type(body_pos)}."
|
"body_pos must be of type integer, instead it was %s." % type(body_pos)
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
class ChunksAndContentLength(typing.NamedTuple):
|
|
||||||
chunks: typing.Iterable[bytes] | None
|
|
||||||
content_length: int | None
|
|
||||||
|
|
||||||
|
|
||||||
def body_to_chunks(
|
|
||||||
body: typing.Any | None, method: str, blocksize: int
|
|
||||||
) -> ChunksAndContentLength:
|
|
||||||
"""Takes the HTTP request method, body, and blocksize and
|
|
||||||
transforms them into an iterable of chunks to pass to
|
|
||||||
socket.sendall() and an optional 'Content-Length' header.
|
|
||||||
|
|
||||||
A 'Content-Length' of 'None' indicates the length of the body
|
|
||||||
can't be determined so should use 'Transfer-Encoding: chunked'
|
|
||||||
for framing instead.
|
|
||||||
"""
|
|
||||||
|
|
||||||
chunks: typing.Iterable[bytes] | None
|
|
||||||
content_length: int | None
|
|
||||||
|
|
||||||
# No body, we need to make a recommendation on 'Content-Length'
|
|
||||||
# based on whether that request method is expected to have
|
|
||||||
# a body or not.
|
|
||||||
if body is None:
|
|
||||||
chunks = None
|
|
||||||
if method.upper() not in _METHODS_NOT_EXPECTING_BODY:
|
|
||||||
content_length = 0
|
|
||||||
else:
|
|
||||||
content_length = None
|
|
||||||
|
|
||||||
# Bytes or strings become bytes
|
|
||||||
elif isinstance(body, (str, bytes)):
|
|
||||||
chunks = (to_bytes(body),)
|
|
||||||
content_length = len(chunks[0])
|
|
||||||
|
|
||||||
# File-like object, TODO: use seek() and tell() for length?
|
|
||||||
elif hasattr(body, "read"):
|
|
||||||
|
|
||||||
def chunk_readable() -> typing.Iterable[bytes]:
|
|
||||||
nonlocal body, blocksize
|
|
||||||
encode = isinstance(body, io.TextIOBase)
|
|
||||||
while True:
|
|
||||||
datablock = body.read(blocksize)
|
|
||||||
if not datablock:
|
|
||||||
break
|
|
||||||
if encode:
|
|
||||||
datablock = datablock.encode("iso-8859-1")
|
|
||||||
yield datablock
|
|
||||||
|
|
||||||
chunks = chunk_readable()
|
|
||||||
content_length = None
|
|
||||||
|
|
||||||
# Otherwise we need to start checking via duck-typing.
|
|
||||||
else:
|
|
||||||
try:
|
|
||||||
# Check if the body implements the buffer API.
|
|
||||||
mv = memoryview(body)
|
|
||||||
except TypeError:
|
|
||||||
try:
|
|
||||||
# Check if the body is an iterable
|
|
||||||
chunks = iter(body)
|
|
||||||
content_length = None
|
|
||||||
except TypeError:
|
|
||||||
raise TypeError(
|
|
||||||
f"'body' must be a bytes-like object, file-like "
|
|
||||||
f"object, or iterable. Instead was {body!r}"
|
|
||||||
) from None
|
|
||||||
else:
|
|
||||||
# Since it implements the buffer API can be passed directly to socket.sendall()
|
|
||||||
chunks = (body,)
|
|
||||||
content_length = mv.nbytes
|
|
||||||
|
|
||||||
return ChunksAndContentLength(chunks=chunks, content_length=content_length)
|
|
||||||
|
|
|
||||||
|
|
@ -1,12 +1,12 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import http.client as httplib
|
|
||||||
from email.errors import MultipartInvariantViolationDefect, StartBoundaryNotFoundDefect
|
from email.errors import MultipartInvariantViolationDefect, StartBoundaryNotFoundDefect
|
||||||
|
|
||||||
from ..exceptions import HeaderParsingError
|
from ..exceptions import HeaderParsingError
|
||||||
|
from ..packages.six.moves import http_client as httplib
|
||||||
|
|
||||||
|
|
||||||
def is_fp_closed(obj: object) -> bool:
|
def is_fp_closed(obj):
|
||||||
"""
|
"""
|
||||||
Checks whether a given file-like object is closed.
|
Checks whether a given file-like object is closed.
|
||||||
|
|
||||||
|
|
@ -17,27 +17,27 @@ def is_fp_closed(obj: object) -> bool:
|
||||||
try:
|
try:
|
||||||
# Check `isclosed()` first, in case Python3 doesn't set `closed`.
|
# Check `isclosed()` first, in case Python3 doesn't set `closed`.
|
||||||
# GH Issue #928
|
# GH Issue #928
|
||||||
return obj.isclosed() # type: ignore[no-any-return, attr-defined]
|
return obj.isclosed()
|
||||||
except AttributeError:
|
except AttributeError:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
try:
|
try:
|
||||||
# Check via the official file-like-object way.
|
# Check via the official file-like-object way.
|
||||||
return obj.closed # type: ignore[no-any-return, attr-defined]
|
return obj.closed
|
||||||
except AttributeError:
|
except AttributeError:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
try:
|
try:
|
||||||
# Check if the object is a container for another file-like object that
|
# Check if the object is a container for another file-like object that
|
||||||
# gets released on exhaustion (e.g. HTTPResponse).
|
# gets released on exhaustion (e.g. HTTPResponse).
|
||||||
return obj.fp is None # type: ignore[attr-defined]
|
return obj.fp is None
|
||||||
except AttributeError:
|
except AttributeError:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
raise ValueError("Unable to determine whether fp is closed.")
|
raise ValueError("Unable to determine whether fp is closed.")
|
||||||
|
|
||||||
|
|
||||||
def assert_header_parsing(headers: httplib.HTTPMessage) -> None:
|
def assert_header_parsing(headers):
|
||||||
"""
|
"""
|
||||||
Asserts whether all headers have been successfully parsed.
|
Asserts whether all headers have been successfully parsed.
|
||||||
Extracts encountered errors from the result of parsing headers.
|
Extracts encountered errors from the result of parsing headers.
|
||||||
|
|
@ -53,18 +53,21 @@ def assert_header_parsing(headers: httplib.HTTPMessage) -> None:
|
||||||
# This will fail silently if we pass in the wrong kind of parameter.
|
# This will fail silently if we pass in the wrong kind of parameter.
|
||||||
# To make debugging easier add an explicit check.
|
# To make debugging easier add an explicit check.
|
||||||
if not isinstance(headers, httplib.HTTPMessage):
|
if not isinstance(headers, httplib.HTTPMessage):
|
||||||
raise TypeError(f"expected httplib.Message, got {type(headers)}.")
|
raise TypeError("expected httplib.Message, got {0}.".format(type(headers)))
|
||||||
|
|
||||||
|
defects = getattr(headers, "defects", None)
|
||||||
|
get_payload = getattr(headers, "get_payload", None)
|
||||||
|
|
||||||
unparsed_data = None
|
unparsed_data = None
|
||||||
|
if get_payload:
|
||||||
# get_payload is actually email.message.Message.get_payload;
|
# get_payload is actually email.message.Message.get_payload;
|
||||||
# we're only interested in the result if it's not a multipart message
|
# we're only interested in the result if it's not a multipart message
|
||||||
if not headers.is_multipart():
|
if not headers.is_multipart():
|
||||||
payload = headers.get_payload()
|
payload = get_payload()
|
||||||
|
|
||||||
if isinstance(payload, (bytes, str)):
|
if isinstance(payload, (bytes, str)):
|
||||||
unparsed_data = payload
|
unparsed_data = payload
|
||||||
|
if defects:
|
||||||
# httplib is assuming a response body is available
|
# httplib is assuming a response body is available
|
||||||
# when parsing headers even when httplib only sends
|
# when parsing headers even when httplib only sends
|
||||||
# header data to parse_headers() This results in
|
# header data to parse_headers() This results in
|
||||||
|
|
@ -78,7 +81,7 @@ def assert_header_parsing(headers: httplib.HTTPMessage) -> None:
|
||||||
# A message claimed to be a multipart but no subparts were found.
|
# A message claimed to be a multipart but no subparts were found.
|
||||||
defects = [
|
defects = [
|
||||||
defect
|
defect
|
||||||
for defect in headers.defects
|
for defect in defects
|
||||||
if not isinstance(
|
if not isinstance(
|
||||||
defect, (StartBoundaryNotFoundDefect, MultipartInvariantViolationDefect)
|
defect, (StartBoundaryNotFoundDefect, MultipartInvariantViolationDefect)
|
||||||
)
|
)
|
||||||
|
|
@ -88,14 +91,17 @@ def assert_header_parsing(headers: httplib.HTTPMessage) -> None:
|
||||||
raise HeaderParsingError(defects=defects, unparsed_data=unparsed_data)
|
raise HeaderParsingError(defects=defects, unparsed_data=unparsed_data)
|
||||||
|
|
||||||
|
|
||||||
def is_response_to_head(response: httplib.HTTPResponse) -> bool:
|
def is_response_to_head(response):
|
||||||
"""
|
"""
|
||||||
Checks whether the request of a response has been a HEAD-request.
|
Checks whether the request of a response has been a HEAD-request.
|
||||||
|
Handles the quirks of AppEngine.
|
||||||
|
|
||||||
:param http.client.HTTPResponse response:
|
:param http.client.HTTPResponse response:
|
||||||
Response to check if the originating request
|
Response to check if the originating request
|
||||||
used 'HEAD' as a method.
|
used 'HEAD' as a method.
|
||||||
"""
|
"""
|
||||||
# FIXME: Can we do this somehow without accessing private httplib _method?
|
# FIXME: Can we do this somehow without accessing private httplib _method?
|
||||||
method_str = response._method # type: str # type: ignore[attr-defined]
|
method = response._method
|
||||||
return method_str.upper() == "HEAD"
|
if isinstance(method, int): # Platform-specific: Appengine
|
||||||
|
return method == 3
|
||||||
|
return method.upper() == "HEAD"
|
||||||
|
|
|
||||||
|
|
@ -1,13 +1,12 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import email
|
import email
|
||||||
import logging
|
import logging
|
||||||
import random
|
|
||||||
import re
|
import re
|
||||||
import time
|
import time
|
||||||
import typing
|
import warnings
|
||||||
|
from collections import namedtuple
|
||||||
from itertools import takewhile
|
from itertools import takewhile
|
||||||
from types import TracebackType
|
|
||||||
|
|
||||||
from ..exceptions import (
|
from ..exceptions import (
|
||||||
ConnectTimeoutError,
|
ConnectTimeoutError,
|
||||||
|
|
@ -18,49 +17,97 @@ from ..exceptions import (
|
||||||
ReadTimeoutError,
|
ReadTimeoutError,
|
||||||
ResponseError,
|
ResponseError,
|
||||||
)
|
)
|
||||||
from .util import reraise
|
from ..packages import six
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
from ..connectionpool import ConnectionPool
|
|
||||||
from ..response import BaseHTTPResponse
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
# Data structure for representing the metadata of requests that result in a retry.
|
# Data structure for representing the metadata of requests that result in a retry.
|
||||||
class RequestHistory(typing.NamedTuple):
|
RequestHistory = namedtuple(
|
||||||
method: str | None
|
"RequestHistory", ["method", "url", "error", "status", "redirect_location"]
|
||||||
url: str | None
|
)
|
||||||
error: Exception | None
|
|
||||||
status: int | None
|
|
||||||
redirect_location: str | None
|
|
||||||
|
|
||||||
|
|
||||||
class Retry:
|
# TODO: In v2 we can remove this sentinel and metaclass with deprecated options.
|
||||||
|
_Default = object()
|
||||||
|
|
||||||
|
|
||||||
|
class _RetryMeta(type):
|
||||||
|
@property
|
||||||
|
def DEFAULT_METHOD_WHITELIST(cls):
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'Retry.DEFAULT_METHOD_WHITELIST' is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'Retry.DEFAULT_ALLOWED_METHODS' instead",
|
||||||
|
DeprecationWarning,
|
||||||
|
)
|
||||||
|
return cls.DEFAULT_ALLOWED_METHODS
|
||||||
|
|
||||||
|
@DEFAULT_METHOD_WHITELIST.setter
|
||||||
|
def DEFAULT_METHOD_WHITELIST(cls, value):
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'Retry.DEFAULT_METHOD_WHITELIST' is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'Retry.DEFAULT_ALLOWED_METHODS' instead",
|
||||||
|
DeprecationWarning,
|
||||||
|
)
|
||||||
|
cls.DEFAULT_ALLOWED_METHODS = value
|
||||||
|
|
||||||
|
@property
|
||||||
|
def DEFAULT_REDIRECT_HEADERS_BLACKLIST(cls):
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'Retry.DEFAULT_REDIRECT_HEADERS_BLACKLIST' is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'Retry.DEFAULT_REMOVE_HEADERS_ON_REDIRECT' instead",
|
||||||
|
DeprecationWarning,
|
||||||
|
)
|
||||||
|
return cls.DEFAULT_REMOVE_HEADERS_ON_REDIRECT
|
||||||
|
|
||||||
|
@DEFAULT_REDIRECT_HEADERS_BLACKLIST.setter
|
||||||
|
def DEFAULT_REDIRECT_HEADERS_BLACKLIST(cls, value):
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'Retry.DEFAULT_REDIRECT_HEADERS_BLACKLIST' is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'Retry.DEFAULT_REMOVE_HEADERS_ON_REDIRECT' instead",
|
||||||
|
DeprecationWarning,
|
||||||
|
)
|
||||||
|
cls.DEFAULT_REMOVE_HEADERS_ON_REDIRECT = value
|
||||||
|
|
||||||
|
@property
|
||||||
|
def BACKOFF_MAX(cls):
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'Retry.BACKOFF_MAX' is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'Retry.DEFAULT_BACKOFF_MAX' instead",
|
||||||
|
DeprecationWarning,
|
||||||
|
)
|
||||||
|
return cls.DEFAULT_BACKOFF_MAX
|
||||||
|
|
||||||
|
@BACKOFF_MAX.setter
|
||||||
|
def BACKOFF_MAX(cls, value):
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'Retry.BACKOFF_MAX' is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'Retry.DEFAULT_BACKOFF_MAX' instead",
|
||||||
|
DeprecationWarning,
|
||||||
|
)
|
||||||
|
cls.DEFAULT_BACKOFF_MAX = value
|
||||||
|
|
||||||
|
|
||||||
|
@six.add_metaclass(_RetryMeta)
|
||||||
|
class Retry(object):
|
||||||
"""Retry configuration.
|
"""Retry configuration.
|
||||||
|
|
||||||
Each retry attempt will create a new Retry object with updated values, so
|
Each retry attempt will create a new Retry object with updated values, so
|
||||||
they can be safely reused.
|
they can be safely reused.
|
||||||
|
|
||||||
Retries can be defined as a default for a pool:
|
Retries can be defined as a default for a pool::
|
||||||
|
|
||||||
.. code-block:: python
|
|
||||||
|
|
||||||
retries = Retry(connect=5, read=2, redirect=5)
|
retries = Retry(connect=5, read=2, redirect=5)
|
||||||
http = PoolManager(retries=retries)
|
http = PoolManager(retries=retries)
|
||||||
response = http.request("GET", "https://example.com/")
|
response = http.request('GET', 'http://example.com/')
|
||||||
|
|
||||||
Or per-request (which overrides the default for the pool):
|
Or per-request (which overrides the default for the pool)::
|
||||||
|
|
||||||
.. code-block:: python
|
response = http.request('GET', 'http://example.com/', retries=Retry(10))
|
||||||
|
|
||||||
response = http.request("GET", "https://example.com/", retries=Retry(10))
|
Retries can be disabled by passing ``False``::
|
||||||
|
|
||||||
Retries can be disabled by passing ``False``:
|
response = http.request('GET', 'http://example.com/', retries=False)
|
||||||
|
|
||||||
.. code-block:: python
|
|
||||||
|
|
||||||
response = http.request("GET", "https://example.com/", retries=False)
|
|
||||||
|
|
||||||
Errors will be wrapped in :class:`~urllib3.exceptions.MaxRetryError` unless
|
Errors will be wrapped in :class:`~urllib3.exceptions.MaxRetryError` unless
|
||||||
retries are disabled, in which case the causing exception will be raised.
|
retries are disabled, in which case the causing exception will be raised.
|
||||||
|
|
@ -122,16 +169,21 @@ class Retry:
|
||||||
If ``total`` is not set, it's a good idea to set this to 0 to account
|
If ``total`` is not set, it's a good idea to set this to 0 to account
|
||||||
for unexpected edge cases and avoid infinite retry loops.
|
for unexpected edge cases and avoid infinite retry loops.
|
||||||
|
|
||||||
:param Collection allowed_methods:
|
:param iterable allowed_methods:
|
||||||
Set of uppercased HTTP method verbs that we should retry on.
|
Set of uppercased HTTP method verbs that we should retry on.
|
||||||
|
|
||||||
By default, we only retry on methods which are considered to be
|
By default, we only retry on methods which are considered to be
|
||||||
idempotent (multiple requests with the same parameters end with the
|
idempotent (multiple requests with the same parameters end with the
|
||||||
same state). See :attr:`Retry.DEFAULT_ALLOWED_METHODS`.
|
same state). See :attr:`Retry.DEFAULT_ALLOWED_METHODS`.
|
||||||
|
|
||||||
Set to a ``None`` value to retry on any verb.
|
Set to a ``False`` value to retry on any verb.
|
||||||
|
|
||||||
:param Collection status_forcelist:
|
.. warning::
|
||||||
|
|
||||||
|
Previously this parameter was named ``method_whitelist``, that
|
||||||
|
usage is deprecated in v1.26.0 and will be removed in v2.0.
|
||||||
|
|
||||||
|
:param iterable status_forcelist:
|
||||||
A set of integer HTTP status codes that we should force a retry on.
|
A set of integer HTTP status codes that we should force a retry on.
|
||||||
A retry is initiated if the request method is in ``allowed_methods``
|
A retry is initiated if the request method is in ``allowed_methods``
|
||||||
and the response status code is in ``status_forcelist``.
|
and the response status code is in ``status_forcelist``.
|
||||||
|
|
@ -143,17 +195,13 @@ class Retry:
|
||||||
(most errors are resolved immediately by a second try without a
|
(most errors are resolved immediately by a second try without a
|
||||||
delay). urllib3 will sleep for::
|
delay). urllib3 will sleep for::
|
||||||
|
|
||||||
{backoff factor} * (2 ** ({number of previous retries}))
|
{backoff factor} * (2 ** ({number of total retries} - 1))
|
||||||
|
|
||||||
seconds. If `backoff_jitter` is non-zero, this sleep is extended by::
|
seconds. If the backoff_factor is 0.1, then :func:`.sleep` will sleep
|
||||||
|
for [0.0s, 0.2s, 0.4s, ...] between retries. It will never be longer
|
||||||
|
than :attr:`Retry.DEFAULT_BACKOFF_MAX`.
|
||||||
|
|
||||||
random.uniform(0, {backoff jitter})
|
By default, backoff is disabled (set to 0).
|
||||||
|
|
||||||
seconds. For example, if the backoff_factor is 0.1, then :func:`Retry.sleep` will
|
|
||||||
sleep for [0.0s, 0.2s, 0.4s, 0.8s, ...] between retries. No backoff will ever
|
|
||||||
be longer than `backoff_max`.
|
|
||||||
|
|
||||||
By default, backoff is disabled (factor set to 0).
|
|
||||||
|
|
||||||
:param bool raise_on_redirect: Whether, if the number of redirects is
|
:param bool raise_on_redirect: Whether, if the number of redirects is
|
||||||
exhausted, to raise a MaxRetryError, or to return a response with a
|
exhausted, to raise a MaxRetryError, or to return a response with a
|
||||||
|
|
@ -172,7 +220,7 @@ class Retry:
|
||||||
Whether to respect Retry-After header on status codes defined as
|
Whether to respect Retry-After header on status codes defined as
|
||||||
:attr:`Retry.RETRY_AFTER_STATUS_CODES` or not.
|
:attr:`Retry.RETRY_AFTER_STATUS_CODES` or not.
|
||||||
|
|
||||||
:param Collection remove_headers_on_redirect:
|
:param iterable remove_headers_on_redirect:
|
||||||
Sequence of headers to remove from the request when a response
|
Sequence of headers to remove from the request when a response
|
||||||
indicating a redirect is returned before firing off the redirected
|
indicating a redirect is returned before firing off the redirected
|
||||||
request.
|
request.
|
||||||
|
|
@ -187,35 +235,50 @@ class Retry:
|
||||||
RETRY_AFTER_STATUS_CODES = frozenset([413, 429, 503])
|
RETRY_AFTER_STATUS_CODES = frozenset([413, 429, 503])
|
||||||
|
|
||||||
#: Default headers to be used for ``remove_headers_on_redirect``
|
#: Default headers to be used for ``remove_headers_on_redirect``
|
||||||
DEFAULT_REMOVE_HEADERS_ON_REDIRECT = frozenset(["Cookie", "Authorization"])
|
DEFAULT_REMOVE_HEADERS_ON_REDIRECT = frozenset(["Authorization"])
|
||||||
|
|
||||||
#: Default maximum backoff time.
|
#: Maximum backoff time.
|
||||||
DEFAULT_BACKOFF_MAX = 120
|
DEFAULT_BACKOFF_MAX = 120
|
||||||
|
|
||||||
# Backward compatibility; assigned outside of the class.
|
|
||||||
DEFAULT: typing.ClassVar[Retry]
|
|
||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self,
|
||||||
total: bool | int | None = 10,
|
total=10,
|
||||||
connect: int | None = None,
|
connect=None,
|
||||||
read: int | None = None,
|
read=None,
|
||||||
redirect: bool | int | None = None,
|
redirect=None,
|
||||||
status: int | None = None,
|
status=None,
|
||||||
other: int | None = None,
|
other=None,
|
||||||
allowed_methods: typing.Collection[str] | None = DEFAULT_ALLOWED_METHODS,
|
allowed_methods=_Default,
|
||||||
status_forcelist: typing.Collection[int] | None = None,
|
status_forcelist=None,
|
||||||
backoff_factor: float = 0,
|
backoff_factor=0,
|
||||||
backoff_max: float = DEFAULT_BACKOFF_MAX,
|
raise_on_redirect=True,
|
||||||
raise_on_redirect: bool = True,
|
raise_on_status=True,
|
||||||
raise_on_status: bool = True,
|
history=None,
|
||||||
history: tuple[RequestHistory, ...] | None = None,
|
respect_retry_after_header=True,
|
||||||
respect_retry_after_header: bool = True,
|
remove_headers_on_redirect=_Default,
|
||||||
remove_headers_on_redirect: typing.Collection[
|
# TODO: Deprecated, remove in v2.0
|
||||||
str
|
method_whitelist=_Default,
|
||||||
] = DEFAULT_REMOVE_HEADERS_ON_REDIRECT,
|
):
|
||||||
backoff_jitter: float = 0.0,
|
|
||||||
) -> None:
|
if method_whitelist is not _Default:
|
||||||
|
if allowed_methods is not _Default:
|
||||||
|
raise ValueError(
|
||||||
|
"Using both 'allowed_methods' and "
|
||||||
|
"'method_whitelist' together is not allowed. "
|
||||||
|
"Instead only use 'allowed_methods'"
|
||||||
|
)
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'method_whitelist' with Retry is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'allowed_methods' instead",
|
||||||
|
DeprecationWarning,
|
||||||
|
stacklevel=2,
|
||||||
|
)
|
||||||
|
allowed_methods = method_whitelist
|
||||||
|
if allowed_methods is _Default:
|
||||||
|
allowed_methods = self.DEFAULT_ALLOWED_METHODS
|
||||||
|
if remove_headers_on_redirect is _Default:
|
||||||
|
remove_headers_on_redirect = self.DEFAULT_REMOVE_HEADERS_ON_REDIRECT
|
||||||
|
|
||||||
self.total = total
|
self.total = total
|
||||||
self.connect = connect
|
self.connect = connect
|
||||||
self.read = read
|
self.read = read
|
||||||
|
|
@ -230,17 +293,15 @@ class Retry:
|
||||||
self.status_forcelist = status_forcelist or set()
|
self.status_forcelist = status_forcelist or set()
|
||||||
self.allowed_methods = allowed_methods
|
self.allowed_methods = allowed_methods
|
||||||
self.backoff_factor = backoff_factor
|
self.backoff_factor = backoff_factor
|
||||||
self.backoff_max = backoff_max
|
|
||||||
self.raise_on_redirect = raise_on_redirect
|
self.raise_on_redirect = raise_on_redirect
|
||||||
self.raise_on_status = raise_on_status
|
self.raise_on_status = raise_on_status
|
||||||
self.history = history or ()
|
self.history = history or tuple()
|
||||||
self.respect_retry_after_header = respect_retry_after_header
|
self.respect_retry_after_header = respect_retry_after_header
|
||||||
self.remove_headers_on_redirect = frozenset(
|
self.remove_headers_on_redirect = frozenset(
|
||||||
h.lower() for h in remove_headers_on_redirect
|
[h.lower() for h in remove_headers_on_redirect]
|
||||||
)
|
)
|
||||||
self.backoff_jitter = backoff_jitter
|
|
||||||
|
|
||||||
def new(self, **kw: typing.Any) -> Retry:
|
def new(self, **kw):
|
||||||
params = dict(
|
params = dict(
|
||||||
total=self.total,
|
total=self.total,
|
||||||
connect=self.connect,
|
connect=self.connect,
|
||||||
|
|
@ -248,28 +309,36 @@ class Retry:
|
||||||
redirect=self.redirect,
|
redirect=self.redirect,
|
||||||
status=self.status,
|
status=self.status,
|
||||||
other=self.other,
|
other=self.other,
|
||||||
allowed_methods=self.allowed_methods,
|
|
||||||
status_forcelist=self.status_forcelist,
|
status_forcelist=self.status_forcelist,
|
||||||
backoff_factor=self.backoff_factor,
|
backoff_factor=self.backoff_factor,
|
||||||
backoff_max=self.backoff_max,
|
|
||||||
raise_on_redirect=self.raise_on_redirect,
|
raise_on_redirect=self.raise_on_redirect,
|
||||||
raise_on_status=self.raise_on_status,
|
raise_on_status=self.raise_on_status,
|
||||||
history=self.history,
|
history=self.history,
|
||||||
remove_headers_on_redirect=self.remove_headers_on_redirect,
|
remove_headers_on_redirect=self.remove_headers_on_redirect,
|
||||||
respect_retry_after_header=self.respect_retry_after_header,
|
respect_retry_after_header=self.respect_retry_after_header,
|
||||||
backoff_jitter=self.backoff_jitter,
|
|
||||||
)
|
)
|
||||||
|
|
||||||
|
# TODO: If already given in **kw we use what's given to us
|
||||||
|
# If not given we need to figure out what to pass. We decide
|
||||||
|
# based on whether our class has the 'method_whitelist' property
|
||||||
|
# and if so we pass the deprecated 'method_whitelist' otherwise
|
||||||
|
# we use 'allowed_methods'. Remove in v2.0
|
||||||
|
if "method_whitelist" not in kw and "allowed_methods" not in kw:
|
||||||
|
if "method_whitelist" in self.__dict__:
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'method_whitelist' with Retry is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'allowed_methods' instead",
|
||||||
|
DeprecationWarning,
|
||||||
|
)
|
||||||
|
params["method_whitelist"] = self.allowed_methods
|
||||||
|
else:
|
||||||
|
params["allowed_methods"] = self.allowed_methods
|
||||||
|
|
||||||
params.update(kw)
|
params.update(kw)
|
||||||
return type(self)(**params) # type: ignore[arg-type]
|
return type(self)(**params)
|
||||||
|
|
||||||
@classmethod
|
@classmethod
|
||||||
def from_int(
|
def from_int(cls, retries, redirect=True, default=None):
|
||||||
cls,
|
|
||||||
retries: Retry | bool | int | None,
|
|
||||||
redirect: bool | int | None = True,
|
|
||||||
default: Retry | bool | int | None = None,
|
|
||||||
) -> Retry:
|
|
||||||
"""Backwards-compatibility for the old retries format."""
|
"""Backwards-compatibility for the old retries format."""
|
||||||
if retries is None:
|
if retries is None:
|
||||||
retries = default if default is not None else cls.DEFAULT
|
retries = default if default is not None else cls.DEFAULT
|
||||||
|
|
@ -282,7 +351,7 @@ class Retry:
|
||||||
log.debug("Converted retries value: %r -> %r", retries, new_retries)
|
log.debug("Converted retries value: %r -> %r", retries, new_retries)
|
||||||
return new_retries
|
return new_retries
|
||||||
|
|
||||||
def get_backoff_time(self) -> float:
|
def get_backoff_time(self):
|
||||||
"""Formula for computing the current backoff
|
"""Formula for computing the current backoff
|
||||||
|
|
||||||
:rtype: float
|
:rtype: float
|
||||||
|
|
@ -297,28 +366,32 @@ class Retry:
|
||||||
return 0
|
return 0
|
||||||
|
|
||||||
backoff_value = self.backoff_factor * (2 ** (consecutive_errors_len - 1))
|
backoff_value = self.backoff_factor * (2 ** (consecutive_errors_len - 1))
|
||||||
if self.backoff_jitter != 0.0:
|
return min(self.DEFAULT_BACKOFF_MAX, backoff_value)
|
||||||
backoff_value += random.random() * self.backoff_jitter
|
|
||||||
return float(max(0, min(self.backoff_max, backoff_value)))
|
|
||||||
|
|
||||||
def parse_retry_after(self, retry_after: str) -> float:
|
def parse_retry_after(self, retry_after):
|
||||||
seconds: float
|
|
||||||
# Whitespace: https://tools.ietf.org/html/rfc7230#section-3.2.4
|
# Whitespace: https://tools.ietf.org/html/rfc7230#section-3.2.4
|
||||||
if re.match(r"^\s*[0-9]+\s*$", retry_after):
|
if re.match(r"^\s*[0-9]+\s*$", retry_after):
|
||||||
seconds = int(retry_after)
|
seconds = int(retry_after)
|
||||||
else:
|
else:
|
||||||
retry_date_tuple = email.utils.parsedate_tz(retry_after)
|
retry_date_tuple = email.utils.parsedate_tz(retry_after)
|
||||||
if retry_date_tuple is None:
|
if retry_date_tuple is None:
|
||||||
raise InvalidHeader(f"Invalid Retry-After header: {retry_after}")
|
raise InvalidHeader("Invalid Retry-After header: %s" % retry_after)
|
||||||
|
if retry_date_tuple[9] is None: # Python 2
|
||||||
|
# Assume UTC if no timezone was specified
|
||||||
|
# On Python2.7, parsedate_tz returns None for a timezone offset
|
||||||
|
# instead of 0 if no timezone is given, where mktime_tz treats
|
||||||
|
# a None timezone offset as local time.
|
||||||
|
retry_date_tuple = retry_date_tuple[:9] + (0,) + retry_date_tuple[10:]
|
||||||
|
|
||||||
retry_date = email.utils.mktime_tz(retry_date_tuple)
|
retry_date = email.utils.mktime_tz(retry_date_tuple)
|
||||||
seconds = retry_date - time.time()
|
seconds = retry_date - time.time()
|
||||||
|
|
||||||
seconds = max(seconds, 0)
|
if seconds < 0:
|
||||||
|
seconds = 0
|
||||||
|
|
||||||
return seconds
|
return seconds
|
||||||
|
|
||||||
def get_retry_after(self, response: BaseHTTPResponse) -> float | None:
|
def get_retry_after(self, response):
|
||||||
"""Get the value of Retry-After in seconds."""
|
"""Get the value of Retry-After in seconds."""
|
||||||
|
|
||||||
retry_after = response.headers.get("Retry-After")
|
retry_after = response.headers.get("Retry-After")
|
||||||
|
|
@ -328,7 +401,7 @@ class Retry:
|
||||||
|
|
||||||
return self.parse_retry_after(retry_after)
|
return self.parse_retry_after(retry_after)
|
||||||
|
|
||||||
def sleep_for_retry(self, response: BaseHTTPResponse) -> bool:
|
def sleep_for_retry(self, response=None):
|
||||||
retry_after = self.get_retry_after(response)
|
retry_after = self.get_retry_after(response)
|
||||||
if retry_after:
|
if retry_after:
|
||||||
time.sleep(retry_after)
|
time.sleep(retry_after)
|
||||||
|
|
@ -336,13 +409,13 @@ class Retry:
|
||||||
|
|
||||||
return False
|
return False
|
||||||
|
|
||||||
def _sleep_backoff(self) -> None:
|
def _sleep_backoff(self):
|
||||||
backoff = self.get_backoff_time()
|
backoff = self.get_backoff_time()
|
||||||
if backoff <= 0:
|
if backoff <= 0:
|
||||||
return
|
return
|
||||||
time.sleep(backoff)
|
time.sleep(backoff)
|
||||||
|
|
||||||
def sleep(self, response: BaseHTTPResponse | None = None) -> None:
|
def sleep(self, response=None):
|
||||||
"""Sleep between retry attempts.
|
"""Sleep between retry attempts.
|
||||||
|
|
||||||
This method will respect a server's ``Retry-After`` response header
|
This method will respect a server's ``Retry-After`` response header
|
||||||
|
|
@ -358,7 +431,7 @@ class Retry:
|
||||||
|
|
||||||
self._sleep_backoff()
|
self._sleep_backoff()
|
||||||
|
|
||||||
def _is_connection_error(self, err: Exception) -> bool:
|
def _is_connection_error(self, err):
|
||||||
"""Errors when we're fairly sure that the server did not receive the
|
"""Errors when we're fairly sure that the server did not receive the
|
||||||
request, so it should be safe to retry.
|
request, so it should be safe to retry.
|
||||||
"""
|
"""
|
||||||
|
|
@ -366,23 +439,33 @@ class Retry:
|
||||||
err = err.original_error
|
err = err.original_error
|
||||||
return isinstance(err, ConnectTimeoutError)
|
return isinstance(err, ConnectTimeoutError)
|
||||||
|
|
||||||
def _is_read_error(self, err: Exception) -> bool:
|
def _is_read_error(self, err):
|
||||||
"""Errors that occur after the request has been started, so we should
|
"""Errors that occur after the request has been started, so we should
|
||||||
assume that the server began processing it.
|
assume that the server began processing it.
|
||||||
"""
|
"""
|
||||||
return isinstance(err, (ReadTimeoutError, ProtocolError))
|
return isinstance(err, (ReadTimeoutError, ProtocolError))
|
||||||
|
|
||||||
def _is_method_retryable(self, method: str) -> bool:
|
def _is_method_retryable(self, method):
|
||||||
"""Checks if a given HTTP method should be retried upon, depending if
|
"""Checks if a given HTTP method should be retried upon, depending if
|
||||||
it is included in the allowed_methods
|
it is included in the allowed_methods
|
||||||
"""
|
"""
|
||||||
if self.allowed_methods and method.upper() not in self.allowed_methods:
|
# TODO: For now favor if the Retry implementation sets its own method_whitelist
|
||||||
|
# property outside of our constructor to avoid breaking custom implementations.
|
||||||
|
if "method_whitelist" in self.__dict__:
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'method_whitelist' with Retry is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'allowed_methods' instead",
|
||||||
|
DeprecationWarning,
|
||||||
|
)
|
||||||
|
allowed_methods = self.method_whitelist
|
||||||
|
else:
|
||||||
|
allowed_methods = self.allowed_methods
|
||||||
|
|
||||||
|
if allowed_methods and method.upper() not in allowed_methods:
|
||||||
return False
|
return False
|
||||||
return True
|
return True
|
||||||
|
|
||||||
def is_retry(
|
def is_retry(self, method, status_code, has_retry_after=False):
|
||||||
self, method: str, status_code: int, has_retry_after: bool = False
|
|
||||||
) -> bool:
|
|
||||||
"""Is this method/status code retryable? (Based on allowlists and control
|
"""Is this method/status code retryable? (Based on allowlists and control
|
||||||
variables such as the number of total retries to allow, whether to
|
variables such as the number of total retries to allow, whether to
|
||||||
respect the Retry-After header, whether this header is present, and
|
respect the Retry-After header, whether this header is present, and
|
||||||
|
|
@ -395,18 +478,16 @@ class Retry:
|
||||||
if self.status_forcelist and status_code in self.status_forcelist:
|
if self.status_forcelist and status_code in self.status_forcelist:
|
||||||
return True
|
return True
|
||||||
|
|
||||||
return bool(
|
return (
|
||||||
self.total
|
self.total
|
||||||
and self.respect_retry_after_header
|
and self.respect_retry_after_header
|
||||||
and has_retry_after
|
and has_retry_after
|
||||||
and (status_code in self.RETRY_AFTER_STATUS_CODES)
|
and (status_code in self.RETRY_AFTER_STATUS_CODES)
|
||||||
)
|
)
|
||||||
|
|
||||||
def is_exhausted(self) -> bool:
|
def is_exhausted(self):
|
||||||
"""Are we out of retries?"""
|
"""Are we out of retries?"""
|
||||||
retry_counts = [
|
retry_counts = (
|
||||||
x
|
|
||||||
for x in (
|
|
||||||
self.total,
|
self.total,
|
||||||
self.connect,
|
self.connect,
|
||||||
self.read,
|
self.read,
|
||||||
|
|
@ -414,8 +495,7 @@ class Retry:
|
||||||
self.status,
|
self.status,
|
||||||
self.other,
|
self.other,
|
||||||
)
|
)
|
||||||
if x
|
retry_counts = list(filter(None, retry_counts))
|
||||||
]
|
|
||||||
if not retry_counts:
|
if not retry_counts:
|
||||||
return False
|
return False
|
||||||
|
|
||||||
|
|
@ -423,18 +503,18 @@ class Retry:
|
||||||
|
|
||||||
def increment(
|
def increment(
|
||||||
self,
|
self,
|
||||||
method: str | None = None,
|
method=None,
|
||||||
url: str | None = None,
|
url=None,
|
||||||
response: BaseHTTPResponse | None = None,
|
response=None,
|
||||||
error: Exception | None = None,
|
error=None,
|
||||||
_pool: ConnectionPool | None = None,
|
_pool=None,
|
||||||
_stacktrace: TracebackType | None = None,
|
_stacktrace=None,
|
||||||
) -> Retry:
|
):
|
||||||
"""Return a new Retry object with incremented retry counters.
|
"""Return a new Retry object with incremented retry counters.
|
||||||
|
|
||||||
:param response: A response object, or None, if the server did not
|
:param response: A response object, or None, if the server did not
|
||||||
return a response.
|
return a response.
|
||||||
:type response: :class:`~urllib3.response.BaseHTTPResponse`
|
:type response: :class:`~urllib3.response.HTTPResponse`
|
||||||
:param Exception error: An error encountered during the request, or
|
:param Exception error: An error encountered during the request, or
|
||||||
None if the response was received successfully.
|
None if the response was received successfully.
|
||||||
|
|
||||||
|
|
@ -442,7 +522,7 @@ class Retry:
|
||||||
"""
|
"""
|
||||||
if self.total is False and error:
|
if self.total is False and error:
|
||||||
# Disabled, indicate to re-raise the error.
|
# Disabled, indicate to re-raise the error.
|
||||||
raise reraise(type(error), error, _stacktrace)
|
raise six.reraise(type(error), error, _stacktrace)
|
||||||
|
|
||||||
total = self.total
|
total = self.total
|
||||||
if total is not None:
|
if total is not None:
|
||||||
|
|
@ -460,14 +540,14 @@ class Retry:
|
||||||
if error and self._is_connection_error(error):
|
if error and self._is_connection_error(error):
|
||||||
# Connect retry?
|
# Connect retry?
|
||||||
if connect is False:
|
if connect is False:
|
||||||
raise reraise(type(error), error, _stacktrace)
|
raise six.reraise(type(error), error, _stacktrace)
|
||||||
elif connect is not None:
|
elif connect is not None:
|
||||||
connect -= 1
|
connect -= 1
|
||||||
|
|
||||||
elif error and self._is_read_error(error):
|
elif error and self._is_read_error(error):
|
||||||
# Read retry?
|
# Read retry?
|
||||||
if read is False or method is None or not self._is_method_retryable(method):
|
if read is False or not self._is_method_retryable(method):
|
||||||
raise reraise(type(error), error, _stacktrace)
|
raise six.reraise(type(error), error, _stacktrace)
|
||||||
elif read is not None:
|
elif read is not None:
|
||||||
read -= 1
|
read -= 1
|
||||||
|
|
||||||
|
|
@ -481,9 +561,7 @@ class Retry:
|
||||||
if redirect is not None:
|
if redirect is not None:
|
||||||
redirect -= 1
|
redirect -= 1
|
||||||
cause = "too many redirects"
|
cause = "too many redirects"
|
||||||
response_redirect_location = response.get_redirect_location()
|
redirect_location = response.get_redirect_location()
|
||||||
if response_redirect_location:
|
|
||||||
redirect_location = response_redirect_location
|
|
||||||
status = response.status
|
status = response.status
|
||||||
|
|
||||||
else:
|
else:
|
||||||
|
|
@ -511,18 +589,31 @@ class Retry:
|
||||||
)
|
)
|
||||||
|
|
||||||
if new_retry.is_exhausted():
|
if new_retry.is_exhausted():
|
||||||
reason = error or ResponseError(cause)
|
raise MaxRetryError(_pool, url, error or ResponseError(cause))
|
||||||
raise MaxRetryError(_pool, url, reason) from reason # type: ignore[arg-type]
|
|
||||||
|
|
||||||
log.debug("Incremented Retry for (url='%s'): %r", url, new_retry)
|
log.debug("Incremented Retry for (url='%s'): %r", url, new_retry)
|
||||||
|
|
||||||
return new_retry
|
return new_retry
|
||||||
|
|
||||||
def __repr__(self) -> str:
|
def __repr__(self):
|
||||||
return (
|
return (
|
||||||
f"{type(self).__name__}(total={self.total}, connect={self.connect}, "
|
"{cls.__name__}(total={self.total}, connect={self.connect}, "
|
||||||
f"read={self.read}, redirect={self.redirect}, status={self.status})"
|
"read={self.read}, redirect={self.redirect}, status={self.status})"
|
||||||
|
).format(cls=type(self), self=self)
|
||||||
|
|
||||||
|
def __getattr__(self, item):
|
||||||
|
if item == "method_whitelist":
|
||||||
|
# TODO: Remove this deprecated alias in v2.0
|
||||||
|
warnings.warn(
|
||||||
|
"Using 'method_whitelist' with Retry is deprecated and "
|
||||||
|
"will be removed in v2.0. Use 'allowed_methods' instead",
|
||||||
|
DeprecationWarning,
|
||||||
)
|
)
|
||||||
|
return self.allowed_methods
|
||||||
|
try:
|
||||||
|
return getattr(super(Retry, self), item)
|
||||||
|
except AttributeError:
|
||||||
|
return getattr(Retry, item)
|
||||||
|
|
||||||
|
|
||||||
# For backwards compatibility (equivalent to pre-v1.9):
|
# For backwards compatibility (equivalent to pre-v1.9):
|
||||||
|
|
|
||||||
|
|
@ -1,150 +1,185 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import hmac
|
import hmac
|
||||||
import os
|
import os
|
||||||
import socket
|
|
||||||
import sys
|
import sys
|
||||||
import typing
|
|
||||||
import warnings
|
import warnings
|
||||||
from binascii import unhexlify
|
from binascii import hexlify, unhexlify
|
||||||
from hashlib import md5, sha1, sha256
|
from hashlib import md5, sha1, sha256
|
||||||
|
|
||||||
from ..exceptions import ProxySchemeUnsupported, SSLError
|
from ..exceptions import (
|
||||||
from .url import _BRACELESS_IPV6_ADDRZ_RE, _IPV4_RE
|
InsecurePlatformWarning,
|
||||||
|
ProxySchemeUnsupported,
|
||||||
|
SNIMissingWarning,
|
||||||
|
SSLError,
|
||||||
|
)
|
||||||
|
from ..packages import six
|
||||||
|
from .url import BRACELESS_IPV6_ADDRZ_RE, IPV4_RE
|
||||||
|
|
||||||
SSLContext = None
|
SSLContext = None
|
||||||
SSLTransport = None
|
SSLTransport = None
|
||||||
HAS_NEVER_CHECK_COMMON_NAME = False
|
HAS_SNI = False
|
||||||
IS_PYOPENSSL = False
|
IS_PYOPENSSL = False
|
||||||
|
IS_SECURETRANSPORT = False
|
||||||
ALPN_PROTOCOLS = ["http/1.1"]
|
ALPN_PROTOCOLS = ["http/1.1"]
|
||||||
|
|
||||||
_TYPE_VERSION_INFO = typing.Tuple[int, int, int, str, int]
|
|
||||||
|
|
||||||
# Maps the length of a digest to a possible hash function producing this digest
|
# Maps the length of a digest to a possible hash function producing this digest
|
||||||
HASHFUNC_MAP = {32: md5, 40: sha1, 64: sha256}
|
HASHFUNC_MAP = {32: md5, 40: sha1, 64: sha256}
|
||||||
|
|
||||||
|
|
||||||
def _is_bpo_43522_fixed(
|
def _const_compare_digest_backport(a, b):
|
||||||
implementation_name: str,
|
|
||||||
version_info: _TYPE_VERSION_INFO,
|
|
||||||
pypy_version_info: _TYPE_VERSION_INFO | None,
|
|
||||||
) -> bool:
|
|
||||||
"""Return True for CPython 3.8.9+, 3.9.3+ or 3.10+ and PyPy 7.3.8+ where
|
|
||||||
setting SSLContext.hostname_checks_common_name to False works.
|
|
||||||
|
|
||||||
Outside of CPython and PyPy we don't know which implementations work
|
|
||||||
or not so we conservatively use our hostname matching as we know that works
|
|
||||||
on all implementations.
|
|
||||||
|
|
||||||
https://github.com/urllib3/urllib3/issues/2192#issuecomment-821832963
|
|
||||||
https://foss.heptapod.net/pypy/pypy/-/issues/3539
|
|
||||||
"""
|
"""
|
||||||
if implementation_name == "pypy":
|
Compare two digests of equal length in constant time.
|
||||||
# https://foss.heptapod.net/pypy/pypy/-/issues/3129
|
|
||||||
return pypy_version_info >= (7, 3, 8) # type: ignore[operator]
|
The digests must be of type str/bytes.
|
||||||
elif implementation_name == "cpython":
|
Returns True if the digests match, and False otherwise.
|
||||||
major_minor = version_info[:2]
|
"""
|
||||||
micro = version_info[2]
|
result = abs(len(a) - len(b))
|
||||||
return (
|
for left, right in zip(bytearray(a), bytearray(b)):
|
||||||
(major_minor == (3, 8) and micro >= 9)
|
result |= left ^ right
|
||||||
or (major_minor == (3, 9) and micro >= 3)
|
return result == 0
|
||||||
or major_minor >= (3, 10)
|
|
||||||
)
|
|
||||||
else: # Defensive:
|
|
||||||
return False
|
|
||||||
|
|
||||||
|
|
||||||
def _is_has_never_check_common_name_reliable(
|
_const_compare_digest = getattr(hmac, "compare_digest", _const_compare_digest_backport)
|
||||||
openssl_version: str,
|
|
||||||
openssl_version_number: int,
|
|
||||||
implementation_name: str,
|
|
||||||
version_info: _TYPE_VERSION_INFO,
|
|
||||||
pypy_version_info: _TYPE_VERSION_INFO | None,
|
|
||||||
) -> bool:
|
|
||||||
# As of May 2023, all released versions of LibreSSL fail to reject certificates with
|
|
||||||
# only common names, see https://github.com/urllib3/urllib3/pull/3024
|
|
||||||
is_openssl = openssl_version.startswith("OpenSSL ")
|
|
||||||
# Before fixing OpenSSL issue #14579, the SSL_new() API was not copying hostflags
|
|
||||||
# like X509_CHECK_FLAG_NEVER_CHECK_SUBJECT, which tripped up CPython.
|
|
||||||
# https://github.com/openssl/openssl/issues/14579
|
|
||||||
# This was released in OpenSSL 1.1.1l+ (>=0x101010cf)
|
|
||||||
is_openssl_issue_14579_fixed = openssl_version_number >= 0x101010CF
|
|
||||||
|
|
||||||
return is_openssl and (
|
try: # Test for SSL features
|
||||||
is_openssl_issue_14579_fixed
|
|
||||||
or _is_bpo_43522_fixed(implementation_name, version_info, pypy_version_info)
|
|
||||||
)
|
|
||||||
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
from ssl import VerifyMode
|
|
||||||
from typing import Literal, TypedDict
|
|
||||||
|
|
||||||
from .ssltransport import SSLTransport as SSLTransportType
|
|
||||||
|
|
||||||
class _TYPE_PEER_CERT_RET_DICT(TypedDict, total=False):
|
|
||||||
subjectAltName: tuple[tuple[str, str], ...]
|
|
||||||
subject: tuple[tuple[tuple[str, str], ...], ...]
|
|
||||||
serialNumber: str
|
|
||||||
|
|
||||||
|
|
||||||
# Mapping from 'ssl.PROTOCOL_TLSX' to 'TLSVersion.X'
|
|
||||||
_SSL_VERSION_TO_TLS_VERSION: dict[int, int] = {}
|
|
||||||
|
|
||||||
try: # Do we have ssl at all?
|
|
||||||
import ssl
|
import ssl
|
||||||
from ssl import ( # type: ignore[assignment]
|
from ssl import CERT_REQUIRED, wrap_socket
|
||||||
CERT_REQUIRED,
|
except ImportError:
|
||||||
HAS_NEVER_CHECK_COMMON_NAME,
|
pass
|
||||||
OP_NO_COMPRESSION,
|
|
||||||
OP_NO_TICKET,
|
try:
|
||||||
OPENSSL_VERSION,
|
from ssl import HAS_SNI # Has SNI?
|
||||||
OPENSSL_VERSION_NUMBER,
|
except ImportError:
|
||||||
PROTOCOL_TLS,
|
pass
|
||||||
PROTOCOL_TLS_CLIENT,
|
|
||||||
OP_NO_SSLv2,
|
try:
|
||||||
OP_NO_SSLv3,
|
from .ssltransport import SSLTransport
|
||||||
SSLContext,
|
except ImportError:
|
||||||
TLSVersion,
|
pass
|
||||||
)
|
|
||||||
|
|
||||||
|
try: # Platform-specific: Python 3.6
|
||||||
|
from ssl import PROTOCOL_TLS
|
||||||
|
|
||||||
PROTOCOL_SSLv23 = PROTOCOL_TLS
|
PROTOCOL_SSLv23 = PROTOCOL_TLS
|
||||||
|
|
||||||
# Setting SSLContext.hostname_checks_common_name = False didn't work before CPython
|
|
||||||
# 3.8.9, 3.9.3, and 3.10 (but OK on PyPy) or OpenSSL 1.1.1l+
|
|
||||||
if HAS_NEVER_CHECK_COMMON_NAME and not _is_has_never_check_common_name_reliable(
|
|
||||||
OPENSSL_VERSION,
|
|
||||||
OPENSSL_VERSION_NUMBER,
|
|
||||||
sys.implementation.name,
|
|
||||||
sys.version_info,
|
|
||||||
sys.pypy_version_info if sys.implementation.name == "pypy" else None, # type: ignore[attr-defined]
|
|
||||||
):
|
|
||||||
HAS_NEVER_CHECK_COMMON_NAME = False
|
|
||||||
|
|
||||||
# Need to be careful here in case old TLS versions get
|
|
||||||
# removed in future 'ssl' module implementations.
|
|
||||||
for attr in ("TLSv1", "TLSv1_1", "TLSv1_2"):
|
|
||||||
try:
|
|
||||||
_SSL_VERSION_TO_TLS_VERSION[getattr(ssl, f"PROTOCOL_{attr}")] = getattr(
|
|
||||||
TLSVersion, attr
|
|
||||||
)
|
|
||||||
except AttributeError: # Defensive:
|
|
||||||
continue
|
|
||||||
|
|
||||||
from .ssltransport import SSLTransport # type: ignore[assignment]
|
|
||||||
except ImportError:
|
except ImportError:
|
||||||
OP_NO_COMPRESSION = 0x20000 # type: ignore[assignment]
|
try:
|
||||||
OP_NO_TICKET = 0x4000 # type: ignore[assignment]
|
from ssl import PROTOCOL_SSLv23 as PROTOCOL_TLS
|
||||||
OP_NO_SSLv2 = 0x1000000 # type: ignore[assignment]
|
|
||||||
OP_NO_SSLv3 = 0x2000000 # type: ignore[assignment]
|
PROTOCOL_SSLv23 = PROTOCOL_TLS
|
||||||
PROTOCOL_SSLv23 = PROTOCOL_TLS = 2 # type: ignore[assignment]
|
except ImportError:
|
||||||
PROTOCOL_TLS_CLIENT = 16 # type: ignore[assignment]
|
PROTOCOL_SSLv23 = PROTOCOL_TLS = 2
|
||||||
|
|
||||||
|
try:
|
||||||
|
from ssl import PROTOCOL_TLS_CLIENT
|
||||||
|
except ImportError:
|
||||||
|
PROTOCOL_TLS_CLIENT = PROTOCOL_TLS
|
||||||
|
|
||||||
|
|
||||||
_TYPE_PEER_CERT_RET = typing.Union["_TYPE_PEER_CERT_RET_DICT", bytes, None]
|
try:
|
||||||
|
from ssl import OP_NO_COMPRESSION, OP_NO_SSLv2, OP_NO_SSLv3
|
||||||
|
except ImportError:
|
||||||
|
OP_NO_SSLv2, OP_NO_SSLv3 = 0x1000000, 0x2000000
|
||||||
|
OP_NO_COMPRESSION = 0x20000
|
||||||
|
|
||||||
|
|
||||||
def assert_fingerprint(cert: bytes | None, fingerprint: str) -> None:
|
try: # OP_NO_TICKET was added in Python 3.6
|
||||||
|
from ssl import OP_NO_TICKET
|
||||||
|
except ImportError:
|
||||||
|
OP_NO_TICKET = 0x4000
|
||||||
|
|
||||||
|
|
||||||
|
# A secure default.
|
||||||
|
# Sources for more information on TLS ciphers:
|
||||||
|
#
|
||||||
|
# - https://wiki.mozilla.org/Security/Server_Side_TLS
|
||||||
|
# - https://www.ssllabs.com/projects/best-practices/index.html
|
||||||
|
# - https://hynek.me/articles/hardening-your-web-servers-ssl-ciphers/
|
||||||
|
#
|
||||||
|
# The general intent is:
|
||||||
|
# - prefer cipher suites that offer perfect forward secrecy (DHE/ECDHE),
|
||||||
|
# - prefer ECDHE over DHE for better performance,
|
||||||
|
# - prefer any AES-GCM and ChaCha20 over any AES-CBC for better performance and
|
||||||
|
# security,
|
||||||
|
# - prefer AES-GCM over ChaCha20 because hardware-accelerated AES is common,
|
||||||
|
# - disable NULL authentication, MD5 MACs, DSS, and other
|
||||||
|
# insecure ciphers for security reasons.
|
||||||
|
# - NOTE: TLS 1.3 cipher suites are managed through a different interface
|
||||||
|
# not exposed by CPython (yet!) and are enabled by default if they're available.
|
||||||
|
DEFAULT_CIPHERS = ":".join(
|
||||||
|
[
|
||||||
|
"ECDHE+AESGCM",
|
||||||
|
"ECDHE+CHACHA20",
|
||||||
|
"DHE+AESGCM",
|
||||||
|
"DHE+CHACHA20",
|
||||||
|
"ECDH+AESGCM",
|
||||||
|
"DH+AESGCM",
|
||||||
|
"ECDH+AES",
|
||||||
|
"DH+AES",
|
||||||
|
"RSA+AESGCM",
|
||||||
|
"RSA+AES",
|
||||||
|
"!aNULL",
|
||||||
|
"!eNULL",
|
||||||
|
"!MD5",
|
||||||
|
"!DSS",
|
||||||
|
]
|
||||||
|
)
|
||||||
|
|
||||||
|
try:
|
||||||
|
from ssl import SSLContext # Modern SSL?
|
||||||
|
except ImportError:
|
||||||
|
|
||||||
|
class SSLContext(object): # Platform-specific: Python 2
|
||||||
|
def __init__(self, protocol_version):
|
||||||
|
self.protocol = protocol_version
|
||||||
|
# Use default values from a real SSLContext
|
||||||
|
self.check_hostname = False
|
||||||
|
self.verify_mode = ssl.CERT_NONE
|
||||||
|
self.ca_certs = None
|
||||||
|
self.options = 0
|
||||||
|
self.certfile = None
|
||||||
|
self.keyfile = None
|
||||||
|
self.ciphers = None
|
||||||
|
|
||||||
|
def load_cert_chain(self, certfile, keyfile):
|
||||||
|
self.certfile = certfile
|
||||||
|
self.keyfile = keyfile
|
||||||
|
|
||||||
|
def load_verify_locations(self, cafile=None, capath=None, cadata=None):
|
||||||
|
self.ca_certs = cafile
|
||||||
|
|
||||||
|
if capath is not None:
|
||||||
|
raise SSLError("CA directories not supported in older Pythons")
|
||||||
|
|
||||||
|
if cadata is not None:
|
||||||
|
raise SSLError("CA data not supported in older Pythons")
|
||||||
|
|
||||||
|
def set_ciphers(self, cipher_suite):
|
||||||
|
self.ciphers = cipher_suite
|
||||||
|
|
||||||
|
def wrap_socket(self, socket, server_hostname=None, server_side=False):
|
||||||
|
warnings.warn(
|
||||||
|
"A true SSLContext object is not available. This prevents "
|
||||||
|
"urllib3 from configuring SSL appropriately and may cause "
|
||||||
|
"certain SSL connections to fail. You can upgrade to a newer "
|
||||||
|
"version of Python to solve this. For more information, see "
|
||||||
|
"https://urllib3.readthedocs.io/en/1.26.x/advanced-usage.html"
|
||||||
|
"#ssl-warnings",
|
||||||
|
InsecurePlatformWarning,
|
||||||
|
)
|
||||||
|
kwargs = {
|
||||||
|
"keyfile": self.keyfile,
|
||||||
|
"certfile": self.certfile,
|
||||||
|
"ca_certs": self.ca_certs,
|
||||||
|
"cert_reqs": self.verify_mode,
|
||||||
|
"ssl_version": self.protocol,
|
||||||
|
"server_side": server_side,
|
||||||
|
}
|
||||||
|
return wrap_socket(socket, ciphers=self.ciphers, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
def assert_fingerprint(cert, fingerprint):
|
||||||
"""
|
"""
|
||||||
Checks if given fingerprint matches the supplied certificate.
|
Checks if given fingerprint matches the supplied certificate.
|
||||||
|
|
||||||
|
|
@ -154,27 +189,26 @@ def assert_fingerprint(cert: bytes | None, fingerprint: str) -> None:
|
||||||
Fingerprint as string of hexdigits, can be interspersed by colons.
|
Fingerprint as string of hexdigits, can be interspersed by colons.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
if cert is None:
|
|
||||||
raise SSLError("No certificate for the peer.")
|
|
||||||
|
|
||||||
fingerprint = fingerprint.replace(":", "").lower()
|
fingerprint = fingerprint.replace(":", "").lower()
|
||||||
digest_length = len(fingerprint)
|
digest_length = len(fingerprint)
|
||||||
hashfunc = HASHFUNC_MAP.get(digest_length)
|
hashfunc = HASHFUNC_MAP.get(digest_length)
|
||||||
if not hashfunc:
|
if not hashfunc:
|
||||||
raise SSLError(f"Fingerprint of invalid length: {fingerprint}")
|
raise SSLError("Fingerprint of invalid length: {0}".format(fingerprint))
|
||||||
|
|
||||||
# We need encode() here for py32; works on py2 and p33.
|
# We need encode() here for py32; works on py2 and p33.
|
||||||
fingerprint_bytes = unhexlify(fingerprint.encode())
|
fingerprint_bytes = unhexlify(fingerprint.encode())
|
||||||
|
|
||||||
cert_digest = hashfunc(cert).digest()
|
cert_digest = hashfunc(cert).digest()
|
||||||
|
|
||||||
if not hmac.compare_digest(cert_digest, fingerprint_bytes):
|
if not _const_compare_digest(cert_digest, fingerprint_bytes):
|
||||||
raise SSLError(
|
raise SSLError(
|
||||||
f'Fingerprints did not match. Expected "{fingerprint}", got "{cert_digest.hex()}"'
|
'Fingerprints did not match. Expected "{0}", got "{1}".'.format(
|
||||||
|
fingerprint, hexlify(cert_digest)
|
||||||
|
)
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
def resolve_cert_reqs(candidate: None | int | str) -> VerifyMode:
|
def resolve_cert_reqs(candidate):
|
||||||
"""
|
"""
|
||||||
Resolves the argument to a numeric constant, which can be passed to
|
Resolves the argument to a numeric constant, which can be passed to
|
||||||
the wrap_socket function/method from the ssl module.
|
the wrap_socket function/method from the ssl module.
|
||||||
|
|
@ -192,12 +226,12 @@ def resolve_cert_reqs(candidate: None | int | str) -> VerifyMode:
|
||||||
res = getattr(ssl, candidate, None)
|
res = getattr(ssl, candidate, None)
|
||||||
if res is None:
|
if res is None:
|
||||||
res = getattr(ssl, "CERT_" + candidate)
|
res = getattr(ssl, "CERT_" + candidate)
|
||||||
return res # type: ignore[no-any-return]
|
return res
|
||||||
|
|
||||||
return candidate # type: ignore[return-value]
|
return candidate
|
||||||
|
|
||||||
|
|
||||||
def resolve_ssl_version(candidate: None | int | str) -> int:
|
def resolve_ssl_version(candidate):
|
||||||
"""
|
"""
|
||||||
like resolve_cert_reqs
|
like resolve_cert_reqs
|
||||||
"""
|
"""
|
||||||
|
|
@ -208,33 +242,35 @@ def resolve_ssl_version(candidate: None | int | str) -> int:
|
||||||
res = getattr(ssl, candidate, None)
|
res = getattr(ssl, candidate, None)
|
||||||
if res is None:
|
if res is None:
|
||||||
res = getattr(ssl, "PROTOCOL_" + candidate)
|
res = getattr(ssl, "PROTOCOL_" + candidate)
|
||||||
return typing.cast(int, res)
|
return res
|
||||||
|
|
||||||
return candidate
|
return candidate
|
||||||
|
|
||||||
|
|
||||||
def create_urllib3_context(
|
def create_urllib3_context(
|
||||||
ssl_version: int | None = None,
|
ssl_version=None, cert_reqs=None, options=None, ciphers=None
|
||||||
cert_reqs: int | None = None,
|
):
|
||||||
options: int | None = None,
|
"""All arguments have the same meaning as ``ssl_wrap_socket``.
|
||||||
ciphers: str | None = None,
|
|
||||||
ssl_minimum_version: int | None = None,
|
By default, this function does a lot of the same work that
|
||||||
ssl_maximum_version: int | None = None,
|
``ssl.create_default_context`` does on Python 3.4+. It:
|
||||||
) -> ssl.SSLContext:
|
|
||||||
"""Creates and configures an :class:`ssl.SSLContext` instance for use with urllib3.
|
- Disables SSLv2, SSLv3, and compression
|
||||||
|
- Sets a restricted set of server ciphers
|
||||||
|
|
||||||
|
If you wish to enable SSLv3, you can do::
|
||||||
|
|
||||||
|
from urllib3.util import ssl_
|
||||||
|
context = ssl_.create_urllib3_context()
|
||||||
|
context.options &= ~ssl_.OP_NO_SSLv3
|
||||||
|
|
||||||
|
You can do the same to enable compression (substituting ``COMPRESSION``
|
||||||
|
for ``SSLv3`` in the last line above).
|
||||||
|
|
||||||
:param ssl_version:
|
:param ssl_version:
|
||||||
The desired protocol version to use. This will default to
|
The desired protocol version to use. This will default to
|
||||||
PROTOCOL_SSLv23 which will negotiate the highest protocol that both
|
PROTOCOL_SSLv23 which will negotiate the highest protocol that both
|
||||||
the server and your installation of OpenSSL support.
|
the server and your installation of OpenSSL support.
|
||||||
|
|
||||||
This parameter is deprecated instead use 'ssl_minimum_version'.
|
|
||||||
:param ssl_minimum_version:
|
|
||||||
The minimum version of TLS to be used. Use the 'ssl.TLSVersion' enum for specifying the value.
|
|
||||||
:param ssl_maximum_version:
|
|
||||||
The maximum version of TLS to be used. Use the 'ssl.TLSVersion' enum for specifying the value.
|
|
||||||
Not recommended to set to anything other than 'ssl.TLSVersion.MAXIMUM_SUPPORTED' which is the
|
|
||||||
default value.
|
|
||||||
:param cert_reqs:
|
:param cert_reqs:
|
||||||
Whether to require the certificate verification. This defaults to
|
Whether to require the certificate verification. This defaults to
|
||||||
``ssl.CERT_REQUIRED``.
|
``ssl.CERT_REQUIRED``.
|
||||||
|
|
@ -242,60 +278,18 @@ def create_urllib3_context(
|
||||||
Specific OpenSSL options. These default to ``ssl.OP_NO_SSLv2``,
|
Specific OpenSSL options. These default to ``ssl.OP_NO_SSLv2``,
|
||||||
``ssl.OP_NO_SSLv3``, ``ssl.OP_NO_COMPRESSION``, and ``ssl.OP_NO_TICKET``.
|
``ssl.OP_NO_SSLv3``, ``ssl.OP_NO_COMPRESSION``, and ``ssl.OP_NO_TICKET``.
|
||||||
:param ciphers:
|
:param ciphers:
|
||||||
Which cipher suites to allow the server to select. Defaults to either system configured
|
Which cipher suites to allow the server to select.
|
||||||
ciphers if OpenSSL 1.1.1+, otherwise uses a secure default set of ciphers.
|
|
||||||
:returns:
|
:returns:
|
||||||
Constructed SSLContext object with specified options
|
Constructed SSLContext object with specified options
|
||||||
:rtype: SSLContext
|
:rtype: SSLContext
|
||||||
"""
|
"""
|
||||||
if SSLContext is None:
|
# PROTOCOL_TLS is deprecated in Python 3.10
|
||||||
raise TypeError("Can't create an SSLContext object without an ssl module")
|
if not ssl_version or ssl_version == PROTOCOL_TLS:
|
||||||
|
ssl_version = PROTOCOL_TLS_CLIENT
|
||||||
|
|
||||||
# This means 'ssl_version' was specified as an exact value.
|
context = SSLContext(ssl_version)
|
||||||
if ssl_version not in (None, PROTOCOL_TLS, PROTOCOL_TLS_CLIENT):
|
|
||||||
# Disallow setting 'ssl_version' and 'ssl_minimum|maximum_version'
|
|
||||||
# to avoid conflicts.
|
|
||||||
if ssl_minimum_version is not None or ssl_maximum_version is not None:
|
|
||||||
raise ValueError(
|
|
||||||
"Can't specify both 'ssl_version' and either "
|
|
||||||
"'ssl_minimum_version' or 'ssl_maximum_version'"
|
|
||||||
)
|
|
||||||
|
|
||||||
# 'ssl_version' is deprecated and will be removed in the future.
|
context.set_ciphers(ciphers or DEFAULT_CIPHERS)
|
||||||
else:
|
|
||||||
# Use 'ssl_minimum_version' and 'ssl_maximum_version' instead.
|
|
||||||
ssl_minimum_version = _SSL_VERSION_TO_TLS_VERSION.get(
|
|
||||||
ssl_version, TLSVersion.MINIMUM_SUPPORTED
|
|
||||||
)
|
|
||||||
ssl_maximum_version = _SSL_VERSION_TO_TLS_VERSION.get(
|
|
||||||
ssl_version, TLSVersion.MAXIMUM_SUPPORTED
|
|
||||||
)
|
|
||||||
|
|
||||||
# This warning message is pushing users to use 'ssl_minimum_version'
|
|
||||||
# instead of both min/max. Best practice is to only set the minimum version and
|
|
||||||
# keep the maximum version to be it's default value: 'TLSVersion.MAXIMUM_SUPPORTED'
|
|
||||||
warnings.warn(
|
|
||||||
"'ssl_version' option is deprecated and will be "
|
|
||||||
"removed in urllib3 v2.1.0. Instead use 'ssl_minimum_version'",
|
|
||||||
category=DeprecationWarning,
|
|
||||||
stacklevel=2,
|
|
||||||
)
|
|
||||||
|
|
||||||
# PROTOCOL_TLS is deprecated in Python 3.10 so we always use PROTOCOL_TLS_CLIENT
|
|
||||||
context = SSLContext(PROTOCOL_TLS_CLIENT)
|
|
||||||
|
|
||||||
if ssl_minimum_version is not None:
|
|
||||||
context.minimum_version = ssl_minimum_version
|
|
||||||
else: # Python <3.10 defaults to 'MINIMUM_SUPPORTED' so explicitly set TLSv1.2 here
|
|
||||||
context.minimum_version = TLSVersion.TLSv1_2
|
|
||||||
|
|
||||||
if ssl_maximum_version is not None:
|
|
||||||
context.maximum_version = ssl_maximum_version
|
|
||||||
|
|
||||||
# Unless we're given ciphers defer to either system ciphers in
|
|
||||||
# the case of OpenSSL 1.1.1+ or use our own secure default ciphers.
|
|
||||||
if ciphers:
|
|
||||||
context.set_ciphers(ciphers)
|
|
||||||
|
|
||||||
# Setting the default here, as we may have no ssl module on import
|
# Setting the default here, as we may have no ssl module on import
|
||||||
cert_reqs = ssl.CERT_REQUIRED if cert_reqs is None else cert_reqs
|
cert_reqs = ssl.CERT_REQUIRED if cert_reqs is None else cert_reqs
|
||||||
|
|
@ -319,28 +313,35 @@ def create_urllib3_context(
|
||||||
|
|
||||||
# Enable post-handshake authentication for TLS 1.3, see GH #1634. PHA is
|
# Enable post-handshake authentication for TLS 1.3, see GH #1634. PHA is
|
||||||
# necessary for conditional client cert authentication with TLS 1.3.
|
# necessary for conditional client cert authentication with TLS 1.3.
|
||||||
# The attribute is None for OpenSSL <= 1.1.0 or does not exist when using
|
# The attribute is None for OpenSSL <= 1.1.0 or does not exist in older
|
||||||
# an SSLContext created by pyOpenSSL.
|
# versions of Python. We only enable on Python 3.7.4+ or if certificate
|
||||||
if getattr(context, "post_handshake_auth", None) is not None:
|
# verification is enabled to work around Python issue #37428
|
||||||
|
# See: https://bugs.python.org/issue37428
|
||||||
|
if (cert_reqs == ssl.CERT_REQUIRED or sys.version_info >= (3, 7, 4)) and getattr(
|
||||||
|
context, "post_handshake_auth", None
|
||||||
|
) is not None:
|
||||||
context.post_handshake_auth = True
|
context.post_handshake_auth = True
|
||||||
|
|
||||||
|
def disable_check_hostname():
|
||||||
|
if (
|
||||||
|
getattr(context, "check_hostname", None) is not None
|
||||||
|
): # Platform-specific: Python 3.2
|
||||||
|
# We do our own verification, including fingerprints and alternative
|
||||||
|
# hostnames. So disable it here
|
||||||
|
context.check_hostname = False
|
||||||
|
|
||||||
# The order of the below lines setting verify_mode and check_hostname
|
# The order of the below lines setting verify_mode and check_hostname
|
||||||
# matter due to safe-guards SSLContext has to prevent an SSLContext with
|
# matter due to safe-guards SSLContext has to prevent an SSLContext with
|
||||||
# check_hostname=True, verify_mode=NONE/OPTIONAL.
|
# check_hostname=True, verify_mode=NONE/OPTIONAL. This is made even more
|
||||||
# We always set 'check_hostname=False' for pyOpenSSL so we rely on our own
|
# complex because we don't know whether PROTOCOL_TLS_CLIENT will be used
|
||||||
# 'ssl.match_hostname()' implementation.
|
# or not so we don't know the initial state of the freshly created SSLContext.
|
||||||
if cert_reqs == ssl.CERT_REQUIRED and not IS_PYOPENSSL:
|
if cert_reqs == ssl.CERT_REQUIRED:
|
||||||
context.verify_mode = cert_reqs
|
context.verify_mode = cert_reqs
|
||||||
context.check_hostname = True
|
disable_check_hostname()
|
||||||
else:
|
else:
|
||||||
context.check_hostname = False
|
disable_check_hostname()
|
||||||
context.verify_mode = cert_reqs
|
context.verify_mode = cert_reqs
|
||||||
|
|
||||||
try:
|
|
||||||
context.hostname_checks_common_name = False
|
|
||||||
except AttributeError: # Defensive: for CPython < 3.8.9 and 3.9.3; for PyPy < 7.3.8
|
|
||||||
pass
|
|
||||||
|
|
||||||
# Enable logging of TLS session keys via defacto standard environment variable
|
# Enable logging of TLS session keys via defacto standard environment variable
|
||||||
# 'SSLKEYLOGFILE', if the feature is available (Python 3.8+). Skip empty values.
|
# 'SSLKEYLOGFILE', if the feature is available (Python 3.8+). Skip empty values.
|
||||||
if hasattr(context, "keylog_filename"):
|
if hasattr(context, "keylog_filename"):
|
||||||
|
|
@ -351,64 +352,24 @@ def create_urllib3_context(
|
||||||
return context
|
return context
|
||||||
|
|
||||||
|
|
||||||
@typing.overload
|
|
||||||
def ssl_wrap_socket(
|
def ssl_wrap_socket(
|
||||||
sock: socket.socket,
|
sock,
|
||||||
keyfile: str | None = ...,
|
keyfile=None,
|
||||||
certfile: str | None = ...,
|
certfile=None,
|
||||||
cert_reqs: int | None = ...,
|
cert_reqs=None,
|
||||||
ca_certs: str | None = ...,
|
ca_certs=None,
|
||||||
server_hostname: str | None = ...,
|
server_hostname=None,
|
||||||
ssl_version: int | None = ...,
|
ssl_version=None,
|
||||||
ciphers: str | None = ...,
|
ciphers=None,
|
||||||
ssl_context: ssl.SSLContext | None = ...,
|
ssl_context=None,
|
||||||
ca_cert_dir: str | None = ...,
|
ca_cert_dir=None,
|
||||||
key_password: str | None = ...,
|
key_password=None,
|
||||||
ca_cert_data: None | str | bytes = ...,
|
ca_cert_data=None,
|
||||||
tls_in_tls: Literal[False] = ...,
|
tls_in_tls=False,
|
||||||
) -> ssl.SSLSocket:
|
):
|
||||||
...
|
|
||||||
|
|
||||||
|
|
||||||
@typing.overload
|
|
||||||
def ssl_wrap_socket(
|
|
||||||
sock: socket.socket,
|
|
||||||
keyfile: str | None = ...,
|
|
||||||
certfile: str | None = ...,
|
|
||||||
cert_reqs: int | None = ...,
|
|
||||||
ca_certs: str | None = ...,
|
|
||||||
server_hostname: str | None = ...,
|
|
||||||
ssl_version: int | None = ...,
|
|
||||||
ciphers: str | None = ...,
|
|
||||||
ssl_context: ssl.SSLContext | None = ...,
|
|
||||||
ca_cert_dir: str | None = ...,
|
|
||||||
key_password: str | None = ...,
|
|
||||||
ca_cert_data: None | str | bytes = ...,
|
|
||||||
tls_in_tls: bool = ...,
|
|
||||||
) -> ssl.SSLSocket | SSLTransportType:
|
|
||||||
...
|
|
||||||
|
|
||||||
|
|
||||||
def ssl_wrap_socket(
|
|
||||||
sock: socket.socket,
|
|
||||||
keyfile: str | None = None,
|
|
||||||
certfile: str | None = None,
|
|
||||||
cert_reqs: int | None = None,
|
|
||||||
ca_certs: str | None = None,
|
|
||||||
server_hostname: str | None = None,
|
|
||||||
ssl_version: int | None = None,
|
|
||||||
ciphers: str | None = None,
|
|
||||||
ssl_context: ssl.SSLContext | None = None,
|
|
||||||
ca_cert_dir: str | None = None,
|
|
||||||
key_password: str | None = None,
|
|
||||||
ca_cert_data: None | str | bytes = None,
|
|
||||||
tls_in_tls: bool = False,
|
|
||||||
) -> ssl.SSLSocket | SSLTransportType:
|
|
||||||
"""
|
"""
|
||||||
All arguments except for server_hostname, ssl_context, tls_in_tls, ca_cert_data and
|
All arguments except for server_hostname, ssl_context, and ca_cert_dir have
|
||||||
ca_cert_dir have the same meaning as they do when using
|
the same meaning as they do when using :func:`ssl.wrap_socket`.
|
||||||
:func:`ssl.create_default_context`, :meth:`ssl.SSLContext.load_cert_chain`,
|
|
||||||
:meth:`ssl.SSLContext.set_ciphers` and :meth:`ssl.SSLContext.wrap_socket`.
|
|
||||||
|
|
||||||
:param server_hostname:
|
:param server_hostname:
|
||||||
When SNI is supported, the expected hostname of the certificate
|
When SNI is supported, the expected hostname of the certificate
|
||||||
|
|
@ -431,18 +392,19 @@ def ssl_wrap_socket(
|
||||||
"""
|
"""
|
||||||
context = ssl_context
|
context = ssl_context
|
||||||
if context is None:
|
if context is None:
|
||||||
# Note: This branch of code and all the variables in it are only used in tests.
|
# Note: This branch of code and all the variables in it are no longer
|
||||||
# We should consider deprecating and removing this code.
|
# used by urllib3 itself. We should consider deprecating and removing
|
||||||
|
# this code.
|
||||||
context = create_urllib3_context(ssl_version, cert_reqs, ciphers=ciphers)
|
context = create_urllib3_context(ssl_version, cert_reqs, ciphers=ciphers)
|
||||||
|
|
||||||
if ca_certs or ca_cert_dir or ca_cert_data:
|
if ca_certs or ca_cert_dir or ca_cert_data:
|
||||||
try:
|
try:
|
||||||
context.load_verify_locations(ca_certs, ca_cert_dir, ca_cert_data)
|
context.load_verify_locations(ca_certs, ca_cert_dir, ca_cert_data)
|
||||||
except OSError as e:
|
except (IOError, OSError) as e:
|
||||||
raise SSLError(e) from e
|
raise SSLError(e)
|
||||||
|
|
||||||
elif ssl_context is None and hasattr(context, "load_default_certs"):
|
elif ssl_context is None and hasattr(context, "load_default_certs"):
|
||||||
# try to load OS default certs; works well on Windows.
|
# try to load OS default certs; works well on Windows (require Python3.4+)
|
||||||
context.load_default_certs()
|
context.load_default_certs()
|
||||||
|
|
||||||
# Attempt to detect if we get the goofy behavior of the
|
# Attempt to detect if we get the goofy behavior of the
|
||||||
|
|
@ -458,30 +420,56 @@ def ssl_wrap_socket(
|
||||||
context.load_cert_chain(certfile, keyfile, key_password)
|
context.load_cert_chain(certfile, keyfile, key_password)
|
||||||
|
|
||||||
try:
|
try:
|
||||||
|
if hasattr(context, "set_alpn_protocols"):
|
||||||
context.set_alpn_protocols(ALPN_PROTOCOLS)
|
context.set_alpn_protocols(ALPN_PROTOCOLS)
|
||||||
except NotImplementedError: # Defensive: in CI, we always have set_alpn_protocols
|
except NotImplementedError: # Defensive: in CI, we always have set_alpn_protocols
|
||||||
pass
|
pass
|
||||||
|
|
||||||
ssl_sock = _ssl_wrap_socket_impl(sock, context, tls_in_tls, server_hostname)
|
# If we detect server_hostname is an IP address then the SNI
|
||||||
|
# extension should not be used according to RFC3546 Section 3.1
|
||||||
|
use_sni_hostname = server_hostname and not is_ipaddress(server_hostname)
|
||||||
|
# SecureTransport uses server_hostname in certificate verification.
|
||||||
|
send_sni = (use_sni_hostname and HAS_SNI) or (
|
||||||
|
IS_SECURETRANSPORT and server_hostname
|
||||||
|
)
|
||||||
|
# Do not warn the user if server_hostname is an invalid SNI hostname.
|
||||||
|
if not HAS_SNI and use_sni_hostname:
|
||||||
|
warnings.warn(
|
||||||
|
"An HTTPS request has been made, but the SNI (Server Name "
|
||||||
|
"Indication) extension to TLS is not available on this platform. "
|
||||||
|
"This may cause the server to present an incorrect TLS "
|
||||||
|
"certificate, which can cause validation failures. You can upgrade to "
|
||||||
|
"a newer version of Python to solve this. For more information, see "
|
||||||
|
"https://urllib3.readthedocs.io/en/1.26.x/advanced-usage.html"
|
||||||
|
"#ssl-warnings",
|
||||||
|
SNIMissingWarning,
|
||||||
|
)
|
||||||
|
|
||||||
|
if send_sni:
|
||||||
|
ssl_sock = _ssl_wrap_socket_impl(
|
||||||
|
sock, context, tls_in_tls, server_hostname=server_hostname
|
||||||
|
)
|
||||||
|
else:
|
||||||
|
ssl_sock = _ssl_wrap_socket_impl(sock, context, tls_in_tls)
|
||||||
return ssl_sock
|
return ssl_sock
|
||||||
|
|
||||||
|
|
||||||
def is_ipaddress(hostname: str | bytes) -> bool:
|
def is_ipaddress(hostname):
|
||||||
"""Detects whether the hostname given is an IPv4 or IPv6 address.
|
"""Detects whether the hostname given is an IPv4 or IPv6 address.
|
||||||
Also detects IPv6 addresses with Zone IDs.
|
Also detects IPv6 addresses with Zone IDs.
|
||||||
|
|
||||||
:param str hostname: Hostname to examine.
|
:param str hostname: Hostname to examine.
|
||||||
:return: True if the hostname is an IP address, False otherwise.
|
:return: True if the hostname is an IP address, False otherwise.
|
||||||
"""
|
"""
|
||||||
if isinstance(hostname, bytes):
|
if not six.PY2 and isinstance(hostname, bytes):
|
||||||
# IDN A-label bytes are ASCII compatible.
|
# IDN A-label bytes are ASCII compatible.
|
||||||
hostname = hostname.decode("ascii")
|
hostname = hostname.decode("ascii")
|
||||||
return bool(_IPV4_RE.match(hostname) or _BRACELESS_IPV6_ADDRZ_RE.match(hostname))
|
return bool(IPV4_RE.match(hostname) or BRACELESS_IPV6_ADDRZ_RE.match(hostname))
|
||||||
|
|
||||||
|
|
||||||
def _is_key_file_encrypted(key_file: str) -> bool:
|
def _is_key_file_encrypted(key_file):
|
||||||
"""Detects if a key file is encrypted or not."""
|
"""Detects if a key file is encrypted or not."""
|
||||||
with open(key_file) as f:
|
with open(key_file, "r") as f:
|
||||||
for line in f:
|
for line in f:
|
||||||
# Look for Proc-Type: 4,ENCRYPTED
|
# Look for Proc-Type: 4,ENCRYPTED
|
||||||
if "ENCRYPTED" in line:
|
if "ENCRYPTED" in line:
|
||||||
|
|
@ -490,12 +478,7 @@ def _is_key_file_encrypted(key_file: str) -> bool:
|
||||||
return False
|
return False
|
||||||
|
|
||||||
|
|
||||||
def _ssl_wrap_socket_impl(
|
def _ssl_wrap_socket_impl(sock, ssl_context, tls_in_tls, server_hostname=None):
|
||||||
sock: socket.socket,
|
|
||||||
ssl_context: ssl.SSLContext,
|
|
||||||
tls_in_tls: bool,
|
|
||||||
server_hostname: str | None = None,
|
|
||||||
) -> ssl.SSLSocket | SSLTransportType:
|
|
||||||
if tls_in_tls:
|
if tls_in_tls:
|
||||||
if not SSLTransport:
|
if not SSLTransport:
|
||||||
# Import error, ssl is not available.
|
# Import error, ssl is not available.
|
||||||
|
|
@ -506,4 +489,7 @@ def _ssl_wrap_socket_impl(
|
||||||
SSLTransport._validate_ssl_context_for_tls_in_tls(ssl_context)
|
SSLTransport._validate_ssl_context_for_tls_in_tls(ssl_context)
|
||||||
return SSLTransport(sock, ssl_context, server_hostname)
|
return SSLTransport(sock, ssl_context, server_hostname)
|
||||||
|
|
||||||
|
if server_hostname:
|
||||||
return ssl_context.wrap_socket(sock, server_hostname=server_hostname)
|
return ssl_context.wrap_socket(sock, server_hostname=server_hostname)
|
||||||
|
else:
|
||||||
|
return ssl_context.wrap_socket(sock)
|
||||||
|
|
|
||||||
|
|
@ -1,18 +1,19 @@
|
||||||
"""The match_hostname() function from Python 3.5, essential when using SSL."""
|
"""The match_hostname() function from Python 3.3.3, essential when using SSL."""
|
||||||
|
|
||||||
# Note: This file is under the PSF license as the code comes from the python
|
# Note: This file is under the PSF license as the code comes from the python
|
||||||
# stdlib. http://docs.python.org/3/license.html
|
# stdlib. http://docs.python.org/3/license.html
|
||||||
# It is modified to remove commonName support.
|
|
||||||
|
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import ipaddress
|
|
||||||
import re
|
import re
|
||||||
import typing
|
import sys
|
||||||
from ipaddress import IPv4Address, IPv6Address
|
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
# ipaddress has been backported to 2.6+ in pypi. If it is installed on the
|
||||||
from .ssl_ import _TYPE_PEER_CERT_RET_DICT
|
# system, use it to handle IPAddress ServerAltnames (this was added in
|
||||||
|
# python-3.5) otherwise only do DNS matching. This allows
|
||||||
|
# util.ssl_match_hostname to continue to be used in Python 2.7.
|
||||||
|
try:
|
||||||
|
import ipaddress
|
||||||
|
except ImportError:
|
||||||
|
ipaddress = None
|
||||||
|
|
||||||
__version__ = "3.5.0.1"
|
__version__ = "3.5.0.1"
|
||||||
|
|
||||||
|
|
@ -21,9 +22,7 @@ class CertificateError(ValueError):
|
||||||
pass
|
pass
|
||||||
|
|
||||||
|
|
||||||
def _dnsname_match(
|
def _dnsname_match(dn, hostname, max_wildcards=1):
|
||||||
dn: typing.Any, hostname: str, max_wildcards: int = 1
|
|
||||||
) -> typing.Match[str] | None | bool:
|
|
||||||
"""Matching according to RFC 6125, section 6.4.3
|
"""Matching according to RFC 6125, section 6.4.3
|
||||||
|
|
||||||
http://tools.ietf.org/html/rfc6125#section-6.4.3
|
http://tools.ietf.org/html/rfc6125#section-6.4.3
|
||||||
|
|
@ -50,7 +49,7 @@ def _dnsname_match(
|
||||||
|
|
||||||
# speed up common case w/o wildcards
|
# speed up common case w/o wildcards
|
||||||
if not wildcards:
|
if not wildcards:
|
||||||
return bool(dn.lower() == hostname.lower())
|
return dn.lower() == hostname.lower()
|
||||||
|
|
||||||
# RFC 6125, section 6.4.3, subitem 1.
|
# RFC 6125, section 6.4.3, subitem 1.
|
||||||
# The client SHOULD NOT attempt to match a presented identifier in which
|
# The client SHOULD NOT attempt to match a presented identifier in which
|
||||||
|
|
@ -77,26 +76,26 @@ def _dnsname_match(
|
||||||
return pat.match(hostname)
|
return pat.match(hostname)
|
||||||
|
|
||||||
|
|
||||||
def _ipaddress_match(ipname: str, host_ip: IPv4Address | IPv6Address) -> bool:
|
def _to_unicode(obj):
|
||||||
|
if isinstance(obj, str) and sys.version_info < (3,):
|
||||||
|
# ignored flake8 # F821 to support python 2.7 function
|
||||||
|
obj = unicode(obj, encoding="ascii", errors="strict") # noqa: F821
|
||||||
|
return obj
|
||||||
|
|
||||||
|
|
||||||
|
def _ipaddress_match(ipname, host_ip):
|
||||||
"""Exact matching of IP addresses.
|
"""Exact matching of IP addresses.
|
||||||
|
|
||||||
RFC 9110 section 4.3.5: "A reference identity of IP-ID contains the decoded
|
RFC 6125 explicitly doesn't define an algorithm for this
|
||||||
bytes of the IP address. An IP version 4 address is 4 octets, and an IP
|
(section 1.7.2 - "Out of Scope").
|
||||||
version 6 address is 16 octets. [...] A reference identity of type IP-ID
|
|
||||||
matches if the address is identical to an iPAddress value of the
|
|
||||||
subjectAltName extension of the certificate."
|
|
||||||
"""
|
"""
|
||||||
# OpenSSL may add a trailing newline to a subjectAltName's IP address
|
# OpenSSL may add a trailing newline to a subjectAltName's IP address
|
||||||
# Divergence from upstream: ipaddress can't handle byte str
|
# Divergence from upstream: ipaddress can't handle byte str
|
||||||
ip = ipaddress.ip_address(ipname.rstrip())
|
ip = ipaddress.ip_address(_to_unicode(ipname).rstrip())
|
||||||
return bool(ip.packed == host_ip.packed)
|
return ip == host_ip
|
||||||
|
|
||||||
|
|
||||||
def match_hostname(
|
def match_hostname(cert, hostname):
|
||||||
cert: _TYPE_PEER_CERT_RET_DICT | None,
|
|
||||||
hostname: str,
|
|
||||||
hostname_checks_common_name: bool = False,
|
|
||||||
) -> None:
|
|
||||||
"""Verify that *cert* (in decoded format as returned by
|
"""Verify that *cert* (in decoded format as returned by
|
||||||
SSLSocket.getpeercert()) matches the *hostname*. RFC 2818 and RFC 6125
|
SSLSocket.getpeercert()) matches the *hostname*. RFC 2818 and RFC 6125
|
||||||
rules are followed, but IP addresses are not accepted for *hostname*.
|
rules are followed, but IP addresses are not accepted for *hostname*.
|
||||||
|
|
@ -112,22 +111,21 @@ def match_hostname(
|
||||||
)
|
)
|
||||||
try:
|
try:
|
||||||
# Divergence from upstream: ipaddress can't handle byte str
|
# Divergence from upstream: ipaddress can't handle byte str
|
||||||
#
|
host_ip = ipaddress.ip_address(_to_unicode(hostname))
|
||||||
# The ipaddress module shipped with Python < 3.9 does not support
|
except (UnicodeError, ValueError):
|
||||||
# scoped IPv6 addresses so we unconditionally strip the Zone IDs for
|
# ValueError: Not an IP address (common case)
|
||||||
# now. Once we drop support for Python 3.9 we can remove this branch.
|
# UnicodeError: Divergence from upstream: Have to deal with ipaddress not taking
|
||||||
if "%" in hostname:
|
# byte strings. addresses should be all ascii, so we consider it not
|
||||||
host_ip = ipaddress.ip_address(hostname[: hostname.rfind("%")])
|
# an ipaddress in this case
|
||||||
else:
|
|
||||||
host_ip = ipaddress.ip_address(hostname)
|
|
||||||
|
|
||||||
except ValueError:
|
|
||||||
# Not an IP address (common case)
|
|
||||||
host_ip = None
|
host_ip = None
|
||||||
|
except AttributeError:
|
||||||
|
# Divergence from upstream: Make ipaddress library optional
|
||||||
|
if ipaddress is None:
|
||||||
|
host_ip = None
|
||||||
|
else: # Defensive
|
||||||
|
raise
|
||||||
dnsnames = []
|
dnsnames = []
|
||||||
san: tuple[tuple[str, str], ...] = cert.get("subjectAltName", ())
|
san = cert.get("subjectAltName", ())
|
||||||
key: str
|
|
||||||
value: str
|
|
||||||
for key, value in san:
|
for key, value in san:
|
||||||
if key == "DNS":
|
if key == "DNS":
|
||||||
if host_ip is None and _dnsname_match(value, hostname):
|
if host_ip is None and _dnsname_match(value, hostname):
|
||||||
|
|
@ -137,23 +135,25 @@ def match_hostname(
|
||||||
if host_ip is not None and _ipaddress_match(value, host_ip):
|
if host_ip is not None and _ipaddress_match(value, host_ip):
|
||||||
return
|
return
|
||||||
dnsnames.append(value)
|
dnsnames.append(value)
|
||||||
|
if not dnsnames:
|
||||||
# We only check 'commonName' if it's enabled and we're not verifying
|
# The subject is only checked when there is no dNSName entry
|
||||||
# an IP address. IP addresses aren't valid within 'commonName'.
|
# in subjectAltName
|
||||||
if hostname_checks_common_name and host_ip is None and not dnsnames:
|
|
||||||
for sub in cert.get("subject", ()):
|
for sub in cert.get("subject", ()):
|
||||||
for key, value in sub:
|
for key, value in sub:
|
||||||
|
# XXX according to RFC 2818, the most specific Common Name
|
||||||
|
# must be used.
|
||||||
if key == "commonName":
|
if key == "commonName":
|
||||||
if _dnsname_match(value, hostname):
|
if _dnsname_match(value, hostname):
|
||||||
return
|
return
|
||||||
dnsnames.append(value)
|
dnsnames.append(value)
|
||||||
|
|
||||||
if len(dnsnames) > 1:
|
if len(dnsnames) > 1:
|
||||||
raise CertificateError(
|
raise CertificateError(
|
||||||
"hostname %r "
|
"hostname %r "
|
||||||
"doesn't match either of %s" % (hostname, ", ".join(map(repr, dnsnames)))
|
"doesn't match either of %s" % (hostname, ", ".join(map(repr, dnsnames)))
|
||||||
)
|
)
|
||||||
elif len(dnsnames) == 1:
|
elif len(dnsnames) == 1:
|
||||||
raise CertificateError(f"hostname {hostname!r} doesn't match {dnsnames[0]!r}")
|
raise CertificateError("hostname %r doesn't match %r" % (hostname, dnsnames[0]))
|
||||||
else:
|
else:
|
||||||
raise CertificateError("no appropriate subjectAltName fields were found")
|
raise CertificateError(
|
||||||
|
"no appropriate commonName or subjectAltName fields were found"
|
||||||
|
)
|
||||||
|
|
|
||||||
|
|
@ -1,21 +1,9 @@
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import io
|
import io
|
||||||
import socket
|
import socket
|
||||||
import ssl
|
import ssl
|
||||||
import typing
|
|
||||||
|
|
||||||
from ..exceptions import ProxySchemeUnsupported
|
from ..exceptions import ProxySchemeUnsupported
|
||||||
|
from ..packages import six
|
||||||
if typing.TYPE_CHECKING:
|
|
||||||
from typing import Literal
|
|
||||||
|
|
||||||
from .ssl_ import _TYPE_PEER_CERT_RET, _TYPE_PEER_CERT_RET_DICT
|
|
||||||
|
|
||||||
|
|
||||||
_SelfT = typing.TypeVar("_SelfT", bound="SSLTransport")
|
|
||||||
_WriteBuffer = typing.Union[bytearray, memoryview]
|
|
||||||
_ReturnValue = typing.TypeVar("_ReturnValue")
|
|
||||||
|
|
||||||
SSL_BLOCKSIZE = 16384
|
SSL_BLOCKSIZE = 16384
|
||||||
|
|
||||||
|
|
@ -32,7 +20,7 @@ class SSLTransport:
|
||||||
"""
|
"""
|
||||||
|
|
||||||
@staticmethod
|
@staticmethod
|
||||||
def _validate_ssl_context_for_tls_in_tls(ssl_context: ssl.SSLContext) -> None:
|
def _validate_ssl_context_for_tls_in_tls(ssl_context):
|
||||||
"""
|
"""
|
||||||
Raises a ProxySchemeUnsupported if the provided ssl_context can't be used
|
Raises a ProxySchemeUnsupported if the provided ssl_context can't be used
|
||||||
for TLS in TLS.
|
for TLS in TLS.
|
||||||
|
|
@ -42,18 +30,20 @@ class SSLTransport:
|
||||||
"""
|
"""
|
||||||
|
|
||||||
if not hasattr(ssl_context, "wrap_bio"):
|
if not hasattr(ssl_context, "wrap_bio"):
|
||||||
|
if six.PY2:
|
||||||
|
raise ProxySchemeUnsupported(
|
||||||
|
"TLS in TLS requires SSLContext.wrap_bio() which isn't "
|
||||||
|
"supported on Python 2"
|
||||||
|
)
|
||||||
|
else:
|
||||||
raise ProxySchemeUnsupported(
|
raise ProxySchemeUnsupported(
|
||||||
"TLS in TLS requires SSLContext.wrap_bio() which isn't "
|
"TLS in TLS requires SSLContext.wrap_bio() which isn't "
|
||||||
"available on non-native SSLContext"
|
"available on non-native SSLContext"
|
||||||
)
|
)
|
||||||
|
|
||||||
def __init__(
|
def __init__(
|
||||||
self,
|
self, socket, ssl_context, server_hostname=None, suppress_ragged_eofs=True
|
||||||
socket: socket.socket,
|
):
|
||||||
ssl_context: ssl.SSLContext,
|
|
||||||
server_hostname: str | None = None,
|
|
||||||
suppress_ragged_eofs: bool = True,
|
|
||||||
) -> None:
|
|
||||||
"""
|
"""
|
||||||
Create an SSLTransport around socket using the provided ssl_context.
|
Create an SSLTransport around socket using the provided ssl_context.
|
||||||
"""
|
"""
|
||||||
|
|
@ -70,36 +60,33 @@ class SSLTransport:
|
||||||
# Perform initial handshake.
|
# Perform initial handshake.
|
||||||
self._ssl_io_loop(self.sslobj.do_handshake)
|
self._ssl_io_loop(self.sslobj.do_handshake)
|
||||||
|
|
||||||
def __enter__(self: _SelfT) -> _SelfT:
|
def __enter__(self):
|
||||||
return self
|
return self
|
||||||
|
|
||||||
def __exit__(self, *_: typing.Any) -> None:
|
def __exit__(self, *_):
|
||||||
self.close()
|
self.close()
|
||||||
|
|
||||||
def fileno(self) -> int:
|
def fileno(self):
|
||||||
return self.socket.fileno()
|
return self.socket.fileno()
|
||||||
|
|
||||||
def read(self, len: int = 1024, buffer: typing.Any | None = None) -> int | bytes:
|
def read(self, len=1024, buffer=None):
|
||||||
return self._wrap_ssl_read(len, buffer)
|
return self._wrap_ssl_read(len, buffer)
|
||||||
|
|
||||||
def recv(self, buflen: int = 1024, flags: int = 0) -> int | bytes:
|
def recv(self, len=1024, flags=0):
|
||||||
if flags != 0:
|
if flags != 0:
|
||||||
raise ValueError("non-zero flags not allowed in calls to recv")
|
raise ValueError("non-zero flags not allowed in calls to recv")
|
||||||
return self._wrap_ssl_read(buflen)
|
return self._wrap_ssl_read(len)
|
||||||
|
|
||||||
def recv_into(
|
def recv_into(self, buffer, nbytes=None, flags=0):
|
||||||
self,
|
|
||||||
buffer: _WriteBuffer,
|
|
||||||
nbytes: int | None = None,
|
|
||||||
flags: int = 0,
|
|
||||||
) -> None | int | bytes:
|
|
||||||
if flags != 0:
|
if flags != 0:
|
||||||
raise ValueError("non-zero flags not allowed in calls to recv_into")
|
raise ValueError("non-zero flags not allowed in calls to recv_into")
|
||||||
if nbytes is None:
|
if buffer and (nbytes is None):
|
||||||
nbytes = len(buffer)
|
nbytes = len(buffer)
|
||||||
|
elif nbytes is None:
|
||||||
|
nbytes = 1024
|
||||||
return self.read(nbytes, buffer)
|
return self.read(nbytes, buffer)
|
||||||
|
|
||||||
def sendall(self, data: bytes, flags: int = 0) -> None:
|
def sendall(self, data, flags=0):
|
||||||
if flags != 0:
|
if flags != 0:
|
||||||
raise ValueError("non-zero flags not allowed in calls to sendall")
|
raise ValueError("non-zero flags not allowed in calls to sendall")
|
||||||
count = 0
|
count = 0
|
||||||
|
|
@ -109,20 +96,15 @@ class SSLTransport:
|
||||||
v = self.send(byte_view[count:])
|
v = self.send(byte_view[count:])
|
||||||
count += v
|
count += v
|
||||||
|
|
||||||
def send(self, data: bytes, flags: int = 0) -> int:
|
def send(self, data, flags=0):
|
||||||
if flags != 0:
|
if flags != 0:
|
||||||
raise ValueError("non-zero flags not allowed in calls to send")
|
raise ValueError("non-zero flags not allowed in calls to send")
|
||||||
return self._ssl_io_loop(self.sslobj.write, data)
|
response = self._ssl_io_loop(self.sslobj.write, data)
|
||||||
|
return response
|
||||||
|
|
||||||
def makefile(
|
def makefile(
|
||||||
self,
|
self, mode="r", buffering=None, encoding=None, errors=None, newline=None
|
||||||
mode: str,
|
):
|
||||||
buffering: int | None = None,
|
|
||||||
*,
|
|
||||||
encoding: str | None = None,
|
|
||||||
errors: str | None = None,
|
|
||||||
newline: str | None = None,
|
|
||||||
) -> typing.BinaryIO | typing.TextIO | socket.SocketIO:
|
|
||||||
"""
|
"""
|
||||||
Python's httpclient uses makefile and buffered io when reading HTTP
|
Python's httpclient uses makefile and buffered io when reading HTTP
|
||||||
messages and we need to support it.
|
messages and we need to support it.
|
||||||
|
|
@ -131,7 +113,7 @@ class SSLTransport:
|
||||||
changes to point to the socket directly.
|
changes to point to the socket directly.
|
||||||
"""
|
"""
|
||||||
if not set(mode) <= {"r", "w", "b"}:
|
if not set(mode) <= {"r", "w", "b"}:
|
||||||
raise ValueError(f"invalid mode {mode!r} (only r, w, b allowed)")
|
raise ValueError("invalid mode %r (only r, w, b allowed)" % (mode,))
|
||||||
|
|
||||||
writing = "w" in mode
|
writing = "w" in mode
|
||||||
reading = "r" in mode or not writing
|
reading = "r" in mode or not writing
|
||||||
|
|
@ -142,8 +124,8 @@ class SSLTransport:
|
||||||
rawmode += "r"
|
rawmode += "r"
|
||||||
if writing:
|
if writing:
|
||||||
rawmode += "w"
|
rawmode += "w"
|
||||||
raw = socket.SocketIO(self, rawmode) # type: ignore[arg-type]
|
raw = socket.SocketIO(self, rawmode)
|
||||||
self.socket._io_refs += 1 # type: ignore[attr-defined]
|
self.socket._io_refs += 1
|
||||||
if buffering is None:
|
if buffering is None:
|
||||||
buffering = -1
|
buffering = -1
|
||||||
if buffering < 0:
|
if buffering < 0:
|
||||||
|
|
@ -152,9 +134,8 @@ class SSLTransport:
|
||||||
if not binary:
|
if not binary:
|
||||||
raise ValueError("unbuffered streams must be binary")
|
raise ValueError("unbuffered streams must be binary")
|
||||||
return raw
|
return raw
|
||||||
buffer: typing.BinaryIO
|
|
||||||
if reading and writing:
|
if reading and writing:
|
||||||
buffer = io.BufferedRWPair(raw, raw, buffering) # type: ignore[assignment]
|
buffer = io.BufferedRWPair(raw, raw, buffering)
|
||||||
elif reading:
|
elif reading:
|
||||||
buffer = io.BufferedReader(raw, buffering)
|
buffer = io.BufferedReader(raw, buffering)
|
||||||
else:
|
else:
|
||||||
|
|
@ -163,56 +144,46 @@ class SSLTransport:
|
||||||
if binary:
|
if binary:
|
||||||
return buffer
|
return buffer
|
||||||
text = io.TextIOWrapper(buffer, encoding, errors, newline)
|
text = io.TextIOWrapper(buffer, encoding, errors, newline)
|
||||||
text.mode = mode # type: ignore[misc]
|
text.mode = mode
|
||||||
return text
|
return text
|
||||||
|
|
||||||
def unwrap(self) -> None:
|
def unwrap(self):
|
||||||
self._ssl_io_loop(self.sslobj.unwrap)
|
self._ssl_io_loop(self.sslobj.unwrap)
|
||||||
|
|
||||||
def close(self) -> None:
|
def close(self):
|
||||||
self.socket.close()
|
self.socket.close()
|
||||||
|
|
||||||
@typing.overload
|
def getpeercert(self, binary_form=False):
|
||||||
def getpeercert(
|
return self.sslobj.getpeercert(binary_form)
|
||||||
self, binary_form: Literal[False] = ...
|
|
||||||
) -> _TYPE_PEER_CERT_RET_DICT | None:
|
|
||||||
...
|
|
||||||
|
|
||||||
@typing.overload
|
def version(self):
|
||||||
def getpeercert(self, binary_form: Literal[True]) -> bytes | None:
|
|
||||||
...
|
|
||||||
|
|
||||||
def getpeercert(self, binary_form: bool = False) -> _TYPE_PEER_CERT_RET:
|
|
||||||
return self.sslobj.getpeercert(binary_form) # type: ignore[return-value]
|
|
||||||
|
|
||||||
def version(self) -> str | None:
|
|
||||||
return self.sslobj.version()
|
return self.sslobj.version()
|
||||||
|
|
||||||
def cipher(self) -> tuple[str, str, int] | None:
|
def cipher(self):
|
||||||
return self.sslobj.cipher()
|
return self.sslobj.cipher()
|
||||||
|
|
||||||
def selected_alpn_protocol(self) -> str | None:
|
def selected_alpn_protocol(self):
|
||||||
return self.sslobj.selected_alpn_protocol()
|
return self.sslobj.selected_alpn_protocol()
|
||||||
|
|
||||||
def selected_npn_protocol(self) -> str | None:
|
def selected_npn_protocol(self):
|
||||||
return self.sslobj.selected_npn_protocol()
|
return self.sslobj.selected_npn_protocol()
|
||||||
|
|
||||||
def shared_ciphers(self) -> list[tuple[str, str, int]] | None:
|
def shared_ciphers(self):
|
||||||
return self.sslobj.shared_ciphers()
|
return self.sslobj.shared_ciphers()
|
||||||
|
|
||||||
def compression(self) -> str | None:
|
def compression(self):
|
||||||
return self.sslobj.compression()
|
return self.sslobj.compression()
|
||||||
|
|
||||||
def settimeout(self, value: float | None) -> None:
|
def settimeout(self, value):
|
||||||
self.socket.settimeout(value)
|
self.socket.settimeout(value)
|
||||||
|
|
||||||
def gettimeout(self) -> float | None:
|
def gettimeout(self):
|
||||||
return self.socket.gettimeout()
|
return self.socket.gettimeout()
|
||||||
|
|
||||||
def _decref_socketios(self) -> None:
|
def _decref_socketios(self):
|
||||||
self.socket._decref_socketios() # type: ignore[attr-defined]
|
self.socket._decref_socketios()
|
||||||
|
|
||||||
def _wrap_ssl_read(self, len: int, buffer: bytearray | None = None) -> int | bytes:
|
def _wrap_ssl_read(self, len, buffer=None):
|
||||||
try:
|
try:
|
||||||
return self._ssl_io_loop(self.sslobj.read, len, buffer)
|
return self._ssl_io_loop(self.sslobj.read, len, buffer)
|
||||||
except ssl.SSLError as e:
|
except ssl.SSLError as e:
|
||||||
|
|
@ -221,32 +192,7 @@ class SSLTransport:
|
||||||
else:
|
else:
|
||||||
raise
|
raise
|
||||||
|
|
||||||
# func is sslobj.do_handshake or sslobj.unwrap
|
def _ssl_io_loop(self, func, *args):
|
||||||
@typing.overload
|
|
||||||
def _ssl_io_loop(self, func: typing.Callable[[], None]) -> None:
|
|
||||||
...
|
|
||||||
|
|
||||||
# func is sslobj.write, arg1 is data
|
|
||||||
@typing.overload
|
|
||||||
def _ssl_io_loop(self, func: typing.Callable[[bytes], int], arg1: bytes) -> int:
|
|
||||||
...
|
|
||||||
|
|
||||||
# func is sslobj.read, arg1 is len, arg2 is buffer
|
|
||||||
@typing.overload
|
|
||||||
def _ssl_io_loop(
|
|
||||||
self,
|
|
||||||
func: typing.Callable[[int, bytearray | None], bytes],
|
|
||||||
arg1: int,
|
|
||||||
arg2: bytearray | None,
|
|
||||||
) -> bytes:
|
|
||||||
...
|
|
||||||
|
|
||||||
def _ssl_io_loop(
|
|
||||||
self,
|
|
||||||
func: typing.Callable[..., _ReturnValue],
|
|
||||||
arg1: None | bytes | int = None,
|
|
||||||
arg2: bytearray | None = None,
|
|
||||||
) -> _ReturnValue:
|
|
||||||
"""Performs an I/O loop between incoming/outgoing and the socket."""
|
"""Performs an I/O loop between incoming/outgoing and the socket."""
|
||||||
should_loop = True
|
should_loop = True
|
||||||
ret = None
|
ret = None
|
||||||
|
|
@ -254,12 +200,7 @@ class SSLTransport:
|
||||||
while should_loop:
|
while should_loop:
|
||||||
errno = None
|
errno = None
|
||||||
try:
|
try:
|
||||||
if arg1 is None and arg2 is None:
|
ret = func(*args)
|
||||||
ret = func()
|
|
||||||
elif arg2 is None:
|
|
||||||
ret = func(arg1)
|
|
||||||
else:
|
|
||||||
ret = func(arg1, arg2)
|
|
||||||
except ssl.SSLError as e:
|
except ssl.SSLError as e:
|
||||||
if e.errno not in (ssl.SSL_ERROR_WANT_READ, ssl.SSL_ERROR_WANT_WRITE):
|
if e.errno not in (ssl.SSL_ERROR_WANT_READ, ssl.SSL_ERROR_WANT_WRITE):
|
||||||
# WANT_READ, and WANT_WRITE are expected, others are not.
|
# WANT_READ, and WANT_WRITE are expected, others are not.
|
||||||
|
|
@ -277,4 +218,4 @@ class SSLTransport:
|
||||||
self.incoming.write(buf)
|
self.incoming.write(buf)
|
||||||
else:
|
else:
|
||||||
self.incoming.write_eof()
|
self.incoming.write_eof()
|
||||||
return typing.cast(_ReturnValue, ret)
|
return ret
|
||||||
|
|
|
||||||
|
|
@ -1,56 +1,44 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import time
|
import time
|
||||||
import typing
|
|
||||||
from enum import Enum
|
# The default socket timeout, used by httplib to indicate that no timeout was; specified by the user
|
||||||
from socket import getdefaulttimeout
|
from socket import _GLOBAL_DEFAULT_TIMEOUT, getdefaulttimeout
|
||||||
|
|
||||||
from ..exceptions import TimeoutStateError
|
from ..exceptions import TimeoutStateError
|
||||||
|
|
||||||
if typing.TYPE_CHECKING:
|
# A sentinel value to indicate that no timeout was specified by the user in
|
||||||
from typing import Final
|
# urllib3
|
||||||
|
_Default = object()
|
||||||
|
|
||||||
|
|
||||||
class _TYPE_DEFAULT(Enum):
|
# Use time.monotonic if available.
|
||||||
# This value should never be passed to socket.settimeout() so for safety we use a -1.
|
current_time = getattr(time, "monotonic", time.time)
|
||||||
# socket.settimout() raises a ValueError for negative values.
|
|
||||||
token = -1
|
|
||||||
|
|
||||||
|
|
||||||
_DEFAULT_TIMEOUT: Final[_TYPE_DEFAULT] = _TYPE_DEFAULT.token
|
class Timeout(object):
|
||||||
|
|
||||||
_TYPE_TIMEOUT = typing.Optional[typing.Union[float, _TYPE_DEFAULT]]
|
|
||||||
|
|
||||||
|
|
||||||
class Timeout:
|
|
||||||
"""Timeout configuration.
|
"""Timeout configuration.
|
||||||
|
|
||||||
Timeouts can be defined as a default for a pool:
|
Timeouts can be defined as a default for a pool:
|
||||||
|
|
||||||
.. code-block:: python
|
.. code-block:: python
|
||||||
|
|
||||||
import urllib3
|
timeout = Timeout(connect=2.0, read=7.0)
|
||||||
|
http = PoolManager(timeout=timeout)
|
||||||
timeout = urllib3.util.Timeout(connect=2.0, read=7.0)
|
response = http.request('GET', 'http://example.com/')
|
||||||
|
|
||||||
http = urllib3.PoolManager(timeout=timeout)
|
|
||||||
|
|
||||||
resp = http.request("GET", "https://example.com/")
|
|
||||||
|
|
||||||
print(resp.status)
|
|
||||||
|
|
||||||
Or per-request (which overrides the default for the pool):
|
Or per-request (which overrides the default for the pool):
|
||||||
|
|
||||||
.. code-block:: python
|
.. code-block:: python
|
||||||
|
|
||||||
response = http.request("GET", "https://example.com/", timeout=Timeout(10))
|
response = http.request('GET', 'http://example.com/', timeout=Timeout(10))
|
||||||
|
|
||||||
Timeouts can be disabled by setting all the parameters to ``None``:
|
Timeouts can be disabled by setting all the parameters to ``None``:
|
||||||
|
|
||||||
.. code-block:: python
|
.. code-block:: python
|
||||||
|
|
||||||
no_timeout = Timeout(connect=None, read=None)
|
no_timeout = Timeout(connect=None, read=None)
|
||||||
response = http.request("GET", "https://example.com/", timeout=no_timeout)
|
response = http.request('GET', 'http://example.com/, timeout=no_timeout)
|
||||||
|
|
||||||
|
|
||||||
:param total:
|
:param total:
|
||||||
|
|
@ -101,34 +89,38 @@ class Timeout:
|
||||||
the case; if a server streams one byte every fifteen seconds, a timeout
|
the case; if a server streams one byte every fifteen seconds, a timeout
|
||||||
of 20 seconds will not trigger, even though the request will take
|
of 20 seconds will not trigger, even though the request will take
|
||||||
several minutes to complete.
|
several minutes to complete.
|
||||||
|
|
||||||
|
If your goal is to cut off any request after a set amount of wall clock
|
||||||
|
time, consider having a second "watcher" thread to cut off a slow
|
||||||
|
request.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
#: A sentinel object representing the default timeout value
|
#: A sentinel object representing the default timeout value
|
||||||
DEFAULT_TIMEOUT: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT
|
DEFAULT_TIMEOUT = _GLOBAL_DEFAULT_TIMEOUT
|
||||||
|
|
||||||
def __init__(
|
def __init__(self, total=None, connect=_Default, read=_Default):
|
||||||
self,
|
|
||||||
total: _TYPE_TIMEOUT = None,
|
|
||||||
connect: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
|
||||||
read: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
|
||||||
) -> None:
|
|
||||||
self._connect = self._validate_timeout(connect, "connect")
|
self._connect = self._validate_timeout(connect, "connect")
|
||||||
self._read = self._validate_timeout(read, "read")
|
self._read = self._validate_timeout(read, "read")
|
||||||
self.total = self._validate_timeout(total, "total")
|
self.total = self._validate_timeout(total, "total")
|
||||||
self._start_connect: float | None = None
|
self._start_connect = None
|
||||||
|
|
||||||
def __repr__(self) -> str:
|
def __repr__(self):
|
||||||
return f"{type(self).__name__}(connect={self._connect!r}, read={self._read!r}, total={self.total!r})"
|
return "%s(connect=%r, read=%r, total=%r)" % (
|
||||||
|
type(self).__name__,
|
||||||
|
self._connect,
|
||||||
|
self._read,
|
||||||
|
self.total,
|
||||||
|
)
|
||||||
|
|
||||||
# __str__ provided for backwards compatibility
|
# __str__ provided for backwards compatibility
|
||||||
__str__ = __repr__
|
__str__ = __repr__
|
||||||
|
|
||||||
@staticmethod
|
@classmethod
|
||||||
def resolve_default_timeout(timeout: _TYPE_TIMEOUT) -> float | None:
|
def resolve_default_timeout(cls, timeout):
|
||||||
return getdefaulttimeout() if timeout is _DEFAULT_TIMEOUT else timeout
|
return getdefaulttimeout() if timeout is cls.DEFAULT_TIMEOUT else timeout
|
||||||
|
|
||||||
@classmethod
|
@classmethod
|
||||||
def _validate_timeout(cls, value: _TYPE_TIMEOUT, name: str) -> _TYPE_TIMEOUT:
|
def _validate_timeout(cls, value, name):
|
||||||
"""Check that a timeout attribute is valid.
|
"""Check that a timeout attribute is valid.
|
||||||
|
|
||||||
:param value: The timeout value to validate
|
:param value: The timeout value to validate
|
||||||
|
|
@ -138,7 +130,10 @@ class Timeout:
|
||||||
:raises ValueError: If it is a numeric value less than or equal to
|
:raises ValueError: If it is a numeric value less than or equal to
|
||||||
zero, or the type is not an integer, float, or None.
|
zero, or the type is not an integer, float, or None.
|
||||||
"""
|
"""
|
||||||
if value is None or value is _DEFAULT_TIMEOUT:
|
if value is _Default:
|
||||||
|
return cls.DEFAULT_TIMEOUT
|
||||||
|
|
||||||
|
if value is None or value is cls.DEFAULT_TIMEOUT:
|
||||||
return value
|
return value
|
||||||
|
|
||||||
if isinstance(value, bool):
|
if isinstance(value, bool):
|
||||||
|
|
@ -152,7 +147,7 @@ class Timeout:
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
"Timeout value %s was %s, but it must be an "
|
"Timeout value %s was %s, but it must be an "
|
||||||
"int, float or None." % (name, value)
|
"int, float or None." % (name, value)
|
||||||
) from None
|
)
|
||||||
|
|
||||||
try:
|
try:
|
||||||
if value <= 0:
|
if value <= 0:
|
||||||
|
|
@ -162,15 +157,16 @@ class Timeout:
|
||||||
"than or equal to 0." % (name, value)
|
"than or equal to 0." % (name, value)
|
||||||
)
|
)
|
||||||
except TypeError:
|
except TypeError:
|
||||||
|
# Python 3
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
"Timeout value %s was %s, but it must be an "
|
"Timeout value %s was %s, but it must be an "
|
||||||
"int, float or None." % (name, value)
|
"int, float or None." % (name, value)
|
||||||
) from None
|
)
|
||||||
|
|
||||||
return value
|
return value
|
||||||
|
|
||||||
@classmethod
|
@classmethod
|
||||||
def from_float(cls, timeout: _TYPE_TIMEOUT) -> Timeout:
|
def from_float(cls, timeout):
|
||||||
"""Create a new Timeout from a legacy timeout value.
|
"""Create a new Timeout from a legacy timeout value.
|
||||||
|
|
||||||
The timeout value used by httplib.py sets the same timeout on the
|
The timeout value used by httplib.py sets the same timeout on the
|
||||||
|
|
@ -179,13 +175,13 @@ class Timeout:
|
||||||
passed to this function.
|
passed to this function.
|
||||||
|
|
||||||
:param timeout: The legacy timeout value.
|
:param timeout: The legacy timeout value.
|
||||||
:type timeout: integer, float, :attr:`urllib3.util.Timeout.DEFAULT_TIMEOUT`, or None
|
:type timeout: integer, float, sentinel default object, or None
|
||||||
:return: Timeout object
|
:return: Timeout object
|
||||||
:rtype: :class:`Timeout`
|
:rtype: :class:`Timeout`
|
||||||
"""
|
"""
|
||||||
return Timeout(read=timeout, connect=timeout)
|
return Timeout(read=timeout, connect=timeout)
|
||||||
|
|
||||||
def clone(self) -> Timeout:
|
def clone(self):
|
||||||
"""Create a copy of the timeout object
|
"""Create a copy of the timeout object
|
||||||
|
|
||||||
Timeout properties are stored per-pool but each request needs a fresh
|
Timeout properties are stored per-pool but each request needs a fresh
|
||||||
|
|
@ -199,7 +195,7 @@ class Timeout:
|
||||||
# detect the user default.
|
# detect the user default.
|
||||||
return Timeout(connect=self._connect, read=self._read, total=self.total)
|
return Timeout(connect=self._connect, read=self._read, total=self.total)
|
||||||
|
|
||||||
def start_connect(self) -> float:
|
def start_connect(self):
|
||||||
"""Start the timeout clock, used during a connect() attempt
|
"""Start the timeout clock, used during a connect() attempt
|
||||||
|
|
||||||
:raises urllib3.exceptions.TimeoutStateError: if you attempt
|
:raises urllib3.exceptions.TimeoutStateError: if you attempt
|
||||||
|
|
@ -207,10 +203,10 @@ class Timeout:
|
||||||
"""
|
"""
|
||||||
if self._start_connect is not None:
|
if self._start_connect is not None:
|
||||||
raise TimeoutStateError("Timeout timer has already been started.")
|
raise TimeoutStateError("Timeout timer has already been started.")
|
||||||
self._start_connect = time.monotonic()
|
self._start_connect = current_time()
|
||||||
return self._start_connect
|
return self._start_connect
|
||||||
|
|
||||||
def get_connect_duration(self) -> float:
|
def get_connect_duration(self):
|
||||||
"""Gets the time elapsed since the call to :meth:`start_connect`.
|
"""Gets the time elapsed since the call to :meth:`start_connect`.
|
||||||
|
|
||||||
:return: Elapsed time in seconds.
|
:return: Elapsed time in seconds.
|
||||||
|
|
@ -222,10 +218,10 @@ class Timeout:
|
||||||
raise TimeoutStateError(
|
raise TimeoutStateError(
|
||||||
"Can't get connect duration for timer that has not started."
|
"Can't get connect duration for timer that has not started."
|
||||||
)
|
)
|
||||||
return time.monotonic() - self._start_connect
|
return current_time() - self._start_connect
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def connect_timeout(self) -> _TYPE_TIMEOUT:
|
def connect_timeout(self):
|
||||||
"""Get the value to use when setting a connection timeout.
|
"""Get the value to use when setting a connection timeout.
|
||||||
|
|
||||||
This will be a positive float or integer, the value None
|
This will be a positive float or integer, the value None
|
||||||
|
|
@ -237,13 +233,13 @@ class Timeout:
|
||||||
if self.total is None:
|
if self.total is None:
|
||||||
return self._connect
|
return self._connect
|
||||||
|
|
||||||
if self._connect is None or self._connect is _DEFAULT_TIMEOUT:
|
if self._connect is None or self._connect is self.DEFAULT_TIMEOUT:
|
||||||
return self.total
|
return self.total
|
||||||
|
|
||||||
return min(self._connect, self.total) # type: ignore[type-var]
|
return min(self._connect, self.total)
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def read_timeout(self) -> float | None:
|
def read_timeout(self):
|
||||||
"""Get the value for the read timeout.
|
"""Get the value for the read timeout.
|
||||||
|
|
||||||
This assumes some time has elapsed in the connection timeout and
|
This assumes some time has elapsed in the connection timeout and
|
||||||
|
|
@ -255,21 +251,21 @@ class Timeout:
|
||||||
raised.
|
raised.
|
||||||
|
|
||||||
:return: Value to use for the read timeout.
|
:return: Value to use for the read timeout.
|
||||||
:rtype: int, float or None
|
:rtype: int, float, :attr:`Timeout.DEFAULT_TIMEOUT` or None
|
||||||
:raises urllib3.exceptions.TimeoutStateError: If :meth:`start_connect`
|
:raises urllib3.exceptions.TimeoutStateError: If :meth:`start_connect`
|
||||||
has not yet been called on this object.
|
has not yet been called on this object.
|
||||||
"""
|
"""
|
||||||
if (
|
if (
|
||||||
self.total is not None
|
self.total is not None
|
||||||
and self.total is not _DEFAULT_TIMEOUT
|
and self.total is not self.DEFAULT_TIMEOUT
|
||||||
and self._read is not None
|
and self._read is not None
|
||||||
and self._read is not _DEFAULT_TIMEOUT
|
and self._read is not self.DEFAULT_TIMEOUT
|
||||||
):
|
):
|
||||||
# In case the connect timeout has not yet been established.
|
# In case the connect timeout has not yet been established.
|
||||||
if self._start_connect is None:
|
if self._start_connect is None:
|
||||||
return self._read
|
return self._read
|
||||||
return max(0, min(self.total - self.get_connect_duration(), self._read))
|
return max(0, min(self.total - self.get_connect_duration(), self._read))
|
||||||
elif self.total is not None and self.total is not _DEFAULT_TIMEOUT:
|
elif self.total is not None and self.total is not self.DEFAULT_TIMEOUT:
|
||||||
return max(0, self.total - self.get_connect_duration())
|
return max(0, self.total - self.get_connect_duration())
|
||||||
else:
|
else:
|
||||||
return self.resolve_default_timeout(self._read)
|
return self._read
|
||||||
|
|
|
||||||
|
|
@ -1,20 +1,22 @@
|
||||||
from __future__ import annotations
|
from __future__ import absolute_import
|
||||||
|
|
||||||
import re
|
import re
|
||||||
import typing
|
from collections import namedtuple
|
||||||
|
|
||||||
from ..exceptions import LocationParseError
|
from ..exceptions import LocationParseError
|
||||||
from .util import to_str
|
from ..packages import six
|
||||||
|
|
||||||
|
url_attrs = ["scheme", "auth", "host", "port", "path", "query", "fragment"]
|
||||||
|
|
||||||
# We only want to normalize urls with an HTTP(S) scheme.
|
# We only want to normalize urls with an HTTP(S) scheme.
|
||||||
# urllib3 infers URLs without a scheme (None) to be http.
|
# urllib3 infers URLs without a scheme (None) to be http.
|
||||||
_NORMALIZABLE_SCHEMES = ("http", "https", None)
|
NORMALIZABLE_SCHEMES = ("http", "https", None)
|
||||||
|
|
||||||
# Almost all of these patterns were derived from the
|
# Almost all of these patterns were derived from the
|
||||||
# 'rfc3986' module: https://github.com/python-hyper/rfc3986
|
# 'rfc3986' module: https://github.com/python-hyper/rfc3986
|
||||||
_PERCENT_RE = re.compile(r"%[a-fA-F0-9]{2}")
|
PERCENT_RE = re.compile(r"%[a-fA-F0-9]{2}")
|
||||||
_SCHEME_RE = re.compile(r"^(?:[a-zA-Z][a-zA-Z0-9+-]*:|/)")
|
SCHEME_RE = re.compile(r"^(?:[a-zA-Z][a-zA-Z0-9+-]*:|/)")
|
||||||
_URI_RE = re.compile(
|
URI_RE = re.compile(
|
||||||
r"^(?:([a-zA-Z][a-zA-Z0-9+.-]*):)?"
|
r"^(?:([a-zA-Z][a-zA-Z0-9+.-]*):)?"
|
||||||
r"(?://([^\\/?#]*))?"
|
r"(?://([^\\/?#]*))?"
|
||||||
r"([^?#]*)"
|
r"([^?#]*)"
|
||||||
|
|
@ -23,10 +25,10 @@ _URI_RE = re.compile(
|
||||||
re.UNICODE | re.DOTALL,
|
re.UNICODE | re.DOTALL,
|
||||||
)
|
)
|
||||||
|
|
||||||
_IPV4_PAT = r"(?:[0-9]{1,3}\.){3}[0-9]{1,3}"
|
IPV4_PAT = r"(?:[0-9]{1,3}\.){3}[0-9]{1,3}"
|
||||||
_HEX_PAT = "[0-9A-Fa-f]{1,4}"
|
HEX_PAT = "[0-9A-Fa-f]{1,4}"
|
||||||
_LS32_PAT = "(?:{hex}:{hex}|{ipv4})".format(hex=_HEX_PAT, ipv4=_IPV4_PAT)
|
LS32_PAT = "(?:{hex}:{hex}|{ipv4})".format(hex=HEX_PAT, ipv4=IPV4_PAT)
|
||||||
_subs = {"hex": _HEX_PAT, "ls32": _LS32_PAT}
|
_subs = {"hex": HEX_PAT, "ls32": LS32_PAT}
|
||||||
_variations = [
|
_variations = [
|
||||||
# 6( h16 ":" ) ls32
|
# 6( h16 ":" ) ls32
|
||||||
"(?:%(hex)s:){6}%(ls32)s",
|
"(?:%(hex)s:){6}%(ls32)s",
|
||||||
|
|
@ -48,78 +50,69 @@ _variations = [
|
||||||
"(?:(?:%(hex)s:){0,6}%(hex)s)?::",
|
"(?:(?:%(hex)s:){0,6}%(hex)s)?::",
|
||||||
]
|
]
|
||||||
|
|
||||||
_UNRESERVED_PAT = r"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789._\-~"
|
UNRESERVED_PAT = r"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789._\-~"
|
||||||
_IPV6_PAT = "(?:" + "|".join([x % _subs for x in _variations]) + ")"
|
IPV6_PAT = "(?:" + "|".join([x % _subs for x in _variations]) + ")"
|
||||||
_ZONE_ID_PAT = "(?:%25|%)(?:[" + _UNRESERVED_PAT + "]|%[a-fA-F0-9]{2})+"
|
ZONE_ID_PAT = "(?:%25|%)(?:[" + UNRESERVED_PAT + "]|%[a-fA-F0-9]{2})+"
|
||||||
_IPV6_ADDRZ_PAT = r"\[" + _IPV6_PAT + r"(?:" + _ZONE_ID_PAT + r")?\]"
|
IPV6_ADDRZ_PAT = r"\[" + IPV6_PAT + r"(?:" + ZONE_ID_PAT + r")?\]"
|
||||||
_REG_NAME_PAT = r"(?:[^\[\]%:/?#]|%[a-fA-F0-9]{2})*"
|
REG_NAME_PAT = r"(?:[^\[\]%:/?#]|%[a-fA-F0-9]{2})*"
|
||||||
_TARGET_RE = re.compile(r"^(/[^?#]*)(?:\?([^#]*))?(?:#.*)?$")
|
TARGET_RE = re.compile(r"^(/[^?#]*)(?:\?([^#]*))?(?:#.*)?$")
|
||||||
|
|
||||||
_IPV4_RE = re.compile("^" + _IPV4_PAT + "$")
|
IPV4_RE = re.compile("^" + IPV4_PAT + "$")
|
||||||
_IPV6_RE = re.compile("^" + _IPV6_PAT + "$")
|
IPV6_RE = re.compile("^" + IPV6_PAT + "$")
|
||||||
_IPV6_ADDRZ_RE = re.compile("^" + _IPV6_ADDRZ_PAT + "$")
|
IPV6_ADDRZ_RE = re.compile("^" + IPV6_ADDRZ_PAT + "$")
|
||||||
_BRACELESS_IPV6_ADDRZ_RE = re.compile("^" + _IPV6_ADDRZ_PAT[2:-2] + "$")
|
BRACELESS_IPV6_ADDRZ_RE = re.compile("^" + IPV6_ADDRZ_PAT[2:-2] + "$")
|
||||||
_ZONE_ID_RE = re.compile("(" + _ZONE_ID_PAT + r")\]$")
|
ZONE_ID_RE = re.compile("(" + ZONE_ID_PAT + r")\]$")
|
||||||
|
|
||||||
_HOST_PORT_PAT = ("^(%s|%s|%s)(?::0*?(|0|[1-9][0-9]{0,4}))?$") % (
|
_HOST_PORT_PAT = ("^(%s|%s|%s)(?::0*?(|0|[1-9][0-9]{0,4}))?$") % (
|
||||||
_REG_NAME_PAT,
|
REG_NAME_PAT,
|
||||||
_IPV4_PAT,
|
IPV4_PAT,
|
||||||
_IPV6_ADDRZ_PAT,
|
IPV6_ADDRZ_PAT,
|
||||||
)
|
)
|
||||||
_HOST_PORT_RE = re.compile(_HOST_PORT_PAT, re.UNICODE | re.DOTALL)
|
_HOST_PORT_RE = re.compile(_HOST_PORT_PAT, re.UNICODE | re.DOTALL)
|
||||||
|
|
||||||
_UNRESERVED_CHARS = set(
|
UNRESERVED_CHARS = set(
|
||||||
"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789._-~"
|
"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789._-~"
|
||||||
)
|
)
|
||||||
_SUB_DELIM_CHARS = set("!$&'()*+,;=")
|
SUB_DELIM_CHARS = set("!$&'()*+,;=")
|
||||||
_USERINFO_CHARS = _UNRESERVED_CHARS | _SUB_DELIM_CHARS | {":"}
|
USERINFO_CHARS = UNRESERVED_CHARS | SUB_DELIM_CHARS | {":"}
|
||||||
_PATH_CHARS = _USERINFO_CHARS | {"@", "/"}
|
PATH_CHARS = USERINFO_CHARS | {"@", "/"}
|
||||||
_QUERY_CHARS = _FRAGMENT_CHARS = _PATH_CHARS | {"?"}
|
QUERY_CHARS = FRAGMENT_CHARS = PATH_CHARS | {"?"}
|
||||||
|
|
||||||
|
|
||||||
class Url(
|
class Url(namedtuple("Url", url_attrs)):
|
||||||
typing.NamedTuple(
|
|
||||||
"Url",
|
|
||||||
[
|
|
||||||
("scheme", typing.Optional[str]),
|
|
||||||
("auth", typing.Optional[str]),
|
|
||||||
("host", typing.Optional[str]),
|
|
||||||
("port", typing.Optional[int]),
|
|
||||||
("path", typing.Optional[str]),
|
|
||||||
("query", typing.Optional[str]),
|
|
||||||
("fragment", typing.Optional[str]),
|
|
||||||
],
|
|
||||||
)
|
|
||||||
):
|
|
||||||
"""
|
"""
|
||||||
Data structure for representing an HTTP URL. Used as a return value for
|
Data structure for representing an HTTP URL. Used as a return value for
|
||||||
:func:`parse_url`. Both the scheme and host are normalized as they are
|
:func:`parse_url`. Both the scheme and host are normalized as they are
|
||||||
both case-insensitive according to RFC 3986.
|
both case-insensitive according to RFC 3986.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __new__( # type: ignore[no-untyped-def]
|
__slots__ = ()
|
||||||
|
|
||||||
|
def __new__(
|
||||||
cls,
|
cls,
|
||||||
scheme: str | None = None,
|
scheme=None,
|
||||||
auth: str | None = None,
|
auth=None,
|
||||||
host: str | None = None,
|
host=None,
|
||||||
port: int | None = None,
|
port=None,
|
||||||
path: str | None = None,
|
path=None,
|
||||||
query: str | None = None,
|
query=None,
|
||||||
fragment: str | None = None,
|
fragment=None,
|
||||||
):
|
):
|
||||||
if path and not path.startswith("/"):
|
if path and not path.startswith("/"):
|
||||||
path = "/" + path
|
path = "/" + path
|
||||||
if scheme is not None:
|
if scheme is not None:
|
||||||
scheme = scheme.lower()
|
scheme = scheme.lower()
|
||||||
return super().__new__(cls, scheme, auth, host, port, path, query, fragment)
|
return super(Url, cls).__new__(
|
||||||
|
cls, scheme, auth, host, port, path, query, fragment
|
||||||
|
)
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def hostname(self) -> str | None:
|
def hostname(self):
|
||||||
"""For backwards-compatibility with urlparse. We're nice like that."""
|
"""For backwards-compatibility with urlparse. We're nice like that."""
|
||||||
return self.host
|
return self.host
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def request_uri(self) -> str:
|
def request_uri(self):
|
||||||
"""Absolute path including the query string."""
|
"""Absolute path including the query string."""
|
||||||
uri = self.path or "/"
|
uri = self.path or "/"
|
||||||
|
|
||||||
|
|
@ -129,37 +122,14 @@ class Url(
|
||||||
return uri
|
return uri
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def authority(self) -> str | None:
|
def netloc(self):
|
||||||
"""
|
"""Network location including host and port"""
|
||||||
Authority component as defined in RFC 3986 3.2.
|
|
||||||
This includes userinfo (auth), host and port.
|
|
||||||
|
|
||||||
i.e.
|
|
||||||
userinfo@host:port
|
|
||||||
"""
|
|
||||||
userinfo = self.auth
|
|
||||||
netloc = self.netloc
|
|
||||||
if netloc is None or userinfo is None:
|
|
||||||
return netloc
|
|
||||||
else:
|
|
||||||
return f"{userinfo}@{netloc}"
|
|
||||||
|
|
||||||
@property
|
|
||||||
def netloc(self) -> str | None:
|
|
||||||
"""
|
|
||||||
Network location including host and port.
|
|
||||||
|
|
||||||
If you need the equivalent of urllib.parse's ``netloc``,
|
|
||||||
use the ``authority`` property instead.
|
|
||||||
"""
|
|
||||||
if self.host is None:
|
|
||||||
return None
|
|
||||||
if self.port:
|
if self.port:
|
||||||
return f"{self.host}:{self.port}"
|
return "%s:%d" % (self.host, self.port)
|
||||||
return self.host
|
return self.host
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def url(self) -> str:
|
def url(self):
|
||||||
"""
|
"""
|
||||||
Convert self into a url
|
Convert self into a url
|
||||||
|
|
||||||
|
|
@ -168,77 +138,88 @@ class Url(
|
||||||
:func:`.parse_url`, but it should be equivalent by the RFC (e.g., urls
|
:func:`.parse_url`, but it should be equivalent by the RFC (e.g., urls
|
||||||
with a blank port will have : removed).
|
with a blank port will have : removed).
|
||||||
|
|
||||||
Example:
|
Example: ::
|
||||||
|
|
||||||
.. code-block:: python
|
>>> U = parse_url('http://google.com/mail/')
|
||||||
|
>>> U.url
|
||||||
import urllib3
|
'http://google.com/mail/'
|
||||||
|
>>> Url('http', 'username:password', 'host.com', 80,
|
||||||
U = urllib3.util.parse_url("https://google.com/mail/")
|
... '/path', 'query', 'fragment').url
|
||||||
|
'http://username:password@host.com:80/path?query#fragment'
|
||||||
print(U.url)
|
|
||||||
# "https://google.com/mail/"
|
|
||||||
|
|
||||||
print( urllib3.util.Url("https", "username:password",
|
|
||||||
"host.com", 80, "/path", "query", "fragment"
|
|
||||||
).url
|
|
||||||
)
|
|
||||||
# "https://username:password@host.com:80/path?query#fragment"
|
|
||||||
"""
|
"""
|
||||||
scheme, auth, host, port, path, query, fragment = self
|
scheme, auth, host, port, path, query, fragment = self
|
||||||
url = ""
|
url = u""
|
||||||
|
|
||||||
# We use "is not None" we want things to happen with empty strings (or 0 port)
|
# We use "is not None" we want things to happen with empty strings (or 0 port)
|
||||||
if scheme is not None:
|
if scheme is not None:
|
||||||
url += scheme + "://"
|
url += scheme + u"://"
|
||||||
if auth is not None:
|
if auth is not None:
|
||||||
url += auth + "@"
|
url += auth + u"@"
|
||||||
if host is not None:
|
if host is not None:
|
||||||
url += host
|
url += host
|
||||||
if port is not None:
|
if port is not None:
|
||||||
url += ":" + str(port)
|
url += u":" + str(port)
|
||||||
if path is not None:
|
if path is not None:
|
||||||
url += path
|
url += path
|
||||||
if query is not None:
|
if query is not None:
|
||||||
url += "?" + query
|
url += u"?" + query
|
||||||
if fragment is not None:
|
if fragment is not None:
|
||||||
url += "#" + fragment
|
url += u"#" + fragment
|
||||||
|
|
||||||
return url
|
return url
|
||||||
|
|
||||||
def __str__(self) -> str:
|
def __str__(self):
|
||||||
return self.url
|
return self.url
|
||||||
|
|
||||||
|
|
||||||
@typing.overload
|
def split_first(s, delims):
|
||||||
def _encode_invalid_chars(
|
"""
|
||||||
component: str, allowed_chars: typing.Container[str]
|
.. deprecated:: 1.25
|
||||||
) -> str: # Abstract
|
|
||||||
...
|
Given a string and an iterable of delimiters, split on the first found
|
||||||
|
delimiter. Return two split parts and the matched delimiter.
|
||||||
|
|
||||||
|
If not found, then the first part is the full input string.
|
||||||
|
|
||||||
|
Example::
|
||||||
|
|
||||||
|
>>> split_first('foo/bar?baz', '?/=')
|
||||||
|
('foo', 'bar?baz', '/')
|
||||||
|
>>> split_first('foo/bar?baz', '123')
|
||||||
|
('foo/bar?baz', '', None)
|
||||||
|
|
||||||
|
Scales linearly with number of delims. Not ideal for large number of delims.
|
||||||
|
"""
|
||||||
|
min_idx = None
|
||||||
|
min_delim = None
|
||||||
|
for d in delims:
|
||||||
|
idx = s.find(d)
|
||||||
|
if idx < 0:
|
||||||
|
continue
|
||||||
|
|
||||||
|
if min_idx is None or idx < min_idx:
|
||||||
|
min_idx = idx
|
||||||
|
min_delim = d
|
||||||
|
|
||||||
|
if min_idx is None or min_idx < 0:
|
||||||
|
return s, "", None
|
||||||
|
|
||||||
|
return s[:min_idx], s[min_idx + 1 :], min_delim
|
||||||
|
|
||||||
|
|
||||||
@typing.overload
|
def _encode_invalid_chars(component, allowed_chars, encoding="utf-8"):
|
||||||
def _encode_invalid_chars(
|
|
||||||
component: None, allowed_chars: typing.Container[str]
|
|
||||||
) -> None: # Abstract
|
|
||||||
...
|
|
||||||
|
|
||||||
|
|
||||||
def _encode_invalid_chars(
|
|
||||||
component: str | None, allowed_chars: typing.Container[str]
|
|
||||||
) -> str | None:
|
|
||||||
"""Percent-encodes a URI component without reapplying
|
"""Percent-encodes a URI component without reapplying
|
||||||
onto an already percent-encoded component.
|
onto an already percent-encoded component.
|
||||||
"""
|
"""
|
||||||
if component is None:
|
if component is None:
|
||||||
return component
|
return component
|
||||||
|
|
||||||
component = to_str(component)
|
component = six.ensure_text(component)
|
||||||
|
|
||||||
# Normalize existing percent-encoded bytes.
|
# Normalize existing percent-encoded bytes.
|
||||||
# Try to see if the component we're encoding is already percent-encoded
|
# Try to see if the component we're encoding is already percent-encoded
|
||||||
# so we can skip all '%' characters but still encode all others.
|
# so we can skip all '%' characters but still encode all others.
|
||||||
component, percent_encodings = _PERCENT_RE.subn(
|
component, percent_encodings = PERCENT_RE.subn(
|
||||||
lambda match: match.group(0).upper(), component
|
lambda match: match.group(0).upper(), component
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
@ -247,7 +228,7 @@ def _encode_invalid_chars(
|
||||||
encoded_component = bytearray()
|
encoded_component = bytearray()
|
||||||
|
|
||||||
for i in range(0, len(uri_bytes)):
|
for i in range(0, len(uri_bytes)):
|
||||||
# Will return a single character bytestring
|
# Will return a single character bytestring on both Python 2 & 3
|
||||||
byte = uri_bytes[i : i + 1]
|
byte = uri_bytes[i : i + 1]
|
||||||
byte_ord = ord(byte)
|
byte_ord = ord(byte)
|
||||||
if (is_percent_encoded and byte == b"%") or (
|
if (is_percent_encoded and byte == b"%") or (
|
||||||
|
|
@ -257,10 +238,10 @@ def _encode_invalid_chars(
|
||||||
continue
|
continue
|
||||||
encoded_component.extend(b"%" + (hex(byte_ord)[2:].encode().zfill(2).upper()))
|
encoded_component.extend(b"%" + (hex(byte_ord)[2:].encode().zfill(2).upper()))
|
||||||
|
|
||||||
return encoded_component.decode()
|
return encoded_component.decode(encoding)
|
||||||
|
|
||||||
|
|
||||||
def _remove_path_dot_segments(path: str) -> str:
|
def _remove_path_dot_segments(path):
|
||||||
# See http://tools.ietf.org/html/rfc3986#section-5.2.4 for pseudo-code
|
# See http://tools.ietf.org/html/rfc3986#section-5.2.4 for pseudo-code
|
||||||
segments = path.split("/") # Turn the path into a list of segments
|
segments = path.split("/") # Turn the path into a list of segments
|
||||||
output = [] # Initialize the variable to use to store output
|
output = [] # Initialize the variable to use to store output
|
||||||
|
|
@ -270,7 +251,7 @@ def _remove_path_dot_segments(path: str) -> str:
|
||||||
if segment == ".":
|
if segment == ".":
|
||||||
continue
|
continue
|
||||||
# Anything other than '..', should be appended to the output
|
# Anything other than '..', should be appended to the output
|
||||||
if segment != "..":
|
elif segment != "..":
|
||||||
output.append(segment)
|
output.append(segment)
|
||||||
# In this case segment == '..', if we can, we should pop the last
|
# In this case segment == '..', if we can, we should pop the last
|
||||||
# element
|
# element
|
||||||
|
|
@ -290,25 +271,18 @@ def _remove_path_dot_segments(path: str) -> str:
|
||||||
return "/".join(output)
|
return "/".join(output)
|
||||||
|
|
||||||
|
|
||||||
@typing.overload
|
def _normalize_host(host, scheme):
|
||||||
def _normalize_host(host: None, scheme: str | None) -> None:
|
|
||||||
...
|
|
||||||
|
|
||||||
|
|
||||||
@typing.overload
|
|
||||||
def _normalize_host(host: str, scheme: str | None) -> str:
|
|
||||||
...
|
|
||||||
|
|
||||||
|
|
||||||
def _normalize_host(host: str | None, scheme: str | None) -> str | None:
|
|
||||||
if host:
|
if host:
|
||||||
if scheme in _NORMALIZABLE_SCHEMES:
|
if isinstance(host, six.binary_type):
|
||||||
is_ipv6 = _IPV6_ADDRZ_RE.match(host)
|
host = six.ensure_str(host)
|
||||||
|
|
||||||
|
if scheme in NORMALIZABLE_SCHEMES:
|
||||||
|
is_ipv6 = IPV6_ADDRZ_RE.match(host)
|
||||||
if is_ipv6:
|
if is_ipv6:
|
||||||
# IPv6 hosts of the form 'a::b%zone' are encoded in a URL as
|
# IPv6 hosts of the form 'a::b%zone' are encoded in a URL as
|
||||||
# such per RFC 6874: 'a::b%25zone'. Unquote the ZoneID
|
# such per RFC 6874: 'a::b%25zone'. Unquote the ZoneID
|
||||||
# separator as necessary to return a valid RFC 4007 scoped IP.
|
# separator as necessary to return a valid RFC 4007 scoped IP.
|
||||||
match = _ZONE_ID_RE.search(host)
|
match = ZONE_ID_RE.search(host)
|
||||||
if match:
|
if match:
|
||||||
start, end = match.span(1)
|
start, end = match.span(1)
|
||||||
zone_id = host[start:end]
|
zone_id = host[start:end]
|
||||||
|
|
@ -317,56 +291,46 @@ def _normalize_host(host: str | None, scheme: str | None) -> str | None:
|
||||||
zone_id = zone_id[3:]
|
zone_id = zone_id[3:]
|
||||||
else:
|
else:
|
||||||
zone_id = zone_id[1:]
|
zone_id = zone_id[1:]
|
||||||
zone_id = _encode_invalid_chars(zone_id, _UNRESERVED_CHARS)
|
zone_id = "%" + _encode_invalid_chars(zone_id, UNRESERVED_CHARS)
|
||||||
return f"{host[:start].lower()}%{zone_id}{host[end:]}"
|
return host[:start].lower() + zone_id + host[end:]
|
||||||
else:
|
else:
|
||||||
return host.lower()
|
return host.lower()
|
||||||
elif not _IPV4_RE.match(host):
|
elif not IPV4_RE.match(host):
|
||||||
return to_str(
|
return six.ensure_str(
|
||||||
b".".join([_idna_encode(label) for label in host.split(".")]),
|
b".".join([_idna_encode(label) for label in host.split(".")])
|
||||||
"ascii",
|
|
||||||
)
|
)
|
||||||
return host
|
return host
|
||||||
|
|
||||||
|
|
||||||
def _idna_encode(name: str) -> bytes:
|
def _idna_encode(name):
|
||||||
if not name.isascii():
|
if name and any(ord(x) >= 128 for x in name):
|
||||||
try:
|
try:
|
||||||
import idna
|
import idna
|
||||||
except ImportError:
|
except ImportError:
|
||||||
raise LocationParseError(
|
six.raise_from(
|
||||||
"Unable to parse URL without the 'idna' module"
|
LocationParseError("Unable to parse URL without the 'idna' module"),
|
||||||
) from None
|
None,
|
||||||
|
)
|
||||||
try:
|
try:
|
||||||
return idna.encode(name.lower(), strict=True, std3_rules=True)
|
return idna.encode(name.lower(), strict=True, std3_rules=True)
|
||||||
except idna.IDNAError:
|
except idna.IDNAError:
|
||||||
raise LocationParseError(
|
six.raise_from(
|
||||||
f"Name '{name}' is not a valid IDNA label"
|
LocationParseError(u"Name '%s' is not a valid IDNA label" % name), None
|
||||||
) from None
|
)
|
||||||
|
|
||||||
return name.lower().encode("ascii")
|
return name.lower().encode("ascii")
|
||||||
|
|
||||||
|
|
||||||
def _encode_target(target: str) -> str:
|
def _encode_target(target):
|
||||||
"""Percent-encodes a request target so that there are no invalid characters
|
"""Percent-encodes a request target so that there are no invalid characters"""
|
||||||
|
path, query = TARGET_RE.match(target).groups()
|
||||||
Pre-condition for this function is that 'target' must start with '/'.
|
target = _encode_invalid_chars(path, PATH_CHARS)
|
||||||
If that is the case then _TARGET_RE will always produce a match.
|
query = _encode_invalid_chars(query, QUERY_CHARS)
|
||||||
"""
|
|
||||||
match = _TARGET_RE.match(target)
|
|
||||||
if not match: # Defensive:
|
|
||||||
raise LocationParseError(f"{target!r} is not a valid request URI")
|
|
||||||
|
|
||||||
path, query = match.groups()
|
|
||||||
encoded_target = _encode_invalid_chars(path, _PATH_CHARS)
|
|
||||||
if query is not None:
|
if query is not None:
|
||||||
query = _encode_invalid_chars(query, _QUERY_CHARS)
|
target += "?" + query
|
||||||
encoded_target += "?" + query
|
return target
|
||||||
return encoded_target
|
|
||||||
|
|
||||||
|
|
||||||
def parse_url(url: str) -> Url:
|
def parse_url(url):
|
||||||
"""
|
"""
|
||||||
Given a url, return a parsed :class:`.Url` namedtuple. Best-effort is
|
Given a url, return a parsed :class:`.Url` namedtuple. Best-effort is
|
||||||
performed to parse incomplete urls. Fields not provided will be None.
|
performed to parse incomplete urls. Fields not provided will be None.
|
||||||
|
|
@ -377,44 +341,28 @@ def parse_url(url: str) -> Url:
|
||||||
|
|
||||||
:param str url: URL to parse into a :class:`.Url` namedtuple.
|
:param str url: URL to parse into a :class:`.Url` namedtuple.
|
||||||
|
|
||||||
Partly backwards-compatible with :mod:`urllib.parse`.
|
Partly backwards-compatible with :mod:`urlparse`.
|
||||||
|
|
||||||
Example:
|
Example::
|
||||||
|
|
||||||
.. code-block:: python
|
>>> parse_url('http://google.com/mail/')
|
||||||
|
Url(scheme='http', host='google.com', port=None, path='/mail/', ...)
|
||||||
import urllib3
|
>>> parse_url('google.com:80')
|
||||||
|
Url(scheme=None, host='google.com', port=80, path=None, ...)
|
||||||
print( urllib3.util.parse_url('http://google.com/mail/'))
|
>>> parse_url('/foo?bar')
|
||||||
# Url(scheme='http', host='google.com', port=None, path='/mail/', ...)
|
Url(scheme=None, host=None, port=None, path='/foo', query='bar', ...)
|
||||||
|
|
||||||
print( urllib3.util.parse_url('google.com:80'))
|
|
||||||
# Url(scheme=None, host='google.com', port=80, path=None, ...)
|
|
||||||
|
|
||||||
print( urllib3.util.parse_url('/foo?bar'))
|
|
||||||
# Url(scheme=None, host=None, port=None, path='/foo', query='bar', ...)
|
|
||||||
"""
|
"""
|
||||||
if not url:
|
if not url:
|
||||||
# Empty
|
# Empty
|
||||||
return Url()
|
return Url()
|
||||||
|
|
||||||
source_url = url
|
source_url = url
|
||||||
if not _SCHEME_RE.search(url):
|
if not SCHEME_RE.search(url):
|
||||||
url = "//" + url
|
url = "//" + url
|
||||||
|
|
||||||
scheme: str | None
|
|
||||||
authority: str | None
|
|
||||||
auth: str | None
|
|
||||||
host: str | None
|
|
||||||
port: str | None
|
|
||||||
port_int: int | None
|
|
||||||
path: str | None
|
|
||||||
query: str | None
|
|
||||||
fragment: str | None
|
|
||||||
|
|
||||||
try:
|
try:
|
||||||
scheme, authority, path, query, fragment = _URI_RE.match(url).groups() # type: ignore[union-attr]
|
scheme, authority, path, query, fragment = URI_RE.match(url).groups()
|
||||||
normalize_uri = scheme is None or scheme.lower() in _NORMALIZABLE_SCHEMES
|
normalize_uri = scheme is None or scheme.lower() in NORMALIZABLE_SCHEMES
|
||||||
|
|
||||||
if scheme:
|
if scheme:
|
||||||
scheme = scheme.lower()
|
scheme = scheme.lower()
|
||||||
|
|
@ -422,33 +370,31 @@ def parse_url(url: str) -> Url:
|
||||||
if authority:
|
if authority:
|
||||||
auth, _, host_port = authority.rpartition("@")
|
auth, _, host_port = authority.rpartition("@")
|
||||||
auth = auth or None
|
auth = auth or None
|
||||||
host, port = _HOST_PORT_RE.match(host_port).groups() # type: ignore[union-attr]
|
host, port = _HOST_PORT_RE.match(host_port).groups()
|
||||||
if auth and normalize_uri:
|
if auth and normalize_uri:
|
||||||
auth = _encode_invalid_chars(auth, _USERINFO_CHARS)
|
auth = _encode_invalid_chars(auth, USERINFO_CHARS)
|
||||||
if port == "":
|
if port == "":
|
||||||
port = None
|
port = None
|
||||||
else:
|
else:
|
||||||
auth, host, port = None, None, None
|
auth, host, port = None, None, None
|
||||||
|
|
||||||
if port is not None:
|
if port is not None:
|
||||||
port_int = int(port)
|
port = int(port)
|
||||||
if not (0 <= port_int <= 65535):
|
if not (0 <= port <= 65535):
|
||||||
raise LocationParseError(url)
|
raise LocationParseError(url)
|
||||||
else:
|
|
||||||
port_int = None
|
|
||||||
|
|
||||||
host = _normalize_host(host, scheme)
|
host = _normalize_host(host, scheme)
|
||||||
|
|
||||||
if normalize_uri and path:
|
if normalize_uri and path:
|
||||||
path = _remove_path_dot_segments(path)
|
path = _remove_path_dot_segments(path)
|
||||||
path = _encode_invalid_chars(path, _PATH_CHARS)
|
path = _encode_invalid_chars(path, PATH_CHARS)
|
||||||
if normalize_uri and query:
|
if normalize_uri and query:
|
||||||
query = _encode_invalid_chars(query, _QUERY_CHARS)
|
query = _encode_invalid_chars(query, QUERY_CHARS)
|
||||||
if normalize_uri and fragment:
|
if normalize_uri and fragment:
|
||||||
fragment = _encode_invalid_chars(fragment, _FRAGMENT_CHARS)
|
fragment = _encode_invalid_chars(fragment, FRAGMENT_CHARS)
|
||||||
|
|
||||||
except (ValueError, AttributeError) as e:
|
except (ValueError, AttributeError):
|
||||||
raise LocationParseError(source_url) from e
|
return six.raise_from(LocationParseError(source_url), None)
|
||||||
|
|
||||||
# For the sake of backwards compatibility we put empty
|
# For the sake of backwards compatibility we put empty
|
||||||
# string values for path if there are any defined values
|
# string values for path if there are any defined values
|
||||||
|
|
@ -460,12 +406,30 @@ def parse_url(url: str) -> Url:
|
||||||
else:
|
else:
|
||||||
path = None
|
path = None
|
||||||
|
|
||||||
|
# Ensure that each part of the URL is a `str` for
|
||||||
|
# backwards compatibility.
|
||||||
|
if isinstance(url, six.text_type):
|
||||||
|
ensure_func = six.ensure_text
|
||||||
|
else:
|
||||||
|
ensure_func = six.ensure_str
|
||||||
|
|
||||||
|
def ensure_type(x):
|
||||||
|
return x if x is None else ensure_func(x)
|
||||||
|
|
||||||
return Url(
|
return Url(
|
||||||
scheme=scheme,
|
scheme=ensure_type(scheme),
|
||||||
auth=auth,
|
auth=ensure_type(auth),
|
||||||
host=host,
|
host=ensure_type(host),
|
||||||
port=port_int,
|
port=port,
|
||||||
path=path,
|
path=ensure_type(path),
|
||||||
query=query,
|
query=ensure_type(query),
|
||||||
fragment=fragment,
|
fragment=ensure_type(fragment),
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
|
def get_host(url):
|
||||||
|
"""
|
||||||
|
Deprecated. Use :func:`parse_url` instead.
|
||||||
|
"""
|
||||||
|
p = parse_url(url)
|
||||||
|
return p.scheme or "http", p.hostname, p.port
|
||||||
|
|
|
||||||
|
|
@ -1,42 +0,0 @@
|
||||||
from __future__ import annotations
|
|
||||||
|
|
||||||
import typing
|
|
||||||
from types import TracebackType
|
|
||||||
|
|
||||||
|
|
||||||
def to_bytes(
|
|
||||||
x: str | bytes, encoding: str | None = None, errors: str | None = None
|
|
||||||
) -> bytes:
|
|
||||||
if isinstance(x, bytes):
|
|
||||||
return x
|
|
||||||
elif not isinstance(x, str):
|
|
||||||
raise TypeError(f"not expecting type {type(x).__name__}")
|
|
||||||
if encoding or errors:
|
|
||||||
return x.encode(encoding or "utf-8", errors=errors or "strict")
|
|
||||||
return x.encode()
|
|
||||||
|
|
||||||
|
|
||||||
def to_str(
|
|
||||||
x: str | bytes, encoding: str | None = None, errors: str | None = None
|
|
||||||
) -> str:
|
|
||||||
if isinstance(x, str):
|
|
||||||
return x
|
|
||||||
elif not isinstance(x, bytes):
|
|
||||||
raise TypeError(f"not expecting type {type(x).__name__}")
|
|
||||||
if encoding or errors:
|
|
||||||
return x.decode(encoding or "utf-8", errors=errors or "strict")
|
|
||||||
return x.decode()
|
|
||||||
|
|
||||||
|
|
||||||
def reraise(
|
|
||||||
tp: type[BaseException] | None,
|
|
||||||
value: BaseException,
|
|
||||||
tb: TracebackType | None = None,
|
|
||||||
) -> typing.NoReturn:
|
|
||||||
try:
|
|
||||||
if value.__traceback__ is not tb:
|
|
||||||
raise value.with_traceback(tb)
|
|
||||||
raise value
|
|
||||||
finally:
|
|
||||||
value = None # type: ignore[assignment]
|
|
||||||
tb = None
|
|
||||||
|
|
@ -1,10 +1,18 @@
|
||||||
from __future__ import annotations
|
import errno
|
||||||
|
|
||||||
import select
|
import select
|
||||||
import socket
|
import sys
|
||||||
from functools import partial
|
from functools import partial
|
||||||
|
|
||||||
__all__ = ["wait_for_read", "wait_for_write"]
|
try:
|
||||||
|
from time import monotonic
|
||||||
|
except ImportError:
|
||||||
|
from time import time as monotonic
|
||||||
|
|
||||||
|
__all__ = ["NoWayToWaitForSocketError", "wait_for_read", "wait_for_write"]
|
||||||
|
|
||||||
|
|
||||||
|
class NoWayToWaitForSocketError(Exception):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
# How should we wait on sockets?
|
# How should we wait on sockets?
|
||||||
|
|
@ -29,13 +37,37 @@ __all__ = ["wait_for_read", "wait_for_write"]
|
||||||
# So: on Windows we use select(), and everywhere else we use poll(). We also
|
# So: on Windows we use select(), and everywhere else we use poll(). We also
|
||||||
# fall back to select() in case poll() is somehow broken or missing.
|
# fall back to select() in case poll() is somehow broken or missing.
|
||||||
|
|
||||||
|
if sys.version_info >= (3, 5):
|
||||||
|
# Modern Python, that retries syscalls by default
|
||||||
|
def _retry_on_intr(fn, timeout):
|
||||||
|
return fn(timeout)
|
||||||
|
|
||||||
def select_wait_for_socket(
|
else:
|
||||||
sock: socket.socket,
|
# Old and broken Pythons.
|
||||||
read: bool = False,
|
def _retry_on_intr(fn, timeout):
|
||||||
write: bool = False,
|
if timeout is None:
|
||||||
timeout: float | None = None,
|
deadline = float("inf")
|
||||||
) -> bool:
|
else:
|
||||||
|
deadline = monotonic() + timeout
|
||||||
|
|
||||||
|
while True:
|
||||||
|
try:
|
||||||
|
return fn(timeout)
|
||||||
|
# OSError for 3 <= pyver < 3.5, select.error for pyver <= 2.7
|
||||||
|
except (OSError, select.error) as e:
|
||||||
|
# 'e.args[0]' incantation works for both OSError and select.error
|
||||||
|
if e.args[0] != errno.EINTR:
|
||||||
|
raise
|
||||||
|
else:
|
||||||
|
timeout = deadline - monotonic()
|
||||||
|
if timeout < 0:
|
||||||
|
timeout = 0
|
||||||
|
if timeout == float("inf"):
|
||||||
|
timeout = None
|
||||||
|
continue
|
||||||
|
|
||||||
|
|
||||||
|
def select_wait_for_socket(sock, read=False, write=False, timeout=None):
|
||||||
if not read and not write:
|
if not read and not write:
|
||||||
raise RuntimeError("must specify at least one of read=True, write=True")
|
raise RuntimeError("must specify at least one of read=True, write=True")
|
||||||
rcheck = []
|
rcheck = []
|
||||||
|
|
@ -50,16 +82,11 @@ def select_wait_for_socket(
|
||||||
# sockets for both conditions. (The stdlib selectors module does the same
|
# sockets for both conditions. (The stdlib selectors module does the same
|
||||||
# thing.)
|
# thing.)
|
||||||
fn = partial(select.select, rcheck, wcheck, wcheck)
|
fn = partial(select.select, rcheck, wcheck, wcheck)
|
||||||
rready, wready, xready = fn(timeout)
|
rready, wready, xready = _retry_on_intr(fn, timeout)
|
||||||
return bool(rready or wready or xready)
|
return bool(rready or wready or xready)
|
||||||
|
|
||||||
|
|
||||||
def poll_wait_for_socket(
|
def poll_wait_for_socket(sock, read=False, write=False, timeout=None):
|
||||||
sock: socket.socket,
|
|
||||||
read: bool = False,
|
|
||||||
write: bool = False,
|
|
||||||
timeout: float | None = None,
|
|
||||||
) -> bool:
|
|
||||||
if not read and not write:
|
if not read and not write:
|
||||||
raise RuntimeError("must specify at least one of read=True, write=True")
|
raise RuntimeError("must specify at least one of read=True, write=True")
|
||||||
mask = 0
|
mask = 0
|
||||||
|
|
@ -71,33 +98,32 @@ def poll_wait_for_socket(
|
||||||
poll_obj.register(sock, mask)
|
poll_obj.register(sock, mask)
|
||||||
|
|
||||||
# For some reason, poll() takes timeout in milliseconds
|
# For some reason, poll() takes timeout in milliseconds
|
||||||
def do_poll(t: float | None) -> list[tuple[int, int]]:
|
def do_poll(t):
|
||||||
if t is not None:
|
if t is not None:
|
||||||
t *= 1000
|
t *= 1000
|
||||||
return poll_obj.poll(t)
|
return poll_obj.poll(t)
|
||||||
|
|
||||||
return bool(do_poll(timeout))
|
return bool(_retry_on_intr(do_poll, timeout))
|
||||||
|
|
||||||
|
|
||||||
def _have_working_poll() -> bool:
|
def null_wait_for_socket(*args, **kwargs):
|
||||||
|
raise NoWayToWaitForSocketError("no select-equivalent available")
|
||||||
|
|
||||||
|
|
||||||
|
def _have_working_poll():
|
||||||
# Apparently some systems have a select.poll that fails as soon as you try
|
# Apparently some systems have a select.poll that fails as soon as you try
|
||||||
# to use it, either due to strange configuration or broken monkeypatching
|
# to use it, either due to strange configuration or broken monkeypatching
|
||||||
# from libraries like eventlet/greenlet.
|
# from libraries like eventlet/greenlet.
|
||||||
try:
|
try:
|
||||||
poll_obj = select.poll()
|
poll_obj = select.poll()
|
||||||
poll_obj.poll(0)
|
_retry_on_intr(poll_obj.poll, 0)
|
||||||
except (AttributeError, OSError):
|
except (AttributeError, OSError):
|
||||||
return False
|
return False
|
||||||
else:
|
else:
|
||||||
return True
|
return True
|
||||||
|
|
||||||
|
|
||||||
def wait_for_socket(
|
def wait_for_socket(*args, **kwargs):
|
||||||
sock: socket.socket,
|
|
||||||
read: bool = False,
|
|
||||||
write: bool = False,
|
|
||||||
timeout: float | None = None,
|
|
||||||
) -> bool:
|
|
||||||
# We delay choosing which implementation to use until the first time we're
|
# We delay choosing which implementation to use until the first time we're
|
||||||
# called. We could do it at import time, but then we might make the wrong
|
# called. We could do it at import time, but then we might make the wrong
|
||||||
# decision if someone goes wild with monkeypatching select.poll after
|
# decision if someone goes wild with monkeypatching select.poll after
|
||||||
|
|
@ -107,17 +133,19 @@ def wait_for_socket(
|
||||||
wait_for_socket = poll_wait_for_socket
|
wait_for_socket = poll_wait_for_socket
|
||||||
elif hasattr(select, "select"):
|
elif hasattr(select, "select"):
|
||||||
wait_for_socket = select_wait_for_socket
|
wait_for_socket = select_wait_for_socket
|
||||||
return wait_for_socket(sock, read, write, timeout)
|
else: # Platform-specific: Appengine.
|
||||||
|
wait_for_socket = null_wait_for_socket
|
||||||
|
return wait_for_socket(*args, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
def wait_for_read(sock: socket.socket, timeout: float | None = None) -> bool:
|
def wait_for_read(sock, timeout=None):
|
||||||
"""Waits for reading to be available on a given socket.
|
"""Waits for reading to be available on a given socket.
|
||||||
Returns True if the socket is readable, or False if the timeout expired.
|
Returns True if the socket is readable, or False if the timeout expired.
|
||||||
"""
|
"""
|
||||||
return wait_for_socket(sock, read=True, timeout=timeout)
|
return wait_for_socket(sock, read=True, timeout=timeout)
|
||||||
|
|
||||||
|
|
||||||
def wait_for_write(sock: socket.socket, timeout: float | None = None) -> bool:
|
def wait_for_write(sock, timeout=None):
|
||||||
"""Waits for writing to be available on a given socket.
|
"""Waits for writing to be available on a given socket.
|
||||||
Returns True if the socket is readable, or False if the timeout expired.
|
Returns True if the socket is readable, or False if the timeout expired.
|
||||||
"""
|
"""
|
||||||
|
|
|
||||||
|
|
@ -1,5 +1,5 @@
|
||||||
from django.contrib import admin
|
from django.contrib import admin
|
||||||
#from rest_framework.documentation import include_docs_urls
|
from rest_framework.documentation import include_docs_urls
|
||||||
from django.urls import path, include
|
from django.urls import path, include
|
||||||
# from api.views import AzuraNowPlayingWebhookView
|
# from api.views import AzuraNowPlayingWebhookView
|
||||||
from loginApi.views import login, register
|
from loginApi.views import login, register
|
||||||
|
|
@ -28,8 +28,8 @@ urlpatterns = [
|
||||||
path('api/token/', TokenObtainPairView.as_view(), name='token_obtain_pair'),
|
path('api/token/', TokenObtainPairView.as_view(), name='token_obtain_pair'),
|
||||||
path('api/token/refresh/', TokenRefreshView.as_view(), name='token_refresh'),
|
path('api/token/refresh/', TokenRefreshView.as_view(), name='token_refresh'),
|
||||||
path('api/token/verify/', TokenVerifyView.as_view(), name='token_verify'),
|
path('api/token/verify/', TokenVerifyView.as_view(), name='token_verify'),
|
||||||
#path('api/', include_docs_urls(title='API docs')),
|
path('api/', include_docs_urls(title='API docs')),
|
||||||
path('api/', include(router.urls)),
|
path('api/radio/', include(router.urls)),
|
||||||
path('api-auth/', include('rest_framework.urls', namespace='rest_framework')),
|
path('api-auth/', include('rest_framework.urls', namespace='rest_framework')),
|
||||||
|
|
||||||
# path('webhook/', AzuraNowPlayingWebhookView.as_view(), name='webhook-receiver'),
|
# path('webhook/', AzuraNowPlayingWebhookView.as_view(), name='webhook-receiver'),
|
||||||
|
|
|
||||||
Loading…
Reference in New Issue